AP Chemistry Quiz: Pre Equilibrium Approximation
20 questions · exam conditions
0:00
Pre Equilibrium ApproximationQuestion 1 of 20

A reaction is proposed to proceed by the following mechanism. The first step is fast and reversible and is described as establishing a pre-equilibrium prior to the slow step.

Step 1 (fast, reversible; pre-equilibrium): Br2+Fe2+FeBr22+\mathrm{Br_2 + Fe^{2+} \rightleftharpoons FeBr_2^{2+}} Step 2 (slow): FeBr22++Fe2+2Fe3++2Br\mathrm{FeBr_2^{2+} + Fe^{2+} \rightarrow 2Fe^{3+} + 2Br^-}

Under these pre-equilibrium conditions, which qualitative rate law is most consistent with the mechanism?

Rate [Br2][Fe2+]2\propto [\mathrm{Br_2}][\mathrm{Fe^{2+}}]^2
Rate [Br2][Fe2+]\propto [\mathrm{Br_2}][\mathrm{Fe^{2+}}]
Rate [FeBr22+][Fe2+]\propto [\mathrm{FeBr_2^{2+}}][\mathrm{Fe^{2+}}]
Rate [Fe3+]2\propto [\mathrm{Fe^{3+}}]^2
Rate [Br]2\propto [\mathrm{Br^-}]^2
← Back to quizzes

AP Chemistry Quiz

AP Chemistry Quiz: Pre Equilibrium Approximation

Practice Pre Equilibrium Approximation in AP Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Pre Equilibrium Approximation, giving you a quick way to practice the rules, question types, and explanations that matter most for AP Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A reaction is proposed to proceed by the following mechanism. The first step is fast and reversible and is described as establishing a pre-equilibrium prior to the slow step.

Step 1 (fast, reversible; pre-equilibrium): Br2+Fe2+FeBr22+\mathrm{Br_2 + Fe^{2+} \rightleftharpoons FeBr_2^{2+}} Step 2 (slow): FeBr22++Fe2+2Fe3++2Br\mathrm{FeBr_2^{2+} + Fe^{2+} \rightarrow 2Fe^{3+} + 2Br^-}

Under these pre-equilibrium conditions, which qualitative rate law is most consistent with the mechanism?

  1. Rate [Br2][Fe2+]2\propto [\mathrm{Br_2}][\mathrm{Fe^{2+}}]^2 (correct answer)
  2. Rate [Br2][Fe2+]\propto [\mathrm{Br_2}][\mathrm{Fe^{2+}}]
  3. Rate [FeBr22+][Fe2+]\propto [\mathrm{FeBr_2^{2+}}][\mathrm{Fe^{2+}}]
  4. Rate [Fe3+]2\propto [\mathrm{Fe^{3+}}]^2
  5. Rate [Br]2\propto [\mathrm{Br^-}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between Br2\mathrm{Br_2}, Fe2+\mathrm{Fe^{2+}}, and the intermediate FeBr22+\mathrm{FeBr_2^{2+}}, with the equilibrium constant providing a relationship [FeBr22+]=K[Br2][Fe2+][\mathrm{FeBr_2^{2+}}] = K [\mathrm{Br_2}][\mathrm{Fe^{2+}}]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [FeBr22+][Fe2+][\mathrm{FeBr_2^{2+}}][\mathrm{Fe^{2+}}] = k K [Br2][Fe2+]2[\mathrm{Br_2}][\mathrm{Fe^{2+}}]^2. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 2

A mechanism is proposed in which an early step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): Fe3++SCNFeSCN2+\mathrm{Fe^{3+} + SCN^- \rightleftharpoons FeSCN^{2+}} Step 2 (slow): FeSCN2++H2OFe2++HSCN+OH\mathrm{FeSCN^{2+} + H_2O \rightarrow Fe^{2+} + HSCN + OH^-}

Which qualitative rate law is most consistent with the mechanism under pre-equilibrium conditions?

  1. Rate [FeSCN2+][H2O]\propto [\mathrm{FeSCN^{2+}}][\mathrm{H_2O}]
  2. Rate [Fe3+][SCN][H2O]\propto [\mathrm{Fe^{3+}}][\mathrm{SCN^-}][\mathrm{H_2O}] (correct answer)
  3. Rate [Fe3+][SCN]\propto [\mathrm{Fe^{3+}}][\mathrm{SCN^-}]
  4. Rate [Fe2+]\propto [\mathrm{Fe^{2+}}]
  5. Rate [SCN]2\propto [\mathrm{SCN^-}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between Fe3+\mathrm{Fe^{3+}}, SCN\mathrm{SCN^-}, and the intermediate FeSCN2+\mathrm{FeSCN^{2+}}, with the equilibrium constant providing a relationship [FeSCN2+]=K[Fe3+][SCN[\mathrm{FeSCN^{2+}}] = K [\mathrm{Fe^{3+}}][\mathrm{SCN^-}. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [FeSCN2+][H2O][\mathrm{FeSCN^{2+}}][\mathrm{H_2O}] = k K [Fe3+][SCN][H2O[\mathrm{Fe^{3+}}][\mathrm{SCN^-}][\mathrm{H_2O}. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 3

A two-step mechanism is proposed. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step occurs.

Step 1 (fast, reversible; pre-equilibrium): O3+NONO2+O2\mathrm{O_3 + NO \rightleftharpoons NO_2 + O_2} Step 2 (slow): NO2+O3NO3+O2\mathrm{NO_2 + O_3 \rightarrow NO_3 + O_2}

Which qualitative rate law is most consistent with this mechanism under the pre-equilibrium assumption?

  1. Rate [NO2][O3]\propto [\mathrm{NO_2}][\mathrm{O_3}]
  2. Rate [NO][O3]\propto [\mathrm{NO}][\mathrm{O_3}]
  3. Rate [NO][O3]2/[O2]\propto [\mathrm{NO}][\mathrm{O_3}]^2/[\mathrm{O_2}] (correct answer)
  4. Rate [NO3]\propto [\mathrm{NO_3}]
  5. Rate [O3]2\propto [\mathrm{O_3}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between O3, NO, NO2, and O2, with the equilibrium constant providing a relationship [NO2] = K [NO][O3] / [O2]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [NO2][O3] = k K [NO][O3]^2 / [O2]. A tempting distractor is choice A, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 4

A mechanism is proposed in which the first step is fast and reversible and is stated to reach a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): CO+Cl2COCl2\mathrm{CO + Cl_2 \rightleftharpoons COCl_2} Step 2 (slow): COCl2+H2OCO2+2HCl\mathrm{COCl_2 + H_2O \rightarrow CO_2 + 2HCl}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [COCl2][H2O]\propto [\mathrm{COCl_2}][\mathrm{H_2O}]
  2. Rate [CO][Cl2][H2O]\propto [\mathrm{CO}][\mathrm{Cl_2}][\mathrm{H_2O}] (correct answer)
  3. Rate [CO][Cl2]\propto [\mathrm{CO}][\mathrm{Cl_2}]
  4. Rate [Cl2]2[H2O]\propto [\mathrm{Cl_2}]^2[\mathrm{H_2O}]
  5. Rate [HCl]2\propto [\mathrm{HCl}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between CO, Cl2, and the intermediate COCl2, with the equilibrium constant providing a relationship [COCl2] = K [CO][Cl2]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [COCl2][H2O] = k K [CO][Cl2][H2O]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 5

A reaction is proposed to proceed by a mechanism in which the first step is fast and reversible and is described as reaching a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): CH3Br+OHCH3OHBr\mathrm{CH_3Br + OH^- \rightleftharpoons CH_3OH\cdots Br^-} Step 2 (slow): CH3OHBrCH3OH+Br\mathrm{CH_3OH\cdots Br^- \rightarrow CH_3OH + Br^-}

Which qualitative rate law is most consistent with the mechanism under the pre-equilibrium assumption?

  1. Rate [CH3Br][OH]\propto [\mathrm{CH_3Br}][\mathrm{OH^-}] (correct answer)
  2. Rate [CH3OHBr]\propto [\mathrm{CH_3OH\cdots Br^-}]
  3. Rate [Br]\propto [\mathrm{Br^-}]
  4. Rate [CH3Br]\propto [\mathrm{CH_3Br}]
  5. Rate [OH]2\propto [\mathrm{OH^-}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between CH3Br, OH^-, and the intermediate CH3OH···Br^-, with the equilibrium constant providing a relationship [CH3OH···Br^-] = K [CH3Br][OH^-]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [CH3OH···Br^-] = k K [CH3Br][OH^-]. A tempting distractor is choice D, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 6

A reaction is proposed to occur by the mechanism below. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): ClO+H+HOCl\mathrm{ClO^- + H^+ \rightleftharpoons HOCl} Step 2 (slow): HOCl+IHOI+Cl\mathrm{HOCl + I^- \rightarrow HOI + Cl^-}

Which qualitative rate law is most consistent with this mechanism under the pre-equilibrium assumption?

  1. Rate [HOCl][I]\propto [\mathrm{HOCl}][\mathrm{I^-}]
  2. Rate [ClO][H+][I]\propto [\mathrm{ClO^-}][\mathrm{H^+}][\mathrm{I^-}] (correct answer)
  3. Rate [ClO][I]\propto [\mathrm{ClO^-}][\mathrm{I^-}]
  4. Rate [H+]2[I]\propto [\mathrm{H^+}]^2[\mathrm{I^-}]
  5. Rate [Cl]\propto [\mathrm{Cl^-}]

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between ClO^-, H^+, and the intermediate HOCl, with the equilibrium constant providing a relationship [HOCl] = K [ClO^-][H^+]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [HOCl][I^-] = k K [ClO^-][H^+][I^-]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 7

A mechanism is proposed where the first step is fast and reversible and is stated to reach a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): 2AA2\mathrm{2A \rightleftharpoons A_2} Step 2 (slow): A2+BAB+A\mathrm{A_2 + B \rightarrow AB + A}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [A2][B]\propto [\mathrm{A_2}][\mathrm{B}]
  2. Rate [A]2[B]\propto [\mathrm{A}]^2[\mathrm{B}] (correct answer)
  3. Rate [AB]\propto [\mathrm{AB}]
  4. Rate [A][B]\propto [\mathrm{A}][\mathrm{B}]
  5. Rate [B]2\propto [\mathrm{B}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between A and the intermediate A2, with the equilibrium constant providing a relationship [A2] = K [A]^2. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [A2][B] = k K [A]^2 [B]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 8

A reaction is proposed to occur by the following mechanism. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): 2NO2N2O4\mathrm{2NO_2 \rightleftharpoons N_2O_4} Step 2 (slow): N2O4+CONO+NO3+CO\mathrm{N_2O_4 + CO \rightarrow NO + NO_3 + CO}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [N2O4][CO]\propto [\mathrm{N_2O_4}][\mathrm{CO}]
  2. Rate [NO2]2[CO]\propto [\mathrm{NO_2}]^2[\mathrm{CO}] (correct answer)
  3. Rate [NO2][CO]\propto [\mathrm{NO_2}][\mathrm{CO}]
  4. Rate [NO]\propto [\mathrm{NO}]
  5. Rate [CO]2\propto [\mathrm{CO}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between NO2 and the intermediate N2O4, with the equilibrium constant providing a relationship [N2O4] = K [NO2]^2. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [N2O4][CO] = k K [NO2]^2 [CO]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 9

A proposed mechanism for the reaction overall is shown below. The first step is explicitly stated to be fast and reversible, and it establishes a pre-equilibrium before the slow step occurs.

Step 1 (fast, reversible; pre-equilibrium): NO+Cl2NOCl2\mathrm{NO + Cl_2 \rightleftharpoons NOCl_2} Step 2 (slow): NOCl2+NO2NOCl\mathrm{NOCl_2 + NO \rightarrow 2NOCl}

Which qualitative rate law form is most consistent with this mechanism under the pre-equilibrium assumption?

  1. Rate [NO]2[Cl2]\propto [\mathrm{NO}]^2[\mathrm{Cl_2}] (correct answer)
  2. Rate [NO][Cl2]\propto [\mathrm{NO}][\mathrm{Cl_2}]
  3. Rate [NOCl2][NO]\propto [\mathrm{NOCl_2}][\mathrm{NO}]
  4. Rate [NOCl]2\propto [\mathrm{NOCl}]^2
  5. Rate [Cl2]2\propto [\mathrm{Cl_2}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between NO, Cl2, and the intermediate NOCl2, with the equilibrium constant providing a relationship [NOCl2] = K [NO][Cl2]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [NOCl2][NO] = k K [NO]^2 [Cl2]. A tempting distractor is choice B, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 10

A reaction is proposed to proceed via the mechanism below. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): C+DCD\mathrm{C + D \rightleftharpoons CD} Step 2 (slow): CD+DCD2\mathrm{CD + D \rightarrow CD_2}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [CD][D]\propto [\mathrm{CD}][\mathrm{D}]
  2. Rate [C][D]2\propto [\mathrm{C}][\mathrm{D}]^2 (correct answer)
  3. Rate [C][D]\propto [\mathrm{C}][\mathrm{D}]
  4. Rate [CD2]\propto [\mathrm{CD_2}]
  5. Rate [D]\propto [\mathrm{D}]

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between C, D, and the intermediate CD, with the equilibrium constant providing a relationship [CD] = K [C][D]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [CD][D] = k K [C][D]^2. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 11

A multistep mechanism is proposed. The first step is fast and reversible and is explicitly stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): 2NON2O2\mathrm{2NO \rightleftharpoons N_2O_2} Step 2 (slow): N2O2+O22NO2\mathrm{N_2O_2 + O_2 \rightarrow 2NO_2}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [NO]2[O2]\propto [\mathrm{NO}]^2[\mathrm{O_2}] (correct answer)
  2. Rate [N2O2][O2]\propto [\mathrm{N_2O_2}][\mathrm{O_2}]
  3. Rate [NO][O2]\propto [\mathrm{NO}][\mathrm{O_2}]
  4. Rate [NO2]2\propto [\mathrm{NO_2}]^2
  5. Rate [O2]2\propto [\mathrm{O_2}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between NO and the intermediate N2O2, with the equilibrium constant providing a relationship [N2O2] = K [NO]^2. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [N2O2][O2] = k K [NO]^2 [O2]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 12

A proposed mechanism includes a fast, reversible first step that is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): 2HClH2Cl++Cl\mathrm{2HCl \rightleftharpoons H_2Cl^+ + Cl^-} Step 2 (slow): H2Cl++ZnZnCl++H2\mathrm{H_2Cl^+ + Zn \rightarrow ZnCl^+ + H_2}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [H2Cl+][Zn]\propto [\mathrm{H_2Cl^+}][\mathrm{Zn}]
  2. Rate [HCl]2[Zn]/[Cl]\propto [\mathrm{HCl}]^2[\mathrm{Zn}]/[\mathrm{Cl^-}] (correct answer)
  3. Rate [HCl][Zn]\propto [\mathrm{HCl}][\mathrm{Zn}]
  4. Rate [H2]\propto [\mathrm{H_2}]
  5. Rate [Cl][Zn]\propto [\mathrm{Cl^-}][\mathrm{Zn}]

Explanation: This question tests the pre-equilibrium approximation. In the pre-equilibrium approximation, the fast reversible first step reaches equilibrium quickly, establishing a constant ratio of concentrations defined by the equilibrium constant K = [H₂Cl⁺][Cl⁻] / [HCl]². The slow second step then determines the overall rate, so rate = k₂ [H₂Cl⁺][Zn]. To express this in terms of measurable species, we solve for the intermediate [H₂Cl⁺] from the equilibrium expression, giving [H₂Cl⁺] = K [HCl]² / [Cl⁻], leading to rate ∝ [HCl]²[Zn]/[Cl⁻]. A tempting distractor is choice A, Rate ∝ [H₂Cl⁺][Zn], which is incorrect because it treats the intermediate as if its concentration were independent and measurable, failing to apply the pre-equilibrium substitution. When an early step is fast and reversible, use the equilibrium constant to relate the intermediate's concentration to the reactants before substituting into the rate-determining step's rate law.

Question 13

A reaction is proposed to proceed via the mechanism below. The first step is fast and reversible and is described as establishing a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): 2ClO2Cl2O4\mathrm{2ClO_2 \rightleftharpoons Cl_2O_4} Step 2 (slow): Cl2O4+OHClO3+ClO2+H+\mathrm{Cl_2O_4 + OH^- \rightarrow ClO_3^- + ClO_2^- + H^+}

Which qualitative rate law is most consistent with the mechanism under pre-equilibrium conditions?

  1. Rate [Cl2O4][OH]\propto [\mathrm{Cl_2O_4}][\mathrm{OH^-}]
  2. Rate [ClO2]2[OH]\propto [\mathrm{ClO_2}]^2[\mathrm{OH^-}] (correct answer)
  3. Rate [ClO2][OH]\propto [\mathrm{ClO_2}][\mathrm{OH^-}]
  4. Rate [ClO3]\propto [\mathrm{ClO_3^-}]
  5. Rate [OH]2\propto [\mathrm{OH^-}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between ClO2 and the intermediate Cl2O4, with the equilibrium constant providing a relationship [Cl2O4] = K [ClO2]^2. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [Cl2O4][OH^-] = k K [ClO2]^2 [OH^-]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 14

A mechanism is proposed where the first step is fast and reversible and is stated to reach a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): P+QPQ\mathrm{P + Q \rightleftharpoons PQ} Step 2 (slow): PQ+RPR+Q\mathrm{PQ + R \rightarrow PR + Q}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [PQ][R]\propto [\mathrm{PQ}][\mathrm{R}]
  2. Rate [P][Q][R]\propto [\mathrm{P}][\mathrm{Q}][\mathrm{R}] (correct answer)
  3. Rate [P][R]\propto [\mathrm{P}][\mathrm{R}]
  4. Rate [Q][R]\propto [\mathrm{Q}][\mathrm{R}]
  5. Rate [PR]\propto [\mathrm{PR}]

Explanation: This question tests the pre-equilibrium approximation. In the pre-equilibrium approximation, the fast reversible first step reaches equilibrium quickly, establishing a constant ratio of concentrations defined by the equilibrium constant K = [PQ] / [P][Q]. The slow second step then determines the overall rate, so rate = k₂ [PQ][R]. To express this in terms of measurable species, we solve for the intermediate [PQ] from the equilibrium expression, giving [PQ] = K [P][Q], leading to rate ∝ [P][Q][R]. A tempting distractor is choice A, Rate ∝ [PQ][R], which is incorrect because it treats the intermediate as if its concentration were independent and measurable, failing to apply the pre-equilibrium substitution. When an early step is fast and reversible, use the equilibrium constant to relate the intermediate's concentration to the reactants before substituting into the rate-determining step's rate law.

Question 15

A mechanism is proposed in which an initial association step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): SO2+O2SO4\mathrm{SO_2 + O_2 \rightleftharpoons SO_4} Step 2 (slow): SO4+SO22SO3\mathrm{SO_4 + SO_2 \rightarrow 2SO_3}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [SO2][O2]\propto [\mathrm{SO_2}][\mathrm{O_2}]
  2. Rate [SO4][SO2]\propto [\mathrm{SO_4}][\mathrm{SO_2}]
  3. Rate [SO2]2[O2]\propto [\mathrm{SO_2}]^2[\mathrm{O_2}] (correct answer)
  4. Rate [SO3]2\propto [\mathrm{SO_3}]^2
  5. Rate [O2]2\propto [\mathrm{O_2}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between SO2, O2, and the intermediate SO4, with the equilibrium constant providing a relationship [SO4] = K [SO2][O2]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [SO4][SO2] = k K [SO2]^2 [O2]. A tempting distractor is choice A, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 16

The following mechanism is proposed. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): H2O2+IHOI+OH\mathrm{H_2O_2 + I^- \rightleftharpoons HOI + OH^-} Step 2 (slow): HOI+I+H+I2+H2O\mathrm{HOI + I^- + H^+ \rightarrow I_2 + H_2O}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [HOI][I][H+]\propto [\mathrm{HOI}][\mathrm{I^-}][\mathrm{H^+}]
  2. Rate [H2O2][I]2[H+]/[OH]\propto [\mathrm{H_2O_2}][\mathrm{I^-}]^2[\mathrm{H^+}]/[\mathrm{OH^-}] (correct answer)
  3. Rate [H2O2][I]\propto [\mathrm{H_2O_2}][\mathrm{I^-}]
  4. Rate [I2]\propto [\mathrm{I_2}]
  5. Rate [H2O2][H+]\propto [\mathrm{H_2O_2}][\mathrm{H^+}]

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between H2O2, I^-, HOI, and OH^-, with the equilibrium constant providing a relationship [HOI] = K [H2O2][I^-] / [OH^-]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [HOI][I^-][H^+] = k K [H2O2][I^-]^2 [H^+] / [OH^-]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 17

A mechanism is proposed in which the first step is fast and reversible and is stated to reach a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): H++AHA\mathrm{H^+ + A^- \rightleftharpoons HA} Step 2 (slow): HA+BAB+H+\mathrm{HA + B^- \rightarrow AB^- + H^+}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [HA][B]\propto [\mathrm{HA}][\mathrm{B^-}]
  2. Rate [A][B]\propto [\mathrm{A^-}][\mathrm{B^-}]
  3. Rate [H+][A][B]\propto [\mathrm{H^+}][\mathrm{A^-}][\mathrm{B^-}] (correct answer)
  4. Rate [AB]\propto [\mathrm{AB^-}]
  5. Rate [H+]2[B]\propto [\mathrm{H^+}]^2[\mathrm{B^-}]

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between H^+, A^-, and the intermediate HA, with the equilibrium constant providing a relationship [HA] = K [H^+][A^-]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [HA][B^-] = k K [H^+][A^-][B^-]. A tempting distractor is choice A, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 18

A proposed mechanism includes an initial fast, reversible step that is stated to establish a pre-equilibrium prior to the slow step.

Step 1 (fast, reversible; pre-equilibrium): NO2+F2NO2F+F\mathrm{NO_2 + F_2 \rightleftharpoons NO_2F + F} Step 2 (slow): F+NO2NO2F\mathrm{F + NO_2 \rightarrow NO_2F}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [NO2]2[F2]/[NO2F]\propto [\mathrm{NO_2}]^2[\mathrm{F_2}]/[\mathrm{NO_2F}] (correct answer)
  2. Rate [F][NO2]\propto [\mathrm{F}][\mathrm{NO_2}]
  3. Rate [NO2F]\propto [\mathrm{NO_2F}]
  4. Rate [NO2][F2]\propto [\mathrm{NO_2}][\mathrm{F_2}]
  5. Rate [F2]2\propto [\mathrm{F_2}]^2

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between NO2, F2, NO2F, and F, with the equilibrium constant providing a relationship [F] = K [NO2][F2] / [NO2F]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [F][NO2] = k K [NO2]^2 [F2] / [NO2F]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.

Question 19

A reaction is proposed to proceed via the following mechanism. The first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): X+YXY\mathrm{X + Y \rightleftharpoons XY} Step 2 (slow): XY+XX2Y\mathrm{XY + X \rightarrow X_2Y}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [X2Y]\propto [\mathrm{X_2Y}]
  2. Rate [X][Y]\propto [\mathrm{X}][\mathrm{Y}]
  3. Rate [X]2[Y]\propto [\mathrm{X}]^2[\mathrm{Y}] (correct answer)
  4. Rate [XY][X]\propto [\mathrm{XY}][\mathrm{X}]
  5. Rate [Y]2\propto [\mathrm{Y}]^2

Explanation: This question tests the pre-equilibrium approximation. In the pre-equilibrium approximation, the fast reversible first step reaches equilibrium quickly, establishing a constant ratio of concentrations defined by the equilibrium constant K = [XY] / [X][Y]. The slow second step then determines the overall rate, so rate = k₂ [XY][X]. To express this in terms of measurable species, we solve for the intermediate [XY] from the equilibrium expression, giving [XY] = K [X][Y], leading to rate ∝ [X]²[Y]. A tempting distractor is choice A, Rate ∝ [XY][X], which is incorrect because it treats the intermediate as if its concentration were independent and measurable, failing to apply the pre-equilibrium substitution. When an early step is fast and reversible, use the equilibrium constant to relate the intermediate's concentration to the reactants before substituting into the rate-determining step's rate law.

Question 20

A mechanism is proposed where the first step is fast and reversible and is stated to establish a pre-equilibrium before the slow step.

Step 1 (fast, reversible; pre-equilibrium): A+BAB\mathrm{A + B \rightleftharpoons AB} Step 2 (slow): AB+CAC+B\mathrm{AB + C \rightarrow AC + B}

Which qualitative rate law is most consistent with this mechanism under pre-equilibrium conditions?

  1. Rate [A][C]\propto [\mathrm{A}][\mathrm{C}]
  2. Rate [A][B][C]\propto [\mathrm{A}][\mathrm{B}][\mathrm{C}] (correct answer)
  3. Rate [AB][C]\propto [\mathrm{AB}][\mathrm{C}]
  4. Rate [B][C]\propto [\mathrm{B}][\mathrm{C}]
  5. Rate [AC]\propto [\mathrm{AC}]

Explanation: The skill being tested is the pre-equilibrium approximation. In this mechanism, the fast reversible step establishes an equilibrium between A, B, and the intermediate AB, with the equilibrium constant providing a relationship [AB] = K [A][B]. This relationship allows us to express the concentration of the intermediate in terms of the reactants. The slow step then controls the overall rate, giving rate = k [AB][C] = k K [A][B][C]. A tempting distractor is choice C, which treated the fast step as rate-determining. When an early step is fast and reversible, use it to relate concentrations before the slow step.