Given that , which angle addition or subtraction formula application most directly verifies this result?
Opening subject page...
Loading your content
Precalculus Quiz
Practice Proving Angle Addition Subtraction Formulas in Precalculus with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.
Question 1 / 20
0 of 20 answered
Given that cos(75°)=46−2, which angle addition or subtraction formula application most directly verifies this result?
This quiz focuses on Proving Angle Addition Subtraction Formulas, giving you a quick way to practice the rules, question types, and explanations that matter most for Precalculus.
Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.
Given that cos(75°)=46−2, which angle addition or subtraction formula application most directly verifies this result?
Explanation: When you encounter problems asking you to verify trigonometric values using angle formulas, look for angle combinations that break down into familiar reference angles (30°, 45°, 60°) whose exact trigonometric values you know by heart. Let's verify the given result by testing option C: cos(75°)=cos(45°+30°). Using the cosine addition formula cos(A+B)=cosAcosB−sinAsinB: cos(75°)=cos(45°)cos(30°)−sin(45°)sin(30°) =22⋅23−22⋅21 =46−42=46−2 This matches the given result perfectly. Option A uses cos(90°−15°), but this becomes sin(15°) by the cofunction identity, not the cosine addition formula shown. Option B uses cos(120°−45°) with angles whose values we know, but cos(120°)=−21 and sin(120°)=23, which won't yield the correct result when calculated. Option D uses cos(135°−60°), but cos(135°)=−22, and the negative value will prevent getting the positive result we need. Study tip: When verifying trigonometric identities, always choose angle combinations that use 30°, 45°, and 60° since you can calculate their exact values without a calculator. Avoid angles that introduce negative values unless the final result should be negative.
Consider the equation sin(x+60°)=sinxcos60°+cosxsin60°. If a student wants to use this to find the exact value of sin(105°), which substitution for x would be most strategic?
Explanation: This question tests your understanding of angle addition formulas and strategic thinking in trigonometry. The given equation is actually the sine addition formula: sin(x+60°)=sinxcos60°+cosxsin60°. To find sin(105°), you need to choose an x value that makes x+60°=105°, which means x=45°. Choice D is correct because when x=45°, the equation becomes sin(105°)=sin45°cos60°+cos45°sin60°. Since sin45°=cos45°=22, cos60°=21, and sin60°=23, you can substitute these exact values to get sin(105°)=22⋅21+22⋅23=42+6. Choice A is incorrect because x=90° gives you sin(150°), not sin(105°). Choice B makes the same error—x=75° produces sin(135°), which isn't your target angle. Choice C is wrong because while 30° and 60° are complementary, using x=30° gives you sin(90°)=1, not sin(105°). Remember: when using addition formulas to find specific trigonometric values, always work backwards from your target angle to determine what substitution you need. Don't get distracted by angles that seem "nice" but don't lead to your desired result.
Which formula correctly gives sin(A+B) (sine angle addition formula)?
Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. The formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B) directly matches the required addition formula. Choice B is correct because it correctly states the formula with proper signs. Choice A incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.
Use the sine addition formula with A=B=θ to derive a double-angle identity. What is sin(2θ)?
Explanation: This question tests understanding of the angle addition formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. Applying the sine addition formula with A = B = θ gives sin(2θ) = sin(θ + θ) = sin(θ)cos(θ) + cos(θ)sin(θ) = 2 sin(θ) cos(θ). Choice C is correct because it correctly states the formula with proper signs. Choice B makes an arithmetic error in the evaluation, omitting the factor of 2 when combining the identical terms. These formulas are fundamental: they cannot be derived from simpler trig properties but must be proven using geometry, the unit circle, or other methods, and they serve as the foundation for proving many other trig identities including double angle and half angle formulas. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).
Using the cosine angle subtraction formula, find the exact value of cos(15∘) by writing 15∘=45∘−30∘.
Explanation: This question tests understanding of the angle subtraction formula for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). Using cos(A - B) = cos(A)cos(B) + sin(A)sin(B) with A = 45°, B = 30°, we calculate cos(45°)cos(30°) + sin(45°)sin(30°) = (√2/2)(√3/2) + (√2/2)(1/2) = √6/4 + √2/4 = (√6 + √2)/4. Choice A is correct because it correctly applies the cosine subtraction formula with the proper positive sign between terms. Choice B incorrectly has (√6 - √2)/4, which would result from using the cosine addition formula instead of subtraction, mixing up the sign convention. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).
Use the angle addition formulas to simplify sin(x+4π)+sin(x−4π). What is the simplified expression?
Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. Expanding sin(x + π/4) + sin(x - π/4) gives [sin(x)cos(π/4) + cos(x)sin(π/4)] + [sin(x)cos(π/4) - cos(x)sin(π/4)] = 2 sin(x) cos(π/4), since the cos(x) terms cancel. Choice A is correct because it properly substitutes the angle values and simplifies accurately. Choice C incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values.
Using the angle subtraction formula for sine, find the exact value of sin(15∘) by writing it as sin(45∘−30∘).
Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(15°) where 15° = 45° - 30°, we substitute into sin(45° - 30°) = sin(45°)cos(30°) - cos(45°)sin(30°), giving (√2/2)(√3/2) - (√2/2)(1/2) = √6/4 - √2/4 = (√6 - √2)/4. Choice A is correct because it properly substitutes the angle values and simplifies accurately. Choice B has the wrong sign between the terms, using plus when the formula for sine subtraction requires minus. To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).
Using the tangent angle addition formula, what is tan(A+B) in terms of tan(A) and tan(B)?
Explanation: This question tests understanding of the angle addition and subtraction formulas for tangent. The tangent addition formula is tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), which shows that tangent of a sum involves both a numerator (sum of tangents) and a denominator (1 minus their product). Applying tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), we see that the denominator uses a minus sign for the addition formula, distinguishing it from the subtraction version. Choice C is correct because it correctly states the formula with proper signs. Choice D incorrectly claims tan(A + B) = tan(A) + tan(B), missing the essential denominator that makes the actual formula tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)). For tangent, remember the formulas have fractions: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), with the sign in the denominator opposite to the numerator (minus for addition, plus for subtraction). Common error: students try tan(A + B) = tan(A) + tan(B), but you can quickly verify this is wrong by trying A = B = 45°: tan(90°) is undefined but tan(45°) + tan(45°) = 1 + 1 = 2, which is finite.
In proving that sin(2θ)=2sinθcosθ using angle addition formulas, a student writes: sin(2θ)=sin(θ+θ)=sinθcosθ+cosθsinθ=2sinθcosθ. What property of real number multiplication justifies the final step?
Explanation: When working with trigonometric identities and algebraic manipulations, you need to identify which fundamental properties of real numbers justify each step in your reasoning. Let's examine what happens in the final step: sinθcosθ+cosθsinθ=2sinθcosθ. The key insight is recognizing that sinθcosθ and cosθsinθ are actually the same expression. Since multiplication of real numbers is commutative, sinθcosθ=cosθsinθ. This means you're adding two identical terms: sinθcosθ+sinθcosθ, which equals 2sinθcosθ. The commutative property is what allows you to see these as like terms that can be combined. Choice A incorrectly describes the distributive property, which would involve factoring out a common factor from different terms—but we're not factoring here, we're combining like terms. Choice C mentions the associative property, which deals with how we group terms in addition or multiplication, not with recognizing that two products are equal. Choice D refers to the identity property, but adding a term to itself doesn't preserve the original expression—it doubles it. The correct answer is B because the commutative property of multiplication is what allows us to recognize that cosθsinθ=sinθcosθ, making them like terms. Study tip: When simplifying algebraic expressions involving products, always check if the commutative property reveals hidden like terms that can be combined.
Using the sine angle addition formula, if sin(A)=53 and cos(A)=54, and sin(B)=135 and cos(B)=1312 (with A and B in Quadrant I), what is sin(A+B)?
Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(A + B) where sin(A) = 3/5, cos(A) = 4/5, sin(B) = 5/13, cos(B) = 12/13, we substitute into sin(A + B) = sin(A)cos(B) + cos(A)sin(B), giving (3/5)(12/13) + (4/5)(5/13) = 36/65 + 20/65 = 56/65. Choice B is correct because it properly substitutes the angle values and simplifies accurately. Choice A makes an arithmetic error in the evaluation, calculating only the first product 36/65 instead of adding both products for 56/65. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.
Which formula correctly gives the cosine subtraction identity cos(A−B) in terms of sin and cos?
Explanation: This question tests understanding of the angle subtraction formula for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). For cosine subtraction specifically, we have cos(A - B) = cos(A)cos(B) + sin(A)sin(B), where the plus sign between the terms is crucial. Choice B is correct because it correctly states the formula with proper signs: cos(A - B) = cos(A)cos(B) + sin(A)sin(B). Choice A incorrectly has the wrong sign between the terms, using cos(A)cos(B) - sin(A)sin(B) which is actually the cosine addition formula for cos(A + B), not the subtraction formula. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.
If sin(x)=53 and cos(y)=135 where x and y are both in the first quadrant, what is the value of sin(x+y)?
Explanation: Using the sine addition formula: sin(x+y)=sinxcosy+cosxsiny. First, find the missing trigonometric values. Since sinx=53 and x is in quadrant I, cosx=1−sin2x=1−259=54. Since cosy=135 and y is in quadrant I, siny=1−cos2y=1−16925=1312. Therefore: sin(x+y)=53⋅135+54⋅1312=6515+6548=6563. Option A results from calculation errors. Option B comes from incorrectly using cosine addition formula. Option D results from sign errors in the Pythagorean theorem applications.
A calculus student needs to prove that dxd[sin(x+h)]=cos(x+h) and plans to use the sine addition formula as an intermediate step. Which expression correctly represents the application of sin(A+B)=sinAcosB+cosAsinB to sin(x+h)?
Explanation: When working with trigonometric identities and derivatives, the sine addition formula is a fundamental tool that breaks down complex expressions into manageable parts. The formula sin(A+B)=sinAcosB+cosAsinB allows you to expand any sine of a sum into terms that can be differentiated separately. For sin(x+h), you need to identify A=x and B=h, then apply the formula directly. This gives you sin(x+h)=sinxcosh+cosxsinh. This expansion is crucial for differentiation because it separates the variable x (which you're differentiating with respect to) from the parameter h, making it possible to apply derivative rules to each term individually. Choice A reverses the order of terms in the addition formula, writing sinhcosx+coshsinx instead of the correct sinxcosh+cosxsinh. While mathematically equivalent due to commutativity, this doesn't match the standard application of the sine addition formula. Choice B incorrectly uses sinxsinh+cosxcosh, which is actually the cosine addition formula cos(x−h), not the sine addition formula. Choice C gives cosxcosh−sinxsinh, which is the cosine addition formula for cos(x+h), completely wrong for expanding sin(x+h). Remember: always match the trigonometric function in your expansion to the function you're working with. Sine addition formulas expand sines, cosine addition formulas expand cosines.
Using the cosine addition formula, what is the exact value of cos(105∘) if you rewrite it as cos(60∘+45∘)?
Explanation: This question tests understanding of the angle addition formulas for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). To find cos(105°) where 105° = 60° + 45°, we substitute into cos(60° + 45°) = cos(60°)cos(45°) - sin(60°)sin(45°), giving (1/2)(√2/2) - (√3/2)(√2/2) = √2/4 - √6/4 = (√2 - √6)/4 = - (√6 - √2)/4. Choice C is correct because it properly substitutes the angle values and simplifies accurately, including the negative sign due to the quadrant. Choice A has the wrong sign between the terms, using plus when the formula for cosine addition requires minus. To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).
Which statement best explains why sin(A+B)=sin(A)+sin(B) in general, referring to the sine angle addition formula?
Explanation: This question tests understanding of why the angle addition formula for sine requires cross terms. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it explains why cross terms are necessary: the sine of a sum must include the cross terms sin(A)cos(B) and cos(A)sin(B), not just a sum of sines. Choice D incorrectly focuses on the range of values rather than the structural reason why the formula needs cross terms - the issue isn't about bounds but about the fundamental trigonometric relationship. Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.
A student claims that sin(A+B)=sin(A)+sin(B). Using the angle addition formula for sine, which statement best explains why this is not true in general?
Explanation: This question tests understanding of the angle addition formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it explains why cross terms are necessary. Choice B confuses the sine formula with the cosine formula, using sin(A)sin(B) + cos(A)cos(B) when sine requires sin(A)cos(B) + cos(A)sin(B). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).
Using the sine angle addition formula, find the exact value of sin(75∘) by writing 75∘=45∘+30∘.
Explanation: This question tests understanding of the angle addition formula for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(75°), we recognize 75° = 45° + 30°, so sin(75°) = sin(45°)cos(30°) + cos(45°)sin(30°) = (√2/2)(√3/2) + (√2/2)(1/2) = √6/4 + √2/4 = (√6 + √2)/4. Choice B is correct because it properly substitutes the angle values and simplifies accurately to (√6 + √2)/4. Choice A incorrectly has (√6 - √2)/4, which would result from using the wrong sign between the terms or confusing this with a cosine formula. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.
Which formula correctly gives sin(A+B) (and is not the incorrect idea sin(A)+sin(B))?
Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it correctly states the formula with proper signs. Choice D incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.
Two students are debating whether the identity cos(A−B)=cosAcosB+sinAsinB can be derived from cos(A+B)=cosAcosB−sinAsinB by substituting −B for B. Student 1 claims this works directly. Student 2 claims additional steps are needed. Who is correct and why?
Explanation: Student 2 is correct. While substituting −B for B in cos(A+B)=cosAcosB−sinAsinB gives cos(A+(−B))=cosAcos(−B)−sinAsin(−B), this requires using the even-odd properties of trigonometric functions to simplify: cos(−B)=cosB (cosine is even) and sin(−B)=−sinB (sine is odd). This yields cosAcosB−sinA(−sinB)=cosAcosB+sinAsinB. Option A ignores these necessary steps. Option C is incorrect about the relationship. Option D overcomplicates the required justification.
Use the tangent angle addition formula to write tan(A+B) in terms of tan(A) and tan(B).
Explanation: This question tests understanding of the angle addition formula for tangent. The tangent addition formula is tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), which shows that tangent of a sum involves both a numerator (sum of tangents) and a denominator (1 minus their product). The formula has a fraction structure where the numerator contains the sum tan(A) + tan(B), and the denominator contains 1 - tan(A)tan(B), with a minus sign being crucial for the addition formula. Choice A is correct because it correctly states the formula with proper signs: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)). Choice B incorrectly has the wrong sign in the denominator, using 1 + tan(A)tan(B) when the formula for tan(A + B) requires the denominator to be 1 - tan(A)tan(B). For tangent, remember the formulas have fractions: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), with the sign in the denominator opposite to the numerator (minus for addition, plus for subtraction).