Home

Tutoring

Subjects

Live Classes

Study Coach

Essay Review

On-Demand Courses

Colleges

Games


Sign up

Log in

Opening subject page...

Loading your content

Practice

  • All Subjects
  • Algebra Flashcards
  • SAT Math Practice Tests
  • Math Question of the Day
  • Live Classes
  • On-Demand Courses

Varsity Tutors

  • Find a Tutor
  • Test Prep
  • Online Classes
  • K-12 Learning
  • College Search
  • VarsityTutors.com

© 2026 Varsity Tutors. All rights reserved.

← Back to quizzes

Precalculus Quiz

Precalculus Quiz: Proving Angle Addition Subtraction Formulas

Practice Proving Angle Addition Subtraction Formulas in Precalculus with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

Question 1 / 20

0 of 20 answered

Given that cos⁡(75°)=6−24\cos(75°) = \frac{\sqrt{6} - \sqrt{2}}{4}cos(75°)=46​−2​​, which angle addition or subtraction formula application most directly verifies this result?

Select an answer to continue

What this quiz covers

This quiz focuses on Proving Angle Addition Subtraction Formulas, giving you a quick way to practice the rules, question types, and explanations that matter most for Precalculus.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

Given that cos⁡(75°)=6−24\cos(75°) = \frac{\sqrt{6} - \sqrt{2}}{4}cos(75°)=46​−2​​, which angle addition or subtraction formula application most directly verifies this result?

  1. cos⁡(75°)=cos⁡(90°−15°)=cos⁡(90°)cos⁡(15°)+sin⁡(90°)sin⁡(15°)\cos(75°) = \cos(90° - 15°) = \cos(90°)\cos(15°) + \sin(90°)\sin(15°)cos(75°)=cos(90°−15°)=cos(90°)cos(15°)+sin(90°)sin(15°)
  2. cos⁡(75°)=cos⁡(120°−45°)=cos⁡(120°)cos⁡(45°)+sin⁡(120°)sin⁡(45°)\cos(75°) = \cos(120° - 45°) = \cos(120°)\cos(45°) + \sin(120°)\sin(45°)cos(75°)=cos(120°−45°)=cos(120°)cos(45°)+sin(120°)sin(45°)
  3. cos⁡(75°)=cos⁡(45°+30°)=cos⁡(45°)cos⁡(30°)−sin⁡(45°)sin⁡(30°)\cos(75°) = \cos(45° + 30°) = \cos(45°)\cos(30°) - \sin(45°)\sin(30°)cos(75°)=cos(45°+30°)=cos(45°)cos(30°)−sin(45°)sin(30°) (correct answer)
  4. cos⁡(75°)=cos⁡(135°−60°)=cos⁡(135°)cos⁡(60°)+sin⁡(135°)sin⁡(60°)\cos(75°) = \cos(135° - 60°) = \cos(135°)\cos(60°) + \sin(135°)\sin(60°)cos(75°)=cos(135°−60°)=cos(135°)cos(60°)+sin(135°)sin(60°)

Explanation: When you encounter problems asking you to verify trigonometric values using angle formulas, look for angle combinations that break down into familiar reference angles (30°, 45°, 60°) whose exact trigonometric values you know by heart. Let's verify the given result by testing option C: cos⁡(75°)=cos⁡(45°+30°)\cos(75°) = \cos(45° + 30°)cos(75°)=cos(45°+30°). Using the cosine addition formula cos⁡(A+B)=cos⁡Acos⁡B−sin⁡Asin⁡B\cos(A + B) = \cos A \cos B - \sin A \sin Bcos(A+B)=cosAcosB−sinAsinB: cos⁡(75°)=cos⁡(45°)cos⁡(30°)−sin⁡(45°)sin⁡(30°)\cos(75°) = \cos(45°)\cos(30°) - \sin(45°)\sin(30°)cos(75°)=cos(45°)cos(30°)−sin(45°)sin(30°) =22⋅32−22⋅12= \frac{\sqrt{2}}{2} \cdot \frac{\sqrt{3}}{2} - \frac{\sqrt{2}}{2} \cdot \frac{1}{2}=22​​⋅23​​−22​​⋅21​ =64−24=6−24= \frac{\sqrt{6}}{4} - \frac{\sqrt{2}}{4} = \frac{\sqrt{6} - \sqrt{2}}{4}=46​​−42​​=46​−2​​ This matches the given result perfectly. Option A uses cos⁡(90°−15°)\cos(90° - 15°)cos(90°−15°), but this becomes sin⁡(15°)\sin(15°)sin(15°) by the cofunction identity, not the cosine addition formula shown. Option B uses cos⁡(120°−45°)\cos(120° - 45°)cos(120°−45°) with angles whose values we know, but cos⁡(120°)=−12\cos(120°) = -\frac{1}{2}cos(120°)=−21​ and sin⁡(120°)=32\sin(120°) = \frac{\sqrt{3}}{2}sin(120°)=23​​, which won't yield the correct result when calculated. Option D uses cos⁡(135°−60°)\cos(135° - 60°)cos(135°−60°), but cos⁡(135°)=−22\cos(135°) = -\frac{\sqrt{2}}{2}cos(135°)=−22​​, and the negative value will prevent getting the positive result we need. Study tip: When verifying trigonometric identities, always choose angle combinations that use 30°, 45°, and 60° since you can calculate their exact values without a calculator. Avoid angles that introduce negative values unless the final result should be negative.

Question 2

Consider the equation sin⁡(x+60°)=sin⁡xcos⁡60°+cos⁡xsin⁡60°\sin(x + 60°) = \sin x \cos 60° + \cos x \sin 60°sin(x+60°)=sinxcos60°+cosxsin60°. If a student wants to use this to find the exact value of sin⁡(105°)\sin(105°)sin(105°), which substitution for xxx would be most strategic?

  1. x=90°x = 90°x=90°, because sin⁡90°=1\sin 90° = 1sin90°=1 and cos⁡90°=0\cos 90° = 0cos90°=0, eliminating terms and simplifying the expression
  2. x=75°x = 75°x=75°, because this creates sin⁡(75°+60°)=sin⁡(135°)\sin(75° + 60°) = \sin(135°)sin(75°+60°)=sin(135°), which has a known exact value
  3. x=30°x = 30°x=30°, because 30°30°30° and 60°60°60° are complementary angles, which simplifies the trigonometric calculations
  4. x=45°x = 45°x=45°, because both sin⁡45°\sin 45°sin45° and cos⁡45°\cos 45°cos45° have exact radical expressions that simplify calculations (correct answer)

Explanation: This question tests your understanding of angle addition formulas and strategic thinking in trigonometry. The given equation is actually the sine addition formula: sin⁡(x+60°)=sin⁡xcos⁡60°+cos⁡xsin⁡60°\sin(x + 60°) = \sin x \cos 60° + \cos x \sin 60°sin(x+60°)=sinxcos60°+cosxsin60°. To find sin⁡(105°)\sin(105°)sin(105°), you need to choose an xxx value that makes x+60°=105°x + 60° = 105°x+60°=105°, which means x=45°x = 45°x=45°. Choice D is correct because when x=45°x = 45°x=45°, the equation becomes sin⁡(105°)=sin⁡45°cos⁡60°+cos⁡45°sin⁡60°\sin(105°) = \sin 45° \cos 60° + \cos 45° \sin 60°sin(105°)=sin45°cos60°+cos45°sin60°. Since sin⁡45°=cos⁡45°=22\sin 45° = \cos 45° = \frac{\sqrt{2}}{2}sin45°=cos45°=22​​, cos⁡60°=12\cos 60° = \frac{1}{2}cos60°=21​, and sin⁡60°=32\sin 60° = \frac{\sqrt{3}}{2}sin60°=23​​, you can substitute these exact values to get sin⁡(105°)=22⋅12+22⋅32=2+64\sin(105°) = \frac{\sqrt{2}}{2} \cdot \frac{1}{2} + \frac{\sqrt{2}}{2} \cdot \frac{\sqrt{3}}{2} = \frac{\sqrt{2} + \sqrt{6}}{4}sin(105°)=22​​⋅21​+22​​⋅23​​=42​+6​​. Choice A is incorrect because x=90°x = 90°x=90° gives you sin⁡(150°)\sin(150°)sin(150°), not sin⁡(105°)\sin(105°)sin(105°). Choice B makes the same error—x=75°x = 75°x=75° produces sin⁡(135°)\sin(135°)sin(135°), which isn't your target angle. Choice C is wrong because while 30°30°30° and 60°60°60° are complementary, using x=30°x = 30°x=30° gives you sin⁡(90°)=1\sin(90°) = 1sin(90°)=1, not sin⁡(105°)\sin(105°)sin(105°). Remember: when using addition formulas to find specific trigonometric values, always work backwards from your target angle to determine what substitution you need. Don't get distracted by angles that seem "nice" but don't lead to your desired result.

Question 3

Which formula correctly gives sin⁡(A+B)\sin(A+B)sin(A+B) (sine angle addition formula)?​

  1. sin⁡(A+B)=sin⁡(A)+sin⁡(B)\sin(A+B)=\sin(A)+\sin(B)sin(A+B)=sin(A)+sin(B)
  2. sin⁡(A+B)=sin⁡(A)cos⁡(B)+cos⁡(A)sin⁡(B)\sin(A+B)=\sin(A)\cos(B)+\cos(A)\sin(B)sin(A+B)=sin(A)cos(B)+cos(A)sin(B) (correct answer)
  3. sin⁡(A+B)=sin⁡(A)sin⁡(B)+cos⁡(A)cos⁡(B)\sin(A+B)=\sin(A)\sin(B)+\cos(A)\cos(B)sin(A+B)=sin(A)sin(B)+cos(A)cos(B)
  4. sin⁡(A+B)=sin⁡(A)cos⁡(B)−cos⁡(A)sin⁡(B)\sin(A+B)=\sin(A)\cos(B)-\cos(A)\sin(B)sin(A+B)=sin(A)cos(B)−cos(A)sin(B)

Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. The formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B) directly matches the required addition formula. Choice B is correct because it correctly states the formula with proper signs. Choice A incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.

Question 4

Use the sine addition formula with A=B=θA=B=\thetaA=B=θ to derive a double-angle identity. What is sin⁡(2θ)\sin(2\theta)sin(2θ)?

  1. sin⁡(2θ)=sin⁡2(θ)+cos⁡2(θ)\sin(2\theta)=\sin^2(\theta)+\cos^2(\theta)sin(2θ)=sin2(θ)+cos2(θ)
  2. sin⁡(2θ)=sin⁡(θ)cos⁡(θ)\sin(2\theta)=\sin(\theta)\cos(\theta)sin(2θ)=sin(θ)cos(θ)
  3. sin⁡(2θ)=2sin⁡(θ)cos⁡(θ)\sin(2\theta)=2\sin(\theta)\cos(\theta)sin(2θ)=2sin(θ)cos(θ) (correct answer)
  4. sin⁡(2θ)=2sin⁡(θ)+2cos⁡(θ)\sin(2\theta)=2\sin(\theta)+2\cos(\theta)sin(2θ)=2sin(θ)+2cos(θ)

Explanation: This question tests understanding of the angle addition formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. Applying the sine addition formula with A = B = θ gives sin(2θ) = sin(θ + θ) = sin(θ)cos(θ) + cos(θ)sin(θ) = 2 sin(θ) cos(θ). Choice C is correct because it correctly states the formula with proper signs. Choice B makes an arithmetic error in the evaluation, omitting the factor of 2 when combining the identical terms. These formulas are fundamental: they cannot be derived from simpler trig properties but must be proven using geometry, the unit circle, or other methods, and they serve as the foundation for proving many other trig identities including double angle and half angle formulas. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).

Question 5

Using the cosine angle subtraction formula, find the exact value of cos⁡(15∘)\cos(15^\circ)cos(15∘) by writing 15∘=45∘−30∘15^\circ = 45^\circ - 30^\circ15∘=45∘−30∘.

  1. 6+24\dfrac{\sqrt{6}+\sqrt{2}}{4}46​+2​​ (correct answer)
  2. 6−24\dfrac{\sqrt{6}-\sqrt{2}}{4}46​−2​​
  3. 22⋅32−22⋅12\dfrac{\sqrt{2}}{2}\cdot\dfrac{\sqrt{3}}{2}-\dfrac{\sqrt{2}}{2}\cdot\dfrac{1}{2}22​​⋅23​​−22​​⋅21​
  4. 32−12\dfrac{\sqrt{3}}{2}-\dfrac{1}{2}23​​−21​

Explanation: This question tests understanding of the angle subtraction formula for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). Using cos(A - B) = cos(A)cos(B) + sin(A)sin(B) with A = 45°, B = 30°, we calculate cos(45°)cos(30°) + sin(45°)sin(30°) = (√2/2)(√3/2) + (√2/2)(1/2) = √6/4 + √2/4 = (√6 + √2)/4. Choice A is correct because it correctly applies the cosine subtraction formula with the proper positive sign between terms. Choice B incorrectly has (√6 - √2)/4, which would result from using the cosine addition formula instead of subtraction, mixing up the sign convention. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).

Question 6

Use the angle addition formulas to simplify sin⁡(x+π4)+sin⁡(x−π4)\sin\left(x+\dfrac{\pi}{4}\right)+\sin\left(x-\dfrac{\pi}{4}\right)sin(x+4π​)+sin(x−4π​). What is the simplified expression?​

  1. 2sin⁡(x)cos⁡(π4)2\sin(x)\cos\left(\dfrac{\pi}{4}\right)2sin(x)cos(4π​) (correct answer)
  2. 2cos⁡(x)sin⁡(π4)2\cos(x)\sin\left(\dfrac{\pi}{4}\right)2cos(x)sin(4π​)
  3. sin⁡(x)+sin⁡(π4)\sin(x)+\sin\left(\dfrac{\pi}{4}\right)sin(x)+sin(4π​)
  4. 2sin⁡(x)sin⁡(π4)2\sin(x)\sin\left(\dfrac{\pi}{4}\right)2sin(x)sin(4π​)

Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. Expanding sin(x + π/4) + sin(x - π/4) gives [sin(x)cos(π/4) + cos(x)sin(π/4)] + [sin(x)cos(π/4) - cos(x)sin(π/4)] = 2 sin(x) cos(π/4), since the cos(x) terms cancel. Choice A is correct because it properly substitutes the angle values and simplifies accurately. Choice C incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values.

Question 7

Using the angle subtraction formula for sine, find the exact value of sin⁡(15∘)\sin(15^\circ)sin(15∘) by writing it as sin⁡(45∘−30∘)\sin(45^\circ-30^\circ)sin(45∘−30∘).

  1. 6−24\dfrac{\sqrt{6}-\sqrt{2}}{4}46​−2​​ (correct answer)
  2. 6+24\dfrac{\sqrt{6}+\sqrt{2}}{4}46​+2​​
  3. 24\dfrac{\sqrt{2}}{4}42​​
  4. 12\dfrac{1}{2}21​

Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(15°) where 15° = 45° - 30°, we substitute into sin(45° - 30°) = sin(45°)cos(30°) - cos(45°)sin(30°), giving (√2/2)(√3/2) - (√2/2)(1/2) = √6/4 - √2/4 = (√6 - √2)/4. Choice A is correct because it properly substitutes the angle values and simplifies accurately. Choice B has the wrong sign between the terms, using plus when the formula for sine subtraction requires minus. To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).

Question 8

Using the tangent angle addition formula, what is tan⁡(A+B)\tan(A+B)tan(A+B) in terms of tan⁡(A)\tan(A)tan(A) and tan⁡(B)\tan(B)tan(B)?

  1. tan⁡(A+B)=tan⁡(A)+tan⁡(B)1+tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)+\tan(B)}{1+\tan(A)\tan(B)}tan(A+B)=1+tan(A)tan(B)tan(A)+tan(B)​
  2. tan⁡(A+B)=tan⁡(A)−tan⁡(B)1−tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)-\tan(B)}{1-\tan(A)\tan(B)}tan(A+B)=1−tan(A)tan(B)tan(A)−tan(B)​
  3. tan⁡(A+B)=tan⁡(A)+tan⁡(B)1−tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)+\tan(B)}{1-\tan(A)\tan(B)}tan(A+B)=1−tan(A)tan(B)tan(A)+tan(B)​ (correct answer)
  4. tan⁡(A+B)=tan⁡(A)+tan⁡(B)\tan(A+B)=\tan(A)+\tan(B)tan(A+B)=tan(A)+tan(B)

Explanation: This question tests understanding of the angle addition and subtraction formulas for tangent. The tangent addition formula is tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), which shows that tangent of a sum involves both a numerator (sum of tangents) and a denominator (1 minus their product). Applying tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), we see that the denominator uses a minus sign for the addition formula, distinguishing it from the subtraction version. Choice C is correct because it correctly states the formula with proper signs. Choice D incorrectly claims tan(A + B) = tan(A) + tan(B), missing the essential denominator that makes the actual formula tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)). For tangent, remember the formulas have fractions: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), with the sign in the denominator opposite to the numerator (minus for addition, plus for subtraction). Common error: students try tan(A + B) = tan(A) + tan(B), but you can quickly verify this is wrong by trying A = B = 45°: tan(90°) is undefined but tan(45°) + tan(45°) = 1 + 1 = 2, which is finite.

Question 9

In proving that sin⁡(2θ)=2sin⁡θcos⁡θ\sin(2\theta) = 2\sin\theta\cos\thetasin(2θ)=2sinθcosθ using angle addition formulas, a student writes: sin⁡(2θ)=sin⁡(θ+θ)=sin⁡θcos⁡θ+cos⁡θsin⁡θ=2sin⁡θcos⁡θ\sin(2\theta) = \sin(\theta + \theta) = \sin\theta\cos\theta + \cos\theta\sin\theta = 2\sin\theta\cos\thetasin(2θ)=sin(θ+θ)=sinθcosθ+cosθsinθ=2sinθcosθ. What property of real number multiplication justifies the final step?

  1. The distributive property, since we can factor out the common factor of 222 from both terms
  2. The commutative property, since sin⁡θcos⁡θ=cos⁡θsin⁡θ\sin\theta\cos\theta = \cos\theta\sin\thetasinθcosθ=cosθsinθ, allowing us to combine like terms (correct answer)
  3. The associative property, since we can group the terms sin⁡θcos⁡θ\sin\theta\cos\thetasinθcosθ and cos⁡θsin⁡θ\cos\theta\sin\thetacosθsinθ together
  4. The identity property, since adding sin⁡θcos⁡θ\sin\theta\cos\thetasinθcosθ to itself preserves the original expression

Explanation: When working with trigonometric identities and algebraic manipulations, you need to identify which fundamental properties of real numbers justify each step in your reasoning. Let's examine what happens in the final step: sin⁡θcos⁡θ+cos⁡θsin⁡θ=2sin⁡θcos⁡θ\sin\theta\cos\theta + \cos\theta\sin\theta = 2\sin\theta\cos\thetasinθcosθ+cosθsinθ=2sinθcosθ. The key insight is recognizing that sin⁡θcos⁡θ\sin\theta\cos\thetasinθcosθ and cos⁡θsin⁡θ\cos\theta\sin\thetacosθsinθ are actually the same expression. Since multiplication of real numbers is commutative, sin⁡θcos⁡θ=cos⁡θsin⁡θ\sin\theta\cos\theta = \cos\theta\sin\thetasinθcosθ=cosθsinθ. This means you're adding two identical terms: sin⁡θcos⁡θ+sin⁡θcos⁡θ\sin\theta\cos\theta + \sin\theta\cos\thetasinθcosθ+sinθcosθ, which equals 2sin⁡θcos⁡θ2\sin\theta\cos\theta2sinθcosθ. The commutative property is what allows you to see these as like terms that can be combined. Choice A incorrectly describes the distributive property, which would involve factoring out a common factor from different terms—but we're not factoring here, we're combining like terms. Choice C mentions the associative property, which deals with how we group terms in addition or multiplication, not with recognizing that two products are equal. Choice D refers to the identity property, but adding a term to itself doesn't preserve the original expression—it doubles it. The correct answer is B because the commutative property of multiplication is what allows us to recognize that cos⁡θsin⁡θ=sin⁡θcos⁡θ\cos\theta\sin\theta = \sin\theta\cos\thetacosθsinθ=sinθcosθ, making them like terms. Study tip: When simplifying algebraic expressions involving products, always check if the commutative property reveals hidden like terms that can be combined.

Question 10

Using the sine angle addition formula, if sin⁡(A)=35\sin(A)=\dfrac{3}{5}sin(A)=53​ and cos⁡(A)=45\cos(A)=\dfrac{4}{5}cos(A)=54​, and sin⁡(B)=513\sin(B)=\dfrac{5}{13}sin(B)=135​ and cos⁡(B)=1213\cos(B)=\dfrac{12}{13}cos(B)=1312​ (with AAA and BBB in Quadrant I), what is sin⁡(A+B)\sin(A+B)sin(A+B)?

  1. 3665\dfrac{36}{65}6536​
  2. 5665\dfrac{56}{65}6556​ (correct answer)
  3. 1665\dfrac{16}{65}6516​
  4. 925+25169\dfrac{9}{25}+\dfrac{25}{169}259​+16925​

Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(A + B) where sin(A) = 3/5, cos(A) = 4/5, sin(B) = 5/13, cos(B) = 12/13, we substitute into sin(A + B) = sin(A)cos(B) + cos(A)sin(B), giving (3/5)(12/13) + (4/5)(5/13) = 36/65 + 20/65 = 56/65. Choice B is correct because it properly substitutes the angle values and simplifies accurately. Choice A makes an arithmetic error in the evaluation, calculating only the first product 36/65 instead of adding both products for 56/65. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.

Question 11

Which formula correctly gives the cosine subtraction identity cos⁡(A−B)\cos(A-B)cos(A−B) in terms of sin⁡\sinsin and cos⁡\coscos?

  1. cos⁡(A−B)=cos⁡(A)cos⁡(B)−sin⁡(A)sin⁡(B)\cos(A-B)=\cos(A)\cos(B)-\sin(A)\sin(B)cos(A−B)=cos(A)cos(B)−sin(A)sin(B)
  2. cos⁡(A−B)=cos⁡(A)cos⁡(B)+sin⁡(A)sin⁡(B)\cos(A-B)=\cos(A)\cos(B)+\sin(A)\sin(B)cos(A−B)=cos(A)cos(B)+sin(A)sin(B) (correct answer)
  3. cos⁡(A−B)=sin⁡(A)cos⁡(B)−cos⁡(A)sin⁡(B)\cos(A-B)=\sin(A)\cos(B)-\cos(A)\sin(B)cos(A−B)=sin(A)cos(B)−cos(A)sin(B)
  4. cos⁡(A−B)=cos⁡(A)−cos⁡(B)\cos(A-B)=\cos(A)-\cos(B)cos(A−B)=cos(A)−cos(B)

Explanation: This question tests understanding of the angle subtraction formula for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). For cosine subtraction specifically, we have cos(A - B) = cos(A)cos(B) + sin(A)sin(B), where the plus sign between the terms is crucial. Choice B is correct because it correctly states the formula with proper signs: cos(A - B) = cos(A)cos(B) + sin(A)sin(B). Choice A incorrectly has the wrong sign between the terms, using cos(A)cos(B) - sin(A)sin(B) which is actually the cosine addition formula for cos(A + B), not the subtraction formula. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.

Question 12

If sin⁡(x)=35\sin(x) = \frac{3}{5}sin(x)=53​ and cos⁡(y)=513\cos(y) = \frac{5}{13}cos(y)=135​ where xxx and yyy are both in the first quadrant, what is the value of sin⁡(x+y)\sin(x + y)sin(x+y)?

  1. 3365\frac{33}{65}6533​
  2. 5665\frac{56}{65}6556​
  3. 6365\frac{63}{65}6563​ (correct answer)
  4. 3965\frac{39}{65}6539​

Explanation: Using the sine addition formula: sin⁡(x+y)=sin⁡xcos⁡y+cos⁡xsin⁡y\sin(x + y) = \sin x \cos y + \cos x \sin ysin(x+y)=sinxcosy+cosxsiny. First, find the missing trigonometric values. Since sin⁡x=35\sin x = \frac{3}{5}sinx=53​ and xxx is in quadrant I, cos⁡x=1−sin⁡2x=1−925=45\cos x = \sqrt{1 - \sin^2 x} = \sqrt{1 - \frac{9}{25}} = \frac{4}{5}cosx=1−sin2x​=1−259​​=54​. Since cos⁡y=513\cos y = \frac{5}{13}cosy=135​ and yyy is in quadrant I, sin⁡y=1−cos⁡2y=1−25169=1213\sin y = \sqrt{1 - \cos^2 y} = \sqrt{1 - \frac{25}{169}} = \frac{12}{13}siny=1−cos2y​=1−16925​​=1312​. Therefore: sin⁡(x+y)=35⋅513+45⋅1213=1565+4865=6365\sin(x + y) = \frac{3}{5} \cdot \frac{5}{13} + \frac{4}{5} \cdot \frac{12}{13} = \frac{15}{65} + \frac{48}{65} = \frac{63}{65}sin(x+y)=53​⋅135​+54​⋅1312​=6515​+6548​=6563​. Option A results from calculation errors. Option B comes from incorrectly using cosine addition formula. Option D results from sign errors in the Pythagorean theorem applications.

Question 13

A calculus student needs to prove that ddx[sin⁡(x+h)]=cos⁡(x+h)\frac{d}{dx}[\sin(x + h)] = \cos(x + h)dxd​[sin(x+h)]=cos(x+h) and plans to use the sine addition formula as an intermediate step. Which expression correctly represents the application of sin⁡(A+B)=sin⁡Acos⁡B+cos⁡Asin⁡B\sin(A + B) = \sin A \cos B + \cos A \sin Bsin(A+B)=sinAcosB+cosAsinB to sin⁡(x+h)\sin(x + h)sin(x+h)?

  1. sin⁡(x+h)=sin⁡hcos⁡x+cos⁡hsin⁡x\sin(x + h) = \sin h \cos x + \cos h \sin xsin(x+h)=sinhcosx+coshsinx, which rearranges terms to facilitate the differentiation process
  2. sin⁡(x+h)=sin⁡xsin⁡h+cos⁡xcos⁡h\sin(x + h) = \sin x \sin h + \cos x \cos hsin(x+h)=sinxsinh+cosxcosh, which enables the use of product rule on each term separately
  3. sin⁡(x+h)=cos⁡xcos⁡h−sin⁡xsin⁡h\sin(x + h) = \cos x \cos h - \sin x \sin hsin(x+h)=cosxcosh−sinxsinh, which directly provides the derivative through term identification
  4. sin⁡(x+h)=sin⁡xcos⁡h+cos⁡xsin⁡h\sin(x + h) = \sin x \cos h + \cos x \sin hsin(x+h)=sinxcosh+cosxsinh, which allows separation of terms involving xxx and hhh for differentiation (correct answer)

Explanation: When working with trigonometric identities and derivatives, the sine addition formula is a fundamental tool that breaks down complex expressions into manageable parts. The formula sin⁡(A+B)=sin⁡Acos⁡B+cos⁡Asin⁡B\sin(A + B) = \sin A \cos B + \cos A \sin Bsin(A+B)=sinAcosB+cosAsinB allows you to expand any sine of a sum into terms that can be differentiated separately. For sin⁡(x+h)\sin(x + h)sin(x+h), you need to identify A=xA = xA=x and B=hB = hB=h, then apply the formula directly. This gives you sin⁡(x+h)=sin⁡xcos⁡h+cos⁡xsin⁡h\sin(x + h) = \sin x \cos h + \cos x \sin hsin(x+h)=sinxcosh+cosxsinh. This expansion is crucial for differentiation because it separates the variable xxx (which you're differentiating with respect to) from the parameter hhh, making it possible to apply derivative rules to each term individually. Choice A reverses the order of terms in the addition formula, writing sin⁡hcos⁡x+cos⁡hsin⁡x\sin h \cos x + \cos h \sin xsinhcosx+coshsinx instead of the correct sin⁡xcos⁡h+cos⁡xsin⁡h\sin x \cos h + \cos x \sin hsinxcosh+cosxsinh. While mathematically equivalent due to commutativity, this doesn't match the standard application of the sine addition formula. Choice B incorrectly uses sin⁡xsin⁡h+cos⁡xcos⁡h\sin x \sin h + \cos x \cos hsinxsinh+cosxcosh, which is actually the cosine addition formula cos⁡(x−h)\cos(x - h)cos(x−h), not the sine addition formula. Choice C gives cos⁡xcos⁡h−sin⁡xsin⁡h\cos x \cos h - \sin x \sin hcosxcosh−sinxsinh, which is the cosine addition formula for cos⁡(x+h)\cos(x + h)cos(x+h), completely wrong for expanding sin⁡(x+h)\sin(x + h)sin(x+h). Remember: always match the trigonometric function in your expansion to the function you're working with. Sine addition formulas expand sines, cosine addition formulas expand cosines.

Question 14

Using the cosine addition formula, what is the exact value of cos⁡(105∘)\cos(105^\circ)cos(105∘) if you rewrite it as cos⁡(60∘+45∘)\cos(60^\circ+45^\circ)cos(60∘+45∘)?

  1. 6+24\dfrac{\sqrt{6}+\sqrt{2}}{4}46​+2​​
  2. 6−24\dfrac{\sqrt{6}-\sqrt{2}}{4}46​−2​​
  3. −6−24-\dfrac{\sqrt{6}-\sqrt{2}}{4}−46​−2​​ (correct answer)
  4. 32+22\dfrac{\sqrt{3}}{2}+\dfrac{\sqrt{2}}{2}23​​+22​​

Explanation: This question tests understanding of the angle addition formulas for cosine. The cosine addition formula is cos(A + B) = cos(A)cos(B) - sin(A)sin(B), and the subtraction formula is cos(A - B) = cos(A)cos(B) + sin(A)sin(B), with the key difference being the sign between the two product terms (minus for addition, plus for subtraction). To find cos(105°) where 105° = 60° + 45°, we substitute into cos(60° + 45°) = cos(60°)cos(45°) - sin(60°)sin(45°), giving (1/2)(√2/2) - (√3/2)(√2/2) = √2/4 - √6/4 = (√2 - √6)/4 = - (√6 - √2)/4. Choice C is correct because it properly substitutes the angle values and simplifies accurately, including the negative sign due to the quadrant. Choice A has the wrong sign between the terms, using plus when the formula for cosine addition requires minus. To use these formulas for exact values, break unfamiliar angles into sums or differences of standard angles (like 75° = 45° + 30° or 15° = 45° - 30°), then apply the formula with the known exact trig values. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).

Question 15

Which statement best explains why sin⁡(A+B)≠sin⁡(A)+sin⁡(B)\sin(A+B)\ne \sin(A)+\sin(B)sin(A+B)=sin(A)+sin(B) in general, referring to the sine angle addition formula?

  1. Because sin⁡(A+B)\sin(A+B)sin(A+B) must include the cross terms sin⁡(A)cos⁡(B)\sin(A)\cos(B)sin(A)cos(B) and cos⁡(A)sin⁡(B)\cos(A)\sin(B)cos(A)sin(B), not just a sum of sines. (correct answer)
  2. Because sin⁡(A+B)=sin⁡(A)sin⁡(B)+cos⁡(A)cos⁡(B)\sin(A+B)=\sin(A)\sin(B)+\cos(A)\cos(B)sin(A+B)=sin(A)sin(B)+cos(A)cos(B) for all angles.
  3. Because sin⁡(A+B)=sin⁡(A)−sin⁡(B)\sin(A+B)=\sin(A)-\sin(B)sin(A+B)=sin(A)−sin(B) for all angles.
  4. Because sin⁡(A)+sin⁡(B)\sin(A)+\sin(B)sin(A)+sin(B) is always between −1-1−1 and 111, but sin⁡(A+B)\sin(A+B)sin(A+B) is not.

Explanation: This question tests understanding of why the angle addition formula for sine requires cross terms. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it explains why cross terms are necessary: the sine of a sum must include the cross terms sin(A)cos(B) and cos(A)sin(B), not just a sum of sines. Choice D incorrectly focuses on the range of values rather than the structural reason why the formula needs cross terms - the issue isn't about bounds but about the fundamental trigonometric relationship. Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1.

Question 16

A student claims that sin⁡(A+B)=sin⁡(A)+sin⁡(B)\sin(A+B)=\sin(A)+\sin(B)sin(A+B)=sin(A)+sin(B). Using the angle addition formula for sine, which statement best explains why this is not true in general?

  1. Because sin⁡(A+B)\sin(A+B)sin(A+B) must include cross terms sin⁡(A)cos⁡(B)\sin(A)\cos(B)sin(A)cos(B) and cos⁡(A)sin⁡(B)\cos(A)\sin(B)cos(A)sin(B), not just sin⁡(A)\sin(A)sin(A) and sin⁡(B)\sin(B)sin(B). (correct answer)
  2. Because sin⁡(A+B)=sin⁡(A)sin⁡(B)+cos⁡(A)cos⁡(B)\sin(A+B)=\sin(A)\sin(B)+\cos(A)\cos(B)sin(A+B)=sin(A)sin(B)+cos(A)cos(B) for all angles.
  3. Because sin⁡(A+B)\sin(A+B)sin(A+B) always equals 111 whenever AAA and BBB are acute.
  4. Because sin⁡(A)+sin⁡(B)\sin(A)+\sin(B)sin(A)+sin(B) is undefined whenever A+B=90∘A+B=90^\circA+B=90∘.

Explanation: This question tests understanding of the angle addition formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it explains why cross terms are necessary. Choice B confuses the sine formula with the cosine formula, using sin(A)sin(B) + cos(A)cos(B) when sine requires sin(A)cos(B) + cos(A)sin(B). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1. Key to angle addition formulas: memorize that both sine and cosine formulas involve four terms (two cross products), with sine having + for addition and - for subtraction, while cosine has - for addition and + for subtraction (opposite signs).

Question 17

Using the sine angle addition formula, find the exact value of sin⁡(75∘)\sin(75^\circ)sin(75∘) by writing 75∘=45∘+30∘75^\circ = 45^\circ + 30^\circ75∘=45∘+30∘.

  1. 6−24\dfrac{\sqrt{6}-\sqrt{2}}{4}46​−2​​
  2. 6+24\dfrac{\sqrt{6}+\sqrt{2}}{4}46​+2​​ (correct answer)
  3. 3+12\dfrac{\sqrt{3}+1}{2}23​+1​
  4. 22+12\dfrac{\sqrt{2}}{2}+\dfrac{1}{2}22​​+21​

Explanation: This question tests understanding of the angle addition formula for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. To find sin(75°), we recognize 75° = 45° + 30°, so sin(75°) = sin(45°)cos(30°) + cos(45°)sin(30°) = (√2/2)(√3/2) + (√2/2)(1/2) = √6/4 + √2/4 = (√6 + √2)/4. Choice B is correct because it properly substitutes the angle values and simplifies accurately to (√6 + √2)/4. Choice A incorrectly has (√6 - √2)/4, which would result from using the wrong sign between the terms or confusing this with a cosine formula. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.

Question 18

Which formula correctly gives sin⁡(A+B)\sin(A+B)sin(A+B) (and is not the incorrect idea sin⁡(A)+sin⁡(B)\sin(A)+\sin(B)sin(A)+sin(B))?

  1. sin⁡(A+B)=sin⁡(A)cos⁡(B)+cos⁡(A)sin⁡(B)\sin(A+B)=\sin(A)\cos(B)+\cos(A)\sin(B)sin(A+B)=sin(A)cos(B)+cos(A)sin(B) (correct answer)
  2. sin⁡(A+B)=sin⁡(A)sin⁡(B)+cos⁡(A)cos⁡(B)\sin(A+B)=\sin(A)\sin(B)+\cos(A)\cos(B)sin(A+B)=sin(A)sin(B)+cos(A)cos(B)
  3. sin⁡(A+B)=sin⁡(A)cos⁡(B)−cos⁡(A)sin⁡(B)\sin(A+B)=\sin(A)\cos(B)-\cos(A)\sin(B)sin(A+B)=sin(A)cos(B)−cos(A)sin(B)
  4. sin⁡(A+B)=sin⁡(A)+sin⁡(B)\sin(A+B)=\sin(A)+\sin(B)sin(A+B)=sin(A)+sin(B)

Explanation: This question tests understanding of the angle addition and subtraction formulas for sine. The sine addition formula is sin(A + B) = sin(A)cos(B) + cos(A)sin(B), which shows that sine of a sum is NOT simply sin(A) + sin(B) but requires cross terms involving both sine and cosine of each angle. If sin(A + B) simply equaled sin(A) + sin(B), then sin(30° + 60°) = sin(90°) = 1 would equal sin(30°) + sin(60°) = 1/2 + √3/2 ≈ 1.37, which is false, demonstrating that the formula requires the cross terms sin(A)cos(B) + cos(A)sin(B) instead. Choice A is correct because it correctly states the formula with proper signs. Choice D incorrectly claims sin(A + B) = sin(A) + sin(B), missing the essential cross terms that make the actual formula sin(A + B) = sin(A)cos(B) + cos(A)sin(B). Common error: students try sin(A + B) = sin(A) + sin(B), but you can quickly verify this is wrong by trying A = B = 45°: sin(90°) = 1 but sin(45°) + sin(45°) = √2/2 + √2/2 = √2 ≠ 1. Remember the pattern: sin formulas have sin·cos + cos·sin (same functions in each term), while cos formulas have cos·cos ∓ sin·sin (same functions in each term but different from numerator function), and the signs are opposite between sin and cos formulas.

Question 19

Two students are debating whether the identity cos⁡(A−B)=cos⁡Acos⁡B+sin⁡Asin⁡B\cos(A - B) = \cos A \cos B + \sin A \sin Bcos(A−B)=cosAcosB+sinAsinB can be derived from cos⁡(A+B)=cos⁡Acos⁡B−sin⁡Asin⁡B\cos(A + B) = \cos A \cos B - \sin A \sin Bcos(A+B)=cosAcosB−sinAsinB by substituting −B-B−B for BBB. Student 1 claims this works directly. Student 2 claims additional steps are needed. Who is correct and why?

  1. Student 1 is correct because substituting −B-B−B for BBB immediately gives the desired formula without additional justification
  2. Student 2 is correct because the substitution requires using the even-odd properties: cos⁡(−B)=cos⁡B\cos(-B) = \cos Bcos(−B)=cosB and sin⁡(−B)=−sin⁡B\sin(-B) = -\sin Bsin(−B)=−sinB (correct answer)
  3. Student 1 is correct because the cosine subtraction formula is just the negative of the cosine addition formula
  4. Student 2 is correct because the derivation requires proving that cos⁡(A+(−B))=cos⁡(A−B)\cos(A + (-B)) = \cos(A - B)cos(A+(−B))=cos(A−B) using angle measurement properties

Explanation: Student 2 is correct. While substituting −B-B−B for BBB in cos⁡(A+B)=cos⁡Acos⁡B−sin⁡Asin⁡B\cos(A + B) = \cos A \cos B - \sin A \sin Bcos(A+B)=cosAcosB−sinAsinB gives cos⁡(A+(−B))=cos⁡Acos⁡(−B)−sin⁡Asin⁡(−B)\cos(A + (-B)) = \cos A \cos(-B) - \sin A \sin(-B)cos(A+(−B))=cosAcos(−B)−sinAsin(−B), this requires using the even-odd properties of trigonometric functions to simplify: cos⁡(−B)=cos⁡B\cos(-B) = \cos Bcos(−B)=cosB (cosine is even) and sin⁡(−B)=−sin⁡B\sin(-B) = -\sin Bsin(−B)=−sinB (sine is odd). This yields cos⁡Acos⁡B−sin⁡A(−sin⁡B)=cos⁡Acos⁡B+sin⁡Asin⁡B\cos A \cos B - \sin A(-\sin B) = \cos A \cos B + \sin A \sin BcosAcosB−sinA(−sinB)=cosAcosB+sinAsinB. Option A ignores these necessary steps. Option C is incorrect about the relationship. Option D overcomplicates the required justification.

Question 20

Use the tangent angle addition formula to write tan⁡(A+B)\tan(A+B)tan(A+B) in terms of tan⁡(A)\tan(A)tan(A) and tan⁡(B)\tan(B)tan(B).

  1. tan⁡(A+B)=tan⁡(A)+tan⁡(B)1−tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)+\tan(B)}{1-\tan(A)\tan(B)}tan(A+B)=1−tan(A)tan(B)tan(A)+tan(B)​ (correct answer)
  2. tan⁡(A+B)=tan⁡(A)+tan⁡(B)1+tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)+\tan(B)}{1+\tan(A)\tan(B)}tan(A+B)=1+tan(A)tan(B)tan(A)+tan(B)​
  3. tan⁡(A+B)=tan⁡(A)−tan⁡(B)1−tan⁡(A)tan⁡(B)\tan(A+B)=\dfrac{\tan(A)-\tan(B)}{1-\tan(A)\tan(B)}tan(A+B)=1−tan(A)tan(B)tan(A)−tan(B)​
  4. tan⁡(A+B)=tan⁡(A)+tan⁡(B)\tan(A+B)=\tan(A)+\tan(B)tan(A+B)=tan(A)+tan(B)

Explanation: This question tests understanding of the angle addition formula for tangent. The tangent addition formula is tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), which shows that tangent of a sum involves both a numerator (sum of tangents) and a denominator (1 minus their product). The formula has a fraction structure where the numerator contains the sum tan(A) + tan(B), and the denominator contains 1 - tan(A)tan(B), with a minus sign being crucial for the addition formula. Choice A is correct because it correctly states the formula with proper signs: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)). Choice B incorrectly has the wrong sign in the denominator, using 1 + tan(A)tan(B) when the formula for tan(A + B) requires the denominator to be 1 - tan(A)tan(B). For tangent, remember the formulas have fractions: tan(A + B) = (tan(A) + tan(B))/(1 - tan(A)tan(B)), with the sign in the denominator opposite to the numerator (minus for addition, plus for subtraction).