IB Mathematics: Analysis and Approaches Quiz: Advanced Trig Identities
20 questions · exam conditions
0:00
Advanced Trig IdentitiesQuestion 1 of 20

In triangle ABC, sin(A)=35\sin(A) = \frac{3}{5} and sin(B)=513\sin(B) = \frac{5}{13}. Given that angle A is acute and angle B is obtuse, find cos(C)\cos(C).

6365-\frac{63}{65}
3365-\frac{33}{65}
3365\frac{33}{65}
6365\frac{63}{65}
← Back to quizzes

IB Mathematics: Analysis and Approaches Quiz

IB Mathematics: Analysis and Approaches Quiz: Advanced Trig Identities

Practice Advanced Trig Identities in IB Mathematics: Analysis and Approaches with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Advanced Trig Identities, giving you a quick way to practice the rules, question types, and explanations that matter most for IB Mathematics: Analysis and Approaches.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

In triangle ABC, sin(A)=35\sin(A) = \frac{3}{5} and sin(B)=513\sin(B) = \frac{5}{13}. Given that angle A is acute and angle B is obtuse, find cos(C)\cos(C).

  1. 6365-\frac{63}{65}
  2. 3365-\frac{33}{65}
  3. 3365\frac{33}{65}
  4. 6365\frac{63}{65} (correct answer)
Explanation: Since angle A is acute, cos(A)>0\cos(A) > 0. cos(A)=1(3/5)2=45\cos(A) = \sqrt{1 - (3/5)^2} = \frac{4}{5}. Since angle B is obtuse, cos(B)<0\cos(B) < 0. cos(B)=1(5/13)2=1213\cos(B) = -\sqrt{1 - (5/13)^2} = -\frac{12}{13}. In a triangle, A+B+C=πA+B+C = \pi, so C=π(A+B)C = \pi - (A+B). Therefore, cos(C)=cos(π(A+B))=cos(A+B)\cos(C) = \cos(\pi - (A+B)) = -\cos(A+B). Using the compound angle identity, cos(A+B)=cos(A)cos(B)sin(A)sin(B)=(45)(1213)(35)(513)=48651565=6365\cos(A+B) = \cos(A)\cos(B) - \sin(A)\sin(B) = \left(\frac{4}{5}\right)\left(-\frac{12}{13}\right) - \left(\frac{3}{5}\right)\left(\frac{5}{13}\right) = -\frac{48}{65} - \frac{15}{65} = -\frac{63}{65}. Finally, cos(C)=(6365)=6365\cos(C) = -(-\frac{63}{65}) = \frac{63}{65}.

Question 2

Find the value of cos(4θ)\cos(4\theta) if cos(θ)=13\cos(\theta) = \frac{1}{3}.

  1. 17981-\frac{179}{81}
  2. 79-\frac{7}{9}
  3. 1781\frac{17}{81} (correct answer)
  4. 4981\frac{49}{81}
Explanation: We can find cos(4θ)\cos(4\theta) by applying the double angle identity for cosine twice. First, find cos(2θ)\cos(2\theta): cos(2θ)=2cos2(θ)1=2(13)21=2(19)1=291=79\cos(2\theta) = 2\cos^2(\theta) - 1 = 2\left(\frac{1}{3}\right)^2 - 1 = 2\left(\frac{1}{9}\right) - 1 = \frac{2}{9} - 1 = -\frac{7}{9}. Now, use this result to find cos(4θ)=cos(2(2θ))\cos(4\theta) = \cos(2(2\theta)): cos(4θ)=2cos2(2θ)1=2(79)21=2(4981)1=98818181=1781\cos(4\theta) = 2\cos^2(2\theta) - 1 = 2\left(-\frac{7}{9}\right)^2 - 1 = 2\left(\frac{49}{81}\right) - 1 = \frac{98}{81} - \frac{81}{81} = \frac{17}{81}.

Question 3

If A+B=π4A+B = \frac{\pi}{4}, what is the value of (1+tanA)(1+tanB)(1+\tan A)(1+\tan B)?

  1. 12-\frac{1}{2}
  2. 1
  3. 32\frac{3}{2}
  4. 2 (correct answer)
Explanation: Since A+B=π4A+B = \frac{\pi}{4}, we have tan(A+B)=tan(π4)=1\tan(A+B) = \tan(\frac{\pi}{4}) = 1. Using the compound angle formula for tangent, tan(A+B)=tanA+tanB1tanAtanB\tan(A+B) = \frac{\tan A + \tan B}{1 - \tan A \tan B}. So, tanA+tanB1tanAtanB=1\frac{\tan A + \tan B}{1 - \tan A \tan B} = 1. This implies tanA+tanB=1tanAtanB\tan A + \tan B = 1 - \tan A \tan B, which can be rearranged to tanA+tanB+tanAtanB=1\tan A + \tan B + \tan A \tan B = 1. Now consider the expression we want to evaluate: (1+tanA)(1+tanB)=1+tanA+tanB+tanAtanB(1+\tan A)(1+\tan B) = 1 + \tan A + \tan B + \tan A \tan B. From our rearrangement, we know that tanA+tanB+tanAtanB=1\tan A + \tan B + \tan A \tan B = 1. Therefore, (1+tanA)(1+tanB)=1+1=2(1+\tan A)(1+\tan B) = 1 + 1 = 2.

Question 4

What is the period of the function f(x)=cos(4x)cos(2x)sin(4x)sin(2x)f(x) = \cos(4x)\cos(2x) - \sin(4x)\sin(2x)?

  1. π6\frac{\pi}{6}
  2. π3\frac{\pi}{3} (correct answer)
  3. π2\frac{\pi}{2}
  4. π\pi
Explanation: The expression cos(A)cos(B)sin(A)sin(B)\cos(A)\cos(B) - \sin(A)\sin(B) is the compound angle identity for cos(A+B)\cos(A+B). In this case, A=4xA=4x and B=2xB=2x. Therefore, f(x)=cos(4x+2x)=cos(6x)f(x) = \cos(4x+2x) = \cos(6x). The period of a function g(x)=acos(kx)+dg(x) = a\cos(kx)+d is given by 2πk\frac{2\pi}{|k|}. For f(x)=cos(6x)f(x) = \cos(6x), we have k=6k=6. The period is 2π6=π3\frac{2\pi}{6} = \frac{\pi}{3}.

Question 5

If tan(A)=12\tan(A) = \frac{1}{2} and tan(A+B)=3\tan(A+B) = 3, what is the value of tan(B)\tan(B)?

  1. 5-5
  2. 1 (correct answer)
  3. 52\frac{5}{2}
  4. 5
Explanation: Start with the compound angle identity for tangent: tan(A+B)=tan(A)+tan(B)1tan(A)tan(B)\tan(A+B) = \frac{\tan(A) + \tan(B)}{1 - \tan(A)\tan(B)}. Substitute the given values: 3=12+tan(B)112tan(B)3 = \frac{\frac{1}{2} + \tan(B)}{1 - \frac{1}{2}\tan(B)}. Let t=tan(B)t = \tan(B). Then 3(112t)=12+t3(1 - \frac{1}{2}t) = \frac{1}{2} + t. This simplifies to 332t=12+t3 - \frac{3}{2}t = \frac{1}{2} + t. Rearranging to solve for tt: 312=t+32t3 - \frac{1}{2} = t + \frac{3}{2}t, which gives 52=52t\frac{5}{2} = \frac{5}{2}t. Therefore, t=tan(B)=1t = \tan(B) = 1.

Question 6

If tan(A)=12\tan(A) = \frac{1}{2} and tan(A+B)=3\tan(A+B) = 3, what is the value of tan(B)\tan(B)?

  1. 5-5
  2. 1 (correct answer)
  3. 52\frac{5}{2}
  4. 5
Explanation: Start with the compound angle identity for tangent: tan(A+B)=tan(A)+tan(B)1tan(A)tan(B)\tan(A+B) = \frac{\tan(A) + \tan(B)}{1 - \tan(A)\tan(B)}. Substitute the given values: 3=12+tan(B)112tan(B)3 = \frac{\frac{1}{2} + \tan(B)}{1 - \frac{1}{2}\tan(B)}. Let t=tan(B)t = \tan(B). Then 3(112t)=12+t3(1 - \frac{1}{2}t) = \frac{1}{2} + t. This simplifies to 332t=12+t3 - \frac{3}{2}t = \frac{1}{2} + t. Rearranging to solve for tt: 312=t+32t3 - \frac{1}{2} = t + \frac{3}{2}t, which gives 52=52t\frac{5}{2} = \frac{5}{2}t. Therefore, t=tan(B)=1t = \tan(B) = 1.

Question 7

Find the value of cos(4θ)\cos(4\theta) if cos(θ)=13\cos(\theta) = \frac{1}{3}.

  1. 17981-\frac{179}{81}
  2. 79-\frac{7}{9}
  3. 1781\frac{17}{81} (correct answer)
  4. 4981\frac{49}{81}
Explanation: We can find cos(4θ)\cos(4\theta) by applying the double angle identity for cosine twice. First, find cos(2θ)\cos(2\theta): cos(2θ)=2cos2(θ)1=2(13)21=2(19)1=291=79\cos(2\theta) = 2\cos^2(\theta) - 1 = 2\left(\frac{1}{3}\right)^2 - 1 = 2\left(\frac{1}{9}\right) - 1 = \frac{2}{9} - 1 = -\frac{7}{9}. Now, use this result to find cos(4θ)=cos(2(2θ))\cos(4\theta) = \cos(2(2\theta)): cos(4θ)=2cos2(2θ)1=2(79)21=2(4981)1=98818181=1781\cos(4\theta) = 2\cos^2(2\theta) - 1 = 2\left(-\frac{7}{9}\right)^2 - 1 = 2\left(\frac{49}{81}\right) - 1 = \frac{98}{81} - \frac{81}{81} = \frac{17}{81}.

Question 8

In triangle ABC, sin(A)=35\sin(A) = \frac{3}{5} and sin(B)=513\sin(B) = \frac{5}{13}. Given that angle A is acute and angle B is obtuse, find cos(C)\cos(C).

  1. 6365-\frac{63}{65}
  2. 3365-\frac{33}{65}
  3. 3365\frac{33}{65}
  4. 6365\frac{63}{65} (correct answer)
Explanation: Since angle A is acute, cos(A)>0\cos(A) > 0. cos(A)=1(3/5)2=45\cos(A) = \sqrt{1 - (3/5)^2} = \frac{4}{5}. Since angle B is obtuse, cos(B)<0\cos(B) < 0. cos(B)=1(5/13)2=1213\cos(B) = -\sqrt{1 - (5/13)^2} = -\frac{12}{13}. In a triangle, A+B+C=πA+B+C = \pi, so C=π(A+B)C = \pi - (A+B). Therefore, cos(C)=cos(π(A+B))=cos(A+B)\cos(C) = \cos(\pi - (A+B)) = -\cos(A+B). Using the compound angle identity, cos(A+B)=cos(A)cos(B)sin(A)sin(B)=(45)(1213)(35)(513)=48651565=6365\cos(A+B) = \cos(A)\cos(B) - \sin(A)\sin(B) = \left(\frac{4}{5}\right)\left(-\frac{12}{13}\right) - \left(\frac{3}{5}\right)\left(\frac{5}{13}\right) = -\frac{48}{65} - \frac{15}{65} = -\frac{63}{65}. Finally, cos(C)=(6365)=6365\cos(C) = -(-\frac{63}{65}) = \frac{63}{65}.

Question 9

What is the period of the function f(x)=cos(4x)cos(2x)sin(4x)sin(2x)f(x) = \cos(4x)\cos(2x) - \sin(4x)\sin(2x)?

  1. π6\frac{\pi}{6}
  2. π3\frac{\pi}{3} (correct answer)
  3. π2\frac{\pi}{2}
  4. π\pi
Explanation: The expression cos(A)cos(B)sin(A)sin(B)\cos(A)\cos(B) - \sin(A)\sin(B) is the compound angle identity for cos(A+B)\cos(A+B). In this case, A=4xA=4x and B=2xB=2x. Therefore, f(x)=cos(4x+2x)=cos(6x)f(x) = \cos(4x+2x) = \cos(6x). The period of a function g(x)=acos(kx)+dg(x) = a\cos(kx)+d is given by 2πk\frac{2\pi}{|k|}. For f(x)=cos(6x)f(x) = \cos(6x), we have k=6k=6. The period is 2π6=π3\frac{2\pi}{6} = \frac{\pi}{3}.

Question 10

Which of the following is an indefinite integral of f(x)=4sin(x)cos(3x)f(x) = 4\sin(x)\cos(3x)?

  1. cos(2x)12cos(4x)+C\cos(2x) - \frac{1}{2}\cos(4x) + C (correct answer)
  2. 12sin(4x)+sin(2x)+C\frac{1}{2}\sin(4x) + \sin(2x) + C
  3. 2cos(2x)2cos(4x)+C2\cos(2x) - 2\cos(4x) + C
  4. cos(2x)+12cos(4x)+C-\cos(2x) + \frac{1}{2}\cos(4x) + C
Explanation: First, use the product-to-sum identity sin(A)cos(B)=12[sin(A+B)+sin(AB)]\sin(A)\cos(B) = \frac{1}{2}[\sin(A+B) + \sin(A-B)]. Let A=xA=x and B=3xB=3x. Then 4sin(x)cos(3x)=412[sin(x+3x)+sin(x3x)]=2[sin(4x)+sin(2x)]=2sin(4x)2sin(2x)4\sin(x)\cos(3x) = 4 \cdot \frac{1}{2}[\sin(x+3x) + \sin(x-3x)] = 2[\sin(4x) + \sin(-2x)] = 2\sin(4x) - 2\sin(2x). Now, integrate this expression: (2sin(4x)2sin(2x))dx=2(cos(4x)4)2(cos(2x)2)+C=12cos(4x)+cos(2x)+C\int (2\sin(4x) - 2\sin(2x)) dx = 2\left(-\frac{\cos(4x)}{4}\right) - 2\left(-\frac{\cos(2x)}{2}\right) + C = -\frac{1}{2}\cos(4x) + \cos(2x) + C, which can be written as cos(2x)12cos(4x)+C\cos(2x) - \frac{1}{2}\cos(4x) + C.

Question 11

Given cos(x)=725\cos(x) = \frac{7}{25} and 3π2<x<2π\frac{3\pi}{2} < x < 2\pi, find the value of cos(x2)\cos(\frac{x}{2}).

  1. 45-\frac{4}{5} (correct answer)
  2. 35-\frac{3}{5}
  3. 35\frac{3}{5}
  4. 45\frac{4}{5}
Explanation: Use the half-angle identity derived from cos(2A)=2cos2(A)1\cos(2A) = 2\cos^2(A) - 1. Let A=x/2A = x/2, so cos(x)=2cos2(x2)1\cos(x) = 2\cos^2(\frac{x}{2}) - 1. Rearranging gives cos2(x2)=1+cos(x)2\cos^2(\frac{x}{2}) = \frac{1+\cos(x)}{2}. Substituting the value of cos(x)\cos(x): cos2(x2)=1+7/252=32/252=1625\cos^2(\frac{x}{2}) = \frac{1 + 7/25}{2} = \frac{32/25}{2} = \frac{16}{25}. Thus, cos(x2)=±1625=±45\cos(\frac{x}{2}) = \pm\sqrt{\frac{16}{25}} = \pm\frac{4}{5}. To determine the sign, consider the quadrant of x2\frac{x}{2}. Since 3π2<x<2π\frac{3\pi}{2} < x < 2\pi, dividing by 2 gives 3π4<x2<π\frac{3\pi}{4} < \frac{x}{2} < \pi. This means x2\frac{x}{2} is in Quadrant II, where cosine is negative. Therefore, cos(x2)=45\cos(\frac{x}{2}) = -\frac{4}{5}.

Question 12

Given cos(x+y)=14\cos(x+y) = \frac{1}{4} and cos(xy)=34\cos(x-y) = \frac{3}{4}, what is the value of cos(x)cos(y)\cos(x)\cos(y)?

  1. 18\frac{1}{8}
  2. 14\frac{1}{4}
  3. 12\frac{1}{2} (correct answer)
  4. 1
Explanation: We use the product-to-sum identity cos(x)cos(y)=12[cos(x+y)+cos(xy)]\cos(x)\cos(y) = \frac{1}{2}[\cos(x+y) + \cos(x-y)]. Substituting the given values directly into this formula: cos(x)cos(y)=12[14+34]=12[44]=12(1)=12\cos(x)\cos(y) = \frac{1}{2}\left[\frac{1}{4} + \frac{3}{4}\right] = \frac{1}{2}\left[\frac{4}{4}\right] = \frac{1}{2}(1) = \frac{1}{2}.

Question 13

Given that sin(A)=35\sin(A) = \frac{3}{5} for π2<A<π\frac{\pi}{2} < A < \pi and cos(B)=1213\cos(B) = -\frac{12}{13} for π<B<3π2\pi < B < \frac{3\pi}{2}, find the value of cos(A+B)\cos(A+B).

  1. 6365-\frac{63}{65}
  2. 3365-\frac{33}{65}
  3. 3365\frac{33}{65}
  4. 6365\frac{63}{65} (correct answer)
Explanation: First, determine the values of cos(A)\cos(A) and sin(B)\sin(B). Since AA is in Quadrant II, cos(A)\cos(A) is negative. Using sin2(A)+cos2(A)=1\sin^2(A) + \cos^2(A) = 1, we have cos(A)=1(3/5)2=19/25=16/25=45\cos(A) = -\sqrt{1 - (3/5)^2} = -\sqrt{1 - 9/25} = -\sqrt{16/25} = -\frac{4}{5}. Since BB is in Quadrant III, sin(B)\sin(B) is negative. Using sin2(B)+cos2(B)=1\sin^2(B) + \cos^2(B) = 1, we have sin(B)=1(12/13)2=1144/169=25/169=513\sin(B) = -\sqrt{1 - (-12/13)^2} = -\sqrt{1 - 144/169} = -\sqrt{25/169} = -\frac{5}{13}. Now, use the compound angle identity for cosine: cos(A+B)=cos(A)cos(B)sin(A)sin(B)\cos(A+B) = \cos(A)\cos(B) - \sin(A)\sin(B). Substituting the values: cos(A+B)=(45)(1213)(35)(513)=4865+1565=6365\cos(A+B) = \left(-\frac{4}{5}\right)\left(-\frac{12}{13}\right) - \left(\frac{3}{5}\right)\left(-\frac{5}{13}\right) = \frac{48}{65} + \frac{15}{65} = \frac{63}{65}.

Question 14

Simplify the expression 2sin(5x)cos(3x)sin(8x)2\sin(5x)\cos(3x) - \sin(8x).

  1. sin(2x)-\sin(2x)
  2. sin(2x)\sin(2x) (correct answer)
  3. cos(2x)\cos(2x)
  4. sin(8x)+sin(2x)\sin(8x) + \sin(2x)
Explanation: Use the product-to-sum identity 2sin(A)cos(B)=sin(A+B)+sin(AB)2\sin(A)\cos(B) = \sin(A+B) + \sin(A-B). Let A=5xA=5x and B=3xB=3x. Then, 2sin(5x)cos(3x)=sin(5x+3x)+sin(5x3x)=sin(8x)+sin(2x)2\sin(5x)\cos(3x) = \sin(5x+3x) + \sin(5x-3x) = \sin(8x) + \sin(2x). The original expression becomes (sin(8x)+sin(2x))sin(8x)=sin(2x)(\sin(8x) + \sin(2x)) - \sin(8x) = \sin(2x).

Question 15

The expression sin(3x)\sin(3x) is equivalent to which of the following?

  1. 3sin(x)4sin3(x)3\sin(x) - 4\sin^3(x) (correct answer)
  2. 4sin3(x)3sin(x)4\sin^3(x) - 3\sin(x)
  3. 4cos3(x)3cos(x)4\cos^3(x) - 3\cos(x)
  4. 3sin(x)2sin3(x)3\sin(x) - 2\sin^3(x)
Explanation: To derive the identity for sin(3x)\sin(3x), we use the compound angle and double angle formulas: sin(3x)=sin(2x+x)=sin(2x)cos(x)+cos(2x)sin(x)=(2sin(x)cos(x))cos(x)+(12sin2(x))sin(x)=2sin(x)cos2(x)+sin(x)2sin3(x)=2sin(x)(1sin2(x))+sin(x)2sin3(x)=2sin(x)2sin3(x)+sin(x)2sin3(x)=3sin(x)4sin3(x)\sin(3x) = \sin(2x+x) = \sin(2x)\cos(x) + \cos(2x)\sin(x) = (2\sin(x)\cos(x))\cos(x) + (1-2\sin^2(x))\sin(x) = 2\sin(x)\cos^2(x) + \sin(x) - 2\sin^3(x) = 2\sin(x)(1-\sin^2(x)) + \sin(x) - 2\sin^3(x) = 2\sin(x) - 2\sin^3(x) + \sin(x) - 2\sin^3(x) = 3\sin(x) - 4\sin^3(x).

Question 16

Given cos(x)=725\cos(x) = \frac{7}{25} and 3π2<x<2π\frac{3\pi}{2} < x < 2\pi, find the value of cos(x2)\cos(\frac{x}{2}).

  1. 45-\frac{4}{5} (correct answer)
  2. 35-\frac{3}{5}
  3. 35\frac{3}{5}
  4. 45\frac{4}{5}
Explanation: Use the half-angle identity derived from cos(2A)=2cos2(A)1\cos(2A) = 2\cos^2(A) - 1. Let A=x/2A = x/2, so cos(x)=2cos2(x2)1\cos(x) = 2\cos^2(\frac{x}{2}) - 1. Rearranging gives cos2(x2)=1+cos(x)2\cos^2(\frac{x}{2}) = \frac{1+\cos(x)}{2}. Substituting the value of cos(x)\cos(x): cos2(x2)=1+7/252=32/252=1625\cos^2(\frac{x}{2}) = \frac{1 + 7/25}{2} = \frac{32/25}{2} = \frac{16}{25}. Thus, cos(x2)=±1625=±45\cos(\frac{x}{2}) = \pm\sqrt{\frac{16}{25}} = \pm\frac{4}{5}. To determine the sign, consider the quadrant of x2\frac{x}{2}. Since 3π2<x<2π\frac{3\pi}{2} < x < 2\pi, dividing by 2 gives 3π4<x2<π\frac{3\pi}{4} < \frac{x}{2} < \pi. This means x2\frac{x}{2} is in Quadrant II, where cosine is negative. Therefore, cos(x2)=45\cos(\frac{x}{2}) = -\frac{4}{5}.

Question 17

What is the maximum value of the function f(x)=sin(x)cos(x)+cos2(x)sin2(x)f(x) = \sin(x)\cos(x) + \cos^2(x) - \sin^2(x)?

  1. 1
  2. 52\frac{\sqrt{5}}{2} (correct answer)
  3. 32\frac{3}{2}
  4. 2\sqrt{2}
Explanation: The function can be rewritten using double angle identities. We know that sin(x)cos(x)=12sin(2x)\sin(x)\cos(x) = \frac{1}{2}\sin(2x) and cos2(x)sin2(x)=cos(2x)\cos^2(x) - \sin^2(x) = \cos(2x). So, f(x)=12sin(2x)+cos(2x)f(x) = \frac{1}{2}\sin(2x) + \cos(2x). This is in the form asin(θ)+bcos(θ)a\sin(\theta) + b\cos(\theta) where θ=2x\theta = 2x, a=1/2a = 1/2, and b=1b = 1. The maximum value of this expression is R=a2+b2R = \sqrt{a^2 + b^2}. In this case, R=(12)2+12=14+1=54=52R = \sqrt{(\frac{1}{2})^2 + 1^2} = \sqrt{\frac{1}{4} + 1} = \sqrt{\frac{5}{4}} = \frac{\sqrt{5}}{2}.

Question 18

Given cos(x+y)=14\cos(x+y) = \frac{1}{4} and cos(xy)=34\cos(x-y) = \frac{3}{4}, what is the value of cos(x)cos(y)\cos(x)\cos(y)?

  1. 18\frac{1}{8}
  2. 14\frac{1}{4}
  3. 12\frac{1}{2} (correct answer)
  4. 1
Explanation: We use the product-to-sum identity cos(x)cos(y)=12[cos(x+y)+cos(xy)]\cos(x)\cos(y) = \frac{1}{2}[\cos(x+y) + \cos(x-y)]. Substituting the given values directly into this formula: cos(x)cos(y)=12[14+34]=12[44]=12(1)=12\cos(x)\cos(y) = \frac{1}{2}\left[\frac{1}{4} + \frac{3}{4}\right] = \frac{1}{2}\left[\frac{4}{4}\right] = \frac{1}{2}(1) = \frac{1}{2}.

Question 19

Which of the following is an indefinite integral of f(x)=4sin(x)cos(3x)f(x) = 4\sin(x)\cos(3x)?

  1. cos(2x)12cos(4x)+C\cos(2x) - \frac{1}{2}\cos(4x) + C (correct answer)
  2. 12sin(4x)+sin(2x)+C\frac{1}{2}\sin(4x) + \sin(2x) + C
  3. 2cos(2x)2cos(4x)+C2\cos(2x) - 2\cos(4x) + C
  4. cos(2x)+12cos(4x)+C-\cos(2x) + \frac{1}{2}\cos(4x) + C
Explanation: First, use the product-to-sum identity sin(A)cos(B)=12[sin(A+B)+sin(AB)]\sin(A)\cos(B) = \frac{1}{2}[\sin(A+B) + \sin(A-B)]. Let A=xA=x and B=3xB=3x. Then 4sin(x)cos(3x)=412[sin(x+3x)+sin(x3x)]=2[sin(4x)+sin(2x)]=2sin(4x)2sin(2x)4\sin(x)\cos(3x) = 4 \cdot \frac{1}{2}[\sin(x+3x) + \sin(x-3x)] = 2[\sin(4x) + \sin(-2x)] = 2\sin(4x) - 2\sin(2x). Now, integrate this expression: (2sin(4x)2sin(2x))dx=2(cos(4x)4)2(cos(2x)2)+C=12cos(4x)+cos(2x)+C\int (2\sin(4x) - 2\sin(2x)) dx = 2\left(-\frac{\cos(4x)}{4}\right) - 2\left(-\frac{\cos(2x)}{2}\right) + C = -\frac{1}{2}\cos(4x) + \cos(2x) + C, which can be written as cos(2x)12cos(4x)+C\cos(2x) - \frac{1}{2}\cos(4x) + C.

Question 20

Which expression is equivalent to sin(x)+sin(5x)cos(x)+cos(5x)\frac{\sin(x) + \sin(5x)}{\cos(x) + \cos(5x)}?

  1. tan(2x)\tan(2x)
  2. tan(3x)\tan(3x) (correct answer)
  3. cot(2x)\cot(2x)
  4. cot(3x)\cot(3x)
Explanation: Apply the sum-to-product identities. Numerator: sin(x)+sin(5x)=2sin(x+5x2)cos(x5x2)=2sin(3x)cos(2x)=2sin(3x)cos(2x)\sin(x) + \sin(5x) = 2\sin\left(\frac{x+5x}{2}\right)\cos\left(\frac{x-5x}{2}\right) = 2\sin(3x)\cos(-2x) = 2\sin(3x)\cos(2x). Denominator: cos(x)+cos(5x)=2cos(x+5x2)cos(x5x2)=2cos(3x)cos(2x)=2cos(3x)cos(2x)\cos(x) + \cos(5x) = 2\cos\left(\frac{x+5x}{2}\right)\cos\left(\frac{x-5x}{2}\right) = 2\cos(3x)\cos(-2x) = 2\cos(3x)\cos(2x). The fraction becomes 2sin(3x)cos(2x)2cos(3x)cos(2x)=sin(3x)cos(3x)=tan(3x)\frac{2\sin(3x)\cos(2x)}{2\cos(3x)\cos(2x)} = \frac{\sin(3x)}{\cos(3x)} = \tan(3x).