IB Mathematics: Analysis and Approaches Quiz: Proof By Induction And Contradiction
20 questions · exam conditions
0:00
Proof By Induction And ContradictionQuestion 1 of 20

A sequence is defined by a1=2,a2=3a_1=2, a_2=3 and an=an1+2an2a_n = a_{n-1} + 2a_{n-2} for n3n \ge 3. A proof by induction is used to show that an=2n+(1)na_n = 2^n + (-1)^n for all nZ+n \in \mathbb{Z}^+. Why is a standard inductive hypothesis (assuming the proposition is true for n=kn=k) insufficient for the inductive step?

The formula involves an exponential term, which requires proof by contradiction.
The recurrence relation for ak+1a_{k+1} depends on two preceding terms, aka_k and ak1a_{k-1}.
Two base cases are needed, which is not allowed in standard induction.
The presence of (1)n(-1)^n means the sequence is not monotonic.
← Back to quizzes

IB Mathematics: Analysis and Approaches Quiz

IB Mathematics: Analysis and Approaches Quiz: Proof By Induction And Contradiction

Practice Proof By Induction And Contradiction in IB Mathematics: Analysis and Approaches with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Proof By Induction And Contradiction, giving you a quick way to practice the rules, question types, and explanations that matter most for IB Mathematics: Analysis and Approaches.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A sequence is defined by a1=2,a2=3a_1=2, a_2=3 and an=an1+2an2a_n = a_{n-1} + 2a_{n-2} for n3n \ge 3. A proof by induction is used to show that an=2n+(1)na_n = 2^n + (-1)^n for all nZ+n \in \mathbb{Z}^+. Why is a standard inductive hypothesis (assuming the proposition is true for n=kn=k) insufficient for the inductive step?

  1. The formula involves an exponential term, which requires proof by contradiction.
  2. The recurrence relation for ak+1a_{k+1} depends on two preceding terms, aka_k and ak1a_{k-1}. (correct answer)
  3. Two base cases are needed, which is not allowed in standard induction.
  4. The presence of (1)n(-1)^n means the sequence is not monotonic.
Explanation: In the inductive step, we need to prove the formula for ak+1a_{k+1}. The recurrence is ak+1=ak+2ak1a_{k+1} = a_k + 2a_{k-1}. To use the formula we are trying to prove, we need to substitute expressions for both aka_k and ak1a_{k-1}. A standard inductive hypothesis only assumes the formula is true for n=kn=k. Therefore, we need a stronger hypothesis, one that assumes the formula is true for both n=kn=k and n=k1n=k-1 (or for all integers up to kk), which is known as strong induction.

Question 2

Let P(n)P(n) be the proposition that 8n3n8^n - 3^n is divisible by 5. In the inductive step, assuming P(k)P(k) is true, we consider 8k+13k+18^{k+1} - 3^{k+1}. Which of the following expressions is a valid manipulation that helps to complete the proof?

  1. 8(8k3k)+53k8(8^k - 3^k) + 5 \cdot 3^k (correct answer)
  2. 3(8k3k)58k3(8^k - 3^k) - 5 \cdot 8^k
  3. 5(8k3k)5(8^k - 3^k)
  4. 8(8k)3(3k)8(8^k) - 3(3^k)
Explanation: We start with 8k+13k+1=88k33k8^{k+1} - 3^{k+1} = 8 \cdot 8^k - 3 \cdot 3^k. To use the inductive hypothesis (that 8k3k8^k - 3^k is divisible by 5), we must isolate the term 8k3k8^k - 3^k. We can rewrite the expression as 88k83k+83k33k8 \cdot 8^k - 8 \cdot 3^k + 8 \cdot 3^k - 3 \cdot 3^k. This simplifies to 8(8k3k)+(83)3k=8(8k3k)+53k8(8^k - 3^k) + (8-3) \cdot 3^k = 8(8^k - 3^k) + 5 \cdot 3^k. Since 8k3k8^k - 3^k is divisible by 5 by the inductive hypothesis, 8(8k3k)8(8^k - 3^k) is divisible by 5. Also, 53k5 \cdot 3^k is clearly divisible by 5. The sum of two numbers divisible by 5 is also divisible by 5, completing the proof.

Question 3

A sequence is defined by a1=2,a2=3a_1=2, a_2=3 and an=an1+2an2a_n = a_{n-1} + 2a_{n-2} for n3n \ge 3. A proof by induction is used to show that an=2n+(1)na_n = 2^n + (-1)^n for all nZ+n \in \mathbb{Z}^+. Why is a standard inductive hypothesis (assuming the proposition is true for n=kn=k) insufficient for the inductive step?

  1. The formula involves an exponential term, which requires proof by contradiction.
  2. The recurrence relation for ak+1a_{k+1} depends on two preceding terms, aka_k and ak1a_{k-1}. (correct answer)
  3. Two base cases are needed, which is not allowed in standard induction.
  4. The presence of (1)n(-1)^n means the sequence is not monotonic.
Explanation: In the inductive step, we need to prove the formula for ak+1a_{k+1}. The recurrence is ak+1=ak+2ak1a_{k+1} = a_k + 2a_{k-1}. To use the formula we are trying to prove, we need to substitute expressions for both aka_k and ak1a_{k-1}. A standard inductive hypothesis only assumes the formula is true for n=kn=k. Therefore, we need a stronger hypothesis, one that assumes the formula is true for both n=kn=k and n=k1n=k-1 (or for all integers up to kk), which is known as strong induction.

Question 4

Let P(n)P(n) be a statement about a positive integer nn. It is found that P(50)P(50) is true. It is also proven that for any integer k>1k > 1, the truth of P(k)P(k) implies the truth of P(k1)P(k-1). What is the strongest conclusion that can be made?

  1. P(n)P(n) is true for all integers n50n \ge 50.
  2. P(n)P(n) is true for all positive integers nn.
  3. P(n)P(n) is true only for n=50n=50.
  4. P(n)P(n) is true for all integers nn such that 1n501 \le n \le 50. (correct answer)
Explanation: This question tests your understanding of mathematical induction, specifically "backward induction" or "strong induction in reverse." When you see conditions about statements being true for one value and implications flowing in a particular direction, think carefully about which way the logical chain works. You're given that P(50)P(50) is true, and that for any integer k>1k > 1, if P(k)P(k) is true, then P(k1)P(k-1) is also true. This creates a "domino effect" moving backward from 50. Since P(50)P(50) is true, and 50>150 > 1, you can apply the implication to conclude P(49)P(49) is true. Since P(49)P(49) is true and 49>149 > 1, you get P(48)P(48) is true. This pattern continues all the way down to P(1)P(1), since you can keep applying the implication as long as k>1k > 1. Choice A is wrong because the implication works backward (from kk to k1k-1), not forward to larger values. You have no information about P(51),P(52),P(51), P(52), etc. Choice B is wrong because while you can prove P(n)P(n) for n=1,2,3,...,50n = 1, 2, 3, ..., 50, you cannot extend beyond 50 without additional information. Choice C is wrong because the backward implication allows you to prove much more than just P(50)P(50) - you can prove all cases from 1 to 50. Choice D is correct because the backward chain of implications establishes P(n)P(n) for every integer from 1 to 50. Remember: in induction problems, pay close attention to the direction of the implication. The logical flow determines exactly which values you can prove.

Question 5

In a proof by induction for the statement S(n):i=1ni(i+1)=n(n+1)(n+2)3S(n): \sum_{i=1}^{n} i(i+1) = \frac{n(n+1)(n+2)}{3} for nZ+n \in \mathbb{Z}^+, the inductive step requires proving that if S(k)S(k) is true for some kZ+k \in \mathbb{Z}^+, then S(k+1)S(k+1) is true. Which of the following equations must be established to complete this inductive step?

  1. k(k+1)(k+2)3+(k+1)=(k+1)(k+2)(k+3)3\frac{k(k+1)(k+2)}{3} + (k+1) = \frac{(k+1)(k+2)(k+3)}{3}
  2. k(k+1)(k+2)3+(k+1)(k+2)=(k+1)(k+2)(k+3)3\frac{k(k+1)(k+2)}{3} + (k+1)(k+2) = \frac{(k+1)(k+2)(k+3)}{3} (correct answer)
  3. i=1k+1i(i+1)=k(k+1)(k+2)3\sum_{i=1}^{k+1} i(i+1) = \frac{k(k+1)(k+2)}{3}
  4. (k+1)(k+2)=(k+1)(k+2)(k+3)3(k+1)(k+2) = \frac{(k+1)(k+2)(k+3)}{3}
Explanation: The inductive step assumes S(k)S(k) is true, so i=1ki(i+1)=k(k+1)(k+2)3\sum_{i=1}^{k} i(i+1) = \frac{k(k+1)(k+2)}{3}. We need to prove S(k+1)S(k+1) is true, which is i=1k+1i(i+1)=(k+1)(k+2)(k+3)3\sum_{i=1}^{k+1} i(i+1) = \frac{(k+1)(k+2)(k+3)}{3}. We start with the left side of S(k+1)S(k+1): i=1k+1i(i+1)=(i=1ki(i+1))+(k+1)((k+1)+1)\sum_{i=1}^{k+1} i(i+1) = \left(\sum_{i=1}^{k} i(i+1)\right) + (k+1)((k+1)+1). Using the inductive hypothesis, this becomes k(k+1)(k+2)3+(k+1)(k+2)\frac{k(k+1)(k+2)}{3} + (k+1)(k+2). We must show this equals the right side of S(k+1)S(k+1), so the required equation is k(k+1)(k+2)3+(k+1)(k+2)=(k+1)(k+2)(k+3)3\frac{k(k+1)(k+2)}{3} + (k+1)(k+2) = \frac{(k+1)(k+2)(k+3)}{3}.

Question 6

Let P(n)P(n) be a statement to be proven by induction for nZ+n \in \mathbb{Z}^+. If the base case P(1)P(1) is false, but the inductive step (that is, P(k)    P(k+1)P(k) \implies P(k+1) for all k1k \ge 1) is proven to be valid, what can be concluded?

  1. P(n)P(n) is false for all nZ+n \in \mathbb{Z}^+. (correct answer)
  2. P(n)P(n) is true for all nZ+n \in \mathbb{Z}^+.
  3. P(n)P(n) may be true for some n>1n > 1, but we cannot be certain.
  4. The inductive step must also be flawed; it cannot be valid if the base case is false.
Explanation: Mathematical induction can be thought of as a chain of dominoes. The base case, P(1)P(1), is the act of knocking over the first domino. The inductive step, P(k)    P(k+1)P(k) \implies P(k+1), ensures that each domino is positioned to knock over the next. If the first domino is never knocked over (P(1)P(1) is false), the chain reaction never starts. Since the implication P(k)    P(k+1)P(k) \implies P(k+1) requires P(k)P(k) to be true to conclude anything about P(k+1)P(k+1), and we know P(1)P(1) is false, we can never establish that P(2)P(2) is true. Consequently, we can't establish P(3)P(3) is true, and so on. Therefore, the statement is false for all nZ+n \in \mathbb{Z}^+.

Question 7

A student presents the following flawed proof that all horses are the same color.

Base Case: For n=1n=1, in any set containing one horse, all horses in that set are the same color. This is true.

Inductive Step: Assume for any set of kk horses, all horses have the same color. Consider a set of k+1k+1 horses. Remove the first horse; the remaining kk horses have the same color by the inductive hypothesis. Put the first horse back and remove the last horse; this set of kk horses also has the same color. Therefore, the first horse has the same color as the middle horses, which in turn have the same color as the last horse. Thus, all k+1k+1 horses have the same color.

The reasoning in the inductive step is flawed. For which value of kk does the argument fail?

  1. k=1k=1 (correct answer)
  2. k=2k=2
  3. k=3k=3
  4. The argument is valid for all k1k \ge 1.
Explanation: The flaw lies in the transition from k=1k=1 to k+1=2k+1=2. The argument relies on the overlap between the two sets of kk horses (the 'middle horses'). When considering a set of k+1=2k+1=2 horses, H1,H2H_1, H_2, the first subset is {H2}\{H_2\} and the second is {H1}\{H_1\}. There is no overlap or 'middle horse' to link the color of H1H_1 to H2H_2. The logic of the argument only works if the two subsets of size kk have a non-empty intersection, which requires k>1k > 1. Therefore, the argument fails for k=1k=1.

Question 8

In the proof of De Moivre's theorem by induction, (cosθ+isinθ)n=cos(nθ)+isin(nθ)(\cos\theta + i\sin\theta)^n = \cos(n\theta) + i\sin(n\theta), the inductive step involves expanding (cos(kθ)+isin(kθ))(cosθ+isinθ)(\cos(k\theta) + i\sin(k\theta))(\cos\theta + i\sin\theta). After expansion, what is the real part of the resulting complex number?

  1. cos(kθ)cosθ+sin(kθ)sinθ\cos(k\theta)\cos\theta + \sin(k\theta)\sin\theta
  2. sin(kθ)cosθ+cos(kθ)sinθ\sin(k\theta)\cos\theta + \cos(k\theta)\sin\theta
  3. sin(kθ)cosθcos(kθ)sinθ\sin(k\theta)\cos\theta - \cos(k\theta)\sin\theta
  4. cos(kθ)cosθsin(kθ)sinθ\cos(k\theta)\cos\theta - \sin(k\theta)\sin\theta (correct answer)
Explanation: When approaching De Moivre's theorem proofs by induction, you're working with complex number multiplication where the key is carefully tracking real and imaginary parts through algebraic expansion. To find the real part of (cos(kθ)+isin(kθ))(cosθ+isinθ)(\cos(k\theta) + i\sin(k\theta))(\cos\theta + i\sin\theta), you need to multiply these complex numbers using the distributive property: (cos(kθ)+isin(kθ))(cosθ+isinθ)(\cos(k\theta) + i\sin(k\theta))(\cos\theta + i\sin\theta) =cos(kθ)cosθ+cos(kθ)(isinθ)+(isin(kθ))cosθ+(isin(kθ))(isinθ)= \cos(k\theta)\cos\theta + \cos(k\theta)(i\sin\theta) + (i\sin(k\theta))\cos\theta + (i\sin(k\theta))(i\sin\theta) Simplifying each term:
  • First term: cos(kθ)cosθ\cos(k\theta)\cos\theta (real)
  • Second term: icos(kθ)sinθi\cos(k\theta)\sin\theta (imaginary)
  • Third term: isin(kθ)cosθi\sin(k\theta)\cos\theta (imaginary)
  • Fourth term: i2sin(kθ)sinθ=sin(kθ)sinθi^2\sin(k\theta)\sin\theta = -\sin(k\theta)\sin\theta (real, since i2=1i^2 = -1)
The real part combines the first and fourth terms: cos(kθ)cosθsin(kθ)sinθ\cos(k\theta)\cos\theta - \sin(k\theta)\sin\theta, which is answer D. Choice A omits the crucial negative sign from the i2i^2 term. Choice B gives you the imaginary part instead of the real part. Choice C has the wrong signs on both terms—it's mixing up which terms are positive and negative. Study tip: In complex multiplication problems, always remember that i2=1i^2 = -1 creates negative real terms, and systematically separate real from imaginary parts during expansion. This pattern appears frequently in trigonometric identities and complex number proofs.

Question 9

A student attempts to prove that if abab is an irrational number, then either aa or bb is irrational. The student writes: 'Assume aa and bb are both rational. Let a=p/qa = p/q and b=r/sb = r/s for integers p,q,r,sp, q, r, s. Then ab=pr/qsab = pr/qs, which is rational. This contradicts the fact that the product of two rationals must be irrational.' Besides the error in the final sentence, what is the primary logical issue with this argument as a proof by contradiction?

  1. The student has correctly proven the contrapositive, not used proof by contradiction. (correct answer)
  2. The initial assumption should be that abab is rational.
  3. The variables qq and ss are not specified to be non-zero.
  4. The student did not state that prpr and qsqs are integers.
Explanation: The original statement is P    QP \implies Q, where PP is 'abab is irrational' and QQ is 'aa is irrational or bb is irrational'. A proof by contradiction would assume P and not QP \text{ and not } Q, which is 'ab is irrational AND a is rational AND b is rational'. The student instead assumed not Q\text{not } Q ('a is rational AND b is rational') and proved not P\text{not } P ('ab is rational'). Proving not Q    not P\text{not } Q \implies \text{not } P is a valid proof of the contrapositive, which is logically equivalent to P    QP \implies Q. However, it is not a proof by contradiction.

Question 10

In the standard proof by contradiction that 5\sqrt{5} is irrational, we assume 5=pq\sqrt{5} = \frac{p}{q} where p,qZp, q \in \mathbb{Z} and the fraction is in its simplest form (i.e., gcd(p,q)=1\gcd(p,q)=1). The proof leads to the conclusion that both pp and qq must be multiples of 5. What is the primary contradiction reached at this point?

  1. An even number is shown to be equal to an odd number.
  2. The number 5\sqrt{5} is shown to be an integer.
  3. The assumption that pp and qq have no common factors is violated. (correct answer)
  4. A rational number is equated to an irrational number in the first step.
Explanation: The proof begins by assuming the fraction pq\frac{p}{q} is in its simplest form, meaning pp and qq share no common factors other than 1. The steps of the proof then logically deduce that both pp and qq must have a factor of 5. This means they share a common factor, which directly contradicts the initial assumption that the fraction was in its simplest form. This is the fundamental contradiction that completes the proof.

Question 11

To prove that there are infinitely many prime numbers, the proof by contradiction begins by assuming there is a finite number of primes, p1,p2,,pnp_1, p_2, \dots, p_n. A new number N=p1p2pn+1N = p_1 p_2 \dots p_n + 1 is constructed. The argument then states that NN must have a prime factor. What contradiction is ultimately reached?

  1. NN is shown to be a prime number, but it is larger than any prime in the finite list.
  2. The prime factor of NN cannot be any of the primes in the finite list, contradicting that the list was complete. (correct answer)
  3. NN is shown to be simultaneously even and odd.
  4. NN is shown to be equal to 1, which is not prime.
Explanation: When NN is divided by any of the primes p1,p2,,pnp_1, p_2, \dots, p_n from the supposedly complete list, there is a remainder of 1. This means that none of these primes are factors of NN. However, by the fundamental theorem of arithmetic, NN must have a prime factor (either it is prime itself, or it is composite). This prime factor is not on the list p1,,pnp_1, \dots, p_n. This contradicts the initial assumption that the list of all prime numbers was finite and complete.

Question 12

In a proof by mathematical induction for a statement P(n)P(n), it is shown that P(2)P(2) is true. It is also shown that for any integer k2k \ge 2, the truth of P(k)P(k) implies the truth of P(k+2)P(k+2). What can be concluded?

  1. P(n)P(n) is true for all integers n2n \ge 2.
  2. P(n)P(n) is true for all odd integers n3n \ge 3.
  3. P(n)P(n) is true for all even integers n2n \ge 2. (correct answer)
  4. Nothing can be concluded about the truth of P(n)P(n).
Explanation: The base case establishes that P(2)P(2) is true. The inductive step, P(k)    P(k+2)P(k) \implies P(k+2), shows that if the statement is true for an integer, it is also true for the integer that is 2 greater. Starting from the base case P(2)P(2), the implication shows that P(4)P(4) must be true. From P(4)P(4), we deduce P(6)P(6) is true, and so on. This chain of logic establishes the truth of P(n)P(n) for all even integers n2n \ge 2. We cannot conclude anything about odd integers because there is no odd base case.

Question 13

Let M=(3411)M = \begin{pmatrix} 3 & -4 \\ 1 & -1 \end{pmatrix}. It is proposed that Mn=(2n+14nn12n)M^n = \begin{pmatrix} 2n+1 & -4n \\ n & 1-2n \end{pmatrix} for nZ+n \in \mathbb{Z}^+. In the inductive step, assuming the formula is true for n=kn=k, we compute Mk+1=MkMM^{k+1} = M^k M. What is the entry in the first row, first column of the resulting matrix Mk+1M^{k+1}?

  1. 2k+22k+2
  2. 2k+32k+3 (correct answer)
  3. 6k+36k+3
  4. 2k12k-1
Explanation: We are computing Mk+1=MkM=(2k+14kk12k)(3411)M^{k+1} = M^k M = \begin{pmatrix} 2k+1 & -4k \\ k & 1-2k \end{pmatrix} \begin{pmatrix} 3 & -4 \\ 1 & -1 \end{pmatrix}. The entry in the first row, first column is found by taking the dot product of the first row of MkM^k and the first column of MM. This gives (2k+1)(3)+(4k)(1)=6k+34k=2k+3(2k+1)(3) + (-4k)(1) = 6k+3-4k = 2k+3. This matches the formula for n=k+1n=k+1, as 2(k+1)+1=2k+2+1=2k+32(k+1)+1 = 2k+2+1 = 2k+3.

Question 14

Let P(n)P(n) be a statement to be proven by induction for nZ+n \in \mathbb{Z}^+. If the base case P(1)P(1) is false, but the inductive step (that is, P(k)    P(k+1)P(k) \implies P(k+1) for all k1k \ge 1) is proven to be valid, what can be concluded?

  1. P(n)P(n) is false for all nZ+n \in \mathbb{Z}^+. (correct answer)
  2. P(n)P(n) is true for all nZ+n \in \mathbb{Z}^+.
  3. P(n)P(n) may be true for some n>1n > 1, but we cannot be certain.
  4. The inductive step must also be flawed; it cannot be valid if the base case is false.
Explanation: Mathematical induction can be thought of as a chain of dominoes. The base case, P(1)P(1), is the act of knocking over the first domino. The inductive step, P(k)    P(k+1)P(k) \implies P(k+1), ensures that each domino is positioned to knock over the next. If the first domino is never knocked over (P(1)P(1) is false), the chain reaction never starts. Since the implication P(k)    P(k+1)P(k) \implies P(k+1) requires P(k)P(k) to be true to conclude anything about P(k+1)P(k+1), and we know P(1)P(1) is false, we can never establish that P(2)P(2) is true. Consequently, we can't establish P(3)P(3) is true, and so on. Therefore, the statement is false for all nZ+n \in \mathbb{Z}^+.

Question 15

In the standard proof by contradiction that 5\sqrt{5} is irrational, we assume 5=pq\sqrt{5} = \frac{p}{q} where p,qZp, q \in \mathbb{Z} and the fraction is in its simplest form (i.e., gcd(p,q)=1\gcd(p,q)=1). The proof leads to the conclusion that both pp and qq must be multiples of 5. What is the primary contradiction reached at this point?

  1. An even number is shown to be equal to an odd number.
  2. The number 5\sqrt{5} is shown to be an integer.
  3. The assumption that pp and qq have no common factors is violated. (correct answer)
  4. A rational number is equated to an irrational number in the first step.
Explanation: The proof begins by assuming the fraction pq\frac{p}{q} is in its simplest form, meaning pp and qq share no common factors other than 1. The steps of the proof then logically deduce that both pp and qq must have a factor of 5. This means they share a common factor, which directly contradicts the initial assumption that the fraction was in its simplest form. This is the fundamental contradiction that completes the proof.

Question 16

To prove that there are infinitely many prime numbers, the proof by contradiction begins by assuming there is a finite number of primes, p1,p2,,pnp_1, p_2, \dots, p_n. A new number N=p1p2pn+1N = p_1 p_2 \dots p_n + 1 is constructed. The argument then states that NN must have a prime factor. What contradiction is ultimately reached?

  1. NN is shown to be a prime number, but it is larger than any prime in the finite list.
  2. The prime factor of NN cannot be any of the primes in the finite list, contradicting that the list was complete. (correct answer)
  3. NN is shown to be simultaneously even and odd.
  4. NN is shown to be equal to 1, which is not prime.
Explanation: When NN is divided by any of the primes p1,p2,,pnp_1, p_2, \dots, p_n from the supposedly complete list, there is a remainder of 1. This means that none of these primes are factors of NN. However, by the fundamental theorem of arithmetic, NN must have a prime factor (either it is prime itself, or it is composite). This prime factor is not on the list p1,,pnp_1, \dots, p_n. This contradicts the initial assumption that the list of all prime numbers was finite and complete.

Question 17

In a proof by mathematical induction for a statement P(n)P(n), it is shown that P(2)P(2) is true. It is also shown that for any integer k2k \ge 2, the truth of P(k)P(k) implies the truth of P(k+2)P(k+2). What can be concluded?

  1. P(n)P(n) is true for all integers n2n \ge 2.
  2. P(n)P(n) is true for all odd integers n3n \ge 3.
  3. P(n)P(n) is true for all even integers n2n \ge 2. (correct answer)
  4. Nothing can be concluded about the truth of P(n)P(n).
Explanation: The base case establishes that P(2)P(2) is true. The inductive step, P(k)    P(k+2)P(k) \implies P(k+2), shows that if the statement is true for an integer, it is also true for the integer that is 2 greater. Starting from the base case P(2)P(2), the implication shows that P(4)P(4) must be true. From P(4)P(4), we deduce P(6)P(6) is true, and so on. This chain of logic establishes the truth of P(n)P(n) for all even integers n2n \ge 2. We cannot conclude anything about odd integers because there is no odd base case.

Question 18

Let M=(3411)M = \begin{pmatrix} 3 & -4 \\ 1 & -1 \end{pmatrix}. It is proposed that Mn=(2n+14nn12n)M^n = \begin{pmatrix} 2n+1 & -4n \\ n & 1-2n \end{pmatrix} for nZ+n \in \mathbb{Z}^+. In the inductive step, assuming the formula is true for n=kn=k, we compute Mk+1=MkMM^{k+1} = M^k M. What is the entry in the first row, first column of the resulting matrix Mk+1M^{k+1}?

  1. 2k+22k+2
  2. 2k+32k+3 (correct answer)
  3. 6k+36k+3
  4. 2k12k-1
Explanation: We are computing Mk+1=MkM=(2k+14kk12k)(3411)M^{k+1} = M^k M = \begin{pmatrix} 2k+1 & -4k \\ k & 1-2k \end{pmatrix} \begin{pmatrix} 3 & -4 \\ 1 & -1 \end{pmatrix}. The entry in the first row, first column is found by taking the dot product of the first row of MkM^k and the first column of MM. This gives (2k+1)(3)+(4k)(1)=6k+34k=2k+3(2k+1)(3) + (-4k)(1) = 6k+3-4k = 2k+3. This matches the formula for n=k+1n=k+1, as 2(k+1)+1=2k+2+1=2k+32(k+1)+1 = 2k+2+1 = 2k+3.

Question 19

To prove that log310\log_3 10 is irrational by contradiction, one assumes log310=pq\log_3 10 = \frac{p}{q} for integers p,qp, q with q0q ≠ 0. Rewriting this gives 3p/q=103^{p/q} = 10, or 3p=10q3^p = 10^q. Why does this final equation represent a contradiction for positive integers pp and qq?

  1. The number 3p3^p is always odd, while 10q10^q is always even.
  2. The equation implies plog3=qlog10p \log 3 = q \log 10, which involves irrational numbers.
  3. 3p3^p has only 3 as a prime factor, while 10q10^q has prime factors 2 and 5. (correct answer)
  4. An exponential function cannot be equal to a polynomial function.
Explanation: The equation is 3p=10q=(25)q=2q5q3^p = 10^q = (2 \cdot 5)^q = 2^q 5^q. According to the Fundamental Theorem of Arithmetic, every integer greater than 1 has a unique prime factorization. The prime factorization of the left side, 3p3^p, consists only of the prime number 3. The prime factorization of the right side, 10q10^q, consists of the prime numbers 2 and 5. Since these prime factorizations are different, the two numbers cannot be equal. This is a contradiction.

Question 20

A student is proving by induction that r=1nr3=(n(n+1)2)2\sum_{r=1}^{n} r^3 = \left( \frac{n(n+1)}{2} \right)^2. They correctly assume the formula for n=kn=k. Which expression correctly represents the value that must be added to (k(k+1)2)2\left( \frac{k(k+1)}{2} \right)^2 to begin the proof for n=k+1n=k+1?

  1. k3k^3
  2. (k+1)(k+2)2\frac{(k+1)(k+2)}{2}
  3. (k+1)3(k+1)^3 (correct answer)
  4. ((k+1)(k+2)2)2\left( \frac{(k+1)(k+2)}{2} \right)^2
Explanation: The inductive step is to show that r=1k+1r3=((k+1)(k+2)2)2\sum_{r=1}^{k+1} r^3 = \left( \frac{(k+1)(k+2)}{2} \right)^2. We can write the sum to k+1k+1 as the sum to kk plus the (k+1)(k+1)-th term. So, r=1k+1r3=(r=1kr3)+(k+1)3\sum_{r=1}^{k+1} r^3 = \left( \sum_{r=1}^{k} r^3 \right) + (k+1)^3. Using the inductive hypothesis, this becomes (k(k+1)2)2+(k+1)3\left( \frac{k(k+1)}{2} \right)^2 + (k+1)^3. Therefore, the term that must be added is (k+1)3(k+1)^3.