Differential Equations Quiz: Solving Exact Des
20 questions · exam conditions
0:00
Solving Exact DesQuestion 1 of 20

The differential equation M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0 is known to be exact with potential function F(x,y)F(x,y). If a new differential equation is formed as (M(x,y)+f(x))dx+(N(x,y)+g(y))dy=0(M(x,y)+f(x))dx + (N(x,y)+g(y))dy = 0, where f(x)f(x) and g(y)g(y) are continuous functions, under what condition is this new equation also exact?

Only if f(x)=g(y)f'(x) = g'(y) for all x,yx, y in the domain.
Only if f(x)f(x) and g(y)g(y) are both constants.
The new equation is always exact for any choice of f(x)f(x) and g(y)g(y).
Only if f(x)f(x) and g(y)g(y) are both identically zero.
← Back to quizzes

Differential Equations Quiz

Differential Equations Quiz: Solving Exact Des

Practice Solving Exact Des in Differential Equations with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Solving Exact Des, giving you a quick way to practice the rules, question types, and explanations that matter most for Differential Equations.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

The differential equation M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0 is known to be exact with potential function F(x,y)F(x,y). If a new differential equation is formed as (M(x,y)+f(x))dx+(N(x,y)+g(y))dy=0(M(x,y)+f(x))dx + (N(x,y)+g(y))dy = 0, where f(x)f(x) and g(y)g(y) are continuous functions, under what condition is this new equation also exact?

  1. Only if f(x)=g(y)f'(x) = g'(y) for all x,yx, y in the domain.
  2. Only if f(x)f(x) and g(y)g(y) are both constants.
  3. The new equation is always exact for any choice of f(x)f(x) and g(y)g(y). (correct answer)
  4. Only if f(x)f(x) and g(y)g(y) are both identically zero.
Explanation: When you encounter questions about exactness of differential equations, remember that the key criterion is whether the mixed partial derivatives are equal: My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. Since the original equation M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0 is exact, we know that My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. For the new equation (M(x,y)+f(x))dx+(N(x,y)+g(y))dy=0(M(x,y)+f(x))dx + (N(x,y)+g(y))dy = 0, we need to check if y[M(x,y)+f(x)]=x[N(x,y)+g(y)]\frac{\partial}{\partial y}[M(x,y)+f(x)] = \frac{\partial}{\partial x}[N(x,y)+g(y)]. Computing these partial derivatives: the left side gives My+f(x)y=My+0=My\frac{\partial M}{\partial y} + \frac{\partial f(x)}{\partial y} = \frac{\partial M}{\partial y} + 0 = \frac{\partial M}{\partial y}, since f(x)f(x) doesn't depend on yy. The right side gives Nx+g(y)x=Nx+0=Nx\frac{\partial N}{\partial x} + \frac{\partial g(y)}{\partial x} = \frac{\partial N}{\partial x} + 0 = \frac{\partial N}{\partial x}, since g(y)g(y) doesn't depend on xx. Since My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x} from the original exact equation, the new equation is also exact regardless of what f(x)f(x) and g(y)g(y) are. This makes C correct. A is wrong because the derivatives of ff and gg don't appear in the exactness condition. B and D are incorrect because they impose unnecessary restrictions—the functions can be any continuous functions, not just constants or zero. Study tip: Remember that adding functions of only one variable to each term preserves exactness because mixed partials of single-variable functions are always zero.

Question 2

The differential equation dx+(2y2xy)dy=0dx + (2y^2 - \frac{x}{y}) dy = 0 is not exact but can be made exact using an integrating factor μ(y)\mu(y) that is a function of yy alone. Find the general solution of the resulting exact equation.

  1. xyy2=C\frac{x}{y} - y^2 = C
  2. xy+y2=C\frac{x}{y} + y^2 = C (correct answer)
  3. x+2y33xlny=Cx + \frac{2y^3}{3} - x \ln|y| = C
  4. xlnyy2=Cx\ln|y| - y^2 = C
Explanation: When you encounter a non-exact differential equation, your goal is to find an integrating factor that makes it exact, then solve the resulting equation systematically. First, verify this equation isn't exact by checking if My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x} where M=1M = 1 and N=2y2xyN = 2y^2 - \frac{x}{y}. Since My=0\frac{\partial M}{\partial y} = 0 but Nx=1y\frac{\partial N}{\partial x} = -\frac{1}{y}, the equation is indeed non-exact. To find the integrating factor μ(y)\mu(y), use the formula: dlnμdy=MyNxN=0(1y)2y2xy=1y(2y2xy)=12y3x\frac{d\ln\mu}{dy} = \frac{\frac{\partial M}{\partial y} - \frac{\partial N}{\partial x}}{N} = \frac{0 - (-\frac{1}{y})}{2y^2 - \frac{x}{y}} = \frac{1}{y(2y^2 - \frac{x}{y})} = \frac{1}{2y^3 - x} Actually, let's try μ(y)=1y\mu(y) = \frac{1}{y}. Multiplying the original equation by 1y\frac{1}{y}: 1ydx+(2yxy2)dy=0\frac{1}{y}dx + (2y - \frac{x}{y^2})dy = 0 Now M=1yM = \frac{1}{y} and N=2yxy2N = 2y - \frac{x}{y^2}. Check: My=1y2\frac{\partial M}{\partial y} = -\frac{1}{y^2} and Nx=1y2\frac{\partial N}{\partial x} = -\frac{1}{y^2}. Perfect—it's exact! For an exact equation, F(x,y)=CF(x,y) = C where Fx=1y\frac{\partial F}{\partial x} = \frac{1}{y} and Fy=2yxy2\frac{\partial F}{\partial y} = 2y - \frac{x}{y^2}. Integrating the first: F=xy+g(y)F = \frac{x}{y} + g(y). Using the second condition gives g(y)=y2g(y) = y^2, so F=xy+y2F = \frac{x}{y} + y^2. The answer is B. Choice A has the wrong sign, while C and D represent different solution approaches that don't match our exact equation's structure. Remember: always verify your integrating factor makes the equation exact before proceeding to solve.

Question 3

The differential equation (2x+y)dx+(x2y)dy=0(2x + y) \, dx + (x - 2y) \, dy = 0 is exact, with general solution F(x,y)=x2+xyy2=CF(x,y) = x^2 + xy - y^2 = C. Which of the following differential equations has solution curves that are orthogonal trajectories to the solution curves of the original equation?

  1. (x2y)dx+(2x+y)dy=0(x - 2y) \, dx + (2x + y) \, dy = 0
  2. (2x+y)dx(x2y)dy=0(2x + y) \, dx - (x - 2y) \, dy = 0
  3. (x2y)dx(2x+y)dy=0(x - 2y) \, dx - (2x + y) \, dy = 0 (correct answer)
  4. (2xy)dx+(x+2y)dy=0(2x - y) \, dx + (x + 2y) \, dy = 0
Explanation: The slope of the tangent line to the solution curves of the given equation Mdx+Ndy=0M \, dx + N \, dy = 0 is given by dydx=MN\frac{dy}{dx} = -\frac{M}{N}. For the given equation, the slope is dydx=2x+yx2y=2x+y2yx\frac{dy}{dx} = -\frac{2x+y}{x-2y} = \frac{2x+y}{2y-x}. The slope of the orthogonal trajectories, let's call it dydx\frac{dy}{dx}_{\perp}, is the negative reciprocal of the original slope. dydx=12x+y2yx=2yx2x+y=x2y2x+y\frac{dy}{dx}_{\perp} = -\frac{1}{\frac{2x+y}{2y-x}} = -\frac{2y-x}{2x+y} = \frac{x-2y}{2x+y}. Now, we convert this slope back into a differential equation of the form Mdx+Ndy=0M_{\perp} \, dx + N_{\perp} \, dy = 0. From dydx=x2y2x+y\frac{dy}{dx} = \frac{x-2y}{2x+y}, we can write (2x+y)dy=(x2y)dx(2x+y) \, dy = (x-2y) \, dx. Rearranging this into the standard form gives: (x2y)dx(2x+y)dy=0(x-2y) \, dx - (2x+y) \, dy = 0. This matches option C. Option A results from a sign error when finding the negative reciprocal. Option B represents the original family of curves.

Question 4

Consider the differential equation M(x,y)dx+N(x,y)dy=0M(x,y) \, dx + N(x,y) \, dy = 0. If My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x} for all (x,y)(x,y) in a simply connected region RR, which statement is guaranteed to be true?

  1. The equation is separable and can be solved by separating variables.
  2. The equation has a unique solution passing through any point in RR.
  3. There exists a function F(x,y)F(x,y) such that M=FyM = \frac{\partial F}{\partial y} and N=FxN = \frac{\partial F}{\partial x}.
  4. The general solution is given by a family of level curves of some potential function F(x,y)F(x,y). (correct answer)
Explanation: The condition My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x} is the test for exactness. If a differential equation is exact on a simply connected region, there exists a potential function F(x,y)F(x,y) such that Fx=M\frac{\partial F}{\partial x} = M and Fy=N\frac{\partial F}{\partial y} = N. The general solution to the differential equation is given implicitly by F(x,y)=CF(x,y) = C, where CC is an arbitrary constant. Each value of CC defines a specific curve, and the set of these curves for all possible CC forms a family of level curves of the surface z=F(x,y)z = F(x,y). Distractor A is incorrect; exact equations are not necessarily separable. Distractor B is incorrect; exactness alone does not guarantee uniqueness for an initial value problem, which requires additional conditions like the Lipschitz condition. Distractor C is incorrect because the partial derivatives are switched; it should be M=FxM = \frac{\partial F}{\partial x} and N=FyN = \frac{\partial F}{\partial y}.

Question 5

Consider the differential equation (3x2y+ex)dx+(x3+2y)dy=0(3x^2y + e^x)dx + (x^3 + 2y)dy = 0. After verifying that this equation is exact, what is the general solution?

  1. x3y+ex+y2=Cx^3y + e^x + y^2 = C (correct answer)
  2. x3y+exy2=Cx^3y + e^x - y^2 = C
  3. 3x2y+ex+x3+2y=C3x^2y + e^x + x^3 + 2y = C
  4. x3y+ex+2y2=Cx^3y + e^x + 2y^2 = C
Explanation: First verify exactness: ∂M/∂y = ∂(3x²y + eˣ)/∂y = 3x² and ∂N/∂x = ∂(x³ + 2y)/∂x = 3x². Since these are equal, the equation is exact. To find F(x,y), integrate M with respect to x: F = ∫(3x²y + eˣ)dx = x³y + eˣ + g(y). Then ∂F/∂y = x³ + g'(y) = N = x³ + 2y, so g'(y) = 2y and g(y) = y². Therefore F(x,y) = x³y + eˣ + y² = C. Choice B has wrong sign on y². Choice C incorrectly adds all terms. Choice D has coefficient error in y² term.

Question 6

The differential equation (ey+yex)dx+(xey+ex)dy=0\left(e^y + ye^x\right)dx + \left(xe^y + e^x\right)dy = 0 is exact. After finding the potential function F(x,y)F(x,y), what is 2Fxy\frac{\partial^2 F}{\partial x \partial y}?

  1. ex+yexe^x + ye^x
  2. ey+exe^y + e^x (correct answer)
  3. xey+yexxe^y + ye^x
  4. ey+xeye^y + xe^y
Explanation: When you encounter an exact differential equation, you're working with equations where M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0 and My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. The key insight is that there exists a potential function F(x,y)F(x,y) such that Fx=M\frac{\partial F}{\partial x} = M and Fy=N\frac{\partial F}{\partial y} = N. Here, M(x,y)=ey+yexM(x,y) = e^y + ye^x and N(x,y)=xey+exN(x,y) = xe^y + e^x. The mixed partial derivative 2Fxy\frac{\partial^2 F}{\partial x \partial y} can be found by taking My\frac{\partial M}{\partial y} or Nx\frac{\partial N}{\partial x} (they're equal for exact equations). Taking My=y(ey+yex)=ey+ex\frac{\partial M}{\partial y} = \frac{\partial}{\partial y}(e^y + ye^x) = e^y + e^x, which is answer B. Let's verify: Nx=x(xey+ex)=ey+ex\frac{\partial N}{\partial x} = \frac{\partial}{\partial x}(xe^y + e^x) = e^y + e^x. Perfect match. Looking at the wrong answers: A) ex+yexe^x + ye^x appears to be Mx\frac{\partial M}{\partial x}, not the mixed partial. C) xey+yexxe^y + ye^x incorrectly combines terms from both MM and NN. D) ey+xeye^y + xe^y seems to be Ny\frac{\partial N}{\partial y}, which gives the wrong mixed partial. Remember: For exact equations, 2Fxy=My=Nx\frac{\partial^2 F}{\partial x \partial y} = \frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. This equality is what makes the equation exact in the first place, and either calculation gives you the mixed partial derivative.

Question 7

Find the general solution to the differential equation (ysin(x)+xycos(x))dx+(xsin(x)+1)dy=0(y\sin(x) + xy\cos(x))dx + (x\sin(x) + 1)dy = 0.

  1. y(xsin(x))=Cy(x\sin(x)) = C
  2. y(xsin(x)+1)=Cy(x\sin(x)+1) = C (correct answer)
  3. y(xcos(x)sin(x))=Cy(x\cos(x)-\sin(x)) = C
  4. y(xsin(x)xcos(x)+1)=Cy(x\sin(x)-x\cos(x)+1) = C
Explanation: When you encounter a differential equation in the form M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0, you should first check if it's exact. An exact equation has the property that My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}, and its solution comes from finding a function F(x,y)=CF(x,y) = C whose total differential equals the given equation. Here, M(x,y)=ysin(x)+xycos(x)M(x,y) = y\sin(x) + xy\cos(x) and N(x,y)=xsin(x)+1N(x,y) = x\sin(x) + 1. Let's verify exactness: My=sin(x)+xcos(x)\frac{\partial M}{\partial y} = \sin(x) + x\cos(x) and Nx=sin(x)+xcos(x)\frac{\partial N}{\partial x} = \sin(x) + x\cos(x). Since these are equal, the equation is exact. To find the solution, integrate MM with respect to xx: F(x,y)=y(sin(x)+xcos(x))dx=y(xsin(x)+C1)=yxsin(x)+C1yF(x,y) = y\int(\sin(x) + x\cos(x))dx = y(x\sin(x) + C_1) = yx\sin(x) + C_1y. Adding any function of yy alone, we get F(x,y)=yxsin(x)+g(y)F(x,y) = yx\sin(x) + g(y). Using Fy=N\frac{\partial F}{\partial y} = N: xsin(x)+g(y)=xsin(x)+1x\sin(x) + g'(y) = x\sin(x) + 1, so g(y)=1g'(y) = 1 and g(y)=yg(y) = y. Therefore, F(x,y)=yxsin(x)+y=y(xsin(x)+1)F(x,y) = yx\sin(x) + y = y(x\sin(x) + 1), giving us the solution y(xsin(x)+1)=Cy(x\sin(x) + 1) = C. Answer A omits the constant term. Answer C uses cosine instead of sine and has incorrect signs. Answer D includes extra terms that don't belong in this solution. Remember: for exact equations, always verify the exactness condition first, then integrate systematically to build the solution function.

Question 8

Consider the initial value problem (yx+6x)dx+(ln(x)2)dy=0(\frac{y}{x} + 6x)dx + (\ln(x) - 2)dy = 0, with the initial condition y(e)=4y(e)=4. What is the value of y(1)y(1)?

  1. 22
  2. 73e22\frac{7 - 3e^2}{2} (correct answer)
  3. 3e272\frac{3e^2 - 7}{2}
  4. 3e2+12-\frac{3e^2 + 1}{2}
Explanation: Let M=y/x+6xM = y/x + 6x and N=ln(x)2N = \ln(x) - 2. The equation is defined for x>0x>0. Check for exactness: My=1/x\frac{\partial M}{\partial y} = 1/x and Nx=1/x\frac{\partial N}{\partial x} = 1/x. The equation is exact. Find the potential function F(x,y)F(x,y) by integrating NN with respect to yy: F(x,y)=(ln(x)2)dy=y(ln(x)2)+h(x)F(x,y) = \int (\ln(x)-2)dy = y(\ln(x)-2) + h(x). Differentiate with respect to xx: Fx=y(1/x)+h(x)\frac{\partial F}{\partial x} = y(1/x) + h'(x). Set this equal to MM: y/x+h(x)=y/x+6xy/x + h'(x) = y/x + 6x. So, h(x)=6xh'(x) = 6x, which gives h(x)=3x2h(x) = 3x^2. The general solution is y(ln(x)2)+3x2=Cy(\ln(x)-2) + 3x^2 = C. Apply the initial condition y(e)=4y(e)=4: 4(ln(e)2)+3e2=C    4(12)+3e2=C    C=3e244(\ln(e)-2) + 3e^2 = C \implies 4(1-2) + 3e^2 = C \implies C = 3e^2 - 4. The particular solution is y(ln(x)2)+3x2=3e24y(\ln(x)-2) + 3x^2 = 3e^2 - 4. To find y(1)y(1), substitute x=1x=1: y(1)(ln(1)2)+3(1)2=3e24    y(1)(02)+3=3e24    2y(1)=3e27    y(1)=73e22y(1)(\ln(1)-2) + 3(1)^2 = 3e^2 - 4 \implies y(1)(0-2) + 3 = 3e^2 - 4 \implies -2y(1) = 3e^2 - 7 \implies y(1) = \frac{7-3e^2}{2}.

Question 9

Consider the differential equation (2x+y)dx+(xy)dy=0(2x+y)dx + (x-y)dy = 0. Which of the following statements is true?

  1. The equation becomes exact after multiplying by the integrating factor μ(x)=ex\mu(x)=e^x.
  2. The equation is not exact, because MyNx\frac{\partial M}{\partial y} \neq \frac{\partial N}{\partial x}.
  3. The equation is exact, and its general solution is x2+y2=Cx^2+y^2=C.
  4. The equation is exact, and its general solution is x2+xy12y2=Cx^2+xy-\frac{1}{2}y^2=C. (correct answer)
Explanation: When you encounter a differential equation in the form M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0, your first step should be checking if it's exact by testing whether My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. Here, M(x,y)=2x+yM(x,y) = 2x+y and N(x,y)=xyN(x,y) = x-y. Computing the partial derivatives: My=1\frac{\partial M}{\partial y} = 1 and Nx=1\frac{\partial N}{\partial x} = 1. Since these are equal, the equation is exact. For an exact equation, there exists a function F(x,y)F(x,y) such that Fx=M\frac{\partial F}{\partial x} = M and Fy=N\frac{\partial F}{\partial y} = N. To find FF, integrate MM with respect to xx: F(x,y)=(2x+y)dx=x2+xy+g(y)F(x,y) = \int(2x+y)dx = x^2 + xy + g(y) To find g(y)g(y), use the condition Fy=N\frac{\partial F}{\partial y} = N: Fy=x+g(y)=xy\frac{\partial F}{\partial y} = x + g'(y) = x - y Therefore, g(y)=yg'(y) = -y, so g(y)=12y2g(y) = -\frac{1}{2}y^2 This gives us F(x,y)=x2+xy12y2F(x,y) = x^2 + xy - \frac{1}{2}y^2, and the general solution is x2+xy12y2=Cx^2 + xy - \frac{1}{2}y^2 = C. Option A is wrong because no integrating factor is needed—the equation is already exact. Option B incorrectly claims the equation isn't exact when our calculation shows it is. Option C has the wrong solution form entirely. Always verify exactness first before seeking integrating factors. This systematic approach prevents unnecessary work and ensures you don't miss when an equation is already in its simplest exact form.

Question 10

For what values of the constants aa and bb is the differential equation (6xy3+bcos(y))dx+(ax2y2xsin(y))dy=0(6xy^3 + b\cos(y))dx + (ax^2y^2 - x\sin(y))dy = 0 exact?

  1. a=9,b=1a=9, b=1 (correct answer)
  2. a=9,b=1a=9, b=-1
  3. a=3,b=1a=3, b=1
  4. a=12,b=1a=12, b=-1
Explanation: For the differential equation M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0 to be exact, the condition My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x} must hold. Here, M(x,y)=6xy3+bcos(y)M(x,y) = 6xy^3 + b\cos(y) and N(x,y)=ax2y2xsin(y)N(x,y) = ax^2y^2 - x\sin(y). We compute the partial derivatives: My=y(6xy3+bcos(y))=18xy2bsin(y)\frac{\partial M}{\partial y} = \frac{\partial}{\partial y}(6xy^3 + b\cos(y)) = 18xy^2 - b\sin(y). Nx=x(ax2y2xsin(y))=2axy2sin(y)\frac{\partial N}{\partial x} = \frac{\partial}{\partial x}(ax^2y^2 - x\sin(y)) = 2axy^2 - \sin(y). For the equation to be exact, these two expressions must be identical for all xx and yy. This means we can equate the coefficients of like terms: 18xy2=2axy2    18=2a    a=918xy^2 = 2axy^2 \implies 18 = 2a \implies a=9. bsin(y)=sin(y)    b=1-b\sin(y) = -\sin(y) \implies b=1. Thus, a=9a=9 and b=1b=1.

Question 11

The differential equation (1+y2sin(2x))dx2ycos2(x)dy=0(1+y^2\sin(2x))dx - 2y\cos^2(x)dy = 0 is exact. Let F(x,y)F(x,y) be its potential function satisfying F(0,1)=5F(0,1)=5. What is the value of F(π/2,2)F(\pi/2, 2)?

  1. π2\frac{\pi}{2}
  2. π2+5\frac{\pi}{2} + 5
  3. π2+4\frac{\pi}{2} + 4
  4. π2+6\frac{\pi}{2} + 6 (correct answer)
Explanation: When you encounter an exact differential equation, you're looking for a potential function F(x,y)F(x,y) such that Fx=M\frac{\partial F}{\partial x} = M and Fy=N\frac{\partial F}{\partial y} = N, where the equation is written as Mdx+Ndy=0M dx + N dy = 0. Here, M=1+y2sin(2x)M = 1 + y^2\sin(2x) and N=2ycos2(x)N = -2y\cos^2(x). To find F(x,y)F(x,y), integrate MM with respect to xx: F(x,y)=(1+y2sin(2x))dx=xy2cos(2x)2+g(y)F(x,y) = \int (1 + y^2\sin(2x)) dx = x - \frac{y^2\cos(2x)}{2} + g(y) To find g(y)g(y), use the condition Fy=N\frac{\partial F}{\partial y} = N: Fy=ycos(2x)+g(y)=2ycos2(x)\frac{\partial F}{\partial y} = -y\cos(2x) + g'(y) = -2y\cos^2(x) Since cos(2x)=2cos2(x)1\cos(2x) = 2\cos^2(x) - 1, we have ycos(2x)=y(2cos2(x)1)=2ycos2(x)+y-y\cos(2x) = -y(2\cos^2(x) - 1) = -2y\cos^2(x) + y. Therefore: g(y)=yg'(y) = y, so g(y)=y22+Cg(y) = \frac{y^2}{2} + C Thus: F(x,y)=xy2cos(2x)2+y22+CF(x,y) = x - \frac{y^2\cos(2x)}{2} + \frac{y^2}{2} + C Using F(0,1)=5F(0,1) = 5: 012+12+C=50 - \frac{1}{2} + \frac{1}{2} + C = 5, so C=5C = 5. Therefore: F(x,y)=x+y2(1cos(2x))2+5F(x,y) = x + \frac{y^2(1-\cos(2x))}{2} + 5 At (π/2,2)(\pi/2, 2): F(π/2,2)=π2+4(1(1))2+5=π2+4+5=π2+6F(\pi/2, 2) = \frac{\pi}{2} + \frac{4(1-(-1))}{2} + 5 = \frac{\pi}{2} + 4 + 5 = \frac{\pi}{2} + 6 Choice A omits the constant and y2y^2 term. Choice B includes only the original constant. Choice C includes the y2y^2 contribution but misses part of the constant adjustment. Key strategy: Always verify your potential function by checking both partial derivative conditions, and don't forget to apply initial conditions to determine all constants.

Question 12

Find the implicit solution to the initial value problem (y2exy2+4x3)dx+(2xyexy23y2)dy=0(y^2 e^{xy^2} + 4x^3) dx + (2xye^{xy^2} - 3y^2) dy = 0, with y(1)=0y(1)=0.

  1. xexy2+x4y3=1x e^{xy^2} + x^4 - y^3 = 1
  2. exy2+x4y3=1e^{xy^2} + x^4 - y^3 = 1
  3. exy2+x4y3=2e^{xy^2} + x^4 - y^3 = 2 (correct answer)
  4. exy2+4x43y3=1e^{xy^2} + 4x^4 - 3y^3 = 1
Explanation: When you encounter a differential equation of the form M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0, check if it's exact by verifying whether My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}. Here, M=y2exy2+4x3M = y^2 e^{xy^2} + 4x^3 and N=2xyexy23y2N = 2xye^{xy^2} - 3y^2. Taking partial derivatives: My=2yexy2+y2exy22xy=2yexy2(1+xy2)\frac{\partial M}{\partial y} = 2ye^{xy^2} + y^2 \cdot e^{xy^2} \cdot 2xy = 2ye^{xy^2}(1 + xy^2) Nx=2yexy2+2xyexy2y2=2yexy2(1+xy2)\frac{\partial N}{\partial x} = 2ye^{xy^2} + 2xy \cdot e^{xy^2} \cdot y^2 = 2ye^{xy^2}(1 + xy^2) Since these are equal, the equation is exact. The solution has the form F(x,y)=CF(x,y) = C where Fx=M\frac{\partial F}{\partial x} = M and Fy=N\frac{\partial F}{\partial y} = N. Integrating Fx=y2exy2+4x3\frac{\partial F}{\partial x} = y^2 e^{xy^2} + 4x^3: F=exy2+x4+g(y)F = e^{xy^2} + x^4 + g(y) To find g(y)g(y), use Fy=N\frac{\partial F}{\partial y} = N: 2xyexy2+g(y)=2xyexy23y22xye^{xy^2} + g'(y) = 2xye^{xy^2} - 3y^2 This gives g(y)=3y2g'(y) = -3y^2, so g(y)=y3g(y) = -y^3. Therefore: F(x,y)=exy2+x4y3F(x,y) = e^{xy^2} + x^4 - y^3 Applying the initial condition y(1)=0y(1) = 0: e102+1403=e0+1=2e^{1 \cdot 0^2} + 1^4 - 0^3 = e^0 + 1 = 2 The solution is exy2+x4y3=2e^{xy^2} + x^4 - y^3 = 2, which is choice C. Choice A has an extra factor of xx in the exponential term. Choice B uses the wrong constant (1 instead of 2). Choice D has incorrect coefficients (4 and 3 instead of 1). Remember: always check if a differential equation is exact first, then integrate systematically and apply initial conditions carefully to determine the constant.

Question 13

A first-order differential equation is given by dydx=2xy3+sec2(x)3x2y2\frac{dy}{dx} = -\frac{2xy^3 + \sec^2(x)}{3x^2y^2}. What is the general solution?

  1. x2y3+tan(x)=Cx^2y^3 + \tan(x) = C (correct answer)
  2. x2y3tan(x)=Cx^2y^3 - \tan(x) = C
  3. y3+tan(x)x2=Cy^3 + \frac{\tan(x)}{x^2} = C
  4. The equation is not exact and cannot be solved this way.
Explanation: First, rewrite the equation in the standard form M(x,y)dx+N(x,y)dy=0M(x,y)dx + N(x,y)dy = 0. From dydx=2xy3+sec2(x)3x2y2\frac{dy}{dx} = -\frac{2xy^3 + \sec^2(x)}{3x^2y^2}, we get (3x2y2)dy=(2xy3+sec2(x))dx(3x^2y^2)dy = -(2xy^3 + \sec^2(x))dx, which is (2xy3+sec2(x))dx+(3x2y2)dy=0(2xy^3 + \sec^2(x))dx + (3x^2y^2)dy = 0. Let M(x,y)=2xy3+sec2(x)M(x,y) = 2xy^3 + \sec^2(x) and N(x,y)=3x2y2N(x,y) = 3x^2y^2. Check for exactness: My=6xy2\frac{\partial M}{\partial y} = 6xy^2 and Nx=6xy2\frac{\partial N}{\partial x} = 6xy^2. The equation is exact. We find a potential function F(x,y)F(x,y). Integrating NN with respect to yy: F(x,y)=3x2y2dy=x2y3+h(x)F(x,y) = \int 3x^2y^2 dy = x^2y^3 + h(x). Differentiating with respect to xx: Fx=2xy3+h(x)\frac{\partial F}{\partial x} = 2xy^3 + h'(x). Setting this equal to MM: 2xy3+h(x)=2xy3+sec2(x)2xy^3 + h'(x) = 2xy^3 + \sec^2(x). This gives h(x)=sec2(x)h'(x) = \sec^2(x), so h(x)=tan(x)h(x) = \tan(x). The potential function is F(x,y)=x2y3+tan(x)F(x,y) = x^2y^3 + \tan(x). The general solution is F(x,y)=CF(x,y) = C, which is x2y3+tan(x)=Cx^2y^3 + \tan(x) = C.

Question 14

For what value of the constant kk is the differential equation (y3+kxy42x)dx+(3xy2+20x2y3)dy=0(y^3 + kxy^4 - 2x) \, dx + (3xy^2 + 20x^2y^3) \, dy = 0 exact?

  1. k=5k=5
  2. k=8k=8
  3. k=10k=10 (correct answer)
  4. k=20k=20
Explanation: Let M(x,y)=y3+kxy42xM(x, y) = y^3 + kxy^4 - 2x and N(x,y)=3xy2+20x2y3N(x, y) = 3xy^2 + 20x^2y^3. For the equation to be exact, the partial derivative of MM with respect to yy must equal the partial derivative of NN with respect to xx. First, compute My\frac{\partial M}{\partial y}: y(y3+kxy42x)=3y2+4kxy3\frac{\partial}{\partial y}(y^3 + kxy^4 - 2x) = 3y^2 + 4kxy^3. Next, compute Nx\frac{\partial N}{\partial x}: x(3xy2+20x2y3)=3y2+40xy3\frac{\partial}{\partial x}(3xy^2 + 20x^2y^3) = 3y^2 + 40xy^3. Set the two partial derivatives equal to each other: 3y2+4kxy3=3y2+40xy33y^2 + 4kxy^3 = 3y^2 + 40xy^3. Subtracting 3y23y^2 from both sides gives: 4kxy3=40xy34kxy^3 = 40xy^3. Assuming xx and yy are not identically zero, we can divide by 4xy34xy^3 to find kk: k=404=10k = \frac{40}{4} = 10.

Question 15

Find the particular solution to the exact differential equation (2xy2+cosx)dx+(2x2ysiny)dy=0(2xy^2 + \cos x) \, dx + (2x^2y - \sin y) \, dy = 0 subject to the initial condition y(0)=πy(0) = \pi.

  1. x2y2+sinx+cosy=1x^2y^2 + \sin x + \cos y = -1 (correct answer)
  2. x2y2+sinx+cosy=1x^2y^2 + \sin x + \cos y = 1
  3. x2y2sinx+cosy=1x^2y^2 - \sin x + \cos y = -1
  4. x2y2+sinxcosy=1x^2y^2 + \sin x - \cos y = 1
Explanation: The equation is exact because My=y(2xy2+cosx)=4xy\frac{\partial M}{\partial y} = \frac{\partial}{\partial y}(2xy^2 + \cos x) = 4xy and Nx=x(2x2ysiny)=4xy\frac{\partial N}{\partial x} = \frac{\partial}{\partial x}(2x^2y - \sin y) = 4xy. To find the solution F(x,y)=CF(x, y) = C, we integrate M(x,y)M(x, y) with respect to xx: F(x,y)=(2xy2+cosx)dx=x2y2+sinx+g(y)F(x, y) = \int (2xy^2 + \cos x) \, dx = x^2y^2 + \sin x + g(y). To find g(y)g(y), we differentiate F(x,y)F(x, y) with respect to yy and set it equal to N(x,y)N(x, y): Fy=2x2y+g(y)=2x2ysiny\frac{\partial F}{\partial y} = 2x^2y + g'(y) = 2x^2y - \sin y. This implies g(y)=sinyg'(y) = -\sin y. Integrating with respect to yy gives g(y)=cosyg(y) = \cos y. The general solution is F(x,y)=x2y2+sinx+cosy=CF(x, y) = x^2y^2 + \sin x + \cos y = C. Apply the initial condition y(0)=πy(0) = \pi: 02π2+sin(0)+cos(π)=C0^2\pi^2 + \sin(0) + \cos(\pi) = C 0+0+(1)=C    C=10 + 0 + (-1) = C \implies C = -1. Thus, the particular solution is x2y2+sinx+cosy=1x^2y^2 + \sin x + \cos y = -1. Distractor B arises from the common error cos(π)=1\cos(\pi)=1.

Question 16

A solution to the exact differential equation (yexy+cosx)dx+(xexy1)dy=0(y e^{xy} + \cos x) \, dx + (x e^{xy} - 1) \, dy = 0 passes through the point (π2,0)(\frac{\pi}{2}, 0). What is the value of yy when x=0x=0?

  1. y=2y=2
  2. y=1y=1
  3. y=0y=0
  4. y=1y=-1 (correct answer)
Explanation: When you encounter a differential equation like this, you need to recognize it's exact and solve by finding a potential function whose partial derivatives match the given coefficients. For an exact equation Mdx+Ndy=0M \, dx + N \, dy = 0, there exists a function F(x,y)F(x,y) where Fx=M=yexy+cosx\frac{\partial F}{\partial x} = M = y e^{xy} + \cos x and Fy=N=xexy1\frac{\partial F}{\partial y} = N = x e^{xy} - 1. To find FF, integrate the first equation with respect to xx: F(x,y)=(yexy+cosx)dx=exy+sinx+g(y)F(x,y) = \int (y e^{xy} + \cos x) \, dx = e^{xy} + \sin x + g(y) To find g(y)g(y), take the partial derivative with respect to yy and set it equal to NN: Fy=xexy+g(y)=xexy1\frac{\partial F}{\partial y} = x e^{xy} + g'(y) = x e^{xy} - 1 This gives us g(y)=1g'(y) = -1, so g(y)=y+Cg(y) = -y + C. Therefore, F(x,y)=exy+sinxy=CF(x,y) = e^{xy} + \sin x - y = C. Using the initial condition (π2,0)(\frac{\pi}{2}, 0): e(π/2)(0)+sin(π2)0=1+10=2e^{(\pi/2)(0)} + \sin(\frac{\pi}{2}) - 0 = 1 + 1 - 0 = 2 So our solution is exy+sinxy=2e^{xy} + \sin x - y = 2. When x=0x = 0: e0+sin(0)y=2e^{0} + \sin(0) - y = 2, which gives us 1+0y=21 + 0 - y = 2, so y=1y = -1. Choice A) y=2y = 2 incorrectly uses the constant value. Choice B) y=1y = 1 likely comes from forgetting the y-y term. Choice C) y=0y = 0 might result from confusing the initial condition coordinates. Always verify your potential function by checking both partial derivatives match the original equation's coefficients.

Question 17

The differential equation (2y2+3x)dx+2xydy=0(2y^2 + 3x) \, dx + 2xy \, dy = 0 can be made exact by an integrating factor μ(x)\mu(x) that is a function of xx alone. Find this integrating factor.

  1. μ(x)=x2\mu(x) = x^2
  2. μ(x)=x\mu(x) = x (correct answer)
  3. μ(x)=ex\mu(x) = e^x
  4. μ(x)=1/x\mu(x) = 1/x
Explanation: When you encounter a differential equation that isn't exact, you need to find an integrating factor to make it exact. For the equation (2y2+3x)dx+2xydy=0(2y^2 + 3x) \, dx + 2xy \, dy = 0, first check if it's exact by testing whether My=Nx\frac{\partial M}{\partial y} = \frac{\partial N}{\partial x}, where M=2y2+3xM = 2y^2 + 3x and N=2xyN = 2xy. We get My=4y\frac{\partial M}{\partial y} = 4y and Nx=2y\frac{\partial N}{\partial x} = 2y. Since 4y2y4y \neq 2y, the equation isn't exact. To find an integrating factor μ(x)\mu(x) that depends only on xx, use the formula: dμdx=μMyNxN\frac{d\mu}{dx} = \mu \cdot \frac{\frac{\partial M}{\partial y} - \frac{\partial N}{\partial x}}{N} Substituting our values: dμdx=μ4y2y2xy=μ2y2xy=μx\frac{d\mu}{dx} = \mu \cdot \frac{4y - 2y}{2xy} = \mu \cdot \frac{2y}{2xy} = \frac{\mu}{x} This gives us dμμ=dxx\frac{d\mu}{\mu} = \frac{dx}{x}, which integrates to lnμ=lnx+C\ln|\mu| = \ln|x| + C. Therefore, μ(x)=x\mu(x) = x. Looking at the wrong answers: A) x2x^2 would arise from a different coefficient in our calculation. C) exe^x would result if the integrating factor formula yielded a constant instead of 1/x1/x. D) 1/x1/x would be correct if we had mistakenly swapped the numerator terms in our fraction. Study tip: Always verify that (MyNx)/N(\frac{\partial M}{\partial y} - \frac{\partial N}{\partial x})/N depends only on xx before using this method. If it depends on both variables, try (NxMy)/M(\frac{\partial N}{\partial x} - \frac{\partial M}{\partial y})/M for a μ(y)\mu(y) instead.

Question 18

Find the general solution to the differential equation dydx=xycos(x)sin(x)+y\frac{dy}{dx} = \frac{x - y\cos(x)}{\sin(x) + y}.

  1. x22ysin(x)y22=C\frac{x^2}{2} - y\sin(x) - \frac{y^2}{2} = C (correct answer)
  2. ysin(x)x22+y22=Cy\sin(x) - \frac{x^2}{2} + \frac{y^2}{2} = C
  3. x22+ysin(x)+y22=C\frac{x^2}{2} + y\sin(x) + \frac{y^2}{2} = C
  4. ycos(x)x2y2=Cy\cos(x) - x^2 - y^2 = C
Explanation: First, rewrite the equation in the standard form M(x,y)dx+N(x,y)dy=0M(x, y) \, dx + N(x, y) \, dy = 0. (sin(x)+y)dy=(xycos(x))dx(\sin(x) + y) \, dy = (x - y\cos(x)) \, dx (xycos(x))dx(sin(x)+y)dy=0(x - y\cos(x)) \, dx - (\sin(x) + y) \, dy = 0. Here, M(x,y)=xycos(x)M(x, y) = x - y\cos(x) and N(x,y)=(sin(x)+y)N(x, y) = -(\sin(x) + y). Check for exactness: My=cos(x)\frac{\partial M}{\partial y} = -\cos(x). Nx=cos(x)\frac{\partial N}{\partial x} = -\cos(x). The equation is exact. Find the potential function F(x,y)F(x, y). Integrate MM with respect to xx: F(x,y)=(xycos(x))dx=x22ysin(x)+g(y)F(x, y) = \int (x - y\cos(x)) \, dx = \frac{x^2}{2} - y\sin(x) + g(y). Differentiate FF with respect to yy and set it equal to NN: Fy=sin(x)+g(y)=sin(x)y\frac{\partial F}{\partial y} = -\sin(x) + g'(y) = -\sin(x) - y. This implies g(y)=yg'(y) = -y. Integrating gives g(y)=y22g(y) = -\frac{y^2}{2}. The general solution is F(x,y)=CF(x, y) = C, which is x22ysin(x)y22=C\frac{x^2}{2} - y\sin(x) - \frac{y^2}{2} = C. Distractor B results from an incorrect sign during the initial rearrangement of the equation.

Question 19

The implicit solution to an exact first-order differential equation is given by F(x,y)=x2sin(y)+y2ex=CF(x, y) = x^2 \sin(y) + y^2 e^x = C. Which of the following is the differential equation?

  1. (2xsin(y)+y2ex)dx+(x2cos(y)+2yex)dy=0(2x \sin(y) + y^2 e^x) \, dx + (x^2 \cos(y) + 2y e^x) \, dy = 0 (correct answer)
  2. (x2cos(y)+2yex)dx+(2xsin(y)+y2ex)dy=0(x^2 \cos(y) + 2y e^x) \, dx + (2x \sin(y) + y^2 e^x) \, dy = 0
  3. (2xsin(y)+y2ex)dx(x2cos(y)+2yex)dy=0(2x \sin(y) + y^2 e^x) \, dx - (x^2 \cos(y) + 2y e^x) \, dy = 0
  4. (2xsin(y)+2yex)dx+(x2cos(y)+y2ex)dy=0(2x \sin(y) + 2y e^x) \, dx + (x^2 \cos(y) + y^2 e^x) \, dy = 0
Explanation: An exact differential equation is of the form M(x,y)dx+N(x,y)dy=0M(x, y) \, dx + N(x, y) \, dy = 0, where M=FxM = \frac{\partial F}{\partial x} and N=FyN = \frac{\partial F}{\partial y} for some function F(x,y)F(x, y). The solution is given by F(x,y)=CF(x, y) = C. Given F(x,y)=x2sin(y)+y2exF(x, y) = x^2 \sin(y) + y^2 e^x, we need to find its partial derivatives. M(x,y)=Fx=x(x2sin(y)+y2ex)=2xsin(y)+y2exM(x, y) = \frac{\partial F}{\partial x} = \frac{\partial}{\partial x}(x^2 \sin(y) + y^2 e^x) = 2x \sin(y) + y^2 e^x. N(x,y)=Fy=y(x2sin(y)+y2ex)=x2cos(y)+2yexN(x, y) = \frac{\partial F}{\partial y} = \frac{\partial}{\partial y}(x^2 \sin(y) + y^2 e^x) = x^2 \cos(y) + 2y e^x. The corresponding differential equation is Mdx+Ndy=0M \, dx + N \, dy = 0, which is: (2xsin(y)+y2ex)dx+(x2cos(y)+2yex)dy=0(2x \sin(y) + y^2 e^x) \, dx + (x^2 \cos(y) + 2y e^x) \, dy = 0. Distractor B incorrectly swaps MM and NN. Distractor C introduces an incorrect sign. Distractor D contains errors in partial differentiation.

Question 20

For the differential equation (yexy+2x)dx+(xexy+3y2)dy=0(ye^{xy} + 2x)dx + (xe^{xy} + 3y^2)dy = 0, which of the following represents the correct potential function F(x,y)F(x,y) such that dF=0dF = 0?

  1. F(x,y)=exy+x2+y3F(x,y) = e^{xy} + x^2 + y^3 (correct answer)
  2. F(x,y)=yexy+2x+xexy+3y2F(x,y) = ye^{xy} + 2x + xe^{xy} + 3y^2
  3. F(x,y)=exy+x2+3y3F(x,y) = e^{xy} + x^2 + 3y^3
  4. F(x,y)=xyexy+x2+y3F(x,y) = xye^{xy} + x^2 + y^3
Explanation: First check exactness: ∂M/∂y = ∂(yeˣʸ + 2x)/∂y = eˣʸ + xyeˣʸ and ∂N/∂x = ∂(xeˣʸ + 3y²)/∂x = eˣʸ + xyeˣʸ. Since these are equal, the equation is exact. To find F, integrate M with respect to x: F = ∫(yeˣʸ + 2x)dx = eˣʸ + x² + g(y). Then ∂F/∂y = xeˣʸ + g'(y) = N = xeˣʸ + 3y², so g'(y) = 3y² and g(y) = y³. Therefore F(x,y) = eˣʸ + x² + y³. Choice B incorrectly lists the coefficients M and N. Choice C has wrong coefficient on y³. Choice D incorrectly includes xy as a factor of eˣʸ.