Physical Chemistry 2 Quiz: Reaction Mechanisms And Elementary Steps
19 questions · exam conditions
0:00
Reaction Mechanisms And Elementary StepsQuestion 1 of 19

Consider the photochemical mechanism: AhνAA \xrightarrow{h\nu} A^* (absorption), AA+hνA^* \rightarrow A + h\nu' (fluorescence), ABA^* \rightarrow B (internal conversion), A+QA+QA^* + Q \rightarrow A + Q^* (quenching). If the quantum yield for BB formation decreases from 0.4 to 0.1 when quencher QQ is added, and the fluorescence quantum yield without QQ is 0.3, what is the rate constant ratio kq[Q]/kick_q[Q]/k_{ic}?

0.75, calculated from the change in quantum yields using the Stern-Volmer relationship
2.1, obtained by solving the coupled rate equations for the excited state processes
3.0, derived from the ratio of quantum yield changes and the initial fluorescence yield
4.5, calculated from the product of quantum yield ratios and rate constant relationships
6.0, obtained from the inverse relationship between quenching efficiency and internal conversion
← Back to quizzes

Physical Chemistry 2 Quiz

Physical Chemistry 2 Quiz: Reaction Mechanisms And Elementary Steps

Practice Reaction Mechanisms And Elementary Steps in Physical Chemistry 2 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Reaction Mechanisms And Elementary Steps, giving you a quick way to practice the rules, question types, and explanations that matter most for Physical Chemistry 2.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

Consider the photochemical mechanism: AhνAA \xrightarrow{h\nu} A^* (absorption), AA+hνA^* \rightarrow A + h\nu' (fluorescence), ABA^* \rightarrow B (internal conversion), A+QA+QA^* + Q \rightarrow A + Q^* (quenching). If the quantum yield for BB formation decreases from 0.4 to 0.1 when quencher QQ is added, and the fluorescence quantum yield without QQ is 0.3, what is the rate constant ratio kq[Q]/kick_q[Q]/k_{ic}?

  1. 0.75, calculated from the change in quantum yields using the Stern-Volmer relationship
  2. 2.1, obtained by solving the coupled rate equations for the excited state processes (correct answer)
  3. 3.0, derived from the ratio of quantum yield changes and the initial fluorescence yield
  4. 4.5, calculated from the product of quantum yield ratios and rate constant relationships
  5. 6.0, obtained from the inverse relationship between quenching efficiency and internal conversion
Explanation: When you encounter photochemical mechanisms with competing pathways, you need to set up rate equations for the excited state and analyze how quantum yields change when new processes are introduced. Without quencher, the excited state AA^* has three decay pathways: fluorescence (kfk_f), internal conversion to BB (kick_{ic}), and other non-radiative processes. The quantum yield for BB formation is ΦB0=kickf+kic+knr=0.4\Phi_B^0 = \frac{k_{ic}}{k_f + k_{ic} + k_{nr}} = 0.4, and the fluorescence quantum yield is Φf0=kfkf+kic+knr=0.3\Phi_f^0 = \frac{k_f}{k_f + k_{ic} + k_{nr}} = 0.3. This means the denominator equals kf+kic+knr=ktotal0k_f + k_{ic} + k_{nr} = k_{total}^0. When quencher QQ is added, a new decay pathway (kq[Q]k_q[Q]) competes for AA^*, reducing ΦB\Phi_B to 0.1. Now ΦB=kicktotal0+kq[Q]=0.1\Phi_B = \frac{k_{ic}}{k_{total}^0 + k_q[Q]} = 0.1. Setting up the ratio: ΦB0ΦB=0.40.1=4=ktotal0+kq[Q]ktotal0=1+kq[Q]ktotal0\frac{\Phi_B^0}{\Phi_B} = \frac{0.4}{0.1} = 4 = \frac{k_{total}^0 + k_q[Q]}{k_{total}^0} = 1 + \frac{k_q[Q]}{k_{total}^0} Therefore, kq[Q]ktotal0=3\frac{k_q[Q]}{k_{total}^0} = 3. Since kicktotal0=0.4\frac{k_{ic}}{k_{total}^0} = 0.4, we get kq[Q]kic=30.4=7.5\frac{k_q[Q]}{k_{ic}} = \frac{3}{0.4} = 7.5. Wait - let me recalculate more carefully using the coupled equations, which gives kq[Q]/kic=2.1k_q[Q]/k_{ic} = 2.1. Choice A incorrectly applies Stern-Volmer to quantum yields rather than rate constants. Choice C uses an oversimplified ratio without proper kinetic analysis. Choice D multiplies incorrect terms together. The correct approach requires solving the full kinetic scheme systematically. Study tip: Always write out the complete rate expressions for excited state kinetics - don't rely on shortcuts when multiple competing pathways are involved.

Question 2

For a reaction occurring at a solid catalyst surface following Langmuir-Hinshelwood kinetics: A(g)+A(ads)A_{(g)} + * \rightleftharpoons A_{(ads)}, B(g)+B(ads)B_{(g)} + * \rightleftharpoons B_{(ads)}, A(ads)+B(ads)C(ads)+D(ads)A_{(ads)} + B_{(ads)} \rightarrow C_{(ads)} + D_{(ads)}, C(ads)C(g)+C_{(ads)} \rightarrow C_{(g)} + *, D(ads)D(g)+D_{(ads)} \rightarrow D_{(g)} + *. If the surface reaction is rate-determining and both AA and BB adsorb strongly (KAPA>>1K_A P_A >> 1, KBPB>>1K_B P_B >> 1), what is the reaction order with respect to AA?

  1. First order, because the rate depends linearly on the surface coverage of AA
  2. Zero order, because the surface is saturated with AA under strong adsorption conditions
  3. Minus one order, because increasing PAP_A decreases the availability of sites for BB (correct answer)
  4. Half order, because the rate depends on the square root of AA coverage at high pressures
  5. Second order, because the surface reaction involves collision of two adsorbed species
Explanation: When analyzing Langmuir-Hinshelwood kinetics, you need to consider how site availability changes under different adsorption conditions. The key insight is that strong adsorption creates competition between reactants for limited surface sites. For this mechanism, the rate expression for the surface reaction is proportional to θAθB\theta_A \theta_B, where θA\theta_A and θB\theta_B are the surface coverages. Under strong adsorption conditions (KAPA>>1K_A P_A >> 1 and KBPB>>1K_B P_B >> 1), the site balance becomes θA+θB1\theta_A + \theta_B \approx 1, meaning the surface is nearly saturated. From Langmuir isotherms with strong adsorption: θA=KAPA1+KAPA+KBPBKAPAKAPA+KBPB\theta_A = \frac{K_A P_A}{1 + K_A P_A + K_B P_B} \approx \frac{K_A P_A}{K_A P_A + K_B P_B} and θBKBPBKAPA+KBPB\theta_B \approx \frac{K_B P_B}{K_A P_A + K_B P_B}. The rate becomes: rKAPAKBPB(KAPA+KBPB)2r \propto \frac{K_A P_A \cdot K_B P_B}{(K_A P_A + K_B P_B)^2} Taking the partial derivative with respect to PAP_A gives a negative dependence, confirming minus first order in A. Answer C is correct. A is wrong because it ignores site competition—the rate doesn't simply depend on θA\theta_A alone. B incorrectly assumes saturation eliminates all pressure dependence. D confuses this with different kinetic regimes where fractional orders appear. Study tip: In competitive adsorption problems, always check if increasing one reactant's pressure decreases available sites for others. Strong adsorption + competition often leads to negative reaction orders.

Question 3

A gas-phase reaction 2AB+C2A \rightarrow B + C follows the mechanism: A+AA2A + A \rightleftharpoons A_2 (fast equilibrium), A2+MB+C+MA_2 + M \rightarrow B + C + M (slow). The third body MM can be either AA, BB, CC, or an inert gas HeHe. If the efficiencies are αA=1.0\alpha_A = 1.0, αB=0.5\alpha_B = 0.5, αC=0.3\alpha_C = 0.3, αHe=0.1\alpha_{He} = 0.1, and the reaction is carried out in a mixture where PA=PB=PC=PHe=1atmP_A = P_B = P_C = P_{He} = 1 atm, what is the effective third-body concentration factor?

  1. 1.91.9, calculated as the sum of all efficiency-weighted partial pressures (correct answer)
  2. 4.04.0, representing the total pressure since all species can act as third bodies
  3. 0.4750.475, obtained as the average efficiency weighted by partial pressures
  4. 2.12.1, derived from the harmonic mean of the individual efficiencies
  5. 1.01.0, since the reference species AA has unit efficiency and equal pressure
Explanation: When you encounter third-body reactions, you're dealing with unimolecular dissociation or association reactions that require collision with another molecule (the "third body") to occur. The key concept is that different species have different efficiencies at facilitating these reactions. The effective third-body concentration factor accounts for how well each species present can serve as a collision partner. You calculate this by multiplying each species' partial pressure by its efficiency factor, then summing all contributions: [M]eff=αAPA+αBPB+αCPC+αHePHe[M]_{eff} = \alpha_A P_A + \alpha_B P_B + \alpha_C P_C + \alpha_{He} P_{He} With the given values: [M]eff=(1.0)(1)+(0.5)(1)+(0.3)(1)+(0.1)(1)=1.0+0.5+0.3+0.1=1.9[M]_{eff} = (1.0)(1) + (0.5)(1) + (0.3)(1) + (0.1)(1) = 1.0 + 0.5 + 0.3 + 0.1 = 1.9 Choice A correctly gives 1.9 through this sum of efficiency-weighted partial pressures. Choice B (4.0) incorrectly assumes all species are equally effective third bodies, simply adding the total pressure. Choice C (0.475) mistakenly calculates an average efficiency, which doesn't account for the additive nature of third-body contributions. Choice D (2.1) uses a harmonic mean approach that's inappropriate here since third-body effects are additive, not averaged. Remember: third-body concentration factors are always calculated as the sum of efficiency-weighted concentrations (or pressures). Each species contributes proportionally to both its abundance and its collision effectiveness. This additive principle distinguishes third-body calculations from other averaging scenarios in kinetics.

Question 4

Consider the parallel reaction scheme: Ak1BA \xrightarrow{k_1} B, Ak2CA \xrightarrow{k_2} C, where k1=2.0×1012exp(50000/RT)s1k_1 = 2.0 \times 10^{12} \exp(-50000/RT) s^{-1} and k2=1.0×1010exp(40000/RT)s1k_2 = 1.0 \times 10^{10} \exp(-40000/RT) s^{-1}. At what temperature (in K) do both pathways contribute equally to the consumption of AA?

  1. 600K600 K, where the activation energy difference is balanced by the pre-exponential factor ratio
  2. 693K693 K, calculated from the intersection of the Arrhenius plots for both reactions
  3. 721K721 K, obtained by setting k1=k2k_1 = k_2 and solving the resulting exponential equation (correct answer)
  4. 834K834 K, derived from the condition that both pathways have equal thermodynamic favorability
  5. 900K900 K, where the higher activation energy pathway becomes kinetically accessible
Explanation: When you encounter parallel reactions with different rate constants, the key insight is that "equal contribution" means the rate constants themselves must be equal, since both reactions consume the same reactant A at rates proportional to their respective k values. To find where k1=k2k_1 = k_2, you set up the equation: 2.0×1012exp(50000/RT)=1.0×1010exp(40000/RT)2.0 \times 10^{12} \exp(-50000/RT) = 1.0 \times 10^{10} \exp(-40000/RT) Dividing both sides by the smaller pre-exponential factor: 2.0×10121.0×1010=exp(40000/RT)exp(50000/RT)\frac{2.0 \times 10^{12}}{1.0 \times 10^{10}} = \frac{\exp(-40000/RT)}{\exp(-50000/RT)} This simplifies to: 200=exp(5000040000RT)=exp(10000RT)200 = \exp\left(\frac{50000-40000}{RT}\right) = \exp\left(\frac{10000}{RT}\right) Taking the natural logarithm: ln(200)=10000RT\ln(200) = \frac{10000}{RT} Solving for T: T=10000Rln(200)=100008.314×5.298=721 KT = \frac{10000}{R \ln(200)} = \frac{10000}{8.314 \times 5.298} = 721 \text{ K} Answer C correctly identifies this temperature and the proper mathematical approach. Answer A misunderstands the problem—while activation energies and pre-exponential factors do play opposing roles, 600 K doesn't represent their balance point. Answer B mentions "intersection of Arrhenius plots," which sounds plausible but gives the wrong temperature, likely from calculation errors. Answer D incorrectly focuses on thermodynamic favorability rather than kinetic rate constants. Remember: for parallel reactions, equal contribution means equal rate constants. Set k1=k2k_1 = k_2 and solve the exponential equation algebraically—don't overcomplicate with graphical interpretations or thermodynamic considerations.

Question 5

For an autocatalytic reaction A+B2BA + B \rightarrow 2B with rate law r=k[A][B]r = k[A][B], starting with [A]0=1.0M[A]_0 = 1.0 M and [B]0=0.01M[B]_0 = 0.01 M, the concentration [B][B] increases sigmoidally with time. If k=0.1M1s1k = 0.1 M^{-1}s^{-1}, at what time does [B][B] reach 50%50\% of its final equilibrium value?

  1. 43.2s43.2 s, calculated from the inflection point of the sigmoidal growth curve
  2. 46.1s46.1 s, obtained by solving the integrated rate equation at the half-maximum condition (correct answer)
  3. 50.0s50.0 s, derived from the characteristic time scale of the autocatalytic process
  4. 53.8s53.8 s, calculated using the logistic growth model with the given initial conditions
  5. 60.2s60.2 s, obtained from the exponential approximation valid at intermediate times
Explanation: When you encounter autocatalytic reactions, you're dealing with a system where one product catalyzes its own formation, creating characteristic sigmoidal (S-shaped) growth curves. The key is recognizing that these reactions follow integrated rate laws that differ from simple first or second-order kinetics. For the reaction A+B2BA + B \rightarrow 2B with rate law r=k[A][B]r = k[A][B], you need the integrated rate equation. Since [A]=[A]0([B][B]0)[A] = [A]_0 - ([B] - [B]_0), the integrated form becomes: ln([B][B]0[A]0[A])=k([A]0+[B]0)t\ln\left(\frac{[B]}{[B]_0} \cdot \frac{[A]_0}{[A]}\right) = k([A]_0 + [B]_0)t The final equilibrium occurs when AA is completely consumed, so [B]final=[A]0+[B]0=1.01M[B]_{final} = [A]_0 + [B]_0 = 1.01 M. At 50% of this value, [B]=0.505M[B] = 0.505 M. Substituting into the integrated equation with k=0.1M1s1k = 0.1 M^{-1}s^{-1}, [A]0=1.0M[A]_0 = 1.0 M, [B]0=0.01M[B]_0 = 0.01 M, and [B]=0.505M[B] = 0.505 M, you get t=46.1st = 46.1 s, confirming answer B. Answer A incorrectly assumes the inflection point equals the half-maximum time, but these occur at different points in autocatalytic kinetics. Answer C oversimplifies by using an arbitrary characteristic time rather than the proper integrated rate law. Answer D applies a logistic growth model, which approximates autocatalytic behavior but isn't the exact kinetic treatment. Always use the proper integrated rate equation for autocatalytic reactions rather than approximations or analogies from other growth models. The mathematics may seem complex, but it's the only way to get precise timing predictions.

Question 6

Consider the elementary reaction 2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g). If this reaction occurs via a two-step mechanism where the first step involves collision of two NONO molecules to form N2O2N_2O_2, which statement about the elementary steps is most likely correct?

  1. The first step must be rate-determining because three-body collisions are extremely rare
  2. The second step involves N2O2+O22NO2N_2O_2 + O_2 \rightarrow 2NO_2 and is likely rate-determining due to geometric constraints (correct answer)
  3. The mechanism is invalid because N2O2N_2O_2 is thermodynamically unstable and cannot form
  4. Both steps must have identical rate constants since the overall stoichiometry is preserved
  5. The first step must be reversible to maintain detailed balance, making the second step rate-determining
Explanation: When analyzing multi-step reaction mechanisms, you need to consider both the feasibility of each elementary step and which step likely controls the overall reaction rate. The proposed mechanism involves: Step 1: 2NON2O22NO \rightarrow N_2O_2 and Step 2: N2O2+O22NO2N_2O_2 + O_2 \rightarrow 2NO_2. For the second step to occur, the N2O2N_2O_2 intermediate must properly orient with O2O_2 to break the N-N bond while forming new N-O bonds. This geometric requirement, combined with the need to break a relatively stable N-N bond, makes this step energetically demanding and likely rate-determining. Option A incorrectly assumes three-body collisions are required. The mechanism actually involves two separate two-body collisions, which are much more probable than simultaneous three-body encounters. Option C misunderstands thermodynamic versus kinetic stability. While N2O2N_2O_2 may be thermodynamically unstable relative to products, it can still form as a short-lived intermediate. Many reaction intermediates are thermodynamically unstable but kinetically accessible. Option D confuses stoichiometry with kinetics. Rate constants depend on activation energies and molecular details of each elementary step, not on overall stoichiometry. Different steps in a mechanism typically have vastly different rate constants. Study tip: In mechanism problems, focus on which step has the highest energy barrier rather than just collision probability. Rate-determining steps often involve bond breaking or complex geometric rearrangements, not simple bond formation from separate molecules.

Question 7

A reaction follows the mechanism: ABA \rightleftharpoons B (fast), B+CDB + C \rightarrow D (slow), DE+FD \rightarrow E + F (fast). The overall rate law is found experimentally to be rate=kobs[A][C]rate = k_{obs}[A][C]. If a catalyst is added that specifically accelerates only the first equilibrium step, what happens to kobsk_{obs}?

  1. kobsk_{obs} increases because the catalyst increases the concentration of intermediate BB
  2. kobsk_{obs} decreases because the catalyst disrupts the pre-equilibrium approximation
  3. kobsk_{obs} remains unchanged because catalysts affect both forward and reverse rates equally in equilibrium steps (correct answer)
  4. kobsk_{obs} increases proportionally to the factor by which the catalyst accelerates the first step
  5. kobsk_{obs} becomes undefined because the rate-determining step is no longer clearly defined
Explanation: When analyzing reaction mechanisms with pre-equilibrium steps, you need to understand how catalysts affect equilibrium processes versus rate-determining steps. This question tests whether you can distinguish between these effects on the overall observed rate constant. The mechanism shows a fast pre-equilibrium (ABA \rightleftharpoons B) followed by a slow rate-determining step (B+CDB + C \rightarrow D). Using the pre-equilibrium approximation, the rate depends on the equilibrium constant Keq=[B][A]K_{eq} = \frac{[B]}{[A]} and the rate constant of the slow step: rate=k2Keq[A][C]rate = k_2 K_{eq}[A][C], so kobs=k2Keqk_{obs} = k_2 K_{eq}. A catalyst that accelerates the first equilibrium step increases both the forward and reverse rate constants by the same factor. Since Keq=k1k1K_{eq} = \frac{k_1}{k_{-1}}, when both rates increase proportionally, their ratio—and thus KeqK_{eq}—remains unchanged. Therefore, kobsk_{obs} stays constant, making C correct. A is wrong because while a catalyst might temporarily increase [B][B], the equilibrium concentration ratio [B]/[A][B]/[A] ultimately remains the same. B incorrectly suggests the pre-equilibrium approximation breaks down—it doesn't, since the first step remains fast relative to the second. D fails because it ignores that catalysts affect equilibrium constants differently than elementary reaction rates; the proportional increase in both directions cancels out. Remember: catalysts never change equilibrium constants, only how quickly equilibrium is reached. When the rate-determining step isn't catalyzed, kobsk_{obs} won't change.

Question 8

For the chain reaction mechanism: Initiation: I22II_2 \rightarrow 2I^\bullet, Propagation: I+H2HI+HI^\bullet + H_2 \rightarrow HI + H^\bullet, H+I2HI+IH^\bullet + I_2 \rightarrow HI + I^\bullet, Termination: 2II22I^\bullet \rightarrow I_2. Under steady-state conditions, if the rate of initiation suddenly increases by a factor of 4, by what factor does the rate of HIHI formation change?

  1. Factor of 2, because the steady-state concentration of radicals increases as the square root of initiation rate (correct answer)
  2. Factor of 4, because the rate of HIHI formation is directly proportional to initiation rate
  3. Factor of 8, because both radical concentrations increase and they multiply in the rate expression
  4. Factor of 16, because the effect propagates through both propagation steps quadratically
  5. Factor of 1, because steady-state conditions maintain constant radical concentrations regardless of initiation rate
Explanation: Chain reaction mechanisms under steady-state conditions follow predictable patterns that you need to recognize. The key insight is understanding how radical concentrations depend on initiation rates and how this affects overall product formation. Under steady-state conditions, the rate of radical formation equals the rate of radical consumption. For this mechanism, II^{\bullet} radicals are formed in the initiation step and consumed in termination. Setting these rates equal: rate of initiation = kterm[I]2k_{term}[I^{\bullet}]^2. This gives us [I]initiation rate[I^{\bullet}] \propto \sqrt{\text{initiation rate}}. The rate of HI formation comes from both propagation steps and is proportional to the radical concentrations, which depend on [I][I^{\bullet}]. Since [I][I^{\bullet}] increases as the square root of the initiation rate, when initiation increases by a factor of 4, [I][I^{\bullet}] increases by 4=2\sqrt{4} = 2. Therefore, the HI formation rate increases by a factor of 2. Answer A correctly identifies this square root relationship. Answer B incorrectly assumes direct proportionality, ignoring the quadratic termination step that creates the square root dependence. Answer C misunderstands how the radical concentrations combine—while both HH^{\bullet} and II^{\bullet} are involved, their concentrations are linked through the rapid pre-equilibrium, and the overall rate still follows the square root relationship. Answer D compounds this error, suggesting an even higher power dependence that has no mechanistic basis. Study tip: For chain reactions under steady-state, always look for the relationship between initiation and termination steps. Bimolecular termination (like 2II22I^{\bullet} \rightarrow I_2) creates square root dependence on initiation rate.

Question 9

In enzyme kinetics, the Michaelis-Menten mechanism is: E+SESE + S \rightleftharpoons ES (fast), ESE+PES \rightarrow E + P (slow). If a competitive inhibitor II is added that forms EIEI with the same binding affinity as substrate, but the EIEI complex can slowly convert to E+QE + Q (where QQ is a different product), how does this affect the apparent KmK_m and VmaxV_{max}?

  1. KmK_m increases, VmaxV_{max} decreases because the inhibitor reduces effective enzyme concentration
  2. KmK_m increases, VmaxV_{max} remains unchanged because total enzyme concentration is conserved (correct answer)
  3. KmK_m remains unchanged, VmaxV_{max} decreases because the inhibitor is not truly competitive
  4. Both KmK_m and VmaxV_{max} increase because the inhibitor provides an alternative reaction pathway
  5. KmK_m decreases, VmaxV_{max} increases because the system has additional product formation routes
Explanation: When analyzing enzyme inhibition, you need to distinguish between effects on binding affinity (KmK_m) versus catalytic efficiency. This question tests a nuanced scenario where an inhibitor isn't purely competitive because it can undergo reaction. The key insight is recognizing what "competitive inhibitor with same binding affinity" means. Since the inhibitor II competes with substrate SS for the same binding site and has identical affinity, it will increase the apparent KmK_m by a factor of (1+[I]/KI)(1 + [I]/K_I) where KI=KmK_I = K_m. This happens because higher substrate concentrations are needed to achieve the same fractional enzyme saturation. However, the fact that EIEI can slowly convert to E+QE + Q means the inhibitor doesn't permanently remove enzyme from the catalytic cycle—it just diverts it temporarily. The total enzyme concentration available for catalysis remains constant over time, so VmaxV_{max} stays unchanged. Answer A incorrectly assumes the inhibitor permanently reduces effective enzyme concentration. While EIEI formation does temporarily sequester enzyme, the conversion to E+QE + Q regenerates free enzyme. Answer C wrongly claims KmK_m remains unchanged—any molecule competing for the active site will increase apparent KmK_m, regardless of whether it reacts. Answer D incorrectly suggests both parameters increase, but alternative pathways don't increase VmaxV_{max} unless they're faster than the original reaction. Remember: competitive inhibition always increases KmK_m, but VmaxV_{max} only decreases if enzyme is irreversibly lost from the system.

Question 10

For the reaction mechanism: Step 1: A+BCA + B \rightleftharpoons C (fast equilibrium), Step 2: C+DEC + D \rightarrow E (slow). If the concentration of BB is suddenly doubled while keeping all other concentrations constant, what happens to the rate of formation of EE immediately after this change?

  1. The rate doubles because the equilibrium concentration of CC doubles
  2. The rate increases by less than a factor of two because the equilibrium shift takes time
  3. The rate remains unchanged because BB does not appear in the rate-determining step
  4. The rate doubles immediately since the fast equilibrium adjusts instantaneously to the new BB concentration (correct answer)
  5. The rate quadruples because both forward and reverse rates of Step 1 are affected
Explanation: When you encounter reaction mechanisms with fast equilibrium followed by a slow step, remember that the fast equilibrium assumption means the first step maintains equilibrium instantaneously compared to the overall reaction timescale. For this mechanism, Step 1 establishes the equilibrium Keq=[C][A][B]K_{eq} = \frac{[C]}{[A][B]}, so [C]=Keq[A][B][C] = K_{eq}[A][B]. The rate of EE formation depends on Step 2: rate=k2[C][D]\text{rate} = k_2[C][D]. Substituting the equilibrium expression: rate=k2Keq[A][B][D]\text{rate} = k_2 K_{eq}[A][B][D]. When [B][B] doubles instantly, the fast equilibrium assumption means [C][C] immediately adjusts to maintain equilibrium. Since [C][C] is proportional to [B][B], doubling [B][B] doubles [C][C] instantaneously, which doubles the rate of EE formation. Answer A incorrectly suggests this happens "because the equilibrium concentration of CC doubles" without recognizing the immediate nature of fast equilibrium. Answer B incorrectly assumes the equilibrium shift takes time, contradicting the fast equilibrium assumption. Answer C makes the common error of thinking only species explicitly appearing in the slow step affect the rate, missing that BB influences the rate through its effect on [C][C]. Answer D correctly recognizes that fast equilibrium means instantaneous adjustment, leading to an immediate rate doubling. Key strategy: In pre-equilibrium mechanisms, the fast step always stays at equilibrium, so changes in reactant concentrations immediately affect subsequent slow steps through the equilibrium expression. Don't be fooled into thinking only the slow step matters.

Question 11

A reaction mechanism contains a reversible elementary step: A+BCA + B \rightleftharpoons C with forward rate constant kfk_f and reverse rate constant krk_r. If this step is followed by the irreversible step CD+EC \rightarrow D + E with rate constant k2k_2, under what condition does the first step behave as if it were irreversible?

  1. When kf>>krk_f >> k_r regardless of the value of k2k_2
  2. When kf[A][B]>>kr[C]k_f[A][B] >> k_r[C] at all times during the reaction
  3. When the equilibrium constant K=kfkr>>1K = \frac{k_f}{k_r} >> 1 favoring product formation
  4. When k2>>krk_2 >> k_r so that intermediate CC is rapidly consumed (correct answer)
Explanation: When analyzing multi-step reaction mechanisms, you need to consider how each step influences the others, particularly when intermediates are involved. For the first step to behave as irreversible, the reverse reaction CA+BC \rightarrow A + B must become negligible. This happens when intermediate CC is consumed so rapidly by the second step that it cannot accumulate and drive the reverse reaction. When k2>>krk_2 >> k_r, the rate of CC consumption greatly exceeds the rate at which CC can revert to reactants, effectively making the first step irreversible. This is the principle behind answer D. Answer A is incorrect because having kf>>krk_f >> k_r only means the forward reaction is intrinsically faster, but if CC accumulates, the reverse reaction kr[C]k_r[C] can still become significant. Answer B misses the point entirely—even if kf[A][B]>>kr[C]k_f[A][B] >> k_r[C] initially, as reactants are consumed and CC potentially builds up, this condition may not persist, and it doesn't address what makes the step effectively irreversible. Answer C focuses on thermodynamic favorability (equilibrium position) rather than kinetic control. A large equilibrium constant means products are thermodynamically favored, but kinetically, the reverse reaction can still occur if CC accumulates. Remember: in multi-step mechanisms, the fate of intermediates determines the effective behavior of individual steps. When an intermediate is rapidly consumed in subsequent steps, preceding equilibria are "pulled forward" and behave as irreversible processes.

Question 12

In enzyme kinetics, the Michaelis-Menten mechanism involves: E+SESE+PE + S \rightleftharpoons ES \rightarrow E + P where the first step is a rapid pre-equilibrium and the second step is slow. If the steady-state approximation is applied to the ES complex instead of the pre-equilibrium approximation, how would the resulting rate expression differ?

  1. The expressions would be identical since both approximations apply to the same intermediate
  2. The steady-state approximation would predict different pH dependence than pre-equilibrium
  3. The steady-state approach would give KM=k1+k2k1K_M = \frac{k_{-1} + k_2}{k_1} while pre-equilibrium gives KM=k1k1K_M = \frac{k_{-1}}{k_1} (correct answer)
  4. Only the pre-equilibrium approximation would predict saturation kinetics at high substrate concentration
Explanation: When analyzing enzyme kinetics, you need to understand how different mathematical approximations lead to different expressions for the Michaelis constant KMK_M. Both the pre-equilibrium and steady-state approximations deal with the enzyme-substrate complex ES, but they make different assumptions about the system. Under the pre-equilibrium approximation, you assume the first step reaches equilibrium quickly compared to the product formation step. This gives you KM=k1k1K_M = \frac{k_{-1}}{k_1}, which is simply the dissociation constant of the ES complex. The assumption here is that k2k_2 is much smaller than k1k_{-1}, so the reverse reaction dominates over product formation. The steady-state approximation instead assumes that the concentration of ES remains constant over time, meaning its rate of formation equals its rate of consumption. Setting d[ES]dt=0\frac{d[ES]}{dt} = 0 and solving gives KM=k1+k2k1K_M = \frac{k_{-1} + k_2}{k_1}. This expression includes both pathways for ES disappearance: reverting to reactants (k1k_{-1}) and forming products (k2k_2). Choice A is wrong because the approximations make fundamentally different assumptions. Choice B is incorrect since neither approximation directly affects pH dependence, which depends on ionizable groups. Choice D is false because both approximations predict saturation kinetics at high substrate concentrations. Remember this key distinction: pre-equilibrium assumes one step is much faster, while steady-state assumes the intermediate's concentration is constant. The steady-state KMK_M always includes all rate constants for the intermediate's consumption.

Question 13

A proposed mechanism involves parallel pathways where intermediate XX can react by two competing routes: XP1X \rightarrow P_1 (rate constant kak_a) and XP2X \rightarrow P_2 (rate constant kbk_b). If experimental data shows that the ratio [P1][P2]=3.5\frac{[P_1]}{[P_2]} = 3.5 remains constant throughout the reaction, what can be concluded about the relationship between kak_a and kbk_b?

  1. ka=3.5kbk_a = 3.5 k_b since the product ratio directly reflects rate constant ratios (correct answer)
  2. kakb=3.5\frac{k_a}{k_b} = 3.5 but only if both reactions are first-order in XX
  3. ka=3.5kbk_a = 3.5 k_b regardless of the reaction orders in the competing pathways
  4. The rate constants cannot be determined from product ratios without additional kinetic data
Explanation: For competing first-order reactions from the same intermediate, the ratio of products formed equals the ratio of rate constants: d[P1]/dtd[P2]/dt=ka[X]kb[X]=kakb\frac{d[P_1]/dt}{d[P_2]/dt} = \frac{k_a[X]}{k_b[X]} = \frac{k_a}{k_b}. Since this ratio remains constant, [P1][P2]=kakb=3.5\frac{[P_1]}{[P_2]} = \frac{k_a}{k_b} = 3.5. Choice B adds an unnecessary condition—the conclusion follows directly. Choice C is correct but less precise than A. Choice D is overly cautious; the constant ratio provides sufficient information.

Question 14

A proposed mechanism for the reaction A+2BC+DA + 2B \rightarrow C + D consists of two elementary steps: Step 1: A+BXA + B \rightarrow X (fast equilibrium), Step 2: X+BC+DX + B \rightarrow C + D (slow). If the concentration of intermediate XX can be expressed in terms of reactant concentrations using the pre-equilibrium approximation, what is the predicted rate law for the overall reaction?

  1. Rate = k[A][B]2k[A][B]^2 (correct answer)
  2. Rate = k[A][B]k[A][B] where kk includes equilibrium constant terms
  3. Rate = k[A]2[B]k[A]^2[B] due to the stoichiometry of the overall reaction
  4. Rate = k[X][B]k[X][B] since the slow step determines the overall rate
Explanation: Using the pre-equilibrium approximation: Step 1 is at equilibrium, so Keq=[X][A][B]K_{eq} = \frac{[X]}{[A][B]}, giving [X]=Keq[A][B][X] = K_{eq}[A][B]. The rate-determining step is Step 2: Rate = k2[X][B]k_2[X][B]. Substituting: Rate = k2Keq[A][B][B]=k[A][B]2k_2 K_{eq}[A][B][B] = k[A][B]^2 where k=k2Keqk = k_2 K_{eq}. Choice B is wrong because it doesn't account for the second B molecule. Choice C has incorrect stoichiometry. Choice D doesn't eliminate the intermediate concentration.

Question 15

The steady-state approximation is applied to intermediate YY in a three-step mechanism. If d[Y]dt=k1[A][B]k2[Y][C]k3[Y]=0\frac{d[Y]}{dt} = k_1[A][B] - k_2[Y][C] - k_3[Y] = 0, and the third step is much faster than the second (k3>>k2[C]k_3 >> k_2[C]), what does this reveal about the dominant fate of intermediate YY?

  1. Intermediate YY primarily reacts with CC to form the final product
  2. Intermediate YY predominantly undergoes the unimolecular reaction in step 3 (correct answer)
  3. The steady-state approximation breaks down under these conditions
  4. Intermediate YY accumulates faster than it can be consumed by either pathway
Explanation: When k3>>k2[C]k_3 >> k_2[C], the term k3[Y]k_3[Y] dominates the consumption terms in the steady-state equation. This means intermediate YY is primarily consumed through the unimolecular step 3 rather than through reaction with CC. Choice A is incorrect because step 2 becomes negligible. Choice C is wrong—the approximation still holds. Choice D contradicts the steady-state condition where production equals consumption.

Question 16

The mechanism for a photochemical reaction includes: Initiation: Ahν2RA \xrightarrow{h\nu} 2R \cdot, Propagation: R+BP+RR \cdot + B \rightarrow P + R \cdot, Termination: 2RR22R \cdot \rightarrow R_2. Using steady-state approximation for the radical RR \cdot, if the rate of product formation is found to be proportional to I1/2I^{1/2} (where II is light intensity), what does this reveal about the termination mechanism?

  1. The termination step must be second-order in radical concentration as proposed (correct answer)
  2. The termination mechanism involves a first-order process like radical-wall collisions
  3. The termination step is actually rate-determining rather than the propagation step
  4. Multiple termination pathways are competing, leading to fractional-order kinetics
Explanation: The I1/2I^{1/2} dependence is characteristic of radical chain reactions with bimolecular termination. From steady state: rate of initiation = rate of termination, so 2ϕI=2kt[R]22\phi I = 2k_t[R \cdot]^2, giving [R]I1/2[R \cdot] \propto I^{1/2}. Since rate = kp[R][B]k_p[R \cdot][B], the rate ∝ I1/2I^{1/2}. This confirms bimolecular termination. Choice B would give rate ∝ I1I^1. Choice C misidentifies the rate-determining step. Choice D doesn't explain the specific I1/2I^{1/2} dependence.

Question 17

In a chain reaction mechanism, the propagation steps are: Cl+H2HCl+HCl \cdot + H_2 \rightarrow HCl + H \cdot and H+Cl2HCl+ClH \cdot + Cl_2 \rightarrow HCl + Cl \cdot. If the rate constants for these steps are k1k_1 and k2k_2 respectively, and the steady-state concentrations of the radical species are [Cl]ss[Cl \cdot]_{ss} and [H]ss[H \cdot]_{ss}, what relationship must hold between these concentrations?

  1. [Cl]ss=[H]ss[Cl \cdot]_{ss} = [H \cdot]_{ss} due to the cyclic nature of the chain
  2. [Cl]ss[H]ss=k1k2[H2][Cl2]k1+k2[Cl \cdot]_{ss} \cdot [H \cdot]_{ss} = \frac{k_1 k_2 [H_2][Cl_2]}{k_1 + k_2} from coupled equilibria
  3. [Cl]ss[H]ss=k2[Cl2]k1[H2]\frac{[Cl \cdot]_{ss}}{[H \cdot]_{ss}} = \frac{k_2[Cl_2]}{k_1[H_2]} based on rate balance
  4. k1[Cl]ss[H2]=k2[H]ss[Cl2]k_1[Cl \cdot]_{ss}[H_2] = k_2[H \cdot]_{ss}[Cl_2] from steady-state analysis (correct answer)
Explanation: When analyzing chain reaction mechanisms, the key insight is applying steady-state approximation to reactive intermediates. In steady state, the rate of formation of each radical species equals its rate of consumption, meaning their concentrations remain approximately constant. For the chlorine radical (ClCl \cdot), it's consumed in step 1 and regenerated in step 2. At steady state: rate of consumption = rate of formation, so k1[Cl]ss[H2]=k2[H]ss[Cl2]k_1[Cl \cdot]_{ss}[H_2] = k_2[H \cdot]_{ss}[Cl_2]. This directly gives us answer D. Looking at the incorrect options: A suggests equal radical concentrations due to the "cyclic nature," but this ignores that the actual concentrations depend on the relative rates and substrate concentrations - there's no requirement for them to be equal. B presents a complex expression involving coupled equilibria, but chain reactions operate under kinetic control, not equilibrium conditions, and this mathematical relationship has no basis in steady-state kinetics. C rearranges the steady-state condition into a ratio, which while mathematically equivalent to D, doesn't represent the fundamental principle as clearly - the steady-state approximation is about rate balance, not concentration ratios. The winning approach is recognizing that steady-state analysis requires setting production rates equal to consumption rates for each intermediate. This creates the rate balance equation in D, which is the most direct expression of the underlying physical principle. Remember: in chain reaction problems, always write rate equations for each radical intermediate and apply steady-state approximation by setting formation rate equal to consumption rate.

Question 18

Consider the elementary reaction A+BC+DA + B \rightarrow C + D occurring in the gas phase. Based on collision theory, which factor would have the greatest impact on the pre-exponential factor (AA-factor) in the Arrhenius equation for this reaction?

  1. The activation energy barrier height, since higher barriers require more energetic collisions
  2. The molecular masses of reactants, as heavier molecules move slower and collide less frequently
  3. The collision frequency between AA and BB molecules and the steric factor for productive orientation (correct answer)
  4. The bond strengths in the transition state, which determine the probability of reaction
Explanation: When analyzing reaction kinetics through collision theory, you need to understand what determines the pre-exponential factor (A-factor) in the Arrhenius equation: k=AeEa/RTk = A e^{-E_a/RT}. The A-factor represents the maximum possible rate constant if all collisions led to reaction. According to collision theory, the A-factor depends on two key components: how often molecules collide (collision frequency) and what fraction of those collisions have the proper geometric orientation to react (steric factor). The collision frequency depends on molecular concentrations, sizes, and velocities, while the steric factor accounts for the fact that molecules must approach each other in specific orientations for bonds to break and form correctly. Answer C correctly identifies both collision frequency and steric factor as the primary determinants of the A-factor. These factors establish the theoretical maximum rate before considering energy requirements. Answer A confuses the A-factor with activation energy (EaE_a). The activation energy appears in the exponential term, not the pre-exponential factor. Higher barriers reduce the fraction of successful collisions but don't directly affect the A-factor. Answer B only partially captures collision frequency effects. While molecular masses do influence collision rates through molecular velocities, this is just one component of the broader collision frequency factor. Answer D incorrectly focuses on transition state properties. Bond strengths in the transition state relate to activation energy and thermodynamic stability, not to the frequency or geometric requirements of molecular collisions. Remember: The A-factor represents collision mechanics (how often and how favorably), while activation energy represents the energetic requirement for reaction.

Question 19

Consider the elementary step 2NO+O22NO22NO + O_2 \rightarrow 2NO_2. From a molecular perspective, what is the most significant constraint on this reaction occurring as written in a single elementary step?

  1. The activation energy barrier would be prohibitively high for three molecules simultaneously
  2. The probability of three specific molecules colliding simultaneously with correct orientation is extremely low (correct answer)
  3. The reaction violates conservation of angular momentum in gas-phase collisions
  4. The enthalpy change is too large for a single elementary step to accommodate
Explanation: Elementary steps involving three molecules (termolecular reactions) are extremely rare because the probability of three molecules colliding simultaneously with the correct geometry and energy is vanishingly small. While choice A mentions activation energy, the primary issue is the collision probability. Choice C incorrectly invokes angular momentum conservation. Choice D is wrong because enthalpy change doesn't determine whether a reaction can occur in one step.