AP Chemistry Flashcards: Types Of Chemical Reactions

Study Types Of Chemical Reactions in AP Chemistry with focused flashcards that help you recognize the idea, recall the key rule, and apply it in practice-style prompts.

AP Chemistry

Types Of Chemical Reactions

0 mastered0 still learning

0% Complete

QUESTION
1/ 36

What is the characteristic feature of a catalyst in a reaction?

Tap card or press Space to flip

ANSWER

Speeds up reaction without being consumed. Lowers activation energy without being consumed.

How well did you know it?

Card 1 / 36

What this deck covers

This deck focuses on Types Of Chemical Reactions, giving you a quick way to review the definitions, rules, and examples that matter most for AP Chemistry.

How to use these flashcards

Work through these flashcards in short sessions. Try to answer each prompt before flipping the card, then revisit any cards you miss until the explanation feels automatic.

All flashcards

Flashcard 1: What is the characteristic feature of a catalyst in a reaction?

Answer: Speeds up reaction without being consumed. Lowers activation energy without being consumed.

Flashcard 2: What type of reaction is H2O2H2O+O2H_2O_2 \rightarrow H_2O + O_2?

Answer: Decomposition reaction. Hydrogen peroxide breaks down into water and oxygen.

Flashcard 3: State the general form of a double replacement reaction.

Answer: AB+CDAD+CBAB + CD \rightarrow AD + CB. Ions from two compounds exchange partners.

Flashcard 4: What is a characteristic of an exothermic reaction?

Answer: Releases energy to the surroundings. Heat is released during the reaction process.

Flashcard 5: What is a characteristic feature of a single replacement reaction?

Answer: One element replaces another in a compound. A free element displaces another in a compound.

Flashcard 6: What is the product of the combustion of methane?

Answer: Carbon dioxide and water. Methane combustion yields CO2CO_2 and H2OH_2O.

Flashcard 7: What defines an endothermic reaction?

Answer: Absorbs energy from the surroundings. Heat is absorbed during the reaction process.

Flashcard 8: What type of reaction occurs in Zn+2HClZnCl2+H2Zn + 2HCl \rightarrow ZnCl_2 + H_2?

Answer: Single replacement reaction. Zinc displaces hydrogen from hydrochloric acid.

Flashcard 9: Identify the type of reaction: C3H8+5O23CO2+4H2OC_3H_8 + 5O_2 \rightarrow 3CO_2 + 4H_2O.

Answer: Combustion reaction. Propane reacts with oxygen producing CO2CO_2 and H2OH_2O.

Flashcard 10: Identify the reaction type of CaCO3CaO+CO2CaCO_3 \rightarrow CaO + CO_2.

Answer: Decomposition reaction. One compound breaks into two products.

Flashcard 11: Identify the products of a hydrocarbon combustion reaction.

Answer: Carbon dioxide and water. Hydrocarbons plus oxygen always yield CO2CO_2 and H2OH_2O.

Flashcard 12: What is the main feature of a displacement reaction?

Answer: One element displaces another in a compound. Same definition as single replacement reaction.

Flashcard 13: Identify the type of reaction: H2+Cl22HClH_2 + Cl_2 \rightleftharpoons 2HCl.

Answer: Reversible reaction. Double arrow indicates equilibrium reaction.

Flashcard 14: Identify the type of reaction: Ba(OH)2+H2SO4BaSO4+2H2OBa(OH)_2 + H_2SO_4 \rightarrow BaSO_4 + 2H_2O.

Answer: Neutralization reaction. Base plus acid forms salt and water.

Flashcard 15: Identify the general form of a decomposition reaction.

Answer: ABA+BAB \rightarrow A + B. One compound breaks down into two or more products.

Flashcard 16: Which type of reaction is AgNO3+NaClAgCl+NaNO3AgNO_3 + NaCl \rightarrow AgCl + NaNO_3?

Answer: Double replacement reaction. Ions exchange partners between compounds.

Flashcard 17: What defines a redox reaction?

Answer: Involves transfer of electrons between species. Oxidation and reduction occur simultaneously.

Flashcard 18: State the general form of a neutralization reaction.

Answer: Acid+BaseSalt+WaterAcid + Base \rightarrow Salt + Water. Standard acid-base reaction equation.

Flashcard 19: What defines a reversible reaction?

Answer: Can proceed in both forward and reverse directions. Equilibrium allows reaction in both directions.

Flashcard 20: What is the role of a reducing agent in a redox reaction?

Answer: Donates electrons and becomes oxidized. Loses electrons while reducing another species.

Flashcard 21: Identify the type of reaction: Mg+2HClMgCl2+H2Mg + 2HCl \rightarrow MgCl_2 + H_2.

Answer: Single replacement reaction. Magnesium displaces hydrogen from acid.

Flashcard 22: Which type of reaction involves electron transfer?

Answer: Redox reaction. Electrons are transferred between reactants.

Flashcard 23: Which reaction type involves a solid forming from two solutions?

Answer: Precipitation reaction. Creates an insoluble solid from aqueous solutions.

Flashcard 24: What is the result of a precipitation reaction?

Answer: Formation of an insoluble solid from solution. Mixing solutions creates an insoluble product.

Flashcard 25: Identify the reaction: HCl+NaOHNaCl+H2OHCl + NaOH \rightarrow NaCl + H_2O.

Answer: Neutralization reaction. Acid plus base forms salt and water.

Flashcard 26: What occurs in a combustion reaction?

Answer: A substance reacts with oxygen, releasing energy. Rapid reaction with O2O_2 that produces heat and light.

Flashcard 27: Identify the type of reaction: Fe+SFeSFe + S \rightarrow FeS.

Answer: Synthesis reaction. Two elements combine to form one compound.

Flashcard 28: Identify the reaction type: 2H2O2H2+O22H_2O \rightarrow 2H_2 + O_2.

Answer: Decomposition reaction. Water molecule breaks into hydrogen and oxygen.

Flashcard 29: Which option best describes an oxidation reaction?

Answer: Loss of electrons by a molecule, atom, or ion. Increase in oxidation state occurs.

Flashcard 30: Identify the type of reaction: Cu+2AgNO3Cu(NO3)2+2AgCu + 2AgNO_3 \rightarrow Cu(NO_3)_2 + 2Ag.

Answer: Single replacement reaction. Copper displaces silver from silver nitrate.

Flashcard 31: What defines a double replacement reaction?

Answer: Ions in two compounds exchange places. Cations and anions swap between two compounds.

Flashcard 32: Identify the type of reaction: 2Na+Cl22NaCl2Na + Cl_2 \rightarrow 2NaCl.

Answer: Synthesis reaction. Two elements combine to form one compound.

Flashcard 33: Determine the reaction type: 2KClO32KCl+3O22KClO_3 \rightarrow 2KCl + 3O_2.

Answer: Decomposition reaction. Potassium chlorate breaks down when heated.

Flashcard 34: Which type of reaction is 2H2+O22H2O2H_2 + O_2 \rightarrow 2H_2O?

Answer: Synthesis reaction. Two elements combine to form one compound.

Flashcard 35: What defines a synthesis reaction in terms of reactants and products?

Answer: Multiple reactants form a single product. Many starting materials yield one final product.

Flashcard 36: What defines a synthesis reaction?

Answer: Two or more substances combine to form one compound. Multiple reactants combine into a single product.