Math 2 Quiz: Independence Of Events
20 questions · exam conditions
0:00
Independence Of EventsQuestion 1 of 20

In a quality control process, two inspectors independently examine products. Inspector 1 rejects 8% of products, Inspector 2 rejects 12% of products, and both inspectors reject the same product 1.5% of the time. A quality manager assumes the inspections are independent. Which statistical test most directly challenges this assumption?

Compare P(R2R1)=0.0150.08=0.1875P(R_2|R_1) = \frac{0.015}{0.08} = 0.1875 with P(R2)=0.12P(R_2) = 0.12; the difference reveals dependence
Compare P(R2R1)=0.0150.08=0.1875P(R_2|R_1) = \frac{0.015}{0.08} = 0.1875 with P(R2)=0.12P(R_2) = 0.12; the agreement supports independence
Compare P(R1R2)=0.1854P(R_1 \cup R_2) = 0.1854 with P(R1)+P(R2)=0.20P(R_1) + P(R_2) = 0.20; the difference shows independence
Compare P(R1R2)=0.015P(R_1 \cap R_2) = 0.015 with P(R1)×P(R2)=0.0096P(R_1) \times P(R_2) = 0.0096; the difference indicates dependence
← Back to quizzes

Math 2 Quiz

Math 2 Quiz: Independence Of Events

Practice Independence Of Events in Math 2 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Independence Of Events, giving you a quick way to practice the rules, question types, and explanations that matter most for Math 2.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

In a quality control process, two inspectors independently examine products. Inspector 1 rejects 8% of products, Inspector 2 rejects 12% of products, and both inspectors reject the same product 1.5% of the time. A quality manager assumes the inspections are independent. Which statistical test most directly challenges this assumption?

  1. Compare P(R2R1)=0.0150.08=0.1875P(R_2|R_1) = \frac{0.015}{0.08} = 0.1875 with P(R2)=0.12P(R_2) = 0.12; the difference reveals dependence (correct answer)
  2. Compare P(R2R1)=0.0150.08=0.1875P(R_2|R_1) = \frac{0.015}{0.08} = 0.1875 with P(R2)=0.12P(R_2) = 0.12; the agreement supports independence
  3. Compare P(R1R2)=0.1854P(R_1 \cup R_2) = 0.1854 with P(R1)+P(R2)=0.20P(R_1) + P(R_2) = 0.20; the difference shows independence
  4. Compare P(R1R2)=0.015P(R_1 \cap R_2) = 0.015 with P(R1)×P(R2)=0.0096P(R_1) \times P(R_2) = 0.0096; the difference indicates dependence
Explanation: When you encounter questions about statistical independence, the key concept to remember is that two events are independent if and only if the probability of one event occurring doesn't change based on whether the other event occurs. Mathematically, events A and B are independent when P(AB)=P(A)P(A|B) = P(A) or equivalently P(AB)=P(A)×P(B)P(A \cap B) = P(A) \times P(B). The most direct way to test independence is comparing conditional probability with marginal probability. Here, we calculate P(R2R1)=P(R1R2)P(R1)=0.0150.08=0.1875P(R_2|R_1) = \frac{P(R_1 \cap R_2)}{P(R_1)} = \frac{0.015}{0.08} = 0.1875. If inspections were truly independent, this should equal P(R2)=0.12P(R_2) = 0.12. Since 0.1875 ≠ 0.12, the inspections are dependent, directly challenging the independence assumption. Choice A correctly identifies this difference as evidence of dependence. Choice B uses the same calculation but incorrectly concludes the difference supports independence—this represents a fundamental misunderstanding of what independence means. Choice C compares the union probability with the sum of individual probabilities, but this tests a different property and doesn't directly address independence. Choice D compares P(R1R2)P(R_1 \cap R_2) with P(R1)×P(R2)P(R_1) \times P(R_2), which is a valid independence test, but the conditional probability approach in choice A is more direct and intuitive. Remember: To test independence, always check if P(AB)=P(A)P(A|B) = P(A). If these probabilities differ significantly, the events are dependent, which challenges any assumption of independence.

Question 2

A manufacturing company produces widgets with a defect rate of 8%. Quality control tests each widget independently with a detection accuracy of 95% (correctly identifies 95% of defective widgets as defective and 95% of non-defective widgets as non-defective). If events DD = "widget is defective" and TT = "test indicates defective," which statement about independence is correct?

  1. Events DD and TT are independent because P(D)=0.08P(D) = 0.08 and P(T)=0.122P(T) = 0.122, so different marginal probabilities indicate independence
  2. Events DD and TT are independent because the test accuracy is 95%, which means high accuracy guarantees independence between actual and detected defects
  3. Events DD and TT are not independent because P(TD)=0.95P(T)=0.124P(T|D) = 0.95 \neq P(T) = 0.124, violating the fundamental independence condition
  4. Events DD and TT are not independent because P(TD)=0.95P(T)=0.122P(T|D) = 0.95 \neq P(T) = 0.122, violating the independence condition (correct answer)
Explanation: For independence, we need P(TD)=P(T)P(T|D) = P(T). First, calculate P(T)P(T) using the law of total probability: P(T)=P(TD)P(D)+P(TDc)P(Dc)=0.950.08+0.050.92=0.076+0.046=0.122P(T) = P(T|D) \cdot P(D) + P(T|D^c) \cdot P(D^c) = 0.95 \cdot 0.08 + 0.05 \cdot 0.92 = 0.076 + 0.046 = 0.122. Since P(TD)=0.950.122=P(T)P(T|D) = 0.95 \neq 0.122 = P(T), the events are not independent. Choice A incorrectly assumes different marginal probabilities indicate independence. Choice B incorrectly assumes high accuracy guarantees independence. Choice C uses the wrong value for P(T)P(T).

Question 3

A survey of 200 students found that 60 play basketball, 80 play soccer, and 20 play both sports. Define events BB = "plays basketball" and SS = "plays soccer." Which conclusion about independence is justified?

  1. Events BB and SS are independent because P(BS)=0.10P(B \cap S) = 0.10 and P(B)P(S)=0.300.40=0.12P(B) \cdot P(S) = 0.30 \cdot 0.40 = 0.12, which are approximately equal
  2. Events BB and SS are not independent because P(BS)=0.100.12=P(B)P(S)P(B \cap S) = 0.10 \neq 0.12 = P(B) \cdot P(S), violating the independence criterion (correct answer)
  3. Events BB and SS are independent because P(SB)=13P(S|B) = \frac{1}{3} and P(S)=0.40P(S) = 0.40, and the difference 115\frac{1}{15} is negligible for practical purposes
  4. Events BB and SS are not independent because more students play soccer than basketball, creating an inherent dependence between the sports
Explanation: For independence, we need P(BS)=P(B)P(S)P(B \cap S) = P(B) \cdot P(S). We have P(B)=60200=0.30P(B) = \frac{60}{200} = 0.30, P(S)=80200=0.40P(S) = \frac{80}{200} = 0.40, and P(BS)=20200=0.10P(B \cap S) = \frac{20}{200} = 0.10. Since P(B)P(S)=0.30×0.40=0.120.10P(B) \cdot P(S) = 0.30 \times 0.40 = 0.12 \neq 0.10, the events are not independent. Choice A incorrectly considers 0.10 and 0.12 "approximately equal." Choice C incorrectly dismisses the difference as negligible. Choice D incorrectly assumes different marginal probabilities imply dependence.

Question 4

A weather forecasting model predicts rain and wind independently. Historical data shows P(Rain)=0.3P(\text{Rain}) = 0.3, P(Wind)=0.4P(\text{Wind}) = 0.4, and P(Rain and Wind)=0.15P(\text{Rain and Wind}) = 0.15. A meteorologist questions whether the model's independence assumption is valid. Using conditional probability, what analysis supports or refutes this assumption?

  1. Independence is confirmed because P(WindRain)=0.150.3=0.5P(\text{Wind}|\text{Rain}) = \frac{0.15}{0.3} = 0.5 equals P(Wind)=0.4P(\text{Wind}) = 0.4
  2. Independence is refuted because P(WindRain)=0.150.3=0.50.4=P(Wind)P(\text{Wind}|\text{Rain}) = \frac{0.15}{0.3} = 0.5 \neq 0.4 = P(\text{Wind})
  3. Independence is confirmed because P(RainWind)=0.150.4=0.375P(\text{Rain}|\text{Wind}) = \frac{0.15}{0.4} = 0.375 equals P(Rain)=0.3P(\text{Rain}) = 0.3
  4. Independence is refuted because P(RainWind)=0.150.4=0.3750.3=P(Rain)P(\text{Rain}|\text{Wind}) = \frac{0.15}{0.4} = 0.375 \neq 0.3 = P(\text{Rain}) (correct answer)
Explanation: For independence, we need P(RainWind)=P(Rain)P(\text{Rain}|\text{Wind}) = P(\text{Rain}). Using conditional probability: P(RainWind)=P(Rain and Wind)P(Wind)=0.150.4=0.375P(\text{Rain}|\text{Wind}) = \frac{P(\text{Rain and Wind})}{P(\text{Wind})} = \frac{0.15}{0.4} = 0.375. Since P(RainWind)=0.3750.3=P(Rain)P(\text{Rain}|\text{Wind}) = 0.375 \neq 0.3 = P(\text{Rain}), the independence assumption is invalid. Choice A tests the wrong conditional probability. Choice B reaches the correct conclusion but analyzes P(WindRain)P(\text{Wind}|\text{Rain}) instead. Choice C incorrectly claims 0.375 equals 0.3.

Question 5

In a card game, player A draws a card from a standard deck and keeps it. Then player B draws from the remaining cards. Let RAR_A = "A draws red" and RBR_B = "B draws red." A student claims these events are independent because "each player draws randomly." What is the flaw in this reasoning?

  1. The reasoning is correct; random drawing always ensures independence between sequential events in probability experiments
  2. Independence requires P(RBRA)=P(RB)P(R_B|R_A) = P(R_B), but P(RBRA)=25512652=P(RB)P(R_B|R_A) = \frac{25}{51} \neq \frac{26}{52} = P(R_B) due to sampling without replacement (correct answer)
  3. Independence requires equal probabilities, but P(RA)=2652P(R_A) = \frac{26}{52} while P(RB)=2551P(R_B) = \frac{25}{51}, showing the events cannot be independent
  4. Independence requires P(RARB)=P(RA)+P(RB)P(R_A \cap R_B) = P(R_A) + P(R_B), but this additive rule fails when cards are drawn sequentially
Explanation: Independence requires P(RBRA)=P(RB)P(R_B|R_A) = P(R_B). When A draws red, 25 red cards remain out of 51 total, so P(RBRA)=2551P(R_B|R_A) = \frac{25}{51}. Initially, P(RB)=2652=12P(R_B) = \frac{26}{52} = \frac{1}{2}. Since 255112\frac{25}{51} \neq \frac{1}{2}, the events are dependent. Choice A incorrectly assumes random drawing guarantees independence. Choice C confuses the definition of independence with equal probabilities. Choice D incorrectly states the multiplication rule as addition.

Question 6

A medical test has a 90% sensitivity (detects 90% of positive cases) and 85% specificity (correctly identifies 85% of negative cases). In a population where 3% have the condition, let CC = "has condition" and TT = "tests positive." Which statement correctly evaluates independence?

  1. Events CC and TT are independent because the test sensitivity and specificity are both high, indicating reliable and unbiased performance
  2. Events CC and TT are independent because P(TC)=0.90P(T|C) = 0.90 and P(T)=0.173P(T) = 0.173, and the ratio indicates reasonable diagnostic performance
  3. Events CC and TT are not independent because P(TC)=0.900.173=P(T)P(T|C) = 0.90 \neq 0.173 = P(T), showing test results depend on condition status (correct answer)
  4. Events CC and TT are not independent because P(TC)=0.900.173=P(T)P(T|C) = 0.90 \neq 0.173 = P(T), demonstrating the test's diagnostic dependence
Explanation: For independence, we need P(TC)=P(T)P(T|C) = P(T). We have P(TC)=0.90P(T|C) = 0.90. Using the law of total probability: P(T)=P(TC)P(C)+P(TCc)P(Cc)=0.90×0.03+0.15×0.97=0.027+0.146=0.173P(T) = P(T|C) \cdot P(C) + P(T|C^c) \cdot P(C^c) = 0.90 \times 0.03 + 0.15 \times 0.97 = 0.027 + 0.146 = 0.173. Since P(TC)=0.900.173P(T|C) = 0.90 \neq 0.173, the events are dependent. Choice A incorrectly assumes high accuracy implies independence. Choice B misunderstands what the ratio indicates about independence. Choice D reaches the correct conclusion but with less specific reasoning.

Question 7

Two events AA and BB satisfy P(A)=0.4P(A) = 0.4, P(B)=0.3P(B) = 0.3, and P(AB)=0.58P(A \cup B) = 0.58. A student uses the inclusion-exclusion principle to find P(AB)=0.12P(A \cap B) = 0.12 and concludes the events are independent because 0.4×0.3=0.120.4 \times 0.3 = 0.12. What additional verification should be performed?

  1. Check if P(ABc)=P(A)P(A|B^c) = P(A) to ensure independence holds for complement events as well, providing complete verification of the independence condition
  2. Check if P(AB)=P(A)+P(B)P(A \cup B) = P(A) + P(B) to verify mutual exclusivity, which is necessary for independence in probability theory
  3. No additional verification needed; the multiplication rule P(AB)=P(A)×P(B)P(A \cap B) = P(A) \times P(B) is sufficient to establish independence between events (correct answer)
  4. Check if P(AcBc)=P(Ac)×P(Bc)P(A^c \cap B^c) = P(A^c) \times P(B^c) to confirm independence extends to complement events, ensuring mathematical consistency
Explanation: The student correctly applied the independence test. Since P(AB)=0.12=0.4×0.3=P(A)×P(B)P(A \cap B) = 0.12 = 0.4 \times 0.3 = P(A) \times P(B), the events are indeed independent. This single condition is both necessary and sufficient for independence. Choice A suggests an unnecessary additional check (if AA and BB are independent, then so are AA and BcB^c). Choice B incorrectly confuses independence with mutual exclusivity. Choice D suggests checking complements, which would be redundant since independence of AA and BB automatically implies independence of their complements.

Question 8

A psychological study examines the relationship between stress level and sleep quality. Researchers categorize 500 participants as either high-stress or low-stress, and rate their sleep as either good or poor. The data shows: 180 participants have high stress, 120 participants have poor sleep, and 54 participants have both high stress and poor sleep.

Let SS = "participant has high stress" and PP = "participant has poor sleep." Which statement correctly analyzes the independence of these events?

  1. Events SS and PP are independent because P(SP)=0.108P(S \cap P) = 0.108 and P(S)×P(P)=0.36×0.24=0.0864P(S) \times P(P) = 0.36 \times 0.24 = 0.0864, which are reasonably close
  2. Events SS and PP are not independent because P(SP)=0.1080.0864=P(S)×P(P)P(S \cap P) = 0.108 \neq 0.0864 = P(S) \times P(P), indicating psychological dependence
  3. Events SS and PP are independent because P(PS)=0.30P(P|S) = 0.30 and P(P)=0.24P(P) = 0.24, and this small difference suggests minimal association
  4. Events SS and PP are not independent because P(PS)=0.300.24=P(P)P(P|S) = 0.30 \neq 0.24 = P(P), demonstrating conditional dependence between stress and sleep (correct answer)
Explanation: For independence, we need P(PS)=P(P)P(P|S) = P(P). We have P(S)=180500=0.36P(S) = \frac{180}{500} = 0.36, P(P)=120500=0.24P(P) = \frac{120}{500} = 0.24, and P(SP)=54500=0.108P(S \cap P) = \frac{54}{500} = 0.108. Therefore, P(PS)=P(SP)P(S)=0.1080.36=0.30P(P|S) = \frac{P(S \cap P)}{P(S)} = \frac{0.108}{0.36} = 0.30. Since P(PS)=0.300.24=P(P)P(P|S) = 0.30 \neq 0.24 = P(P), the events are not independent. Choice A incorrectly considers 0.108 and 0.0864 "reasonably close." Choice B reaches the correct conclusion but focuses on the multiplication rule. Choice C incorrectly dismisses the difference as minimal.

Question 9

In a computer network, the probability that Server A fails is 0.05, Server B fails is 0.08, and both fail simultaneously is 0.004. Network engineers claim the failures are independent. A systems analyst argues this claim by computing P(AcBc)P(A^c \cap B^c). What should the analyst conclude?

  1. Independence is confirmed because P(AcBc)=0.874P(A^c \cap B^c) = 0.874 matches the expected value of 0.95×0.92=0.8740.95 \times 0.92 = 0.874 under independence (correct answer)
  2. Independence is rejected because P(AcBc)=0.9160.874P(A^c \cap B^c) = 0.916 \neq 0.874, indicating dependence between server failures in the network
  3. Independence is confirmed because P(AB)=0.004=0.05×0.08P(A \cap B) = 0.004 = 0.05 \times 0.08, and this multiplication rule verification is sufficient
  4. Independence is rejected because P(AcBc)=0.916P(A^c \cap B^c) = 0.916 should equal P(Ac)+P(Bc)=1.87P(A^c) + P(B^c) = 1.87 under independence assumptions
Explanation: To check independence, we can verify if P(AcBc)=P(Ac)P(Bc)P(A^c \cap B^c) = P(A^c) \cdot P(B^c). We have P(Ac)=10.05=0.95P(A^c) = 1 - 0.05 = 0.95 and P(Bc)=10.08=0.92P(B^c) = 1 - 0.08 = 0.92. Under independence, P(AcBc)=0.95×0.92=0.874P(A^c \cap B^c) = 0.95 \times 0.92 = 0.874. Using P(AcBc)=1P(AB)=1[P(A)+P(B)P(AB)]=1[0.05+0.080.004]=0.874P(A^c \cap B^c) = 1 - P(A \cup B) = 1 - [P(A) + P(B) - P(A \cap B)] = 1 - [0.05 + 0.08 - 0.004] = 0.874. Since this matches the independence calculation, the servers fail independently. Choice B uses incorrect calculation. Choice C is correct about P(AB)P(A \cap B) but doesn't address the analyst's approach. Choice D incorrectly uses addition instead of multiplication.

Question 10

In a lottery, tickets are numbered 1 through 1000. Let AA = "ticket number is divisible by 4" and BB = "ticket number is divisible by 6." A student calculates P(A)=0.25P(A) = 0.25, P(B)=0.166P(B) = 0.166, and P(AB)=0.083P(A \cap B) = 0.083. Based on these calculations, what conclusion about independence is most appropriate?

  1. Events AA and BB are independent because P(A)×P(B)=0.25×0.166=0.04150.083=P(AB)P(A) \times P(B) = 0.25 \times 0.166 = 0.0415 \approx 0.083 = P(A \cap B)
  2. Events AA and BB are not independent because P(A)×P(B)=0.04150.083=P(AB)P(A) \times P(B) = 0.0415 \neq 0.083 = P(A \cap B); the discrepancy indicates dependence
  3. Events AA and BB are independent because both involve divisibility conditions, which are mathematically unrelated for different prime factors
  4. Events AA and BB are not independent because P(BA)=0.0830.25=0.3320.166=P(B)P(B|A) = \frac{0.083}{0.25} = 0.332 \neq 0.166 = P(B), violating independence conditions (correct answer)
Explanation: For independence, we need P(BA)=P(B)P(B|A) = P(B). Using the conditional probability formula: P(BA)=P(AB)P(A)=0.0830.25=0.332P(B|A) = \frac{P(A \cap B)}{P(A)} = \frac{0.083}{0.25} = 0.332. Since P(BA)=0.3320.166=P(B)P(B|A) = 0.332 \neq 0.166 = P(B), the events are not independent. Note that ABA \cap B corresponds to numbers divisible by lcm(4,6)=12\text{lcm}(4,6) = 12. Choice A incorrectly considers the values approximately equal. Choice B reaches the right conclusion but with less precise reasoning. Choice C incorrectly assumes divisibility by different numbers implies independence.

Question 11

In a standard deck of 52 cards, let A be the event "drawing a red card" and B be the event "drawing a face card." If these events are independent, what must be true about the conditional probability P(AB)P(A|B)?

  1. P(AB)=612=12P(A|B) = \frac{6}{12} = \frac{1}{2} because half of all face cards are red
  2. P(AB)=2652=12P(A|B) = \frac{26}{52} = \frac{1}{2} because independence requires P(AB)=P(A)P(A|B) = P(A) (correct answer)
  3. P(AB)=652=326P(A|B) = \frac{6}{52} = \frac{3}{26} because there are 6 red face cards total
  4. P(AB)=1226=613P(A|B) = \frac{12}{26} = \frac{6}{13} because there are 12 face cards among 26 red cards
Explanation: For independent events, P(A|B) = P(A). Since P(A) = 26/52 = 1/2 (probability of drawing a red card), if the events are independent, then P(A|B) must equal 1/2. We can verify: P(A|B) = P(A∩B)/P(B) = (6/52)/(12/52) = 6/12 = 1/2, confirming independence. Choice A gives the right value but wrong reasoning. Choice C confuses conditional probability calculation. Choice D reverses the conditional probability.

Question 12

A survey of 200 students found that 80 students like pizza, 60 students like burgers, and 30 students like both pizza and burgers. If a student is randomly selected from this group, what can be concluded about the events "the student likes pizza" and "the student likes burgers"?

  1. The events are independent because P(pizza and burgers)=P(pizza)×P(burgers)P(\text{pizza and burgers}) = P(\text{pizza}) \times P(\text{burgers})
  2. The events are not independent because P(pizza and burgers)P(pizza)×P(burgers)P(\text{pizza and burgers}) \neq P(\text{pizza}) \times P(\text{burgers}) (correct answer)
  3. The events are independent because some students like both pizza and burgers
  4. The events are not independent because P(pizza|burgers)=P(pizza)P(\text{pizza|burgers}) = P(\text{pizza})
Explanation: To check independence, we need to verify if P(A ∩ B) = P(A) × P(B). Here, P(pizza) = 80/200 = 0.4, P(burgers) = 60/200 = 0.3, and P(pizza and burgers) = 30/200 = 0.15. Since P(pizza) × P(burgers) = 0.4 × 0.3 = 0.12 ≠ 0.15, the events are not independent. Choice A incorrectly states they are independent. Choice C shows a misunderstanding that overlap prevents independence. Choice D incorrectly states the condition for independence.

Question 13

In a certain high school, 40% of students take calculus, 25% take physics, and 15% take both calculus and physics. A guidance counselor claims that taking calculus and taking physics are independent choices. To verify this claim, which calculation should be performed?

  1. Check if P(physics|calculus)=0.150.40=0.375P(\text{physics|calculus}) = \frac{0.15}{0.40} = 0.375 equals P(physics)=0.25P(\text{physics}) = 0.25
  2. Check if P(calculus|physics)=0.150.25=0.60P(\text{calculus|physics}) = \frac{0.15}{0.25} = 0.60 equals P(calculus)=0.40P(\text{calculus}) = 0.40
  3. Check if P(calculus or physics)=0.50P(\text{calculus or physics}) = 0.50 equals P(calculus)+P(physics)=0.65P(\text{calculus}) + P(\text{physics}) = 0.65
  4. Check if P(both)=0.15P(\text{both}) = 0.15 equals P(calculus)×P(physics)=0.40×0.25=0.10P(\text{calculus}) \times P(\text{physics}) = 0.40 \times 0.25 = 0.10 (correct answer)
Explanation: When you encounter questions about independence in probability, remember that two events are independent if the occurrence of one doesn't affect the probability of the other. There are several equivalent ways to test this, but the most fundamental is checking whether P(A and B)=P(A)×P(B)P(A \text{ and } B) = P(A) \times P(B). The correct approach is answer choice D: calculate whether P(both)=P(calculus)×P(physics)P(\text{both}) = P(\text{calculus}) \times P(\text{physics}). If calculus and physics choices are truly independent, then 0.150.15 should equal 0.40×0.25=0.100.40 \times 0.25 = 0.10. Since 0.150.100.15 \neq 0.10, the events are not independent—students who take calculus are actually more likely to take physics than the general population. Choice A incorrectly calculates the conditional probability P(physics|calculus)P(\text{physics|calculus}) but fails to recognize that this conditional probability (0.375) being different from P(physics)=0.25P(\text{physics}) = 0.25 actually proves dependence, not independence. Choice B makes the same error in reverse, calculating P(calculus|physics)P(\text{calculus|physics}). Both A and B actually demonstrate dependence but frame it as a test for independence. Choice C tests whether P(calculus or physics)=P(calculus)+P(physics)P(\text{calculus or physics}) = P(\text{calculus}) + P(\text{physics}), which would only be true if the events were mutually exclusive (impossible to occur together), not independent. This confuses two completely different concepts. Remember: for independence, always check if P(A and B)=P(A)×P(B)P(A \text{ and } B) = P(A) \times P(B). If they're equal, the events are independent; if not, they're dependent.

Question 14

A bag contains red and blue marbles. Event R is "drawing a red marble on the first draw" and event B is "drawing a blue marble on the second draw" (without replacement). For these events to be independent, what must be true about the composition of the bag?

  1. The events can never be independent when sampling without replacement from a finite bag (correct answer)
  2. The bag must be infinite in size so that removing one marble doesn't change probabilities
  3. The bag must contain equal numbers of red and blue marbles for symmetry
  4. The bag must contain only one color of marble to eliminate dependence
Explanation: When you encounter problems about independence in probability, remember that two events are independent only if the outcome of the first event doesn't affect the probability of the second event. This means P(BR)=P(B)P(B|R) = P(B) - the probability of drawing blue second must be the same whether you drew red or blue first. Let's think about what happens when sampling without replacement from a finite bag. If you draw a red marble first, you've removed one red marble, changing the composition of the remaining marbles. This necessarily changes the probability of drawing blue on the second draw compared to if you had drawn blue first. No matter how you arrange the colors, removing any marble from a finite collection changes the ratios. Looking at the answer choices: A is correct because true independence requires that the first draw doesn't change the probability structure for the second draw, which is impossible with finite sampling without replacement. B suggests an infinite bag would work, but the question specifically asks about "a bag" in practical terms. C incorrectly assumes equal numbers create independence - even with 50-50 ratios, removing one marble still changes the remaining proportions. D is wrong because if there's only one color, you can't have both red and blue marbles as described in the events. The key insight for probability problems: always check whether the sample space changes between events. When sampling without replacement from finite populations, the events are inherently dependent because each draw changes the conditions for subsequent draws.

Question 15

Two dice are rolled simultaneously. Let A be the event "the first die shows an even number" and B be the event "the sum of both dice is 8." A student calculates P(A)=12P(A) = \frac{1}{2}, P(B)=536P(B) = \frac{5}{36}, and P(AB)=236P(A \cap B) = \frac{2}{36}. What should the student conclude about independence?

  1. Events A and B are independent because P(A)×P(B)=12×536=572=2.536P(A) \times P(B) = \frac{1}{2} \times \frac{5}{36} = \frac{5}{72} = \frac{2.5}{36}
  2. Events A and B are independent because P(A)×P(B)=12×536=572236P(A) \times P(B) = \frac{1}{2} \times \frac{5}{36} = \frac{5}{72} \approx \frac{2}{36}
  3. Events A and B are not independent because P(A)×P(B)=572236=472P(A) \times P(B) = \frac{5}{72} \neq \frac{2}{36} = \frac{4}{72} (correct answer)
  4. Events A and B are not independent because P(AB)=2/365/36=2512P(A|B) = \frac{2/36}{5/36} = \frac{2}{5} \neq \frac{1}{2}
Explanation: To check independence, compare P(A) × P(B) with P(A ∩ B). We have P(A) × P(B) = (1/2) × (5/36) = 5/72, while P(A ∩ B) = 2/36 = 4/72. Since 5/72 ≠ 4/72, the events are not independent. Choice A makes an error in decimal conversion. Choice B incorrectly claims the values are approximately equal when they're clearly different. Choice D uses the correct alternative method (conditional probability) and reaches the right conclusion, but choice C more directly addresses the standard independence test.

Question 16

In a large corporation, 30% of employees work in sales, 20% have MBA degrees, and 8% both work in sales and have MBA degrees. The HR director wants to determine if having an MBA and working in sales are independent characteristics. Based on this information, which statement is most accurate?

  1. The characteristics are not independent because P(sales)×P(MBA)=0.060.08=P(sales and MBA)P(\text{sales}) \times P(\text{MBA}) = 0.06 \neq 0.08 = P(\text{sales and MBA}) (correct answer)
  2. The characteristics are independent because P(sales and MBA)=0.08P(\text{sales and MBA}) = 0.08 is less than both individual probabilities
  3. The characteristics are independent because P(MBA|sales)=8300.267P(\text{MBA|sales}) = \frac{8}{30} \approx 0.267 is close to P(MBA)=0.20P(\text{MBA}) = 0.20
  4. The characteristics are not independent because P(MBA|sales)=8300.267>P(MBA)=0.20P(\text{MBA|sales}) = \frac{8}{30} \approx 0.267 > P(\text{MBA}) = 0.20
Explanation: When you encounter questions about independence of events or characteristics, you need to test whether knowing one event affects the probability of the other. Two events are independent if P(A and B)=P(A)×P(B)P(A \text{ and } B) = P(A) \times P(B). Let's check this condition with the given data. We have P(sales)=0.30P(\text{sales}) = 0.30, P(MBA)=0.20P(\text{MBA}) = 0.20, and P(sales and MBA)=0.08P(\text{sales and MBA}) = 0.08. If these characteristics were independent, we would expect P(sales)×P(MBA)=0.30×0.20=0.06P(\text{sales}) \times P(\text{MBA}) = 0.30 \times 0.20 = 0.06 to equal P(sales and MBA)=0.08P(\text{sales and MBA}) = 0.08. Since 0.060.080.06 \neq 0.08, the characteristics are not independent. Choice A correctly identifies this relationship and concludes the characteristics are not independent, making it the right answer. Choice B incorrectly suggests independence because the joint probability is smaller than individual probabilities. This reasoning is flawed—independence isn't about relative magnitude but about the multiplicative relationship. Choice C uses conditional probability P(MBA|sales)=0.080.300.267P(\text{MBA|sales}) = \frac{0.08}{0.30} \approx 0.267 and claims this is "close to" P(MBA)=0.20P(\text{MBA}) = 0.20. However, 0.267 is notably different from 0.20, and "close" isn't sufficient for independence anyway. Choice D correctly calculates that P(MBA|sales)>P(MBA)P(\text{MBA|sales}) > P(\text{MBA}), indicating dependence, but the question asks which statement is most accurate, and A provides the most direct and complete analysis. Remember: For independence questions, always check if P(A and B)=P(A)×P(B)P(A \text{ and } B) = P(A) \times P(B). This is the most straightforward test and avoids subjective interpretations of conditional probabilities.

Question 17

A medical test for a rare disease has the following characteristics: 2% of the population has the disease, 95% of people with the disease test positive, and 8% of people without the disease test positive. Are the events "having the disease" and "testing positive" independent?

  1. Yes, because P(positive|disease)=0.95P(\text{positive|disease}) = 0.95 is much higher than P(positive)=0.0778P(\text{positive}) = 0.0778
  2. No, because P(positive|disease)=0.95P(positive)=0.1074P(\text{positive|disease}) = 0.95 \neq P(\text{positive}) = 0.1074 (correct answer)
  3. Yes, because the test correctly identifies 95% of diseased individuals, showing independence
  4. No, because P(positive|no disease)=0.08P(positive|disease)=0.95P(\text{positive|no disease}) = 0.08 \neq P(\text{positive|disease}) = 0.95
Explanation: For independence, P(positive|disease) must equal P(positive). First calculate P(positive) = P(positive|disease) × P(disease) + P(positive|no disease) × P(no disease) = 0.95 × 0.02 + 0.08 × 0.98 = 0.019 + 0.0784 = 0.1074. Since P(positive|disease) = 0.95 ≠ 0.1074 = P(positive), the events are not independent. Choice A uses wrong reasoning about independence. Choice C misunderstands what independence means in this context. Choice D compares irrelevant conditional probabilities.

Question 18

A researcher studying voter behavior finds that P(votes Democrat)=0.45P(\text{votes Democrat}) = 0.45, P(college graduate)=0.35P(\text{college graduate}) = 0.35, and P(votes Democrat|college graduate)=0.60P(\text{votes Democrat|college graduate}) = 0.60. What can be concluded about the independence of voting preference and education level?

  1. The events are independent because P(Democrat|college)=0.60>P(Democrat)=0.45P(\text{Democrat|college}) = 0.60 > P(\text{Democrat}) = 0.45
  2. The events are dependent because P(Democrat and college)=0.21<P(Democrat)×P(college)P(\text{Democrat and college}) = 0.21 < P(\text{Democrat}) \times P(\text{college})
  3. The events are independent because both P(Democrat)P(\text{Democrat}) and P(college)P(\text{college}) are less than 0.50
  4. The events are dependent because P(Democrat|college)=0.60P(Democrat)=0.45P(\text{Democrat|college}) = 0.60 \neq P(\text{Democrat}) = 0.45 (correct answer)
Explanation: When you encounter probability questions about independence, you need to test whether one event affects the likelihood of another. Two events are independent if knowing one event occurred doesn't change the probability of the other event. The formal test for independence is: events A and B are independent if and only if P(AB)=P(A)P(A|B) = P(A). Let's apply this test here. We have P(votes Democrat)=0.45P(\text{votes Democrat}) = 0.45 and P(votes Democrat|college graduate)=0.60P(\text{votes Democrat|college graduate}) = 0.60. Since 0.600.450.60 \neq 0.45, knowing someone is a college graduate changes the probability they vote Democrat from 45% to 60%. This proves the events are dependent. Option A incorrectly states the events are independent, when the fact that P(Democrat|college)>P(Democrat)P(\text{Democrat|college}) > P(\text{Democrat}) actually proves dependence. Option B makes a calculation error—it claims P(Democrat and college)=0.21P(\text{Democrat and college}) = 0.21 is less than P(Democrat)×P(college)=0.45×0.35=0.1575P(\text{Democrat}) \times P(\text{college}) = 0.45 \times 0.35 = 0.1575, but 0.21>0.15750.21 > 0.1575. Also, we can verify: P(Democrat and college)=P(Democrat|college)×P(college)=0.60×0.35=0.21P(\text{Democrat and college}) = P(\text{Democrat|college}) \times P(\text{college}) = 0.60 \times 0.35 = 0.21. Option C completely misunderstands independence—it has nothing to do with whether individual probabilities are above or below 0.50. The correct answer is D because it properly applies the independence test and correctly identifies that the unequal conditional and unconditional probabilities indicate dependence. Study tip: Always check independence by comparing P(AB)P(A|B) to P(A)P(A). If they're different, the events are dependent.

Question 19

A quality control inspector finds that in a batch of electronic components, 15% are defective. She also finds that 8% of all components have a manufacturing date in January, and 1.5% of all components are both defective and made in January. What conclusion can be drawn about the relationship between being defective and being made in January?

  1. The events are independent because the percentage of defective January components is higher than expected
  2. The events are dependent because 1.5% is much smaller than either 15% or 8% individually
  3. The events are independent because 0.15×0.08=0.0120.0150.15 \times 0.08 = 0.012 \neq 0.015 (correct answer)
  4. The events are independent because 0.15×0.08=0.012=0.0150.15 \times 0.08 = 0.012 = 0.015 (within rounding)
Explanation: For independence, P(defective ∩ January) should equal P(defective) × P(January). We have P(defective) = 0.15, P(January) = 0.08, so P(defective) × P(January) = 0.012. Since P(defective ∩ January) = 0.015 ≠ 0.012, the events are not independent. Choice A misinterprets what independence means. Choice B uses faulty reasoning about intersection probability. Choice D incorrectly suggests the values are equal within rounding when they clearly differ significantly.

Question 20

Two events A and B have probabilities P(A)=0.4P(A) = 0.4, P(B)=0.3P(B) = 0.3, and P(AB)=0.58P(A \cup B) = 0.58. A student claims that events A and B are independent. Which statement best evaluates this claim?

  1. The claim is correct because P(AB)<P(A)+P(B)P(A \cup B) < P(A) + P(B), indicating no overlap between independent events
  2. The claim is incorrect because for independent events, P(AB)P(A \cup B) should equal P(A)+P(B)=0.7P(A) + P(B) = 0.7
  3. The claim is correct because P(AB)=0.12P(A \cap B) = 0.12, and P(A)×P(B)=0.4×0.3=0.12P(A) \times P(B) = 0.4 \times 0.3 = 0.12 (correct answer)
  4. The claim is incorrect because P(AB)=0.12P(A \cap B) = 0.12, but P(AB)=0.4P(A)P(A|B) = 0.4 \neq P(A)
Explanation: First, find P(A ∩ B) using P(A ∪ B) = P(A) + P(B) - P(A ∩ B), so P(A ∩ B) = 0.4 + 0.3 - 0.58 = 0.12. For independence, we need P(A ∩ B) = P(A) × P(B) = 0.4 × 0.3 = 0.12. Since this equality holds, the events are independent. Choice A misunderstands independence. Choice B incorrectly assumes independent events are mutually exclusive. Choice D incorrectly calculates P(A|B) = P(A ∩ B)/P(B) = 0.12/0.3 = 0.4 = P(A), actually confirming independence.