Physical Chemistry 1 Quiz: Entropy Definition And Interpretation
20 questions · exam conditions
0:00
Entropy Definition And InterpretationQuestion 1 of 20

A crystalline solid has a residual entropy of Rln2R \ln 2 per mole at 0 K due to two-fold orientational disorder. When heated to temperature T, additional thermal entropy develops. Which statement correctly describes the relationship between residual and thermal entropy contributions?

The residual entropy decreases as thermal entropy increases, because thermal motion tends to remove orientational disorder and establish preferred molecular orientations in the crystal.
The residual entropy remains constant at Rln2R \ln 2 while thermal entropy increases, because orientational and thermal contributions are independent and additive in the total entropy expression.
The total entropy approaches Rln2+Sthermal(T)R \ln 2 + S_{thermal}(T), but the two contributions are coupled because thermal motion affects the energy barriers between orientational configurations.
The residual entropy increases proportionally with thermal entropy, because higher temperature enhances both orientational disorder and vibrational motion through the same molecular mechanisms.
The residual entropy becomes negligible compared to thermal entropy at high temperature, because thermal contributions scale with T3T^3 while orientational contributions remain constant.
← Back to quizzes

Physical Chemistry 1 Quiz

Physical Chemistry 1 Quiz: Entropy Definition And Interpretation

Practice Entropy Definition And Interpretation in Physical Chemistry 1 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Entropy Definition And Interpretation, giving you a quick way to practice the rules, question types, and explanations that matter most for Physical Chemistry 1.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A crystalline solid has a residual entropy of Rln2R \ln 2 per mole at 0 K due to two-fold orientational disorder. When heated to temperature T, additional thermal entropy develops. Which statement correctly describes the relationship between residual and thermal entropy contributions?

  1. The residual entropy decreases as thermal entropy increases, because thermal motion tends to remove orientational disorder and establish preferred molecular orientations in the crystal.
  2. The residual entropy remains constant at Rln2R \ln 2 while thermal entropy increases, because orientational and thermal contributions are independent and additive in the total entropy expression. (correct answer)
  3. The total entropy approaches Rln2+Sthermal(T)R \ln 2 + S_{thermal}(T), but the two contributions are coupled because thermal motion affects the energy barriers between orientational configurations.
  4. The residual entropy increases proportionally with thermal entropy, because higher temperature enhances both orientational disorder and vibrational motion through the same molecular mechanisms.
  5. The residual entropy becomes negligible compared to thermal entropy at high temperature, because thermal contributions scale with T3T^3 while orientational contributions remain constant.
Explanation: When you encounter entropy questions involving crystalline solids, focus on understanding the fundamental difference between residual entropy and thermal entropy—they arise from completely different physical origins. Residual entropy of Rln2R \ln 2 represents orientational disorder that's "frozen in" at absolute zero. This exists because molecules can adopt two equally probable orientations in the crystal lattice, creating configurational disorder that persists even when all thermal motion ceases. This value is fixed by the crystal structure itself. Thermal entropy, conversely, develops from vibrational motion as temperature increases. As you heat the crystal, atoms vibrate more vigorously around their equilibrium positions, but this doesn't change the underlying orientational disorder that creates residual entropy. The total entropy becomes Stotal=Rln2+Sthermal(T)S_{total} = R \ln 2 + S_{thermal}(T), where these contributions are completely independent and additive. Option A incorrectly suggests thermal motion removes orientational disorder—but heating typically increases all forms of disorder, not decrease some while increasing others. Option C introduces unnecessary complexity by claiming the contributions are "coupled," but orientational configurations and vibrational motion operate independently in most crystalline systems. Option D wrongly states residual entropy increases with temperature, but residual entropy is a constant structural property. The key insight is that residual entropy reflects static configurational possibilities, while thermal entropy reflects dynamic motion. These are separate phenomena that don't interfere with each other. Study tip: Remember that residual entropy is always temperature-independent—it's determined solely by the number of equivalent configurations available to the system, regardless of thermal conditions.

Question 2

A magnetic system has N independent spins, each with magnetic moment μ\mu, in a magnetic field B at temperature T. The entropy is S=Nkln[2cosh(μBkT)]NμBTtanh(μBkT)S = Nk \ln[2 \cosh(\frac{\mu B}{kT})] - \frac{N \mu B}{T} \tanh(\frac{\mu B}{kT}). What happens to the entropy in the limit of very strong magnetic field, and what is the microscopic explanation?

  1. S0S \rightarrow 0 because all spins align with the field, reducing the system to a single microstate with no remaining orientational disorder among the magnetic moments. (correct answer)
  2. SNkS \rightarrow Nk because strong fields create maximum entropy through complete randomization of spin orientations perpendicular to the field direction in three-dimensional space.
  3. SNkln2S \rightarrow Nk \ln 2 because the field cannot completely eliminate quantum mechanical uncertainty, leaving residual two-fold degeneracy for each spin orientation.
  4. SNμBTS \rightarrow \frac{N \mu B}{T} because the entropy becomes dominated by the magnetic energy contribution rather than the configurational disorder of spin states.
  5. SS \rightarrow \infty because strong magnetic fields induce rapid spin precession, creating unlimited rotational microstates for each magnetic moment in the system.
Explanation: When analyzing entropy in magnetic systems, you need to understand how thermal energy competes with magnetic alignment. In weak fields, thermal motion dominates and spins orient randomly. In strong fields, the magnetic interaction overwhelms thermal effects. To find the strong field limit, examine what happens as μBkT\frac{\mu B}{kT} \rightarrow \infty. The hyperbolic functions behave as: cosh(x)tanh(x)1\cosh(x) \approx \tanh(x) \approx 1 for large xx. Substituting into the entropy expression: SNkln(21)NμBT1=Nkln2NμBTS \approx Nk \ln(2 \cdot 1) - \frac{N \mu B}{T} \cdot 1 = Nk \ln 2 - \frac{N \mu B}{T}. Since NμBT\frac{N \mu B}{T} grows much faster than the constant Nkln2Nk \ln 2, the entropy approaches zero. Answer A correctly captures both the mathematical result and physical reasoning: strong fields force all spins to align with the field direction, eliminating orientational disorder and reducing the system to essentially one microstate. Answer B incorrectly suggests maximum entropy and randomization - the opposite of what strong fields produce. Answer C makes a common error by stopping at the Nkln2Nk \ln 2 term without recognizing that the much larger NμBT\frac{N \mu B}{T} term dominates in the strong field limit. Answer D misidentifies the entropy limit as the magnetic energy term itself, confusing the dominant term in the expression with the final limit. Remember: strong external fields always reduce entropy by forcing order. When evaluating limits involving competing exponential and polynomial terms, the exponential behavior typically dominates.

Question 3

Consider two identical containers, each holding 1 mole of an ideal gas. Container A has all molecules moving with velocity vv, while Container B has half the molecules moving with velocity 2v2v and half stationary. Both systems have the same total kinetic energy. From a microscopic perspective, which statement correctly compares their entropies?

  1. SA=SBS_A = S_B because both systems have identical total kinetic energies, and entropy depends only on the total energy available to the system.
  2. SA>SBS_A > S_B because Container A has more uniform energy distribution among molecules, creating more accessible microstates for the system overall.
  3. SB>SAS_B > S_A because Container B has greater velocity dispersion, providing more ways to distribute kinetic energy among the molecular degrees of freedom. (correct answer)
  4. SA=SBS_A = S_B because the Maxwell-Boltzmann distribution ensures that any kinetic energy configuration with the same total energy has identical entropy values.
  5. The comparison is impossible without knowing the container volumes, since entropy depends on both momentum and position distributions of the molecules.
Explanation: When you encounter problems comparing entropy between different molecular velocity distributions, focus on the microscopic definition: entropy relates to the number of ways energy can be distributed among particles, not just the total energy. Container B has higher entropy because it offers more microstates for energy distribution. In Container A, all molecules have identical velocity vv, creating only one way to arrange the kinetic energies. Container B has two distinct energy levels (2v2v and stationary), and you can choose which specific molecules occupy each energy state. With NA/2N_A/2 molecules in each group, the number of ways to select which molecules have high velocity versus zero velocity is given by the binomial coefficient, creating many more possible microstates than Container A's single configuration. Option A incorrectly assumes entropy depends only on total energy. While total energy affects temperature, entropy specifically counts accessible microstates, which depends on how that energy is distributed among particles. Option B reverses the relationship. Uniform distributions actually provide fewer microstates than distributions with energy spread across different levels. A completely uniform system has minimal entropy because there's only one way to arrange identical energies. Option D misapplies the Maxwell-Boltzmann distribution, which describes equilibrium systems at fixed temperature. These containers represent specific non-equilibrium configurations with artificially constrained velocity distributions, so Maxwell-Boltzmann statistics don't apply. Remember: entropy increases with the number of ways to arrange energy among particles. Systems with multiple energy levels and flexible particle assignments typically have higher entropy than uniform distributions, even at identical total energies.

Question 4

A crystal at 0 K is subjected to a magnetic field that aligns all nuclear spins in one direction. When the field is suddenly removed, the spins randomize while the crystal remains at 0 K. If there are NN nuclei each with spin 12\frac{1}{2}, what is the entropy change and its microscopic interpretation?

  1. ΔS=0\Delta S = 0 because the Third Law requires zero entropy at 0 K regardless of nuclear spin configurations, and the total energy remains unchanged.
  2. ΔS=Nkln2\Delta S = Nk \ln 2 because each nucleus can adopt two spin orientations independently, changing from 1 microstate to 2N2^N total microstates available. (correct answer)
  3. ΔS=klnN\Delta S = k \ln N because the NN nuclei can be permuted among the available spin states, but quantum indistinguishability limits the accessible configurations.
  4. ΔS=12Nkln2\Delta S = \frac{1}{2}Nk \ln 2 because only half the nuclei change orientation on average, and entropy change is proportional to the fraction participating.
  5. ΔS=Nk\Delta S = Nk because each nucleus contributes one unit of randomness when transitioning from ordered to completely disordered spin configuration.
Explanation: When you encounter problems about entropy changes involving nuclear spins, you're dealing with statistical thermodynamics and the relationship between microstates and entropy through Boltzmann's equation: S=klnΩS = k \ln \Omega, where Ω\Omega is the number of accessible microstates. Initially, with the magnetic field present, all nuclear spins are aligned in one direction. This represents a single, unique microstate where every nucleus has the same spin orientation, so Ωi=1\Omega_i = 1 and Si=0S_i = 0. When the field is removed, each spin-12\frac{1}{2} nucleus can independently adopt either of two orientations (up or down). Since the nuclei are distinguishable by their positions in the crystal lattice, the total number of accessible microstates becomes Ωf=2N\Omega_f = 2^N. The entropy change is therefore ΔS=kln(2N)kln(1)=Nkln2\Delta S = k \ln(2^N) - k \ln(1) = Nk \ln 2. Option A incorrectly assumes the Third Law prohibits any entropy at 0 K, but the Third Law specifically refers to perfectly ordered crystals—nuclear spin disorder is an exception that can persist even at absolute zero. Option C mistakes the counting of microstates; quantum indistinguishability doesn't apply here since nuclei occupy distinct lattice positions. Option D incorrectly assumes only half the spins change, missing that entropy depends on total accessible configurations, not the average number of spins that flip. Remember: nuclear spin contributions to entropy follow standard statistical mechanics even at 0 K because nuclear and electronic degrees of freedom are largely decoupled at low temperatures.

Question 5

Two systems A and B are initially isolated. System A has entropy SA=100S_A = 100 J/K and temperature TA=400T_A = 400 K. System B has entropy SB=200S_B = 200 J/K and temperature TB=300T_B = 300 K. When brought into thermal contact, they reach equilibrium at Teq=320T_{eq} = 320 K. Which statement best explains the entropy change from a microscopic perspective?

  1. ΔStotal>0\Delta S_{total} > 0 because thermal contact allows energy microstates from both systems to mix, creating new accessible configurations that weren't available when isolated.
  2. ΔStotal=0\Delta S_{total} = 0 because the total number of microstates is conserved when systems combine, and equilibrium represents the most probable distribution of existing states.
  3. ΔStotal<0\Delta S_{total} < 0 because reaching thermal equilibrium constrains the energy distribution, reducing the number of accessible microstates compared to the isolated condition.
  4. ΔStotal>0\Delta S_{total} > 0 because energy transfer from hot to cold system increases molecular disorder in the cold system more than it decreases disorder in hot system. (correct answer)
  5. ΔStotal=0\Delta S_{total} = 0 because entropy is conserved in reversible processes, and thermal equilibration can be carried out reversibly using appropriate thermal reservoirs.
Explanation: When two systems at different temperatures reach thermal equilibrium, you're witnessing a fundamental principle: entropy always increases in spontaneous processes. The key insight is understanding how molecular energy distributions change during this process. Energy flows from the hot system (A, 400 K) to the cold system (B, 300 K) until both reach 320 K. From a microscopic perspective, this energy transfer affects the number of accessible microstates differently in each system. When the cold system gains energy, its molecules can access many new energy levels and arrangements, dramatically increasing its microstates. Meanwhile, the hot system loses some energy, reducing its accessible microstates but not as dramatically as the cold system gains them. This asymmetric effect occurs because entropy changes more steeply at lower temperatures than higher ones (dS=dQ/TdS = dQ/T). The cold system's entropy increase outweighs the hot system's entropy decrease, making ΔStotal>0\Delta S_{total} > 0. Answer D correctly captures this microscopic explanation. Answer A incorrectly suggests that simply mixing systems creates new microstates - the entropy increase isn't about "mixing" energy states but about redistributing energy. Answer B wrongly claims entropy is conserved, contradicting the Second Law of Thermodynamics for irreversible processes. Answer C completely misunderstands the process, suggesting equilibrium reduces total microstates when it actually maximizes them. Study tip: Remember that entropy changes are temperature-dependent (ΔS=Q/T\Delta S = Q/T). In heat transfer problems, always consider that the same energy transfer causes larger entropy changes in colder systems than hotter ones.

Question 6

Consider a gas expanding freely into vacuum (Joule expansion). During this process, the temperature remains constant but the volume doubles. A student argues that since no work is done and no heat is exchanged, the entropy change should be zero. What is the flaw in this reasoning from a microscopic perspective?

  1. The reasoning is correct for ideal gases, but real gases have intermolecular forces that create entropy changes even in free expansion processes.
  2. The student confuses entropy with energy conservation; while energy is conserved, the number of accessible positional microstates increases with volume expansion. (correct answer)
  3. The reasoning fails because temperature constancy requires heat exchange with surroundings, contradicting the assumption of an isolated system during free expansion.
  4. The student incorrectly applies the definition dS=dQrevTdS = \frac{dQ_{rev}}{T}; this formula applies only to reversible processes, not irreversible free expansions.
  5. The reasoning is thermodynamically sound, but quantum mechanical effects at the molecular level create additional entropy contributions not captured by classical analysis.
Explanation: When analyzing entropy changes in thermodynamic processes, you need to distinguish between the macroscopic thermodynamic approach and the microscopic statistical perspective. The key insight is that entropy fundamentally measures the number of ways particles can be arranged in a system. In Joule expansion, a gas expands into a vacuum with no external work or heat exchange. From a microscopic viewpoint, when the volume doubles, each gas molecule now has twice as much space to occupy. This dramatically increases the number of possible positional arrangements (microstates) available to the system. Using Boltzmann's equation S=klnΩS = k \ln \Omega, where Ω\Omega is the number of microstates, the entropy must increase as ΔS=nRln(Vf/Vi)=nRln(2)\Delta S = nR \ln(V_f/V_i) = nR \ln(2). Option A incorrectly suggests this only applies to real gases with intermolecular forces. Actually, even ideal gases experience entropy increases during free expansion due to increased spatial arrangements. Option C wrongly claims temperature constancy requires heat exchange—in free expansion of an ideal gas, temperature remains constant because internal energy depends only on temperature. Option D misapplies the reversible heat formula; while dS=dQrev/TdS = dQ_{rev}/T doesn't directly apply to irreversible processes, we can still calculate entropy changes using state functions. The student's error lies in conflating energy conservation with entropy behavior—energy remains constant, but entropy increases due to greater molecular disorder. Study tip: Remember that entropy changes depend on accessible microstates, not just energy transfers. Free expansion always increases entropy even when energy is conserved.

Question 7

Consider two systems: System 1 has entropy S1=aklnV+bklnT+cS_1 = ak \ln V + bk \ln T + c, and System 2 has entropy S2=dklnV+eklnT+fS_2 = dk \ln V + ek \ln T + f, where a,b,c,d,e,fa, b, c, d, e, f are constants. When these systems are brought into thermal contact at constant total volume, which statement correctly describes the entropy change during equilibration?

  1. ΔStotal=0\Delta S_{total} = 0 because both systems have identical functional dependence on volume and temperature, making them thermodynamically equivalent during equilibration processes.
  2. ΔStotal>0\Delta S_{total} > 0 if beb \neq e, because different temperature dependencies indicate different heat capacities, leading to irreversible heat transfer between the systems. (correct answer)
  3. ΔStotal=(be)klnTfinal\Delta S_{total} = (b-e)k \ln T_{final} where TfinalT_{final} is determined by energy conservation, representing the entropy change from temperature equilibration between systems with different thermal properties.
  4. ΔStotal>0\Delta S_{total} > 0 only if ada \neq d, because volume-dependent entropy differences create driving forces for irreversible processes even at constant total volume.
  5. ΔStotal\Delta S_{total} depends on the initial temperature difference and the values of bb and ee, but is always positive for spontaneous equilibration regardless of other parameters.
Explanation: When two systems are brought into thermal contact, you need to analyze whether irreversible processes will occur based on their thermodynamic properties. The key insight is recognizing how different entropy dependencies indicate different material properties that drive equilibration. The entropy expressions show that both systems depend on volume and temperature, but with potentially different coefficients. Since ST=CVT\frac{\partial S}{\partial T} = \frac{C_V}{T} at constant volume, the temperature coefficients bb and ee are directly related to the systems' heat capacities. When beb \neq e, the systems have different heat capacities, meaning they respond differently to temperature changes. During thermal equilibration, heat will flow between systems with different temperatures until thermal equilibrium is reached. This irreversible heat transfer increases the total entropy of the universe. The magnitude depends on the initial temperature difference and the heat capacity differences encoded in the bb and ee values. Option A incorrectly assumes that having the same functional form makes systems thermodynamically equivalent - the coefficients matter crucially. Option C attempts to give a specific formula but misses that the actual entropy change depends on initial conditions and the complex equilibration process, not just the final temperature. Option D focuses on volume coefficients aa and dd, but since total volume is constant and no volume exchange occurs between systems, these don't create driving forces for irreversible processes. Remember: different heat capacities (revealed by different temperature dependencies in entropy) always lead to irreversible heat transfer and positive entropy production during thermal equilibration.

Question 8

A system undergoes a process where the number of accessible microstates changes from Ω1=220\Omega_1 = 2^{20} to Ω2=230\Omega_2 = 2^{30}. Simultaneously, the system exchanges heat Q with a reservoir at temperature T such that QT=5kln2\frac{Q}{T} = 5k \ln 2. What can be concluded about the nature of this process?

  1. The process is reversible because the entropy change of the system equals the entropy change of the reservoir, satisfying ΔSuniverse=0\Delta S_{universe} = 0 for reversible processes.
  2. The process is irreversible because ΔSsystem=10kln2>QT=5kln2\Delta S_{system} = 10k \ln 2 > \frac{Q}{T} = 5k \ln 2, indicating entropy generation within the system beyond heat exchange effects. (correct answer)
  3. The process is impossible because the system entropy increase exceeds the maximum possible entropy transfer from the reservoir, violating the Second Law of Thermodynamics.
  4. The process is reversible if Q > 0 (heat absorbed) but irreversible if Q < 0 (heat released), because the direction of heat flow determines process reversibility.
  5. The process reversibility cannot be determined without knowing whether the reservoir temperature T equals the system temperature during the heat exchange period.
Explanation: When analyzing entropy changes in thermodynamic processes, you need to distinguish between entropy changes due to heat exchange and entropy generation within the system itself. This distinction is crucial for determining whether a process is reversible or irreversible. First, calculate the system's entropy change from the microstate information. Using Boltzmann's equation S=klnΩS = k \ln \Omega, the entropy change is ΔSsystem=kln(Ω2/Ω1)=kln(230/220)=kln(210)=10kln2\Delta S_{system} = k \ln(\Omega_2/\Omega_1) = k \ln(2^{30}/2^{20}) = k \ln(2^{10}) = 10k \ln 2. Meanwhile, the heat exchange with the reservoir contributes Q/T=5kln2Q/T = 5k \ln 2 to the entropy change. The key insight is that ΔSsystem=10kln2\Delta S_{system} = 10k \ln 2 exceeds Q/T=5kln2Q/T = 5k \ln 2. This means the system's entropy increased by more than what can be attributed to heat exchange alone. The "extra" entropy (5kln25k \ln 2) must have been generated internally through irreversible processes within the system. Option A is wrong because the entropy changes are not equal—the system's entropy change exceeds the heat exchange term. Option C incorrectly suggests the process violates thermodynamics; it's perfectly allowed since total entropy increases. Option D incorrectly ties reversibility solely to heat flow direction, ignoring the fundamental entropy analysis. The correct answer is B because ΔSsystem>Q/T\Delta S_{system} > Q/T indicates internal entropy generation, which is the hallmark of irreversibility. Remember: Compare the system's entropy change to Q/TQ/T. If they're equal, the process is reversible; if the system's entropy change is larger, irreversible processes occurred internally.

Question 9

A molecular motor protein can exist in four conformational states with relative energies 0, ϵ\epsilon, 2ϵ2\epsilon, and 3ϵ3\epsilon. At thermal equilibrium, the populations follow Boltzmann distribution. If ϵ=2kT\epsilon = 2kT, what is the dominant contribution to the entropy, and how does this relate to the motor's function?

  1. The entropy is dominated by the ground state population, which provides thermal stability necessary for reliable motor function under physiological conditions.
  2. The entropy is maximized by near-equal populations of all states, allowing the motor to sample all conformations and maintain functional flexibility during operation.
  3. The entropy is dominated by transitions between the two lowest energy states, which corresponds to the primary conformational changes driving motor movement.
  4. The entropy reflects significant population of the first excited state while higher states remain sparsely populated, balancing stability with sufficient thermal activation for motor function. (correct answer)
  5. The entropy is minimized due to the large energy gaps, which ensures that the motor operates in a deterministic manner rather than randomly sampling conformations.
Explanation: When analyzing molecular systems with multiple energy states, you need to calculate the Boltzmann populations and understand how they contribute to entropy and biological function. Given ϵ=2kT\epsilon = 2kT, the relative populations are proportional to eEi/kTe^{-E_i/kT}. For states with energies 0, ϵ\epsilon, 2ϵ2\epsilon, and 3ϵ3\epsilon, the Boltzmann factors are: 1, e2e^{-2}, e4e^{-4}, and e6e^{-6}. This gives approximate relative populations of 1.00, 0.135, 0.018, and 0.002. The ground state dominates (≈87% population), but the first excited state has significant occupancy (≈12%), while higher states are sparsely populated. This distribution maximizes entropy while maintaining thermal stability—exactly what's needed for motor protein function. The protein can access its first conformational change readily (driving motor action) without excessive population of higher, potentially non-functional states. Option A is wrong because entropy isn't "dominated by ground state population"—entropy actually increases with more distributed populations. Option B incorrectly suggests near-equal populations, but ϵ=2kT\epsilon = 2kT creates substantial energy gaps that prevent this. Option C misidentifies the entropy source as "transitions between states" rather than the population distribution itself—entropy is a state function, not a kinetic property. Remember that ϵ=2kT\epsilon = 2kT is a key threshold in biological systems: it provides enough thermal energy to access the first excited state (essential for function) while keeping higher states mostly unoccupied (maintaining specificity). Watch for this energy scale in biomolecular problems.

Question 10

Two identical Einstein solids, each with N oscillators and total energy qωq \hbar \omega, are brought into thermal contact. Initially, solid A has energy qAωq_A \hbar \omega and solid B has energy qBωq_B \hbar \omega where qA+qB=2qq_A + q_B = 2q. The entropy of each solid is S=kln(N+q1q)S = k \ln \binom{N+q-1}{q}. What energy distribution maximizes the total entropy?

  1. qA=qB=qq_A = q_B = q because equal energy distribution always maximizes entropy when combining identical systems, reflecting the most probable microstate configuration. (correct answer)
  2. qA=2q,qB=0q_A = 2q, q_B = 0 because concentrating all energy in one solid maximizes the number of ways to arrange energy quanta among oscillators.
  3. qA=qB=qq_A = q_B = q because this distribution maximizes ln(N+q1q)\ln \binom{N+q-1}{q}, and the total entropy is the sum of identical terms from each solid.
  4. The optimal distribution depends on the ratio qN\frac{q}{N}; equal distribution maximizes entropy only when qNq \ll N (high temperature limit).
  5. qA=2q3,qB=4q3q_A = \frac{2q}{3}, q_B = \frac{4q}{3} because entropy maximization requires weighting the energy distribution according to the golden ratio principle for coupled oscillator systems.
Explanation: When two identical systems are brought into thermal contact, you're dealing with the fundamental principle that entropy always increases toward equilibrium. The key insight is that identical systems at thermal equilibrium must have equal energy distributions to maximize the total entropy of the combined system. The total entropy is Stotal=kln(N+qA1qA)+kln(N+qB1qB)S_{total} = k \ln \binom{N+q_A-1}{q_A} + k \ln \binom{N+q_B-1}{q_B}, subject to the constraint qA+qB=2qq_A + q_B = 2q. At equilibrium, the derivative of total entropy with respect to energy distribution equals zero. This mathematical condition, combined with the constraint, leads directly to qA=qB=qq_A = q_B = q. Answer A correctly identifies this equal distribution and provides the right reasoning: identical systems naturally evolve toward equal energy sharing because this represents the most probable microstate configuration. Answer B is fundamentally wrong because concentrating all energy in one system (qA=2q,qB=0q_A = 2q, q_B = 0) actually minimizes entropy, not maximizes it. This creates maximum energy inequality. Answer C reaches the correct distribution but uses flawed reasoning. It incorrectly suggests that maximizing ln(N+q1q)\ln \binom{N+q-1}{q} for individual terms leads to the solution, when actually you must maximize the total entropy considering both systems simultaneously. Answer D introduces an irrelevant temperature dependence. While the ratio q/Nq/N affects the absolute entropy values, the equal distribution qA=qB=qq_A = q_B = q maximizes total entropy regardless of this ratio. Study tip: Remember that thermal equilibrium between identical systems always means equal energy distribution. This principle applies universally in statistical mechanics problems involving entropy maximization.

Question 11

A gas undergoes an isothermal process at temperature T during which its entropy changes by ΔS\Delta S. The same gas then undergoes an adiabatic process that returns it to the original volume. What is the net entropy change for the complete cycle, and what does this reveal about the relationship between path-dependent and state-dependent quantities?

  1. ΔSnet=0\Delta S_{net} = 0 because entropy is a state function, and any cyclic process must return the system to its original entropy regardless of path details.
  2. ΔSnet=ΔS\Delta S_{net} = \Delta S because the isothermal entropy change is irreversible while the adiabatic process conserves entropy, demonstrating path dependence in thermodynamic cycles.
  3. ΔSnet=ΔS\Delta S_{net} = \Delta S if the adiabatic process is reversible, but ΔSnet>ΔS\Delta S_{net} > \Delta S if irreversible, showing that entropy generation depends on process details.
  4. ΔSnet=0\Delta S_{net} = 0 for reversible processes but ΔSnet>0\Delta S_{net} > 0 for irreversible processes, illustrating that while entropy is a state function, total entropy change depends on irreversibilities. (correct answer)
  5. ΔSnet\Delta S_{net} cannot be determined without knowing the specific heat capacity, because entropy changes in cyclic processes depend on material properties rather than thermodynamic state functions.
Explanation: When analyzing thermodynamic cycles, you need to distinguish between state functions (like entropy) and the actual entropy changes that occur during real processes. The key insight is that while entropy is indeed a state function, the total entropy change includes both the system and surroundings. For this cycle, the isothermal process changes the system's entropy by ΔS\Delta S. The subsequent adiabatic process returns the gas to its original volume, and since we're completing a cycle, the system's entropy returns to its initial value. However, the net entropy change depends on whether the processes are reversible or irreversible. If both processes are reversible, no entropy is generated, so ΔSnet=0\Delta S_{net} = 0. But if either process involves irreversibilities (friction, finite temperature differences, etc.), additional entropy is created and cannot be destroyed. This makes ΔSnet>0\Delta S_{net} > 0 for irreversible cycles. Answer A incorrectly assumes that being a state function guarantees zero net change regardless of process details. Answer B wrongly suggests the isothermal change is inherently irreversible and that adiabatic processes always conserve entropy. Answer C focuses only on the adiabatic step's reversibility while ignoring that the isothermal process can also generate entropy. Answer D correctly captures that entropy's state function nature ensures zero change for reversible cycles, but irreversibilities create additional entropy that accumulates. Study tip: Remember that "state function" doesn't mean "no net change in real processes" – irreversibilities always increase total entropy, even in cycles.

Question 12

A quantum system has energy levels En=nωE_n = n\hbar\omega where n=0,1,2,...n = 0, 1, 2, ... At temperature T, the entropy is S=klnZ+UTS = k \ln Z + \frac{U}{T} where Z=neEn/kTZ = \sum_n e^{-E_n/kT} and U=EU = \langle E \rangle. In the high temperature limit kTωkT \gg \hbar\omega, how does the entropy behave, and what is the microscopic interpretation?

  1. Skln(kTω)S \rightarrow k \ln(\frac{kT}{\hbar\omega}) because high temperature makes all energy levels equally accessible, and entropy reflects the number of thermally populated states.
  2. SkTS \rightarrow kT because the entropy becomes proportional to thermal energy when quantum effects become negligible at high temperature.
  3. Skln(kTω)+kS \rightarrow k \ln(\frac{kT}{\hbar\omega}) + k because the system approaches classical behavior where entropy includes both energy and configuration contributions. (correct answer)
  4. SS \rightarrow \infty because infinitely many energy levels become accessible as kTωkT \gg \hbar\omega, leading to unlimited microstates for the quantum system.
  5. Sk+ωTeω/kTS \rightarrow k + \frac{\hbar\omega}{T}e^{-\hbar\omega/kT} because high temperature limits involve exponential corrections to the classical entropy value.
Explanation: This question tests your understanding of the classical limit of quantum statistical mechanics, where quantum systems transition to classical behavior at high temperatures. To find the high-temperature entropy, you need to evaluate the partition function Z=n=0enω/kTZ = \sum_{n=0}^{\infty} e^{-n\hbar\omega/kT} when kTωkT \gg \hbar\omega. Since ω/kT1\hbar\omega/kT \ll 1, the exponential spacing becomes small, and you can approximate the sum as an integral: Z0enω/kTdn=kTωZ \approx \int_0^{\infty} e^{-n\hbar\omega/kT} dn = \frac{kT}{\hbar\omega}. The average energy becomes U=lnZβ=kTU = -\frac{\partial \ln Z}{\partial \beta} = kT (where β=1/kT\beta = 1/kT). Substituting into the entropy formula: S=klnZ+UT=kln(kTω)+kS = k \ln Z + \frac{U}{T} = k \ln(\frac{kT}{\hbar\omega}) + k. This is answer C. Answer A misses the constant kk term that arises from U/TU/T in the classical limit. Answer B incorrectly suggests entropy is proportional to energy rather than logarithmic in the number of accessible states. Answer D is wrong because while many states become accessible, the entropy doesn't diverge—it grows logarithmically with the effective number of states kT/ωkT/\hbar\omega. The additional kk term represents the classical contribution to entropy and distinguishes quantum harmonic oscillators from purely classical systems. Remember that in the classical limit, quantum systems don't just become classical—they retain quantum corrections that appear as constant shifts in thermodynamic quantities.

Question 13

Two systems with entropies S1(U1,V1)S_1(U_1, V_1) and S2(U2,V2)S_2(U_2, V_2) are isolated but can exchange energy through a diathermal wall while maintaining constant total volume V1+V2=VtotalV_1 + V_2 = V_{total}. At equilibrium, S1U1=S2U2\frac{\partial S_1}{\partial U_1} = \frac{\partial S_2}{\partial U_2}. If initially this condition is not met, what drives the approach to equilibrium from a microscopic perspective?

  1. Energy flows to equalize the energy densities U1V1\frac{U_1}{V_1} and U2V2\frac{U_2}{V_2}, driven by the tendency to maximize spatial uniformity of energy distribution.
  2. Energy flows from the system with higher SU\frac{\partial S}{\partial U} to the one with lower SU\frac{\partial S}{\partial U}, driven by the requirement that total entropy must increase.
  3. Energy flows to equalize temperatures, and since SU=1T\frac{\partial S}{\partial U} = \frac{1}{T}, this process maximizes total entropy by allowing both systems to access optimal microstate distributions. (correct answer)
  4. Energy flows are random due to thermal fluctuations, but the equilibrium condition S1U1=S2U2\frac{\partial S_1}{\partial U_1} = \frac{\partial S_2}{\partial U_2} represents the most probable energy distribution.
  5. Energy flows to maximize the product S1S2S_1 \cdot S_2 rather than the sum S1+S2S_1 + S_2, because equilibrium requires balanced entropy between interacting systems.
Explanation: This question tests your understanding of thermal equilibrium from both thermodynamic and microscopic perspectives. When you see problems about entropy maximization and energy exchange, think about the connection between macroscopic thermodynamic quantities and the underlying statistical mechanics. The key insight is recognizing that SU=1T\frac{\partial S}{\partial U} = \frac{1}{T}, which transforms the equilibrium condition into temperature equality. From a microscopic perspective, energy flows between systems to maximize the total number of accessible microstates. When temperatures differ, transferring energy from the hotter to cooler system increases the total entropy because the cooler system gains more microstates than the hotter system loses. This process continues until temperatures equalize, at which point no further entropy increase is possible through energy transfer. Option A incorrectly focuses on energy density uniformity rather than temperature. Energy densities don't need to be equal at thermal equilibrium - only temperatures do. Option B has the energy flow direction backwards. Energy actually flows from lower SU\frac{\partial S}{\partial U} (higher temperature) to higher SU\frac{\partial S}{\partial U} (lower temperature), not the reverse. Option D mischaracterizes the driving force as purely random fluctuations, missing that there's a systematic thermodynamic driving force toward maximum entropy. Remember this key connection: whenever you see SU\frac{\partial S}{\partial U} in equilibrium problems, immediately think "inverse temperature." This transforms abstract entropy conditions into concrete thermal concepts and helps you understand the microscopic mechanism - energy redistribution to maximize the total number of accessible quantum states.

Question 14

Consider a system where particles can exist in two regions of phase space with volumes Ω1\Omega_1 and Ω2\Omega_2. Initially, all N particles are in region 1. A barrier between regions is suddenly removed, allowing free exchange. After equilibration, the probability of finding any specific particle in region 1 is p=Ω1Ω1+Ω2p = \frac{\Omega_1}{\Omega_1 + \Omega_2}. What is the entropy change, and what fundamental principle does this illustrate?

  1. ΔS=Nkln(Ω1+Ω2Ω1)\Delta S = Nk \ln(\frac{\Omega_1 + \Omega_2}{\Omega_1}); this illustrates the principle that entropy increases when systems access larger regions of phase space through removal of constraints. (correct answer)
  2. ΔS=kln(Ω1+Ω2)klnΩ1\Delta S = k \ln(\Omega_1 + \Omega_2) - k \ln \Omega_1; this demonstrates that entropy is simply proportional to the logarithm of available phase space volume.
  3. ΔS=Nk[plnp+(1p)ln(1p)]\Delta S = -Nk[p \ln p + (1-p) \ln(1-p)]; this illustrates the fundamental connection between entropy and information theory through the Shannon entropy formula.
  4. ΔS=Nkln2\Delta S = Nk \ln 2 regardless of the ratio Ω2Ω1\frac{\Omega_2}{\Omega_1}; this shows that entropy change depends only on the number of accessible regions, not their relative sizes.
  5. ΔS=kln[(NNp)]\Delta S = k \ln[\binom{N}{Np}]; this demonstrates that entropy arises from the combinatorial problem of distributing distinguishable particles among available states.
Explanation: When you encounter problems about particles distributing between regions of phase space, you're dealing with statistical mechanics and the fundamental relationship between microscopic arrangements and macroscopic entropy. The key insight is that entropy measures how many ways particles can be distributed among available states. Initially, all N particles are confined to region 1, giving only one possible arrangement. After equilibration, particles distribute randomly with probability p=Ω1Ω1+Ω2p = \frac{\Omega_1}{\Omega_1 + \Omega_2} in region 1. Using Boltzmann's entropy formula S=klnWS = k \ln W, where W is the number of accessible microstates, the initial entropy is Si=kln(1)=0S_i = k \ln(1) = 0 (relative scale). The final entropy accounts for all possible ways to distribute N particles between regions, proportional to the total accessible phase space volume (Ω1+Ω2)N(\Omega_1 + \Omega_2)^N. This gives ΔS=Nkln(Ω1+Ω2Ω1)\Delta S = Nk \ln(\frac{\Omega_1 + \Omega_2}{\Omega_1}), confirming answer A. Answer B incorrectly treats this as a single-particle problem rather than an N-particle system, missing the factor of N. Answer C confuses this with information entropy—while related conceptually, the Shannon formula applies to information content, not thermodynamic entropy of particle distributions in phase space. Answer D wrongly assumes the entropy change is independent of region sizes, which would only be true if Ω1=Ω2\Omega_1 = \Omega_2. Remember: entropy changes in statistical mechanics problems always depend on the ratio of final to initial accessible microstates. When constraints are removed, systems explore larger regions of phase space, invariably increasing entropy.

Question 15

A polymer chain can exist in two conformations: extended (E) with energy 0 and folded (F) with energy ϵ-\epsilon where ϵ>0\epsilon > 0. At temperature T, if the ratio of folded to extended molecules is 3:1, what happens to the system entropy per molecule when the temperature is doubled, and what is the microscopic interpretation?

  1. Entropy decreases because higher temperature favors the extended state, reducing conformational disorder and creating more uniform population distributions.
  2. Entropy increases because higher temperature provides more thermal energy to overcome barriers, creating additional accessible microstates for molecular conformations.
  3. Entropy increases because the population shifts toward equal distribution between folded and extended states, maximizing the conformational entropy contribution. (correct answer)
  4. Entropy remains constant because the energy difference ϵ\epsilon between conformations is unchanged, making the partition function temperature-independent.
  5. Entropy decreases because thermal energy preferentially populates the higher-energy extended state, concentrating molecules in fewer accessible microstates.
Explanation: When you encounter polymer conformational equilibrium problems, you're dealing with statistical thermodynamics where entropy depends on how populations are distributed between available states. At the initial temperature T, the folded:extended ratio is 3:1. Using the Boltzmann distribution, NFNE=eϵ/kT=3\frac{N_F}{N_E} = e^{\epsilon/kT} = 3, so the populations are 75% folded and 25% extended. The conformational entropy is S=k[0.75ln(0.75)+0.25ln(0.25)]S = -k[0.75\ln(0.75) + 0.25\ln(0.25)]. When temperature doubles to 2T, the ratio becomes eϵ/2kT=31.73e^{\epsilon/2kT} = \sqrt{3} \approx 1.73, giving populations of about 63% folded and 37% extended. This more equal distribution increases the conformational entropy because entropy is maximized when populations are equal (50:50). The microscopic interpretation is that higher temperature reduces the relative importance of the energy difference ϵ\epsilon, allowing thermal energy to more effectively populate the higher-energy extended state. Answer A is incorrect because while higher temperature does favor the extended state, this actually increases disorder by making the distribution more equal, not more uniform. Answer B contains the right conclusion but wrong reasoning—this isn't about accessing new microstates or overcoming barriers, but rather redistributing populations among existing states. Answer D is wrong because although ϵ\epsilon stays constant, the partition function Z=1+eϵ/kTZ = 1 + e^{\epsilon/kT} is clearly temperature-dependent through the exponential term. Remember: conformational entropy increases as state populations become more equal, regardless of which direction the shift occurs.

Question 16

A system consists of distinguishable particles that can occupy energy levels 0, ϵ\epsilon, and 2ϵ2\epsilon. At low temperature, most particles are in the ground state. As temperature increases, the entropy change is dominated by which microscopic factor?

  1. The increasing kinetic energy of particles within each energy level, which creates more translational microstates available to the system overall.
  2. The thermal population of higher energy levels, which increases the number of ways to distribute particles among the available energy states. (correct answer)
  3. The enhanced vibrational motion of particles at higher temperatures, leading to greater positional uncertainty and more accessible configuration space.
  4. The temperature-dependent degeneracy of energy levels, where higher levels become more degenerate and provide additional microstates for particle occupation.
  5. The increased collision frequency between particles, creating more pathways for energy exchange and generating additional entropy through intermolecular interactions.
Explanation: When you encounter questions about entropy changes in statistical mechanics, focus on the fundamental relationship between entropy and the number of accessible microstates. Entropy S=klnΩS = k \ln \Omega, where Ω\Omega is the number of ways to arrange particles among available states. At low temperature, nearly all distinguishable particles occupy the ground state (energy = 0), giving very few possible arrangements. As temperature increases, thermal energy allows particles to populate the ϵ\epsilon and 2ϵ2\epsilon levels. Since particles are distinguishable, each different assignment of particles to energy levels represents a unique microstate. The number of possible distributions grows dramatically as more particles gain access to higher energy levels, causing entropy to increase substantially. Answer choice A incorrectly focuses on kinetic energy within levels—but we're dealing with discrete energy levels, not continuous translational motion. The microstates here come from which level each particle occupies, not their motion within levels. Choice C describes vibrational motion and positional uncertainty, which aren't relevant to this discrete energy level system. We're counting arrangements among specific energy states, not spatial configurations. Choice D mentions temperature-dependent degeneracy, but the problem states three specific energy levels (0, ϵ\epsilon, 2ϵ2\epsilon) without indicating their degeneracies change with temperature. The entropy increase comes from thermal population redistribution, not changing degeneracies. Choice B correctly identifies that thermal population of higher levels increases the ways to distribute distinguishable particles among states—this is the dominant factor driving entropy increase. Study tip: For statistical mechanics problems, always ask "what creates new microstates?" Temperature typically increases entropy by making more quantum states accessible, not by changing the states themselves.

Question 17

Consider a system where entropy is measured as a function of internal energy U. The relationship follows S(U)=32NklnU+constantS(U) = \frac{3}{2}Nk \ln U + \text{constant}. If the internal energy doubles, what is the microscopic interpretation of the entropy change, and what does this reveal about the system?

  1. ΔS=32Nkln2\Delta S = \frac{3}{2}Nk \ln 2; this indicates a three-dimensional ideal gas where energy primarily affects translational kinetic energy microstates of the molecules. (correct answer)
  2. ΔS=3Nkln2\Delta S = 3Nk \ln 2; this suggests a system with both kinetic and potential energy contributions, where doubling energy creates exponentially more accessible microstates.
  3. ΔS=32Nkln2\Delta S = \frac{3}{2}Nk \ln 2; this represents a harmonic oscillator system where energy quantization leads to logarithmic scaling of microstate density with total energy.
  4. ΔS=32Nkln4\Delta S = \frac{3}{2}Nk \ln 4; the entropy change indicates a two-dimensional system where energy doubling affects both x and y translational degrees of freedom independently.
  5. ΔS=32Nkln2\Delta S = \frac{3}{2}Nk \ln 2; this behavior is characteristic of photon gas systems where energy-entropy scaling reflects the massless nature of the constituent particles.
Explanation: When you encounter entropy-energy relationships in statistical thermodynamics, you're examining how the number of accessible microstates changes with energy. The given relationship S(U)=32NklnU+constantS(U) = \frac{3}{2}Nk \ln U + \text{constant} is characteristic of specific physical systems. To find the entropy change when energy doubles, calculate: ΔS=S(2U)S(U)=32Nkln(2U)32Nkln(U)=32Nkln2\Delta S = S(2U) - S(U) = \frac{3}{2}Nk \ln(2U) - \frac{3}{2}Nk \ln(U) = \frac{3}{2}Nk \ln 2. This logarithmic dependence on energy is the signature of a three-dimensional ideal gas, where the entropy primarily reflects translational kinetic energy microstates. In such systems, the number of momentum states scales as U3/2U^{3/2}, leading directly to this entropy-energy relationship. Choice B incorrectly doubles the coefficient to 3Nkln23Nk \ln 2, which would correspond to a different system entirely—one where entropy scales as U3U^3 rather than U3/2U^{3/2}. Choice C gets the calculation right but misidentifies the system as harmonic oscillators, where you'd expect different scaling behavior due to energy quantization. Choice D makes a calculation error (ln4\ln 4 instead of ln2\ln 2) and incorrectly suggests a two-dimensional system, which would have a 22Nk=Nk\frac{2}{2}Nk = Nk coefficient, not 32Nk\frac{3}{2}Nk. Study tip: Remember that the coefficient in SNklnUS \propto Nk \ln U directly tells you the dimensionality—f2Nk\frac{f}{2}Nk where ff is the degrees of freedom. For translational motion, this equals the spatial dimensions.

Question 18

A diatomic gas undergoes expansion where both translational and rotational modes contribute to entropy. If the translational entropy increases by ΔStrans=Rln(8)\Delta S_{trans} = R\ln(8) and the total entropy increases by ΔStotal=Rln(16)\Delta S_{total} = R\ln(16), what can be concluded about the rotational contribution?

  1. ΔSrot=Rln(2)\Delta S_{rot} = R\ln(2) because rotational entropy changes independently and additively with translational entropy
  2. ΔSrot=Rln(8)\Delta S_{rot} = R\ln(8) because rotational and translational contributions must be equal for diatomic molecules
  3. ΔSrot=0\Delta S_{rot} = 0 because rotational modes are not significantly populated at typical temperatures
  4. ΔSrot=Rln(16)Rln(8)=Rln(2)\Delta S_{rot} = R\ln(16) - R\ln(8) = R\ln(2) from direct subtraction of logarithmic entropy contributions (correct answer)
Explanation: Since entropy contributions are additive: ΔStotal=ΔStrans+ΔSrot\Delta S_{total} = \Delta S_{trans} + \Delta S_{rot}. Therefore: ΔSrot=Rln(16)Rln(8)=Rln(16/8)=Rln(2)\Delta S_{rot} = R\ln(16) - R\ln(8) = R\ln(16/8) = R\ln(2). Choice A reaches the right answer but with incorrect reasoning about independence. Choice B assumes equal contributions without justification. Choice C incorrectly claims rotational modes aren't populated.

Question 19

Consider a quantum harmonic oscillator at temperature T where the entropy is S=kB[βωnln(1eβω)]S = k_B [\beta \hbar \omega \langle n \rangle - \ln(1 - e^{-\beta \hbar \omega})] with n\langle n \rangle being the average occupation number. In the high temperature limit (kBTωk_B T \gg \hbar \omega), what is the dominant contribution to entropy?

  1. The term βωn\beta \hbar \omega \langle n \rangle dominates because thermal energy creates many excited states
  2. Both terms contribute equally because the oscillator becomes classical with equipartition theorem
  3. The term ln(1eβω)-\ln(1 - e^{-\beta \hbar \omega}) dominates and approaches ln(βω)\ln(\beta \hbar \omega) for large temperatures (correct answer)
  4. The entropy approaches zero because high temperature destroys quantum coherence effects
Explanation: When analyzing quantum harmonic oscillators at different temperatures, you need to understand how thermal energy compares to the quantum energy scale ω\hbar \omega. The high temperature limit occurs when kBTωk_B T \gg \hbar \omega, meaning βω=ωkBT1\beta \hbar \omega = \frac{\hbar \omega}{k_B T} \ll 1. In this limit, you can expand the exponential term: eβω1βωe^{-\beta \hbar \omega} \approx 1 - \beta \hbar \omega for small βω\beta \hbar \omega. This makes 1eβωβω1 - e^{-\beta \hbar \omega} \approx \beta \hbar \omega, so ln(1eβω)ln(β\hharω)=ln(kBT/ω)-\ln(1 - e^{-\beta \hbar \omega}) \approx -\ln(\beta \hhar \omega) = \ln(k_B T/\hbar \omega). Since temperature is large, this logarithmic term grows without bound and dominates the entropy. Meanwhile, the average occupation number n=1eβω11βω=kBTω\langle n \rangle = \frac{1}{e^{\beta \hbar \omega} - 1} \approx \frac{1}{\beta \hbar \omega} = \frac{k_B T}{\hbar \omega} in the high temperature limit. The first term becomes βωn1\beta \hbar \omega \langle n \rangle \approx 1, which remains finite. Answer A incorrectly suggests the occupation term dominates—while n\langle n \rangle grows linearly with temperature, it's multiplied by the small factor βω\beta \hbar \omega. Answer B misses that the logarithmic term grows faster than the linear term. Answer D is wrong because high temperature increases entropy rather than destroying it. Study tip: In high-temperature quantum systems, look for logarithmic terms involving kBTk_B T—these typically dominate because logarithms of large quantities grow without bound while other terms often saturate.

Question 20

A protein can exist in two conformations: folded (F) with 1 accessible microstate and unfolded (U) with 10610^6 accessible microstates. At equilibrium, 90% of proteins are folded. What is the ratio of the entropy per molecule in the unfolded state to the folded state?

  1. SUSF=106\frac{S_U}{S_F} = 10^6 because entropy scales directly with the number of microstates
  2. SUSF=ln(106)ln(1)=\frac{S_U}{S_F} = \frac{\ln(10^6)}{\ln(1)} = \infty because the folded state has zero configurational entropy (correct answer)
  3. SUSF=0.10.9=0.11\frac{S_U}{S_F} = \frac{0.1}{0.9} = 0.11 because entropy is proportional to population fractions
  4. SUSF=ln(106)+ln(0.1)ln(1)+ln(0.9)\frac{S_U}{S_F} = \frac{\ln(10^6) + \ln(0.1)}{\ln(1) + \ln(0.9)} accounting for both conformational and mixing contributions
Explanation: The entropy per molecule depends only on accessible microstates: S=kBln(Ω)S = k_B \ln(\Omega). For unfolded: SU=kBln(106)S_U = k_B \ln(10^6). For folded: SF=kBln(1)=0S_F = k_B \ln(1) = 0. Therefore SU/SF=S_U/S_F = \infty. Choice A confuses entropy with microstate count. Choice C incorrectly uses population fractions. Choice D inappropriately mixes single-molecule and ensemble properties.