Geometry Quiz: Proving Applying Laws Of Sines Cosines
20 questions · exam conditions
0:00
Proving Applying Laws Of Sines CosinesQuestion 1 of 20

A surveyor needs to find the area of a triangular plot of land. She measures two adjacent sides as 4545 meters and 6060 meters, with an included angle of 120°120°. Using an auxiliary line from the vertex of the 120°120° angle perpendicular to the opposite side, what is the area of the triangular plot?

135031350\sqrt{3} square meters
6753675\sqrt{3} square meters
13501350 square meters
675675 square meters
← Back to quizzes

Geometry Quiz

Geometry Quiz: Proving Applying Laws Of Sines Cosines

Practice Proving Applying Laws Of Sines Cosines in Geometry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Proving Applying Laws Of Sines Cosines, giving you a quick way to practice the rules, question types, and explanations that matter most for Geometry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A surveyor needs to find the area of a triangular plot of land. She measures two adjacent sides as 4545 meters and 6060 meters, with an included angle of 120°120°. Using an auxiliary line from the vertex of the 120°120° angle perpendicular to the opposite side, what is the area of the triangular plot?

  1. 135031350\sqrt{3} square meters
  2. 6753675\sqrt{3} square meters (correct answer)
  3. 13501350 square meters
  4. 675675 square meters
Explanation: Using the area formula A=12absin(C)A = \frac{1}{2}ab\sin(C) where a=45a = 45, b=60b = 60, and C=120°C = 120°. The area is 124560sin(120°)=12456032=270034=6753\frac{1}{2} \cdot 45 \cdot 60 \cdot \sin(120°) = \frac{1}{2} \cdot 45 \cdot 60 \cdot \frac{\sqrt{3}}{2} = \frac{2700\sqrt{3}}{4} = 675\sqrt{3}. Choice A incorrectly doubles the result. Choice C uses sin(120°)=1\sin(120°) = 1 instead of 32\frac{\sqrt{3}}{2}. Choice D omits the 3\sqrt{3} factor entirely.

Question 2

In triangle PQRPQR, side PQ=12PQ = 12, side QR=15QR = 15, and angle Q=60°Q = 60°. An auxiliary line is drawn from vertex PP perpendicular to side QRQR. Which expression correctly represents the area of triangle PQRPQR using the derived formula?

  1. 121215sin(60°)=453\frac{1}{2} \cdot 12 \cdot 15 \cdot \sin(60°) = 45\sqrt{3} (correct answer)
  2. 121215cos(60°)=45\frac{1}{2} \cdot 12 \cdot 15 \cdot \cos(60°) = 45
  3. 121215sin(30°)=45\frac{1}{2} \cdot 12 \cdot 15 \cdot \sin(30°) = 45
  4. 121215tan(60°)=903\frac{1}{2} \cdot 12 \cdot 15 \cdot \tan(60°) = 90\sqrt{3}
Explanation: The formula A=12absin(C)A = \frac{1}{2}ab\sin(C) uses the sine of the included angle between the two known sides. Here, sides PQ=12PQ = 12 and QR=15QR = 15 form angle Q=60°Q = 60°, so the area is 121215sin(60°)=9032=453\frac{1}{2} \cdot 12 \cdot 15 \cdot \sin(60°) = 90 \cdot \frac{\sqrt{3}}{2} = 45\sqrt{3}. Choice B incorrectly uses cosine instead of sine. Choice C uses the wrong angle (30° instead of 60°). Choice D incorrectly uses tangent instead of sine.

Question 3

Triangle XYZXYZ has sides XY=10XY = 10, YZ=14YZ = 14, and XZ=16XZ = 16. To find the area using the formula A=12absin(C)A = \frac{1}{2}ab\sin(C), which of the following approaches requires drawing an auxiliary line and is mathematically sound?

  1. Find the altitude to side XZXZ, then use A=1216hA = \frac{1}{2} \cdot 16 \cdot h
  2. Find angle XX using the Law of Sines, then calculate A=121416cos(X)A = \frac{1}{2} \cdot 14 \cdot 16 \cdot \cos(X)
  3. Use Heron's formula directly since all three sides are known
  4. Find angle YY using the Law of Cosines, then calculate A=121014sin(Y)A = \frac{1}{2} \cdot 10 \cdot 14 \cdot \sin(Y) (correct answer)
Explanation: When you're asked to find a triangle's area using A=12absin(C)A = \frac{1}{2}ab\sin(C), you need two sides and the included angle between them. Since you're only given the three side lengths (10, 14, and 16), you must first find one of the angles. Option D correctly identifies this approach: use the Law of Cosines to find angle YY, then apply the area formula. The Law of Cosines states c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab\cos(C). For angle YY, you'd write 162=102+1422(10)(14)cos(Y)16^2 = 10^2 + 14^2 - 2(10)(14)\cos(Y), solve for cos(Y)\cos(Y), then find YY. Finally, calculate A=121014sin(Y)A = \frac{1}{2} \cdot 10 \cdot 14 \cdot \sin(Y) using the two sides that form angle YY. Option A uses the altitude formula A=12bhA = \frac{1}{2}bh, which is valid but doesn't use the required A=12absin(C)A = \frac{1}{2}ab\sin(C) formula specified in the question. Option B contains a critical error: it uses cos(X)\cos(X) instead of sin(X)\sin(X) in the area formula. The correct formula always uses sine, not cosine. Option C suggests Heron's formula, which works perfectly for this triangle but again doesn't use the specified A=12absin(C)A = \frac{1}{2}ab\sin(C) format. Remember: when you have three sides and need to use A=12absin(C)A = \frac{1}{2}ab\sin(C), always use the Law of Cosines first to find an angle, then apply the area formula with the two sides that form that angle.

Question 4

Two triangles have the same area calculated using A=12absin(C)A = \frac{1}{2}ab\sin(C). Triangle 1 has sides a1=8a_1 = 8, b1=12b_1 = 12, and included angle C1=30°C_1 = 30°. Triangle 2 has sides a2=6a_2 = 6, b2=16b_2 = 16, and included angle C2C_2. What is the measure of angle C2C_2?

  1. 60°60°
  2. 45°45°
  3. 30°30° (correct answer)
  4. 90°90°
Explanation: When you encounter problems involving the area formula A=12absin(C)A = \frac{1}{2}ab\sin(C), you're working with the relationship between two sides of a triangle and their included angle. Since both triangles have equal areas, you can set up an equation to find the unknown angle. First, calculate the area of Triangle 1: A1=12(8)(12)sin(30°)=12(96)(12)=24A_1 = \frac{1}{2}(8)(12)\sin(30°) = \frac{1}{2}(96)(\frac{1}{2}) = 24. Since the triangles have equal areas, Triangle 2 also has area 24. Now set up the equation for Triangle 2: 24=12(6)(16)sin(C2)24 = \frac{1}{2}(6)(16)\sin(C_2). Simplifying: 24=48sin(C2)24 = 48\sin(C_2), so sin(C2)=2448=12\sin(C_2) = \frac{24}{48} = \frac{1}{2}. Therefore, C2=30°C_2 = 30°. Looking at the wrong answers: Choice (A) 60°60° would give sin(60°)=320.866\sin(60°) = \frac{\sqrt{3}}{2} \approx 0.866, resulting in an area of about 41.6, which is too large. Choice (B) 45°45° would yield sin(45°)=220.707\sin(45°) = \frac{\sqrt{2}}{2} \approx 0.707, giving an area of about 33.9, still too large. Choice (D) 90°90° would produce sin(90°)=1\sin(90°) = 1, resulting in an area of 48, which is exactly double what we need. Remember that when using A=12absin(C)A = \frac{1}{2}ab\sin(C), the angle C must be the included angle between sides a and b. Always double-check your sine values for common angles—knowing that sin(30°)=12\sin(30°) = \frac{1}{2} is essential for quick problem-solving.

Question 5

In the diagram, ABC is not a right triangle. The included angle at AA is θ\theta, with adjacent sides AB=cAB=c and AC=bAC=b, and opposite side BC=aBC=a.

A student claims: "If θ=90\theta=90^\circ, then the Law of Cosines becomes the Pythagorean Theorem." Which expression correctly shows this special case?

  1. If θ=90\theta=90^\circ, then a2=b2+c22bccos90=b2+c2a^2=b^2+c^2-2bc\cos90^\circ=b^2+c^2. (correct answer)
  2. If θ=90\theta=90^\circ, then a=b+ca=b+c because right triangles add sides.
  3. If θ=90\theta=90^\circ, then sinθ=1\sin\theta=1 so a1=bsinB\tfrac{a}{1}=\tfrac{b}{\sin B}.
  4. If θ=90\theta=90^\circ, then a2=b2+c2+2bccos90=b2+c2+2bca^2=b^2+c^2+2bc\cos90^\circ=b^2+c^2+2bc.
Explanation: The skill is applying the Law of Cosines and verifying its special case as the Pythagorean theorem. The geometric setup is triangle ABC with included angle θ at A, sides b and c adjacent, a opposite. The derivation idea is to substitute θ = 90° where cos 90° = 0, simplifying the formula. To apply the Law of Cosines, get a² = b² + c² - 2bc · 0 = b² + c². This is justified because it matches the Pythagorean theorem for right angles at A. A distractor adds unnecessary terms or misapplies sine instead. To transfer this strategy, ask why the cosine vanishes at 90° before how to simplify.

Question 6

In non-right triangle ABCABC, the included angle C\angle C is shown between sides ACAC and BCBC. Given AC=5AC=5, BC=9BC=9, and C=120\angle C=120^\circ, which reasoning correctly applies a law to find ABAB and explains why this law still works when the angle is obtuse?

  1. Use the Law of Cosines since it generalizes the Pythagorean Theorem: AB2=AC2+BC22(AC)(BC)cosCAB^2=AC^2+BC^2-2(AC)(BC)\cos C. (correct answer)
  2. Use the Pythagorean Theorem because any triangle with an obtuse angle can be split into two right triangles, so AB2=AC2+BC2AB^2=AC^2+BC^2.
  3. Use the Law of Sines with ABsinC=ACsinC\dfrac{AB}{\sin C}=\dfrac{AC}{\sin C} to conclude AB=ACAB=AC and then find ABAB.
  4. Estimate ABAB from the picture because C\angle C looks close to 180180^\circ so ABAC+BCAB\approx AC+BC.
Explanation: This problem involves finding side AB when given two sides and their included obtuse angle. The geometric setup provides AC = 5, BC = 9, and the included angle C = 120°, making this a Side-Angle-Side (SAS) case with an obtuse angle. The Law of Cosines generalizes the Pythagorean theorem to any triangle: AB² = AC² + BC² - 2(AC)(BC)cos C. Applying this: AB² = 25 + 81 - 2(5)(9)cos(120°) = 106 - 90(-0.5) = 106 + 45 = 151. The law works for obtuse angles because cos(120°) = -0.5, making the correction term positive, which increases AB² beyond what the Pythagorean theorem would give. Option B wrongly claims the Pythagorean theorem applies to obtuse triangles, while option D relies on visual estimation. When dealing with obtuse angles, the negative cosine in the Law of Cosines accounts for the triangle "opening up" more than a right triangle.

Question 7

In the diagram, ABC is not a right triangle. Segment ADAD is an altitude to BCBC (so ADBCAD\perp BC). Side AB=cAB=c, side AC=bAC=b, and angles at BB and CC are β\beta and γ\gamma.

A student wants to prove a Law of Sines relationship. Which statement correctly identifies the key equal quantities obtained from the right triangles ABD\triangle ABD and ACD\triangle ACD?

  1. AD=csinβAD=c\sin\beta and AD=bsinγAD=b\sin\gamma, so csinβ=bsinγc\sin\beta=b\sin\gamma. (correct answer)
  2. AD=ccosβAD=c\cos\beta and AD=bcosγAD=b\cos\gamma, so ccosβ=bcosγ\tfrac{c}{\cos\beta}=\tfrac{b}{\cos\gamma}.
  3. BD=csinβBD=c\sin\beta and DC=bsinγDC=b\sin\gamma, so BD=DCBD=DC.
  4. Since ADAD is an altitude, β+γ=90\beta+\gamma=90^\circ, so sinβ=cosγ\sin\beta=\cos\gamma.
Explanation: The skill is proving the Law of Sines using properties of right triangles formed by an altitude. The geometric setup features triangle ABC with altitude AD to BC, sides AB = c, AC = b, and angles β at B and γ at C. The derivation idea is to identify equal expressions for the altitude AD from trigonometric definitions in triangles ABD and ACD. To apply the Law of Sines, recognize AD = c sin β and AD = b sin γ, equating them for the relationship. This is correct as it directly leads to the proportional sides and sines after algebraic manipulation. A distractor incorrectly uses cosines instead of sines for the opposite side relations. To transfer this strategy, ask why the altitude is shared before how to express the sines.

Question 8

A non-right triangle XYZ\triangle XYZ has XY=6XY=6, XZ=11XZ=11, and included angle YXZ=30\angle YXZ=30^\circ emphasized at XX.

Which setup correctly uses a justification aligned with the Law of Cosines (and its Pythagorean special case) to find YZYZ?​

  1. Use YZ2=XY2+XZ22(XY)(XZ)cos30YZ^2=XY^2+XZ^2-2(XY)(XZ)\cos 30^\circ, which reduces to the Pythagorean Theorem when the included angle is 9090^\circ. (correct answer)
  2. Use YZ=XY+XZcos30YZ=XY+XZ-\cos 30^\circ because the cosine term is subtracted from the sum of the sides.
  3. Use YZ2=XY2+XZ2YZ^2=XY^2+XZ^2 because the included angle is given, so the triangle can be treated as right at XX.
  4. Use the Law of Sines: YZsin30=11sinY\frac{YZ}{\sin 30^\circ}=\frac{11}{\sin Y} and choose Y\angle Y by visual estimation.
Explanation: The skill involves proving and applying the Law of Cosines for sides. In triangle XYZ, sides XY and XZ enclose acute angle YXZ at 30 degrees. The derivation idea adds a cosine term to generalize Pythagorean for any angle. Apply the law using YZ² = 6² + 11² - 2(6)(11)cos 30°, reducing to Pythagorean at 90°. This is correct because it connects to the special case effectively. A distractor like choice C treats it as right-angled without basis. To transfer this strategy, always ask why the formula generalizes Pythagorean before how to calculate the side.

Question 9

A non-right triangle MNO\triangle MNO has sides MN=8MN=8, MO=13MO=13, and NO=17NO=17. The included angle at MM is emphasized (between MNMN and MOMO).

Which setup correctly finds M\angle M using a justification consistent with the Law of Cosines (as a Pythagorean generalization)?​

  1. Set 172=82+1322(8)(13)cosM17^2=8^2+13^2-2(8)(13)\cos M, so cosM=82+1321722813\cos M=\frac{8^2+13^2-17^2}{2\cdot 8\cdot 13}. (correct answer)
  2. Set 17sinM=13sinN\frac{17}{\sin M}=\frac{13}{\sin N} and choose N\angle N by estimating it from the drawing.
  3. Assume M=90\angle M=90^\circ because it is the included angle, then use 172=82+13217^2=8^2+13^2.
  4. Write cosM=178+13\cos M=\frac{17}{8+13} since cosine compares the opposite side to the sum of adjacent sides.
Explanation: The skill involves proving and applying the Law of Cosines to find angles in non-right triangles. In triangle MNO, sides MN and MO enclose angle M, with opposite side NO given. The derivation idea generalizes the Pythagorean theorem with a cosine adjustment for the included angle. Apply the law by setting 17² = 8² + 13² - 2(8)(13)cos M, solving for cos M. This is correct because it accurately isolates the angle using the formula's structure. A distractor like choice C assumes a right angle at M without justification. To transfer this strategy, always ask why the formula accounts for the angle before how to solve for cosine.

Question 10

A triangle has an area of 30230\sqrt{2} square units. Two of its sides measure 1212 units and 1010 units respectively. If an auxiliary line is drawn from the vertex between these sides perpendicular to the opposite side, what is the measure of the included angle between the two known sides?

  1. 60°60°
  2. 30°30°
  3. 45°45° (correct answer)
  4. 135°135°
Explanation: When you encounter a triangle problem involving area, two sides, and an included angle, you're working with the area formula: A=12absinCA = \frac{1}{2}ab\sin C, where aa and bb are the two known sides and CC is the angle between them. Given: area = 30230\sqrt{2}, sides = 12 and 10 units. Substituting into the formula: 302=121210sinC30\sqrt{2} = \frac{1}{2} \cdot 12 \cdot 10 \cdot \sin C 302=60sinC30\sqrt{2} = 60\sin C sinC=30260=22\sin C = \frac{30\sqrt{2}}{60} = \frac{\sqrt{2}}{2} Since sinC=22\sin C = \frac{\sqrt{2}}{2}, the angle C=45°C = 45° (or 135°135°). To determine which, consider that the auxiliary line mentioned is the altitude from the vertex between the known sides. This detail suggests we're working with the acute angle case, making C=45°C = 45°. Answer A (60°60°) would give sin60°=32\sin 60° = \frac{\sqrt{3}}{2}, not 22\frac{\sqrt{2}}{2}. Answer B (30°30°) would give sin30°=12\sin 30° = \frac{1}{2}, which is too small. Answer D (135°135°) technically satisfies sin135°=22\sin 135° = \frac{\sqrt{2}}{2}, but the auxiliary line context indicates the acute angle. Study tip: Always memorize the exact sine values for special angles (30°30°, 45°45°, 60°60°). When you see 22\frac{\sqrt{2}}{2} as a sine value, immediately think 45°45°. The area formula with sine is crucial for any triangle where you know two sides and need the included angle.

Question 11

In the derivation of the area formula A=12absin(C)A = \frac{1}{2}ab\sin(C), an auxiliary line creates a right triangle. If the original triangle has sides a=15a = 15, b=20b = 20, and the included angle C=150°C = 150°, what is the length of the auxiliary line (height)?

  1. 1010 units
  2. 7.57.5 units (correct answer)
  3. 15315\sqrt{3} units
  4. 10310\sqrt{3} units
Explanation: When the auxiliary line is drawn from the vertex with angle CC perpendicular to side bb, it creates a height hh. In the right triangle formed, h=asin(C)=15sin(150°)=1512=7.5h = a\sin(C) = 15\sin(150°) = 15 \cdot \frac{1}{2} = 7.5 units (since sin(150°)=sin(30°)=12\sin(150°) = \sin(30°) = \frac{1}{2}). Choice A would result from using b=20b = 20 instead of a=15a = 15. Choice C incorrectly uses sin(150°)=32\sin(150°) = \frac{\sqrt{3}}{2}. Choice D combines the wrong sine value with side bb.

Question 12

In the diagram, ABC is not a right triangle. The included angle at AA is θ\theta, with AB=cAB=c, AC=bAC=b, and BC=aBC=a.

Which setup correctly applies the Law of Cosines to solve for cosθ\cos\theta in terms of aa, bb, and cc?

  1. cosθ=b2+c2a22bc\cos\theta=\dfrac{b^2+c^2-a^2}{2bc}. (correct answer)
  2. cosθ=a2b2c22bc\cos\theta=\dfrac{a^2-b^2-c^2}{2bc}.
  3. cosθ=ab+c\cos\theta=\dfrac{a}{b+c}.
  4. Since the triangle is not right, cosθ=0\cos\theta=0.
Explanation: The skill is applying the Law of Cosines to solve for the cosine of an angle. The geometric setup involves triangle ABC with angle θ at A, sides AB = c, AC = b, BC = a. The derivation idea is to rearrange the standard formula to isolate cos θ. To apply the Law of Cosines, compute cos θ = (b² + c² - a²) / (2bc). This is justified as it derives from the projection and Pythagorean applications. A distractor negates terms incorrectly or assumes zero cosine. To transfer this strategy, ask why the formula isolates cosine before how to compute it.

Question 13

In non-right triangle ABCABC, the included angle A\angle A is shown. Given AB=6AB=6, AC=6AC=6, and A=30\angle A=30^\circ, which setup correctly finds BCBC and also connects to the idea that the Law of Cosines reduces to the Pythagorean Theorem when A=90\angle A=90^\circ?

  1. Use the Law of Sines: BCsinA=ABsinB\dfrac{BC}{\sin A}=\dfrac{AB}{\sin B}, then set B=60B=60^\circ because the sides look equal.
  2. Use the Law of Cosines: BC2=AB2+AC22(AB)(AC)cosABC^2=AB^2+AC^2-2(AB)(AC)\cos A, noting if A=90A=90^\circ then cosA=0\cos A=0. (correct answer)
  3. Assume A=90\angle A=90^\circ since AB=ACAB=AC, then use BC2=AB2+AC2BC^2=AB^2+AC^2.
  4. Estimate BCBC by the drawing since equal sides guarantee a right triangle, so BC62BC\approx 6\sqrt2.
Explanation: This problem involves finding side BC in an isosceles triangle with a given vertex angle. The geometric setup shows AB = AC = 6 and angle A = 30°, making this a Side-Angle-Side case where the two known sides are equal. The Law of Cosines states BC² = AB² + AC² - 2(AB)(AC)cos A, which becomes BC² = 36 + 36 - 2(6)(6)cos(30°) = 72 - 72(√3/2). This formula generalizes the Pythagorean theorem, reducing to it when A = 90° because cos(90°) = 0, eliminating the correction term. The calculation shows how the Law of Cosines handles any angle, with the cosine term adjusting for how much the triangle deviates from a right triangle. Option C incorrectly assumes A = 90° just because AB = AC (isosceles doesn't mean right), while option D relies on faulty visual estimation. Understanding this connection helps you see the Law of Cosines as a natural extension of the Pythagorean theorem.

Question 14

In triangle ABCABC (not right), an altitude CDCD is drawn to ABAB. Given AC=8AC=8, BC=11BC=11, and A=35\angle A=35^\circ, which plan correctly uses the altitude to justify a Law of Sines relationship and then find B\angle B?

  1. Use CD=ACsinACD=AC\sin A and CD=BCsinBCD=BC\sin B to get ACsinA=BCsinBAC\sin A=BC\sin B, then solve for sinB\sin B. (correct answer)
  2. Use CD=ACcosACD=AC\cos A and CD=BCcosBCD=BC\cos B to get ACcosA=BCcosBAC\cos A=BC\cos B, then solve for BB.
  3. Use the Law of Cosines with AB2=AC2+BC22(AC)(BC)cosCAB^2=AC^2+BC^2-2(AC)(BC)\cos C, then set C=90C=90^\circ to find BB.
  4. Apply the Law of Sines directly because it is a memorized formula; no altitude reasoning is needed.
Explanation: This problem demonstrates using an altitude to derive and apply the Law of Sines. The geometric setup has altitude CD to side AB, with AC = 8, BC = 11, and angle A = 35°. In right triangle ACD, sin A = CD/AC, giving CD = AC·sin A = 8·sin(35°), and in right triangle BCD, sin B = CD/BC, so CD = BC·sin B = 11·sin B. Setting these equal: 8·sin(35°) = 11·sin B, which solves for sin B and thus angle B. This approach justifies the Law of Sines relationship AC·sin A = BC·sin B through the common altitude CD. Option B incorrectly uses cosine instead of sine for the altitude relationship, while option C unnecessarily invokes the Law of Cosines. The altitude method shows why the Law of Sines works: it captures how angles relate to opposite sides through a common height.

Question 15

In non-right triangle ABCABC, the included angle at AA is emphasized. Given AB=9AB=9, AC=12AC=12, and A=40\angle A=40^\circ, which reasoning correctly sets up a method to find BCBC and explains why that method is valid?

  1. Use the Law of Cosines because it generalizes the Pythagorean Theorem: BC2=AB2+AC22(AB)(AC)cosABC^2=AB^2+AC^2-2(AB)(AC)\cos A. (correct answer)
  2. Use the Law of Sines because ABsinA=ACsinA\dfrac{AB}{\sin A}=\dfrac{AC}{\sin A}, so AB=ACAB=AC and then find BCBC.
  3. Assume a right triangle at AA because the included angle is shown, then use BC=AB2+AC2BC=\sqrt{AB^2+AC^2}.
  4. Estimate BCBC by comparing how long it looks relative to ABAB and ACAC in the diagram.
Explanation: This problem requires finding the third side BC when given two sides and their included angle. The geometric setup shows AB = 9, AC = 12, and the included angle A = 40°, making this a Side-Angle-Side (SAS) case. The Law of Cosines generalizes the Pythagorean theorem by adding a correction term for non-right angles: BC² = AB² + AC² - 2(AB)(AC)cos A. Applying this law: BC² = 9² + 12² - 2(9)(12)cos(40°), which can be calculated to find BC. The formula correctly handles any angle, reducing to the Pythagorean theorem when A = 90° (since cos 90° = 0). Option B incorrectly claims sin A = sin A implies AB = AC, while option C wrongly assumes a right angle. When you know two sides and their included angle, the Law of Cosines is the appropriate tool.

Question 16

In the diagram, ABC is not a right triangle. The included angle at AA is labeled θ\theta, with adjacent sides AB=9AB=9 and AC=12AC=12.

Which setup correctly finds the length of BCBC when θ=120\theta=120^\circ, using reasoning consistent with the Law of Cosines (generalizing the Pythagorean Theorem to an obtuse included angle)? ​

  1. Use BC2=92+1222(9)(12)cos120BC^2=9^2+12^2-2(9)(12)\cos120^\circ, then take BC=92+1222(9)(12)cos120BC=\sqrt{9^2+12^2-2(9)(12)\cos120^\circ}. (correct answer)
  2. Use BC2=92+122BC^2=9^2+12^2 since the largest angle makes it a right triangle.
  3. Use BCsin120=12sin120\tfrac{BC}{\sin120^\circ}=\tfrac{12}{\sin120^\circ}, so BC=12BC=12.
  4. Because the picture would look wide at AA, estimate BC3BC\approx 3.
Explanation: The skill is applying the Law of Cosines for obtuse angles, generalizing Pythagorean. The geometric setup is triangle ABC with obtuse angle 120° at A, adjacent sides AB = 9, AC = 12, opposite BC. The derivation idea is to use negative cosine for obtuse angles, adding to the sum of squares. To apply the Law of Cosines, compute BC² = 9² + 12² - 2·9·12·cos 120°, with cos 120° = -0.5. This is justified as it accounts for the angle spreading the sides. A distractor ignores the cosine and assumes right triangle. To transfer this strategy, ask why obtuse angles increase the opposite side before how to calculate.

Question 17

In the diagram, ABC is not a right triangle. The included angle at AA is A=60\angle A=60^\circ, with adjacent sides AB=7AB=7 and AC=10AC=10. The opposite side is BC=aBC=a.

Which setup both (i) uses the Law of Cosines as a generalization of the Pythagorean Theorem and (ii) correctly computes aa?

  1. Assume a right triangle: a2=72+102a^2=7^2+10^2, so a=149a=\sqrt{149}.
  2. Use a2=72+1022(7)(10)cos60a^2=7^2+10^2-2(7)(10)\cos60^\circ, so a=79a=\sqrt{79}. (correct answer)
  3. Use asin60=7sin60\tfrac{a}{\sin60^\circ}=\tfrac{7}{\sin60^\circ}, so a=7a=7.
  4. Since the diagram looks obtuse at AA, take a17a\approx 17 by visual estimation.
Explanation: The skill is applying the Law of Cosines as a generalization of the Pythagorean theorem. The geometric setup is triangle ABC with angle 60° at A, adjacent sides AB = 7 and AC = 10, opposite side BC = a. The derivation idea is to incorporate the cosine of the included angle to adjust for non-right triangles. To apply the Law of Cosines, calculate a² = 7² + 10² - 2·7·10·cos 60°, resulting in a = √79. This is justified because cos 60° = 0.5 reduces the subtraction, yielding a value between the right-triangle case and others. A distractor assumes a right triangle, ignoring the angle adjustment. To transfer this strategy, ask why the law extends Pythagorean before how to plug in values.

Question 18

A non-right triangle DEF\triangle DEF has DE=5DE=5, DF=12DF=12, and EF=13EF=13. The included angle at DD is emphasized.

Which reasoning correctly decides whether D\angle D is acute, right, or obtuse using the Law of Cosines as a generalization of the Pythagorean Theorem?​

  1. Compute cosD=DE2+DF2EF22(DE)(DF)\cos D=\frac{DE^2+DF^2-EF^2}{2(DE)(DF)}; since this value is 00, conclude D\angle D is right. (correct answer)
  2. Since 5+12=135+12=13, the triangle must be right at DD, so D=90\angle D=90^\circ by inspection.
  3. Use the Law of Sines with 13sinD\frac{13}{\sin D} and infer D\angle D from how large 13 is compared to 12.
  4. Because the diagram is not drawn to scale, you cannot classify D\angle D even with the side lengths given.
Explanation: The skill involves proving and applying the Law of Cosines to classify angles. In triangle DEF, sides DE and DF enclose angle D, with opposite side EF. The derivation idea uses cosine sign to determine acute, right, or obtuse compared to Pythagorean. Apply the law by computing cos D = (5² + 12² - 13²)/(2·5·12), yielding 0 for right angle. This is correct because zero cosine confirms 90° precisely. A distractor like choice B misuses side sum instead of squares. To transfer this strategy, always ask why cosine sign indicates angle type before how to compute it.

Question 19

A non-right triangle XYZ\triangle XYZ has XY=6XY=6, XZ=11XZ=11, and included angle YXZ=30\angle YXZ=30^\circ emphasized at XX.

Which setup correctly uses a justification aligned with the Law of Cosines (and its Pythagorean special case) to find YZYZ?

  1. Use YZ2=XY2+XZ22(XY)(XZ)cos30YZ^2=XY^2+XZ^2-2(XY)(XZ)\cos 30^\circ, which reduces to the Pythagorean Theorem when the included angle is 9090^\circ. (correct answer)
  2. Use YZ=XY+XZcos30YZ=XY+XZ-\cos 30^\circ because the cosine term is subtracted from the sum of the sides.
  3. Use YZ2=XY2+XZ2YZ^2=XY^2+XZ^2 because the included angle is given, so the triangle can be treated as right at XX.
  4. Use the Law of Sines: YZsin30=11sinY\frac{YZ}{\sin 30^\circ}=\frac{11}{\sin Y} and choose Y\angle Y by visual estimation.
Explanation: The skill involves proving and applying the Law of Cosines for sides. In triangle XYZ, sides XY and XZ enclose acute angle YXZ at 30 degrees. The derivation idea adds a cosine term to generalize Pythagorean for any angle. Apply the law using YZ² = 6² + 11² - 2(6)(11)cos 30°, reducing to Pythagorean at 90°. This is correct because it connects to the special case effectively. A distractor like choice C treats it as right-angled without basis. To transfer this strategy, always ask why the formula generalizes Pythagorean before how to calculate the side.

Question 20

In triangle ABCABC (not right), an altitude CDCD is drawn to ABAB. Suppose you know ACAC and BCBC and you measure A\angle A and B\angle B. Which reasoning correctly explains why ACsinB=BCsinA\dfrac{AC}{\sin B}=\dfrac{BC}{\sin A} must be true using the altitude (not memorized formulas)?

  1. Because CD=ACsinACD=AC\sin A and CD=BCsinBCD=BC\sin B, so ACsinA=BCsinBAC\sin A=BC\sin B and the ratio follows by rearranging. (correct answer)
  2. Because CD=ACsinBCD=AC\sin B and CD=BCsinACD=BC\sin A, so ACsinB=BCsinAAC\sin B=BC\sin A and the ratio follows.
  3. Because ABC\triangle ABC is a right triangle once the altitude is drawn, so the sine ratios are the same in both smaller triangles.
  4. Because the diagram appears symmetric about CDCD, so AC=BCAC=BC and therefore ACsinB=BCsinA\dfrac{AC}{\sin B}=\dfrac{BC}{\sin A}.
Explanation: This problem asks for a geometric justification of the Law of Sines using an altitude. The setup has altitude CD from C to side AB, creating two right triangles where we can apply basic trigonometry. In right triangle ACD, sin A = CD/AC, which gives CD = AC·sin A, and in right triangle BCD, sin B = CD/BC, which gives CD = BC·sin B. Since both expressions equal the same altitude CD, we have AC·sin A = BC·sin B. Rearranging this equality by dividing both sides by sin A·sin B gives AC/sin B = BC/sin A, which is the Law of Sines relationship. Option B reverses the angles in the sine expressions, while option C incorrectly claims the original triangle becomes right. This altitude-based reasoning shows why the Law of Sines must be true: it expresses the invariant relationship between a triangle's sides and opposite angles through a common height.