Home

Tutoring

Subjects

Live Classes

Study Coach

Essay Review

On-Demand Courses

Colleges

Games


Sign up

Log in

Opening subject page...

Loading your content

Practice

  • All Subjects
  • Algebra Flashcards
  • SAT Math Practice Tests
  • Math Question of the Day
  • Live Classes
  • On-Demand Courses

Varsity Tutors

  • Find a Tutor
  • Test Prep
  • Online Classes
  • K-12 Learning
  • College Search
  • VarsityTutors.com

© 2026 Varsity Tutors. All rights reserved.

← Back to quizzes

Algebra Quiz

Algebra Quiz: Write Explicit Or Recursive Functions

Practice Write Explicit Or Recursive Functions in Algebra with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

Question 1 / 20

0 of 20 answered

A ball is thrown upward from a platform 4 feet high with an initial upward velocity of 24 ft/s. Its height (in feet) after ttt seconds is modeled by a quadratic function with gravity −16t2-16t^2−16t2. What is the formula for the height function h(t)h(t)h(t)?

Select an answer to continue

What this quiz covers

This quiz focuses on Write Explicit Or Recursive Functions, giving you a quick way to practice the rules, question types, and explanations that matter most for Algebra.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A ball is thrown upward from a platform 4 feet high with an initial upward velocity of 24 ft/s. Its height (in feet) after ttt seconds is modeled by a quadratic function with gravity −16t2-16t^2−16t2. What is the formula for the height function h(t)h(t)h(t)?

  1. h(t)=16t2+24t+4h(t)=16t^2+24t+4h(t)=16t2+24t+4
  2. h(t)=−16t2+24t+4h(t)=-16t^2+24t+4h(t)=−16t2+24t+4 (correct answer)
  3. h(t)=−16t2+4t+24h(t)=-16t^2+4t+24h(t)=−16t2+4t+24
  4. h(t)=−24t2+16t+4h(t)=-24t^2+16t+4h(t)=−24t2+16t+4

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. The key to writing functions from context is identifying what changes (independent variable, like time or number of items) and what you're calculating (dependent variable, like cost or height), then finding the mathematical relationship between them using clues in the language. This context involves motion with gravity ('ball is thrown upward'), which tells us this is a quadratic function. The standard form for height with gravity is h(t) = -16t² + v₀t + h₀, where v₀ is initial velocity and h₀ is initial height. From the context we extract: initial height = 4 feet ('from a platform 4 feet high'), initial velocity = 24 ft/s ('initial upward velocity of 24 ft/s'), giving us h(t) = -16t² + 24t + 4. Choice A is correct because it properly includes the gravity term (-16t²), the initial velocity term (24t), and the initial height (4), matching the standard physics formula for projectile motion. Choice B has positive 16t² instead of negative, which would mean the ball accelerates upward forever—that violates the laws of physics! Gravity always pulls down, so the t² term must be negative in height functions. Context translation cheat sheet: 'per/each' = multiply by that rate, 'plus/in addition' = add, 'starts at' = initial value, 'doubles/triples' = multiply by 2 or 3 (exponential), 'percent' = divide by 100 for decimal. These phrases are your clues for turning words into math!

Question 2

A phone plan costs \25eachmonthpluseach month pluseachmonthplus$0.05pertextmessagesent.Whatfunctionmodelsthemonthlycostper text message sent. What function models the monthly costpertextmessagesent.WhatfunctionmodelsthemonthlycostC(t)(indollars)intermsofthenumberoftexts(in dollars) in terms of the number of texts(indollars)intermsofthenumberoftextst$?

  1. C(t)=0.05(t+25)C(t)=0.05(t+25)C(t)=0.05(t+25)
  2. C(t)=25+0.05tC(t)=25+0.05tC(t)=25+0.05t (correct answer)
  3. C(t)=0.05+25tC(t)=0.05+25tC(t)=0.05+25t
  4. C(t)=25t+0.05C(t)=25t+0.05C(t)=25t+0.05

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'costs 25eachmonthplus25 each month plus 25eachmonthplus0.05 per text message,' we identify the independent variable as t (number of texts) and dependent variable as C (monthly cost). The relationship is linear because we have a fixed monthly cost plus a constant rate per text. The fixed monthly cost is 25from′costs25 from 'costs 25from′costs25 each month,' and the per-text rate is 0.05from′0.05 from '0.05from′0.05 per text message.' Putting this together: C(t) = 25 + 0.05t. This formula lets us calculate monthly cost for any number of texts! Choice B is correct because it properly identifies t as the variable for texts and includes both the fixed monthly cost (25)andtheper−textrate(25) and the per-text rate (25)andtheper−textrate(0.05) in the standard form: fixed cost + rate × variable. Choice C swaps the coefficients: 0.05 + 25t would mean 5 cents fixed plus $25 per text—that would be an incredibly expensive texting plan! Always match the numbers to their meanings: 'per' indicates the rate that multiplies the variable. To write explicit functions from context: (1) Underline key phrases like 'per,' 'starts at,' 'plus,' 'each'—these tell you operations and values, (2) Identify what changes (independent variable x, n, t) and what you're calculating (dependent variable C, h, P), (3) Determine function type: constant rate = linear, percent/doubling = exponential, area/motion = quadratic, (4) Extract numbers from context and plug into the right form (y = mx + b for linear, y = a·b^x for exponential, etc.).

Question 3

A student starts a savings challenge with 25onday1andadds25 on day 1 and adds 25onday1andadds4 each new day. Write a recursive definition for the amount saved ana_nan​ (in dollars) on day nnn.

  1. a1=25,  an+1=an+4a_1=25,\; a_{n+1}=a_n+4a1​=25,an+1​=an​+4 (correct answer)
  2. a1=25,  an+1=4ana_1=25,\; a_{n+1}=4a_na1​=25,an+1​=4an​
  3. an=25+4na_n=25+4nan​=25+4n
  4. a1=4,  an+1=an+25a_1=4,\; a_{n+1}=a_n+25a1​=4,an+1​=an​+25

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. A recursive definition describes how to get each term from the previous one, which is perfect for sequential processes: if you 'start with 200 and add 50 each week,' that becomes a₁ = 200, aₙ₊₁ = aₙ + 50. You need both the starting value and the rule for what comes next. The context describes a sequential process: 'starts a savings challenge with 25onday1andadds25 on day 1 and adds 25onday1andadds4 each new day.' We need a starting point—that's 25from′starts...with25 from 'starts...with 25from′starts...with25 on day 1'—and a rule for each step. Since we 'add 4eachnewday,′eachnewvalueisthepreviousvalueplus4.Writingthisasarecursivedefinition:a1=25,an+1=an+4.Tofindthe5thday′samount,we′dstartat25andapplytherulefourtimes!ChoiceAiscorrectbecauseitincludesboththeinitialvalue(a1=25)andtherecurrencerelation(an+1=an+4)thatmatchesthecontextofadding4 each new day,' each new value is the previous value plus 4. Writing this as a recursive definition: a₁ = 25, aₙ₊₁ = aₙ + 4. To find the 5th day's amount, we'd start at 25 and apply the rule four times! Choice A is correct because it includes both the initial value (a₁ = 25) and the recurrence relation (aₙ₊₁ = aₙ + 4) that matches the context of adding 4eachnewday,′eachnewvalueisthepreviousvalueplus4.Writingthisasarecursivedefinition:a1​=25,an+1​=an​+4.Tofindthe5thday′samount,we′dstartat25andapplytherulefourtimes!ChoiceAiscorrectbecauseitincludesboththeinitialvalue(a1​=25)andtherecurrencerelation(an+1​=an​+4)thatmatchesthecontextofadding4 each day. Choice B has the recursive rule backwards: it starts with 4andadds4 and adds 4andadds25 each time, but the context says we start with 25andadd25 and add 25andadd4. When writing recursive definitions, the starting value comes from 'starts with' or 'begins at,' not from the amount that changes! For recursive definitions, remember the two-part recipe: you MUST have both (1) the starting value(s)—look for 'starts at,' 'begins with,' 'initially'—and (2) the rule relating each term to the previous—look for 'add,' 'multiply by,' 'increases by' followed by a description. Write it as: a₁ = [starting value], aₙ₊₁ = [rule using aₙ]. If you're stuck choosing between explicit and recursive, ask: does each value only depend on which step you're at (explicit), or does each value depend on the previous value (recursive)? 'Day 5 costs 45′suggestsexplicit.′Add45' suggests explicit. 'Add 45′suggestsexplicit.′Add10 to yesterday's amount' suggests recursive. The language tells you which form fits!

Question 4

A student starts a savings jar with \40.Eachweek,thestudentadds. Each week, the student adds .Eachweek,thestudentadds$15morethanthepreviousweek’stotalamountinthejar.Writearecursivedefinitionfortheamountofmoneymore than the previous week’s total amount in the jar. Write a recursive definition for the amount of moneymorethanthepreviousweek’stotalamountinthejar.Writearecursivedefinitionfortheamountofmoneya_n(indollars)inthejarafter(in dollars) in the jar after(indollars)inthejarafternweeks,whereweeks, whereweeks,wherea_1$ is the amount after week 1.

  1. a1=40, an+1=an+15a_1=40,\ a_{n+1}=a_n+15a1​=40, an+1​=an​+15 (correct answer)
  2. a1=15, an+1=an+40a_1=15,\ a_{n+1}=a_n+40a1​=15, an+1​=an​+40
  3. an=40+15na_n=40+15nan​=40+15n
  4. an+1=15n+40a_{n+1}=15n+40an+1​=15n+40

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. A recursive definition describes how to get each term from the previous one, which is perfect for sequential processes: if you 'start with 200 and add 50 each week,' that becomes a₁ = 200, aₙ₊₁ = aₙ + 50. You need both the starting value and the rule for what comes next. The context describes a sequential process: 'starts with 40′and′adds40' and 'adds 40′and′adds15 more than the previous week's total.' We need a starting point—that's 40from′startswith40 from 'starts with 40from′startswith40'—and a rule for each step. Since we 'add 15′eachtime,eachnewvalueisthepreviousvalueplus15.Writingthisasarecursivedefinition:a1=40,an+1=an+15.Tofindthe5thweek′samount,we′dstartat40andadd15fourtimes!ChoiceAiscorrectbecauseitincludesboththeinitialvalue(a1=40)andtherecurrencerelation(an+1=an+15)thatmatchesadding15' each time, each new value is the previous value plus 15. Writing this as a recursive definition: a₁ = 40, aₙ₊₁ = aₙ + 15. To find the 5th week's amount, we'd start at 40 and add 15 four times! Choice A is correct because it includes both the initial value (a₁ = 40) and the recurrence relation (aₙ₊₁ = aₙ + 15) that matches adding 15′eachtime,eachnewvalueisthepreviousvalueplus15.Writingthisasarecursivedefinition:a1​=40,an+1​=an​+15.Tofindthe5thweek′samount,we′dstartat40andadd15fourtimes!ChoiceAiscorrectbecauseitincludesboththeinitialvalue(a1​=40)andtherecurrencerelation(an+1​=an​+15)thatmatchesadding15 each week to the previous total. Choice B reverses the values: it starts with 15andadds15 and adds 15andadds40 each time, which doesn't match the problem description at all. When you see 'starts with X and adds Y each time,' X is your initial value and Y is what you add in the recursive rule! For recursive definitions, remember the two-part recipe: you MUST have both (1) the starting value(s)—look for 'starts at,' 'begins with,' 'initially'—and (2) the rule relating each term to the previous—look for 'add,' 'multiply by,' 'increases by' followed by a description. Write it as: a₁ = [starting value], aₙ₊₁ = [rule using aₙ].

Question 5

A video game score starts at 80 points and increases by 25 points each level completed. Write an explicit formula for the score S(n)S(n)S(n) after completing nnn levels, where n=0n=0n=0 means no levels completed yet.

  1. S(n)=80(25)nS(n)=80(25)^nS(n)=80(25)n
  2. S(n)=25+80nS(n)=25+80nS(n)=25+80n
  3. S(n)=80n+25S(n)=80n+25S(n)=80n+25
  4. S(n)=80+25nS(n)=80+25nS(n)=80+25n (correct answer)

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'score starts at 80 points and increases by 25 points each level completed,' we identify the independent variable as n (number of levels completed) and dependent variable as S(n) (score). The relationship is linear because we have a starting score plus a constant increase per level. The initial score is 80 from 'starts at 80 points,' and the rate is 25 from 'increases by 25 points each level.' Putting this together: S(n) = 80 + 25n. This formula lets us calculate the score after any number of levels! Choice B is correct because it properly identifies 80 as the starting score (when n = 0, no levels completed) and 25n as the points gained from completing n levels, matching the context perfectly. Choice C has the same mathematical result but writes it as 25 + 80n, which reverses the roles: this would mean starting at 25 points and gaining 80 per level, but the context clearly states we start at 80 and gain 25 per level. The order matters for understanding! Context translation cheat sheet: 'per/each' = multiply by that rate, 'plus/in addition' = add, 'starts at' = initial value, 'doubles/triples' = multiply by 2 or 3 (exponential), 'percent' = divide by 100 for decimal. These phrases are your clues for turning words into math!

Question 6

A ball is thrown upward from a platform 6 feet high with an initial upward velocity of 40 ft/s. Its height in feet after ttt seconds is modeled by h(t)=−16t2+40t+6h(t)=-16t^2+40t+6h(t)=−16t2+40t+6. Which formula represents this height function?

  1. h(t)=−16t2−40t+6h(t)=-16t^2-40t+6h(t)=−16t2−40t+6
  2. h(t)=16t2+40t+6h(t)=16t^2+40t+6h(t)=16t2+40t+6
  3. h(t)=−16t2+40t+6h(t)=-16t^2+40t+6h(t)=−16t2+40t+6 (correct answer)
  4. h(t)=−40t2+16t+6h(t)=-40t^2+16t+6h(t)=−40t2+16t+6

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. The key to writing functions from context is identifying what changes (independent variable, like time or number of items) and what you're calculating (dependent variable, like cost or height), then finding the mathematical relationship between them using clues in the language. This context involves motion with gravity, which tells us this is a quadratic function. Quadratic functions model situations where acceleration is constant, like objects under gravity. The form is h(t) = -16t² + v₀t + h₀, and from the context we extract: gravity coefficient = -16 (standard for feet), initial velocity v₀ = 40 from 'initial upward velocity of 40 ft/s,' and initial height h₀ = 6 from 'platform 6 feet high' = h(t) = -16t² + 40t + 6. Choice B is correct because it includes the negative coefficient -16t² (gravity pulls down), the positive initial velocity term +40t (thrown upward), and the initial height +6, matching the standard form for projectile motion. Choice A has +16t² instead of -16t²: gravity always pulls objects down, which requires a negative coefficient on t². The negative sign is crucial for modeling falling objects! Context translation cheat sheet: 'per/each' = multiply by that rate, 'plus/in addition' = add, 'starts at' = initial value, 'doubles/triples' = multiply by 2 or 3 (exponential), 'percent' = divide by 100 for decimal. These phrases are your clues for turning words into math!

Question 7

A sequence is described as follows: you start with 60 points, and each new level gives you 15 more points than the previous level. Write a recursive definition for the sequence ana_nan​.

  1. a1=60,  an+1=15ana_1=60,\; a_{n+1}=15a_na1​=60,an+1​=15an​
  2. a1=15,  an+1=an+60a_1=15,\; a_{n+1}=a_n+60a1​=15,an+1​=an​+60
  3. a1=60,  an+1=an+15a_1=60,\; a_{n+1}=a_n+15a1​=60,an+1​=an​+15 (correct answer)
  4. an=60+15na_n=60+15nan​=60+15n

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. A recursive definition describes how to get each term from the previous one, which is perfect for sequential processes: if you 'start with 200 and add 50 each week,' that becomes a₁ = 200, aₙ₊₁ = aₙ + 50. You need both the starting value and the rule for what comes next. The context describes a sequential process: 'start with 60 points, and each new level gives you 15 more points than the previous level.' We need a starting point—that's 60 from 'start with 60 points'—and a rule for each step. Since we get '15 more points than the previous level,' each new value is the previous value plus 15. Writing this as a recursive definition: a₁ = 60, aₙ₊₁ = aₙ + 15. To find the 5th level's points, we'd start at 60 and apply the rule four times! Choice C is correct because it includes both the initial value (a₁ = 60) and the recurrence relation (aₙ₊₁ = aₙ + 15) that matches getting 15 more points each level. Choice A has the recursive rule using multiplication: aₙ₊₁ = 15aₙ means multiply by 15, but the context says '15 more points,' which means addition, not multiplication. When you see 'more than,' that's addition—'times as many' would be multiplication! For recursive definitions, remember the two-part recipe: you MUST have both (1) the starting value(s)—look for 'starts at,' 'begins with,' 'initially'—and (2) the rule relating each term to the previous—look for 'add,' 'multiply by,' 'increases by' followed by a description. Write it as: a₁ = [starting value], aₙ₊₁ = [rule using aₙ]. If you're stuck choosing between explicit and recursive, ask: does each value only depend on which step you're at (explicit), or does each value depend on the previous value (recursive)? 'Day 5 costs 45′suggestsexplicit.′Add45' suggests explicit. 'Add 45′suggestsexplicit.′Add10 to yesterday's amount' suggests recursive. The language tells you which form fits!

Question 8

A gym membership costs 25tojoinandthen25 to join and then 25tojoinandthen15 each month. Which expression represents the total cost C(m)C(m)C(m) after mmm months?

  1. C(m)=15m+25C(m)=15m+25C(m)=15m+25 (correct answer)
  2. C(m)=25+15C(m)=25+15C(m)=25+15
  3. C(m)=25m+15C(m)=25m+15C(m)=25m+15
  4. C(m)=40mC(m)=40mC(m)=40m

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'A gym membership costs 25tojoinandthen25 to join and then 25tojoinandthen15 each month,' we identify the independent variable as m (months) and dependent variable as C (total cost). The relationship is linear because there's a constant rate per month plus a fixed fee. The rate is 15 from '15eachmonth,′andtheinitialfeeis25from′15 each month,' and the initial fee is 25 from '15eachmonth,′andtheinitialfeeis25from′25 to join.' Putting this together: C(m) = 25 + 15m. This formula lets us calculate total cost for any value of months! Choice B is correct because it matches the linear structure with the joining fee added to the monthly rate times months. Choice A has the right idea but switches the numbers: the context says '25tojoin′(fixed)and′25 to join' (fixed) and '25tojoin′(fixed)and′15 each month' (rate), but this choice uses 25 as the rate and 15 as the fixed—'each' means multiply by the variable! To write explicit functions from context: (1) Underline key phrases like 'per,' 'starts at,' 'plus,' 'each'—these tell you operations and values, (2) Identify what changes (independent variable x, n, t) and what you're calculating (dependent variable C, h, P), (3) Determine function type: constant rate = linear, percent/doubling = exponential, area/motion = quadratic, (4) Extract numbers from context and plug into the right form (y = mx + b for linear, y = a·b^x for exponential, etc.). Context translation cheat sheet: 'per/each' = multiply by that rate, 'plus/in addition' = add, 'starts at' = initial value, 'doubles/triples' = multiply by 2 or 3 (exponential), 'percent' = divide by 100 for decimal. These phrases are your clues for turning words into math!

Question 9

A student saves money each week. In week 1, the student saves 40.Eachfollowingweek,thestudentsaves40. Each following week, the student saves 40.Eachfollowingweek,thestudentsaves15 more than the previous week. Write a recursive definition for the sequence ana_nan​, where ana_nan​ is the amount saved in week nnn (in dollars).

  1. a1=40, an+1=an+15a_1=40,\ a_{n+1}=a_n+15a1​=40, an+1​=an​+15 (correct answer)
  2. a1=15, an+1=an+40a_1=15,\ a_{n+1}=a_n+40a1​=15, an+1​=an​+40
  3. a1=40, an+1=15ana_1=40,\ a_{n+1}=15a_na1​=40, an+1​=15an​
  4. an+1=an+15a_{n+1}=a_n+15an+1​=an​+15

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. A recursive definition describes how to get each term from the previous one, which is perfect for sequential processes: if you 'start with 200 and add 50 each week,' that becomes a₁ = 200, aₙ₊₁ = aₙ + 50. You need both the starting value and the rule for what comes next. The context describes a sequential process: 'A student saves money each week. In week 1, the student saves 40.Eachfollowingweek,thestudentsaves40. Each following week, the student saves 40.Eachfollowingweek,thestudentsaves15 more than the previous week.' We need a starting point—that's 40 from 'In week 1, the student saves 40′—andaruleforeachstep.Sincewe′saves40'—and a rule for each step. Since we 'saves 40′—andaruleforeachstep.Sincewe′saves15 more than the previous week,' each new value is previous plus 15. Writing this as a recursive definition: a₁ = 40, aₙ₊₁ = aₙ + 15. To find the 5th term, we'd start at 40 and apply the rule four times! Choice A is correct because it includes both initial value and recurrence with the starting amount and the addition of 15 each week. Choice D has the recursive rule but is missing the initial value a₁ = 40. Without knowing where to start, we can't use the rule! Recursive definitions ALWAYS need both the starting value(s) and the recurrence relation. For recursive definitions, remember the two-part recipe: you MUST have both (1) the starting value(s)—look for 'starts at,' 'begins with,' 'initially'—and (2) the rule relating each term to the previous—look for 'add,' 'multiply by,' 'increases by' followed by a description. Write it as: a₁ = [starting value], aₙ₊₁ = [rule using aₙ]. If you're stuck choosing between explicit and recursive, ask: does each value only depend on which step you're at (explicit), or does each value depend on the previous value (recursive)? 'Day 5 costs 45′suggestsexplicit.′Add45' suggests explicit. 'Add 45′suggestsexplicit.′Add10 to yesterday's amount' suggests recursive. The language tells you which form fits!

Question 10

A bacteria culture starts with 200 bacteria and triples every hour. What function models the population P(t)P(t)P(t) after ttt hours?

  1. P(t)=200+3tP(t)=200+3tP(t)=200+3t
  2. P(t)=3(200)tP(t)=3(200)^tP(t)=3(200)t
  3. P(t)=200⋅3tP(t)=200\cdot 3^tP(t)=200⋅3t (correct answer)
  4. P(t)=200⋅t3P(t)=200\cdot t^3P(t)=200⋅t3

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. The key to writing functions from context is identifying what changes (independent variable, like time or number of items) and what you're calculating (dependent variable, like cost or height), then finding the mathematical relationship between them using clues in the language. This context involves 'triples every hour,' which tells us this is an exponential function. Exponential functions have constant multiplication—the population is multiplied by the same factor each time period. The form is P(t) = a·b^t, and from the context we extract: initial population a = 200 from 'starts with 200 bacteria' and growth factor b = 3 from 'triples' = P(t) = 200·3^t. Choice C is correct because it properly identifies 200 as the initial population (when t = 0) and 3^t as the growth factor that triples the population each hour, matching the exponential structure for repeated multiplication. Choice A gives a linear function when the context describes exponential growth: 'triples every hour' indicates multiplication by 3 each hour, which means exponential growth, not adding 3 each hour. Percent growth and multiplication patterns mean exponential! If you're stuck choosing between explicit and recursive, ask: does each value only depend on which step you're at (explicit), or does each value depend on the previous value (recursive)? 'Day 5 costs 45′suggestsexplicit.′Add45' suggests explicit. 'Add 45′suggestsexplicit.′Add10 to yesterday's amount' suggests recursive. The language tells you which form fits!

Question 11

A video game character has 80 health points and loses 6 health points each minute. Express remaining health H(t)H(t)H(t) as a function of time ttt (in minutes).

  1. H(t)=80+6tH(t)=80+6tH(t)=80+6t
  2. H(t)=80−6tH(t)=80-6tH(t)=80−6t (correct answer)
  3. H(t)=6−80tH(t)=6-80tH(t)=6−80t
  4. H(t)=80⋅6tH(t)=80\cdot 6^tH(t)=80⋅6t

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'has 80 health points and loses 6 health points each minute,' we identify the independent variable as t (time in minutes) and dependent variable as H (remaining health). The relationship is linear because we have a starting amount that decreases at a constant rate. The initial health is 80 from 'has 80 health points,' and the rate is -6 per minute from 'loses 6 health points each minute.' Putting this together: H(t) = 80 - 6t. This formula lets us calculate remaining health at any time! Choice C is correct because it properly identifies the starting health (80) and subtracts the health lost over time (6t), matching the context of losing 6 points per minute. Choice A has the right numbers but uses addition instead of subtraction: the context says 'loses,' which means subtract, not add. When you see 'loses,' 'decreases,' or 'drains,' that's subtraction—the opposite of 'gains' or 'adds'! To write explicit functions from context: (1) Underline key phrases like 'per,' 'starts at,' 'plus,' 'each'—these tell you operations and values, (2) Identify what changes (independent variable x, n, t) and what you're calculating (dependent variable C, h, P), (3) Determine function type: constant rate = linear, percent/doubling = exponential, area/motion = quadratic, (4) Extract numbers from context and plug into the right form (y = mx + b for linear, y = a·b^x for exponential, etc.). Context translation cheat sheet: 'per/each' = multiply by that rate, 'plus/in addition' = add, 'starts at' = initial value, 'doubles/triples' = multiply by 2 or 3 (exponential), 'percent' = divide by 100 for decimal. These phrases are your clues for turning words into math!

Question 12

A gym membership costs 35tosignupplus35 to sign up plus 35tosignupplus18 per month. What is the formula for the total cost C(m)C(m)C(m) (in dollars) after mmm months?

  1. C(m)=35m+18C(m)=35m+18C(m)=35m+18
  2. C(m)=18+35mC(m)=18+35mC(m)=18+35m
  3. C(m)=35+18mC(m)=35+18mC(m)=35+18m (correct answer)
  4. C(m)=35⋅18mC(m)=35\cdot 18^mC(m)=35⋅18m

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'costs 35tosignupplus35 to sign up plus 35tosignupplus18 per month,' we identify the independent variable as m (number of months) and dependent variable as C(m) (total cost). The relationship is linear because we have a one-time fee plus a constant monthly rate. The sign-up fee is 35from′costs35 from 'costs 35from′costs35 to sign up,' and the monthly rate is 18from′18 from '18from′18 per month.' Putting this together: C(m) = 35 + 18m. This formula lets us calculate the total cost after any number of months! Choice C is correct because it properly identifies 35astheinitialsign−upfeeand35 as the initial sign-up fee and 35astheinitialsign−upfeeand18m as the total monthly charges for m months, matching the structure 'initial fee + rate × time.' Choice A reverses the coefficients: it would mean 35permonthplusan35 per month plus an 35permonthplusan18 sign-up fee, but the context clearly states '35tosignup′(one−time)and′35 to sign up' (one-time) and '35tosignup′(one−time)and′18 per month' (recurring). Always match the numbers to their correct roles! To write explicit functions from context: (1) Underline key phrases like 'per,' 'starts at,' 'plus,' 'each'—these tell you operations and values, (2) Identify what changes (independent variable x, n, t) and what you're calculating (dependent variable C, h, P), (3) Determine function type: constant rate = linear, percent/doubling = exponential, area/motion = quadratic, (4) Extract numbers from context and plug into the right form (y = mx + b for linear, y = a·b^x for exponential, etc.).

Question 13

A water tank contains 600 liters and drains at a constant rate of 15 liters per minute. Express the remaining volume V(t)V(t)V(t) (in liters) as a function of time ttt (in minutes).

  1. V(t)=600−15tV(t)=600-15tV(t)=600−15t (correct answer)
  2. V(t)=600+15tV(t)=600+15tV(t)=600+15t
  3. V(t)=15−600tV(t)=15-600tV(t)=15−600t
  4. V(t)=600(115)tV(t)=600\left(\frac{1}{15}\right)^tV(t)=600(151​)t

Explanation: This question tests your ability to translate a real-world situation into mathematical language—either as an explicit formula, a recursive process, or a series of calculation steps. An explicit expression gives you a direct formula to calculate the output from the input without needing any previous values: if the context says 'costs 45perdayplus45 per day plus 45perdayplus25 fee,' you can write C(d) = 45d + 25, where d is days and C is cost. Just plug in any number of days and calculate immediately! Looking at the context 'tank contains 600 liters and drains at a constant rate of 15 liters per minute,' we identify the independent variable as t (time in minutes) and dependent variable as V(t) (remaining volume). The relationship is linear because we have a starting amount that decreases at a constant rate. The initial volume is 600 from 'contains 600 liters,' and the rate is -15 (negative because draining) from 'drains...15 liters per minute.' Putting this together: V(t) = 600 - 15t. This formula lets us calculate the remaining water after any time! Choice A is correct because it properly identifies 600 as the starting volume and subtracts 15t to represent the volume drained after t minutes, matching the decreasing linear relationship. Choice B has the right numbers but adds instead of subtracts: the context says 'drains,' which means the volume decreases, so we subtract 15t, not add it. When you see 'drains,' 'loses,' or 'decreases,' that's subtraction! To write explicit functions from context: (1) Underline key phrases like 'per,' 'starts at,' 'plus,' 'each'—these tell you operations and values, (2) Identify what changes (independent variable x, n, t) and what you're calculating (dependent variable C, h, P), (3) Determine function type: constant rate = linear, percent/doubling = exponential, area/motion = quadratic, (4) Extract numbers from context and plug into the right form (y = mx + b for linear, y = a·b^x for exponential, etc.).

Question 14

A landscaping company plants trees in a triangular pattern. In the first row, they plant 1 tree. In the second row, they plant 3 trees. In the third row, they plant 5 trees, and so on, with each row containing 2 more trees than the previous row.

Which recursive formula represents TnT_nTn​, the number of trees in the nnnth row?

  1. T1=1T_1 = 1T1​=1; Tn=Tn−1+2nT_n = T_{n-1} + 2nTn​=Tn−1​+2n for n≥2n \geq 2n≥2
  2. T1=1T_1 = 1T1​=1; Tn=2Tn−1+1T_n = 2T_{n-1} + 1Tn​=2Tn−1​+1 for n≥2n \geq 2n≥2
  3. T1=3T_1 = 3T1​=3; Tn=Tn−1+2T_n = T_{n-1} + 2Tn​=Tn−1​+2 for n≥2n \geq 2n≥2
  4. T1=1T_1 = 1T1​=1; Tn=Tn−1+2T_n = T_{n-1} + 2Tn​=Tn−1​+2 for n≥2n \geq 2n≥2 (correct answer)

Explanation: When you encounter recursive sequence problems, focus on identifying the pattern between consecutive terms and the starting value. A recursive formula needs two parts: an initial term and a rule showing how each term relates to the previous one. Let's trace through this tree-planting pattern. Row 1 has 1 tree, row 2 has 3 trees, row 3 has 5 trees. The pattern shows each row has exactly 2 more trees than the previous row: 1 → 3 (add 2) → 5 (add 2) → 7 (add 2), and so on. This means T1=1T_1 = 1T1​=1 and Tn=Tn−1+2T_n = T_{n-1} + 2Tn​=Tn−1​+2 for n≥2n \geq 2n≥2. Let's verify: T2=T1+2=1+2=3T_2 = T_1 + 2 = 1 + 2 = 3T2​=T1​+2=1+2=3 ✓, and T3=T2+2=3+2=5T_3 = T_2 + 2 = 3 + 2 = 5T3​=T2​+2=3+2=5 ✓. Choice A incorrectly adds 2n2n2n instead of just 2. This would give T2=1+2(2)=5T_2 = 1 + 2(2) = 5T2​=1+2(2)=5, which doesn't match our pattern where the second row has 3 trees. Choice B uses 2Tn−1+12T_{n-1} + 12Tn−1​+1, which doubles the previous term. This would give T2=2(1)+1=3T_2 = 2(1) + 1 = 3T2​=2(1)+1=3, which works for row 2, but T3=2(3)+1=7T_3 = 2(3) + 1 = 7T3​=2(3)+1=7, not the correct 5 trees. Choice C starts with T1=3T_1 = 3T1​=3, but the problem clearly states the first row has 1 tree, not 3. The correct answer is D. Study tip: Always test your recursive formula with the given values. Calculate the first few terms to verify your formula produces the correct sequence.

Question 15

A gym membership costs 50tojoinplus50 to join plus 50tojoinplus30 per month. After 6 months of membership, the monthly rate decreases to $25. Which function represents the total cost C(m)C(m)C(m) after mmm months of membership?

  1. C(m)={50+30mif m≤650+25mif m>6C(m) = \begin{cases} 50 + 30m & \text{if } m \leq 6 \\ 50 + 25m & \text{if } m > 6 \end{cases}C(m)={50+30m50+25m​if m≤6if m>6​
  2. C(m)={50+30mif m≤6230+25mif m>6C(m) = \begin{cases} 50 + 30m & \text{if } m \leq 6 \\ 230 + 25m & \text{if } m > 6 \end{cases}C(m)={50+30m230+25m​if m≤6if m>6​
  3. C(m)={50+30mif m≤6230+25(m−6)if m>6C(m) = \begin{cases} 50 + 30m & \text{if } m \leq 6 \\ 230 + 25(m-6) & \text{if } m > 6 \end{cases}C(m)={50+30m230+25(m−6)​if m≤6if m>6​ (correct answer)
  4. C(m)={50+30mif m≤650+180+25(m−6)if m>6C(m) = \begin{cases} 50 + 30m & \text{if } m \leq 6 \\ 50 + 180 + 25(m-6) & \text{if } m > 6 \end{cases}C(m)={50+30m50+180+25(m−6)​if m≤6if m>6​

Explanation: The correct answer is C. For the first 6 months, the cost is 50+50 + 50+30m. After 6 months, the total cost is 50+50 + 50+30(6) = 230.Formonthsbeyond6,theadditionalcostis230. For months beyond 6, the additional cost is 230.Formonthsbeyond6,theadditionalcostis25 per month for each month beyond 6, so the total cost is 230+230 + 230+25(m-6). Choice A restarts the calculation ignoring previous payments. Choice B incorrectly adds 25m for all months rather than just the additional months beyond 6. Choice D is equivalent to choice C when simplified (50 + 180 + 25(m-6) = 230 + 25(m-6)), but choice C is the more direct representation.

Question 16

A car rental company charges 35perdayplus35 per day plus 35perdayplus0.15 per mile driven. However, if a customer drives more than 200 miles in a day, they pay a flat rate of $75 for that day regardless of mileage. Which function correctly represents the daily cost C(m)C(m)C(m) for driving mmm miles?

  1. C(m)=35+0.15mC(m) = 35 + 0.15mC(m)=35+0.15m for all values of mmm
  2. C(m)={35+0.15mif m≤20075if m>200C(m) = \begin{cases} 35 + 0.15m & \text{if } m \leq 200 \\ 75 & \text{if } m > 200 \end{cases}C(m)={35+0.15m75​if m≤200if m>200​ (correct answer)
  3. C(m)={35+0.15mif m<20075+0.15mif m≥200C(m) = \begin{cases} 35 + 0.15m & \text{if } m < 200 \\ 75 + 0.15m & \text{if } m \geq 200 \end{cases}C(m)={35+0.15m75+0.15m​if m<200if m≥200​
  4. C(m)={35+0.15mif m≤20075+0.15(m−200)if m>200C(m) = \begin{cases} 35 + 0.15m & \text{if } m \leq 200 \\ 75 + 0.15(m-200) & \text{if } m > 200 \end{cases}C(m)={35+0.15m75+0.15(m−200)​if m≤200if m>200​

Explanation: The correct answer is B. For 200 miles or fewer, the cost follows the standard formula of 35+35 + 35+0.15m. For more than 200 miles, the cost is a flat $75 regardless of mileage. Choice A ignores the flat rate condition entirely. Choice C incorrectly adds the mileage charge to the flat rate for high mileage. Choice D attempts to charge the flat rate plus additional mileage beyond 200 miles, which contradicts the 'regardless of mileage' condition in the problem.

Question 17

A bacteria culture starts with 500 bacteria. Every 4 hours, the population triples. Which recursive formula correctly represents the bacteria population PnP_nPn​ after nnn four-hour periods?

  1. P0=500P_0 = 500P0​=500; Pn=Pn−1+3P_n = P_{n-1} + 3Pn​=Pn−1​+3 for n≥1n \geq 1n≥1
  2. P0=500P_0 = 500P0​=500; Pn=3Pn−1P_n = 3P_{n-1}Pn​=3Pn−1​ for n≥1n \geq 1n≥1 (correct answer)
  3. P0=3P_0 = 3P0​=3; Pn=500Pn−1P_n = 500P_{n-1}Pn​=500Pn−1​ for n≥1n \geq 1n≥1
  4. P0=500P_0 = 500P0​=500; Pn=Pn−1+3Pn−1P_n = P_{n-1} + 3P_{n-1}Pn​=Pn−1​+3Pn−1​ for n≥1n \geq 1n≥1

Explanation: The correct answer is B. The initial population is 500, so P₀ = 500. Since the population triples every 4 hours, each term is 3 times the previous term, giving us Pₙ = 3P_{n-1}. Choice A shows addition instead of multiplication for tripling. Choice C has the wrong initial value and multiplication factor reversed. Choice D represents Pₙ = P_{n-1} + 3P_{n-1} = 4P_{n-1}, which would quadruple the population rather than triple it.

Question 18

A water tank contains 1200 gallons initially. Water is drained at a rate of 15 gallons per minute for the first 30 minutes, then at 25 gallons per minute thereafter. Which function represents the amount of water W(t)W(t)W(t) remaining after ttt minutes?

  1. W(t)={1200−15tif 0≤t≤301200−25tif t>30W(t) = \begin{cases} 1200 - 15t & \text{if } 0 \leq t \leq 30 \\ 1200 - 25t & \text{if } t > 30 \end{cases}W(t)={1200−15t1200−25t​if 0≤t≤30if t>30​
  2. W(t)={1200−15tif 0≤t≤301200−25(t−15)if t>30W(t) = \begin{cases} 1200 - 15t & \text{if } 0 \leq t \leq 30 \\ 1200 - 25(t-15) & \text{if } t > 30 \end{cases}W(t)={1200−15t1200−25(t−15)​if 0≤t≤30if t>30​
  3. W(t)={1200−15tif 0≤t≤301200−15(30)−25tif t>30W(t) = \begin{cases} 1200 - 15t & \text{if } 0 \leq t \leq 30 \\ 1200 - 15(30) - 25t & \text{if } t > 30 \end{cases}W(t)={1200−15t1200−15(30)−25t​if 0≤t≤30if t>30​
  4. W(t)={1200−15tif 0≤t≤30750−25(t−30)if t>30W(t) = \begin{cases} 1200 - 15t & \text{if } 0 \leq t \leq 30 \\ 750 - 25(t-30) & \text{if } t > 30 \end{cases}W(t)={1200−15t750−25(t−30)​if 0≤t≤30if t>30​ (correct answer)

Explanation: When you encounter piecewise functions modeling real-world scenarios with changing rates, you need to carefully track what happens at each stage and ensure continuity between the pieces. For the first 30 minutes, water drains at 15 gallons per minute from the initial 1200 gallons, so W(t)=1200−15tW(t) = 1200 - 15tW(t)=1200−15t for 0≤t≤300 \leq t \leq 300≤t≤30. At t=30t = 30t=30, this gives us W(30)=1200−15(30)=750W(30) = 1200 - 15(30) = 750W(30)=1200−15(30)=750 gallons remaining. After 30 minutes, the rate changes to 25 gallons per minute. The key insight is that you start this second phase with 750 gallons (not the original 1200), and you only count the additional time beyond 30 minutes at the new rate. So for t>30t > 30t>30: W(t)=750−25(t−30)W(t) = 750 - 25(t-30)W(t)=750−25(t−30). Choice A incorrectly restarts from 1200 gallons at t=30t = 30t=30, ignoring the water already drained in the first phase. Choice B has the wrong rate in the second piece and an illogical (t−15)(t-15)(t−15) term. Choice C attempts to account for the first 30 minutes by subtracting 15(30)=45015(30) = 45015(30)=450, but then incorrectly subtracts 25t25t25t for the entire time ttt, rather than just the time after 30 minutes. Only choice D correctly shows that after 30 minutes, you have 750 gallons left and drain at 25 gallons per minute for each additional minute beyond the first 30. Study tip: In piecewise rate problems, always check that your function pieces connect properly at the boundary points—the amount at the end of one phase must equal the starting amount for the next phase.

Question 19

A ball is dropped from a height of 64 feet. After each bounce, it reaches a height that is 34\frac{3}{4}43​ of its previous height. Which function represents the height h(n)h(n)h(n) of the ball after nnn bounces?

  1. h(n)=64(34)nh(n) = 64 \left(\frac{3}{4}\right)^nh(n)=64(43​)n (correct answer)
  2. h(n)=64(34)n−1h(n) = 64 \left(\frac{3}{4}\right)^{n-1}h(n)=64(43​)n−1
  3. h(n)=64−n⋅34h(n) = 64 - n \cdot \frac{3}{4}h(n)=64−n⋅43​
  4. h(n)=64(43)nh(n) = 64 \left(\frac{4}{3}\right)^nh(n)=64(34​)n

Explanation: The correct answer is A. Before any bounces (n = 0), the ball is at 64 feet. After 1 bounce (n = 1), the height is 64 × (3/4) = 48 feet. After 2 bounces (n = 2), the height is 64 × (3/4)² = 36 feet. The pattern shows h(n) = 64(3/4)ⁿ. Choice B would give h(1) = 64(3/4)⁰ = 64, meaning the ball doesn't lose height after the first bounce. Choice C represents linear decay rather than exponential decay. Choice D uses the reciprocal ratio 4/3, which would make the ball gain height with each bounce.

Question 20

A streaming service charges a monthly subscription fee of 12.99plus12.99 plus 12.99plus2.50 for each premium movie rental during that month. If C(n)C(n)C(n) represents the total cost in dollars for a month with nnn premium movie rentals, which function correctly models this situation?

  1. C(n)=12.99n+2.50C(n) = 12.99n + 2.50C(n)=12.99n+2.50
  2. C(n)=2.50n+12.99C(n) = 2.50n + 12.99C(n)=2.50n+12.99 (correct answer)
  3. C(n)=12.99+2.50+nC(n) = 12.99 + 2.50 + nC(n)=12.99+2.50+n
  4. C(n)=(12.99+2.50)⋅nC(n) = (12.99 + 2.50) \cdot nC(n)=(12.99+2.50)⋅n

Explanation: The correct answer is B. The monthly subscription fee of 12.99isafixedcostthatdoesn′tchangeregardlessofthenumberofrentals,soit′stheconstantterm.The12.99 is a fixed cost that doesn't change regardless of the number of rentals, so it's the constant term. The 12.99isafixedcostthatdoesn′tchangeregardlessofthenumberofrentals,soit′stheconstantterm.The2.50 per rental is the variable cost that depends on n, making it the coefficient of n. Therefore, C(n) = 2.50n + 12.99. Choice A incorrectly treats the subscription fee as the coefficient of n. Choice C adds n as a separate term rather than as a coefficient. Choice D multiplies the entire sum by n, which would mean both costs depend on the number of rentals.