College Chemistry Quiz: Introduction To Enthalpy Of Reaction
20 questions · exam conditions
0:00
Introduction To Enthalpy Of ReactionQuestion 1 of 20

A 12.0 g sample of an unknown metal at 100.0°C is placed in 75.0 g of water at 25.0°C. The final temperature is 28.5°C. If the specific heat of water is 4.18 J/g°C, which metal is most likely the unknown? (Given specific heats: Al = 0.900, Cu = 0.385, Fe = 0.449, Pb = 0.130, all in J/g°C)

Lead (Pb)
Copper (Cu)
Iron (Fe)
Aluminum (Al)
None of these metals match the calculated value
← Back to quizzes

College Chemistry Quiz

College Chemistry Quiz: Introduction To Enthalpy Of Reaction

Practice Introduction To Enthalpy Of Reaction in College Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Introduction To Enthalpy Of Reaction, giving you a quick way to practice the rules, question types, and explanations that matter most for College Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A 12.0 g sample of an unknown metal at 100.0°C is placed in 75.0 g of water at 25.0°C. The final temperature is 28.5°C. If the specific heat of water is 4.18 J/g°C, which metal is most likely the unknown? (Given specific heats: Al = 0.900, Cu = 0.385, Fe = 0.449, Pb = 0.130, all in J/g°C)

  1. Lead (Pb) (correct answer)
  2. Copper (Cu)
  3. Iron (Fe)
  4. Aluminum (Al)
  5. None of these metals match the calculated value
Explanation: When you encounter a calorimetry problem like this, you're dealing with heat transfer between two substances until they reach thermal equilibrium. The key principle is that heat lost by the hot metal equals heat gained by the cool water. To find the metal's specific heat, you'll use the equation: qmetal=qwaterq_{metal} = -q_{water}. First, calculate the heat gained by water: qwater=(75.0 g)(4.18 J/g°C)(28.525.0)°C=1,097 Jq_{water} = (75.0 \text{ g})(4.18 \text{ J/g°C})(28.5 - 25.0)°C = 1,097 \text{ J} Since the metal loses this same amount of heat: qmetal=1,097 Jq_{metal} = -1,097 \text{ J} Now solve for the metal's specific heat: 1,097=(12.0 g)(cmetal)(28.5100.0)°C-1,097 = (12.0 \text{ g})(c_{metal})(28.5 - 100.0)°C cmetal=1,097(12.0)(71.5)=0.128 J/g°Cc_{metal} = \frac{-1,097}{(12.0)(-71.5)} = 0.128 \text{ J/g°C} This calculated value (0.128 J/g°C) is closest to lead's specific heat of 0.130 J/g°C, making (A) Lead correct. (B) Copper (0.385 J/g°C) is too high - a metal with this specific heat would absorb more energy per degree of temperature change. (C) Iron (0.449 J/g°C) and (D) Aluminum (0.900 J/g°C) are even higher, meaning they would require much more energy to heat up, resulting in a smaller temperature change for the water. Study tip: In calorimetry problems, always remember that metals with lower specific heats (like lead) transfer their thermal energy more readily, causing greater temperature changes in the water they're placed in.

Question 2

Given the following thermochemical equations: 2A+B22AB2A + B_2 \rightarrow 2AB, ΔH1=150 kJ\Delta H_1 = -150 \text{ kJ} and AB+12B2AB2AB + \frac{1}{2}B_2 \rightarrow AB_2, ΔH2=85 kJ\Delta H_2 = -85 \text{ kJ}. What is the enthalpy change for the reaction A+B2AB2A + B_2 \rightarrow AB_2?

  1. -160 kJ (correct answer)
  2. -235 kJ
  3. -65 kJ
  4. -320 kJ
  5. -75 kJ
Explanation: When you encounter thermochemical equations that need to be combined to find a target reaction, you're working with Hess's Law. This principle states that enthalpy change depends only on initial and final states, not the pathway taken. To find the enthalpy change for A+B2AB2A + B_2 \rightarrow AB_2, you need to manipulate the given equations to create this target reaction. Start with the first equation: 2A+B22AB2A + B_2 \rightarrow 2AB (ΔH1=150\Delta H_1 = -150 kJ). Since you need only one mole of A, divide this entire equation by 2: A+12B2ABA + \frac{1}{2}B_2 \rightarrow AB with ΔH=75\Delta H = -75 kJ. Next, use the second equation as given: AB+12B2AB2AB + \frac{1}{2}B_2 \rightarrow AB_2 (ΔH2=85\Delta H_2 = -85 kJ). Now add these modified equations together. The AB cancels out, and you get: A+B2AB2A + B_2 \rightarrow AB_2 with ΔH=75+(85)=160\Delta H = -75 + (-85) = -160 kJ, confirming answer A. Answer B (-235 kJ) incorrectly adds the original ΔH1\Delta H_1 without dividing by 2: 150+(85)=235-150 + (-85) = -235. Answer C (-65 kJ) mistakenly subtracts instead of adds: 150(85)=65-150 - (-85) = -65. Answer D (-320 kJ) doubles the correct answer, possibly from multiplying instead of adding. Remember: when manipulating thermochemical equations, always adjust the enthalpy values proportionally. If you multiply coefficients by a factor, multiply ΔH\Delta H by the same factor. Then add the adjusted ΔH\Delta H values for your final answer.

Question 3

A reaction has an enthalpy change of -125 kJ when 2.5 moles of reactant are consumed. What is the enthalpy change per mole of reactant, and what type of reaction is this?

  1. -50 kJ/mol; exothermic reaction that releases heat to the surroundings (correct answer)
  2. +50 kJ/mol; endothermic reaction that absorbs heat from the surroundings
  3. -312.5 kJ/mol; exothermic reaction that releases heat to the surroundings
  4. -50 kJ/mol; endothermic reaction that absorbs heat from the surroundings
  5. +312.5 kJ/mol; endothermic reaction that absorbs heat from the surroundings
Explanation: When you encounter enthalpy problems, you're dealing with energy changes during chemical reactions. The key is calculating the per-mole value and understanding what the sign tells you about heat flow. To find the enthalpy change per mole, divide the total enthalpy change by the number of moles: 125 kJ2.5 mol=50 kJ/mol\frac{-125 \text{ kJ}}{2.5 \text{ mol}} = -50 \text{ kJ/mol}. The negative sign indicates this is an exothermic reaction, meaning it releases heat to the surroundings. Think of it this way: the system loses energy (negative value), so that energy must go somewhere—it's released as heat. Choice A correctly identifies both the calculation (-50 kJ/mol) and the reaction type (exothermic, releases heat). Choice B makes a critical sign error, showing +50 kJ/mol, which would indicate an endothermic reaction that absorbs heat—the opposite of what's happening here. Choice C contains a calculation error: instead of dividing -125 by 2.5, it incorrectly multiplies them to get -312.5 kJ/mol. Choice D gets the math right but misclassifies the reaction type, incorrectly calling a negative enthalpy change "endothermic." Remember this pattern: negative ΔH = exothermic (releases heat), positive ΔH = endothermic (absorbs heat). Always double-check your division when converting total enthalpy to per-mole values, and let the sign guide you to the correct reaction classification. The math and the thermodynamics must both align for the answer to be complete.

Question 4

Using bond enthalpies: C-H = 414 kJ/mol, O=O = 498 kJ/mol, C=O = 799 kJ/mol, O-H = 464 kJ/mol, estimate the enthalpy change for the combustion of methane: CH4(g)+2O2(g)CO2(g)+2H2O(g)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(g)

  1. -802 kJ/mol (correct answer)
  2. +802 kJ/mol
  3. -1604 kJ/mol
  4. -401 kJ/mol
  5. -3454 kJ/mol
Explanation: When you encounter bond enthalpy problems, remember that chemical reactions involve breaking bonds (energy required) and forming new bonds (energy released). The net enthalpy change equals energy input minus energy output. For methane combustion, first identify what bonds break and form. Breaking bonds requires energy (positive): four C-H bonds in CH4CH_4 and two O=O bonds in 2O22O_2. Forming bonds releases energy (negative): two C=O bonds in CO2CO_2 and four O-H bonds in 2H2O2H_2O. Calculate the energy changes:
  • Energy required: 4(414) + 2(498) = 1656 + 996 = 2652 kJ/mol
  • Energy released: 2(799) + 4(464) = 1598 + 1856 = 3454 kJ/mol
  • Net enthalpy change: 2652 - 3454 = -802 kJ/mol
Answer A (-802 kJ/mol) is correct—the negative sign indicates this combustion reaction releases energy (exothermic). Answer B (+802 kJ/mol) represents the same magnitude but wrong sign, suggesting someone calculated correctly but forgot that combustion reactions are exothermic. Answer C (-1604 kJ/mol) is exactly double the correct answer, likely from miscounting bonds or doubling the entire calculation. Answer D (-401 kJ/mol) is half the correct value, possibly from forgetting to account for the stoichiometric coefficients (2 for O2O_2 and H2OH_2O). Remember: always double-check your bond counting using the balanced equation's coefficients, and expect combustion reactions to have negative enthalpy changes.

Question 5

In a coffee cup calorimeter, 50.0 mL of 1.00 M HCl is mixed with 50.0 mL of 1.00 M NaOH. The temperature rises from 21.0°C to 27.5°C. Assuming the density of the solution is 1.00 g/mL and the specific heat is 4.18 J/g°C, what is the molar enthalpy of neutralization?

  1. -54.3 kJ/mol (correct answer)
  2. -27.2 kJ/mol
  3. -108.6 kJ/mol
  4. +54.3 kJ/mol
  5. -2715 kJ/mol
Explanation: When you encounter a coffee cup calorimeter problem, you're dealing with acid-base neutralization and heat transfer. The key is calculating how much heat the reaction releases, then converting that to enthalpy per mole of reactant. First, find the heat absorbed by the solution using q=mcΔTq = mc\Delta T. The total mass is 100.0 mL × 1.00 g/mL = 100.0 g. The temperature change is 27.5°C - 21.0°C = 6.5°C. So: q=(100.0 g)(4.18 J/g°C)(6.5°C)=2,717 Jq = (100.0 \text{ g})(4.18 \text{ J/g°C})(6.5°C) = 2,717 \text{ J} Since the solution absorbed this heat, the reaction must have released it, making the reaction's heat -2,717 J. Now determine the moles of reaction. You have 0.0500 L × 1.00 M = 0.0500 mol each of HCl and NaOH. Since they react in a 1:1 ratio (HCl + NaOH → NaCl + H₂O), 0.0500 mol of reaction occurs. The molar enthalpy is: 2,717 J0.0500 mol=54,340 J/mol=54.3 kJ/mol\frac{-2,717 \text{ J}}{0.0500 \text{ mol}} = -54,340 \text{ J/mol} = -54.3 \text{ kJ/mol} Answer A (-54.3 kJ/mol) is correct. Answer B (-27.2 kJ/mol) results from incorrectly using 0.100 mol total instead of recognizing that moles of reaction equals the limiting reactant. Answer C (-108.6 kJ/mol) comes from doubling the correct answer, possibly by miscounting total moles. Answer D (+54.3 kJ/mol) has the wrong sign—neutralization reactions are exothermic and must have negative enthalpy values. Remember: in calorimetry, if temperature increases, the reaction released heat (negative ∆H), and always base molar calculations on the chemical equation stoichiometry.

Question 6

The enthalpy of combustion of propane (C3H8C_3H_8) is -2220 kJ/mol. If a propane heater uses 454 g of propane per hour, what is the rate of heat production in kJ/min?

  1. 380 kJ/min (correct answer)
  2. 22,800 kJ/min
  3. 6.33 kJ/min
  4. 2,280 kJ/min
  5. 1,140 kJ/min
Explanation: This problem tests your ability to convert between different units while applying enthalpy data—a common type of calculation in thermochemistry that requires careful attention to units and conversions. To find the rate of heat production, you need to convert the mass of propane used per hour into moles, then use the enthalpy of combustion to calculate energy released per minute. Start by finding moles of propane used per hour: 454 g÷44.1 g/mol=10.3 mol/hour454 \text{ g} ÷ 44.1 \text{ g/mol} = 10.3 \text{ mol/hour}. Next, calculate the total energy released per hour: 10.3 mol/hour×2220 kJ/mol=22,866 kJ/hour10.3 \text{ mol/hour} × 2220 \text{ kJ/mol} = 22,866 \text{ kJ/hour}. Finally, convert to per minute: 22,866 kJ/hour÷60 min/hour=381 kJ/min22,866 \text{ kJ/hour} ÷ 60 \text{ min/hour} = 381 \text{ kJ/min}, which rounds to answer A) 380 kJ/min. Looking at the wrong answers: B) 22,800 kJ/min represents the energy per hour without converting to per minute—a unit conversion error. C) 6.33 kJ/min appears to result from incorrectly using the mass directly without proper molar mass conversion. D) 2,280 kJ/min might come from using an incorrect molar mass or making an arithmetic error in the energy calculation. Strategy tip: In enthalpy problems involving rates, always track your units carefully through each step. Write out the dimensional analysis to ensure you're converting properly between mass → moles → energy → time units. The most common errors occur in unit conversions, not in applying the enthalpy values themselves.

Question 7

Consider the reaction: C2H4(g)+H2(g)C2H6(g)C_2H_4(g) + H_2(g) \rightarrow C_2H_6(g), ΔH=137 kJ/mol\Delta H = -137 \text{ kJ/mol}. If this reaction occurs in a constant volume container, how does the enthalpy change (ΔH\Delta H) compare to the internal energy change (ΔU\Delta U) for this process?

  1. ΔH\Delta H is more negative than ΔU\Delta U because the number of gas molecules decreases (correct answer)
  2. ΔH\Delta H is less negative than ΔU\Delta U because the number of gas molecules decreases
  3. ΔH\Delta H equals ΔU\Delta U because the reaction occurs at constant volume
  4. ΔH\Delta H is more negative than ΔU\Delta U because the reaction is exothermic
  5. ΔH\Delta H is less negative than ΔU\Delta U because work is done by the system
Explanation: When you encounter thermodynamics problems involving gas-phase reactions, you need to understand the relationship between enthalpy (ΔH\Delta H) and internal energy (ΔU\Delta U). These are connected by the equation: ΔH=ΔU+Δ(PV)\Delta H = \Delta U + \Delta(PV). For reactions involving gases at constant temperature, this becomes ΔH=ΔU+ΔngasRT\Delta H = \Delta U + \Delta n_{gas}RT, where Δngas\Delta n_{gas} is the change in moles of gas. In this reaction, you start with 2 moles of gas (1 mol C2H4C_2H_4 + 1 mol H2H_2) and end with 1 mole of gas (C2H6C_2H_6), so Δngas=1\Delta n_{gas} = -1. This means ΔH=ΔU+(1)RT=ΔURT\Delta H = \Delta U + (-1)RT = \Delta U - RT. Since RTRT is positive, ΔH\Delta H is more negative than ΔU\Delta U by the amount RTRT. Answer A correctly identifies that ΔH\Delta H is more negative than ΔU\Delta U because the number of gas molecules decreases. Answer B has the relationship backwards—it would apply if gas molecules increased. Answer C reflects the common misconception that constant volume means ΔH=ΔU\Delta H = \Delta U, but this only applies to systems with no gas molecules or no change in gas molecules. Answer D incorrectly suggests that being exothermic determines the ΔH\Delta H vs. ΔU\Delta U relationship, but this depends solely on Δngas\Delta n_{gas}. Remember: when gas molecules decrease in a reaction (Δngas<0\Delta n_{gas} < 0), ΔH\Delta H is always more negative than ΔU\Delta U by ΔngasRT|\Delta n_{gas}|RT.

Question 8

A student measures the heat capacity of a calorimeter by mixing 100.0 mL of hot water (60.0°C) with 100.0 mL of cold water (20.0°C) in the calorimeter. The final temperature is 39.2°C instead of the expected 40.0°C. What is the heat capacity of the calorimeter? (Density of water = 1.00 g/mL, specific heat = 4.18 J/g°C)

  1. 167 J/°C (correct answer)
  2. 334 J/°C
  3. 836 J/°C
  4. 418 J/°C
  5. 83.6 J/°C
Explanation: When you encounter calorimetry problems involving heat capacity determination, you're dealing with energy conservation: heat lost by hot water equals heat gained by cold water plus the calorimeter. First, calculate what the final temperature should be without the calorimeter. With equal masses of water at 60.0°C and 20.0°C, the expected final temperature is simply the average: (60.0 + 20.0)/2 = 40.0°C. However, the actual final temperature is 39.2°C, meaning the calorimeter absorbed some heat energy. Now apply the heat balance equation. Heat lost by hot water: qlost=(100.0 g)(4.18 J/g°C)(60.039.2)°C=8694 Jq_{lost} = (100.0 \text{ g})(4.18 \text{ J/g°C})(60.0 - 39.2)°C = 8694 \text{ J} Heat gained by cold water: qgained=(100.0 g)(4.18 J/g°C)(39.220.0)°C=8026 Jq_{gained} = (100.0 \text{ g})(4.18 \text{ J/g°C})(39.2 - 20.0)°C = 8026 \text{ J} The difference (8694 - 8026 = 668 J) was absorbed by the calorimeter over a 4.0°C temperature change (from 20.0°C to 39.2°C). Therefore: Ccal=668 J4.0°C=167 J/°CC_{cal} = \frac{668 \text{ J}}{4.0°C} = 167 \text{ J/°C} This confirms answer A (167 J/°C). Answer B (334 J/°C) represents doubling this value incorrectly. Answer C (836 J/°C) might result from calculation errors in the heat transfer amounts. Answer D (418 J/°C) equals water's specific heat, suggesting confusion between specific heat and heat capacity concepts. Remember: when the final temperature is lower than expected in mixing problems, the "missing" thermal energy went into heating the calorimeter itself.

Question 9

Which factor would cause the largest error in determining the enthalpy of reaction using a simple coffee cup calorimeter?

  1. Neglecting the heat absorbed by the calorimeter itself when its mass is 50 g with specific heat 0.9 J/g°C (correct answer)
  2. Using 4.18 J/g°C for the specific heat when the actual solution specific heat is 4.05 J/g°C
  3. Measuring temperature to ±0.1°C when the temperature change is 8.5°C
  4. Assuming solution density is 1.00 g/mL when actual density is 1.05 g/mL
  5. Reading the thermometer 30 seconds after mixing instead of immediately
Explanation: When analyzing calorimetry experiments, you need to consider all sources of error that could significantly impact your enthalpy calculations. The key is identifying which factor introduces the largest percentage error in your measurements. Let's examine each potential error source quantitatively. For option A, if you neglect the calorimeter's heat capacity, you're ignoring: qcal=m×c×ΔT=50g×0.9Jg°C×ΔT=45ΔTq_{cal} = m \times c \times \Delta T = 50g \times 0.9 \frac{J}{g°C} \times \Delta T = 45\Delta T This represents a substantial amount of energy that gets "lost" from your calculations. Option A is correct because neglecting the calorimeter's heat absorption creates the largest systematic error. In a typical experiment with 100g of solution and an 8.5°C temperature change, the calorimeter absorbs about 380J of energy that you'd completely miss, leading to roughly 10% error in your enthalpy calculation. Option B introduces only about 3% error since 4.184.054.18×100%=3.1%\frac{4.18-4.05}{4.18} \times 100\% = 3.1\%. Option C gives approximately 1.2% error from the temperature uncertainty (0.18.5×100%)(\frac{0.1}{8.5} \times 100\%). Option D creates about 5% error in mass determination, but this directly translates to the same percentage error in your final answer. The calorimeter's heat capacity error is both the largest in magnitude and completely systematic—it affects every measurement in the same direction, making it particularly problematic. Study tip: When evaluating calorimetry errors, always check if the calorimeter's heat capacity is being considered. This is often the largest source of error and a common oversight in student calculations.

Question 10

A reaction vessel contains a mixture that releases 850 J of heat. If this occurs in a bomb calorimeter with total heat capacity 1.25 kJ/°C, but 125 J of heat is lost to the surroundings, what temperature change will be observed?

  1. 0.58°C (correct answer)
  2. 0.68°C
  3. 0.10°C
  4. 0.78°C
  5. 1.25°C
Explanation: When you encounter bomb calorimetry problems, you're dealing with heat transfer and the relationship between energy, heat capacity, and temperature change. The key insight is that only the heat actually absorbed by the calorimeter (not lost to surroundings) contributes to the measured temperature change. The fundamental equation here is q=C×ΔTq = C \times \Delta T, where qq is heat absorbed, CC is heat capacity, and ΔT\Delta T is temperature change. First, determine how much heat the calorimeter actually absorbs: the reaction releases 850 J, but 125 J escapes to the surroundings, so only 850125=725 J850 - 125 = 725 \text{ J} heats the calorimeter. Converting the heat capacity to consistent units: 1.25 kJ/°C=1250 J/°C1.25 \text{ kJ/°C} = 1250 \text{ J/°C}. Now solve for temperature change: ΔT=qC=725 J1250 J/°C=0.58°C\Delta T = \frac{q}{C} = \frac{725 \text{ J}}{1250 \text{ J/°C}} = 0.58°C. This confirms answer A is correct. Looking at the wrong answers: B (0.68°C) results from forgetting to subtract the heat loss and using 850 J directly. C (0.10°C) comes from incorrectly using only the lost heat (125 J) in calculations. D (0.78°C) appears when students make unit conversion errors or arithmetic mistakes. Remember this pattern: in calorimetry, always account for heat losses to surroundings by subtracting them from the total heat released. The calorimeter only "feels" the net heat it actually absorbs, not what escapes to the environment.

Question 11

In a constant pressure calorimeter, the combustion of 1.25 g of benzoic acid (C7H6O2C_7H_6O_2, MW = 122.1 g/mol) increases the temperature of 1200 g of water by 3.26°C. What is the molar enthalpy of combustion if the specific heat of water is 4.18 J/g°C?

  1. -1580 kJ/mol (correct answer)
  2. -3170 kJ/mol
  3. -16,300 kJ/mol
  4. -790 kJ/mol
  5. -395 kJ/mol
Explanation: This question tests your understanding of calorimetry and enthalpy calculations. When you see a calorimeter problem, remember that the heat released by the reaction equals the heat absorbed by the water (assuming no heat loss). Start by calculating the heat absorbed by the water using q=mcΔTq = mc\Delta T. With 1200 g of water, a specific heat of 4.18 J/g°C, and a temperature increase of 3.26°C: q=1200×4.18×3.26=16,322 Jq = 1200 \times 4.18 \times 3.26 = 16,322 \text{ J}. This is the heat released by the combustion. Next, find the moles of benzoic acid burned: 1.25 g122.1 g/mol=0.0102 mol\frac{1.25 \text{ g}}{122.1 \text{ g/mol}} = 0.0102 \text{ mol} The molar enthalpy of combustion is: ΔH=16,322 J0.0102 mol=1,600,000 J/mol=1600 kJ/mol\Delta H = \frac{-16,322 \text{ J}}{0.0102 \text{ mol}} = -1,600,000 \text{ J/mol} = -1600 \text{ kJ/mol} The negative sign indicates heat is released (exothermic). Answer A (-1580 kJ/mol) is correct, accounting for rounding. Answer B (-3170 kJ/mol) likely results from using half the correct number of moles. Answer C (-16,300 kJ/mol) appears to come from forgetting to convert joules to kilojoules and using an incorrect mole calculation. Answer D (-790 kJ/mol) suggests doubling the moles or halving the heat value incorrectly. Study tip: In calorimetry problems, always check your units carefully and remember that combustion reactions are exothermic (negative ΔH). Set up your calculation systematically: heat absorbed by water → moles of substance → molar enthalpy.

Question 12

Which statement correctly explains why enthalpy (H) rather than internal energy (U) is more commonly used in chemistry?

  1. Most chemical reactions occur at constant pressure, making enthalpy the more directly measurable quantity (correct answer)
  2. Enthalpy includes kinetic energy effects while internal energy only accounts for potential energy changes
  3. Internal energy calculations require knowledge of molecular velocities which are difficult to measure
  4. Enthalpy changes are always larger in magnitude, making them easier to detect experimentally
  5. The relationship H = U + PV only applies at standard temperature and pressure conditions
Explanation: When you encounter questions about enthalpy versus internal energy, focus on the practical conditions under which chemical reactions occur. Both are state functions that measure energy changes, but they differ in what conditions they're most useful for measuring. Enthalpy (H) is defined as H=U+PVH = U + PV, where U is internal energy, P is pressure, and V is volume. The key insight is that enthalpy accounts for the pressure-volume work that occurs when reactions happen in open containers at atmospheric pressure—which describes most laboratory and real-world chemical processes. When pressure is constant, the enthalpy change (ΔH\Delta H) directly equals the heat absorbed or released by the system, making it straightforward to measure with calorimetry. Choice A correctly identifies this fundamental reason: most chemical reactions occur at constant pressure, making enthalpy the more practically useful and directly measurable quantity. Choice B is incorrect because both enthalpy and internal energy deal with the total energy of molecular motion and interactions—neither specifically separates kinetic from potential energy in the way described. Choice C misrepresents the issue. Internal energy calculations don't require knowing individual molecular velocities; both U and H can be determined from macroscopic measurements. Choice D is false because enthalpy and internal energy changes can be similar in magnitude, especially for reactions involving only liquids and solids where Δ(PV)\Delta(PV) is small. Remember this pattern: when you see enthalpy questions, think "constant pressure conditions." This is why enthalpy dominates chemistry while internal energy is more important in physics applications involving closed systems.

Question 13

The enthalpy of formation values are: CO2(g)CO_2(g) = -393.5 kJ/mol, H2O(l)H_2O(l) = -285.8 kJ/mol, C2H5OH(l)C_2H_5OH(l) = -277.7 kJ/mol. What is the enthalpy of combustion for ethanol: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)C_2H_5OH(l) + 3O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l)?

  1. -1367 kJ/mol (correct answer)
  2. -957 kJ/mol
  3. -1645 kJ/mol
  4. +1367 kJ/mol
  5. -401 kJ/mol
Explanation: When you encounter enthalpy of combustion problems, you're applying Hess's law using standard enthalpies of formation. The key relationship is: ΔH°combustion = Σ(ΔH°f products) - Σ(ΔH°f reactants). For the combustion reaction C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)C_2H_5OH(l) + 3O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l), you need to account for stoichiometry when using formation values. Products: 2 mol CO2CO_2 × (-393.5 kJ/mol) + 3 mol H2OH_2O × (-285.8 kJ/mol) = -787.0 + (-857.4) = -1644.4 kJ Reactants: 1 mol C2H5OHC_2H_5OH × (-277.7 kJ/mol) + 3 mol O2O_2 × (0 kJ/mol) = -277.7 kJ Note: O2O_2 has zero enthalpy of formation since it's an element in its standard state. ΔH°combustion = (-1644.4) - (-277.7) = -1366.7 kJ/mol ≈ -1367 kJ/mol This confirms answer A is correct. Answer B (-957 kJ/mol) likely results from calculation errors, possibly forgetting to multiply by stoichiometric coefficients. Answer C (-1645 kJ/mol) represents just the sum of product formation enthalpies without subtracting reactant values. Answer D (+1367 kJ/mol) has the wrong sign—combustion reactions are always exothermic (negative ΔH). Remember: Always multiply formation enthalpies by their stoichiometric coefficients, and combustion reactions release energy, so expect negative values. Double-check your arithmetic when dealing with multiple terms.

Question 14

When 5.00 g of ammonium nitrate dissolves in 100.0 g of water, the temperature decreases from 25.0°C to 21.5°C. What is the enthalpy of solution per mole of NH4NO3NH_4NO_3? (Specific heat of solution = 4.18 J/g°C)

  1. +25.0 kJ/mol (correct answer)
  2. -25.0 kJ/mol
  3. +12.5 kJ/mol
  4. +1.54 kJ/mol
  5. +50.0 kJ/mol
Explanation: When you encounter calorimetry problems involving dissolution, you're measuring energy changes as ionic compounds break apart and interact with water. The key insight is connecting the temperature change you observe to the enthalpy change per mole. Start by calculating the heat absorbed by the solution. The total mass is 5.00 g + 100.0 g = 105.0 g. Using q=mcΔTq = mc\Delta T: q=(105.0 g)(4.18 J/g°C)(21.525.0)°C=(105.0)(4.18)(3.5)=1539 Jq = (105.0 \text{ g})(4.18 \text{ J/g°C})(21.5 - 25.0)°C = (105.0)(4.18)(-3.5) = -1539 \text{ J} Since the solution absorbed 1539 J of heat (temperature decreased), the dissolution process must have absorbed this energy from the surroundings, making ΔH=+1539 J\Delta H = +1539 \text{ J} for the amount dissolved. Next, convert to per-mole basis. The molar mass of NH4NO3NH_4NO_3 is 80.0 g/mol, so 5.00 g represents 5.0080.0=0.0625 mol\frac{5.00}{80.0} = 0.0625 \text{ mol}. Therefore: ΔH=+1539 J0.0625 mol=+24,624 J/mol+25.0 kJ/mol\Delta H = \frac{+1539 \text{ J}}{0.0625 \text{ mol}} = +24,624 \text{ J/mol} ≈ +25.0 \text{ kJ/mol} Answer B (-25.0 kJ/mol) represents the common error of confusing the sign convention—using the heat flow to the solution instead of the enthalpy change of dissolution. Answer C (+12.5 kJ/mol) likely comes from incorrectly using only the mass of NH4NO3NH_4NO_3 instead of the total solution mass. Answer D (+1.54 kJ/mol) suggests a calculation error, possibly forgetting to convert grams to moles. Remember: when temperature decreases during dissolution, the process is endothermic (positive ΔH\Delta H), and always use the total mass of the solution for heat calculations.

Question 15

The following reaction occurs in two steps: Step 1: 2A+BC+D2A + B \rightarrow C + D, ΔH1=150 kJ\Delta H_1 = -150 \text{ kJ} Step 2: C+2EF+GC + 2E \rightarrow F + G, ΔH2=+75 kJ\Delta H_2 = +75 \text{ kJ} What is the enthalpy change for the overall reaction 2A+B+2ED+F+G2A + B + 2E \rightarrow D + F + G?

  1. -75 kJ (correct answer)
  2. +75 kJ
  3. -225 kJ
  4. -150 kJ
  5. +225 kJ
Explanation: When you encounter multi-step reaction problems, you're working with Hess's Law, which states that the total enthalpy change for a reaction is the sum of enthalpy changes for all individual steps, regardless of the path taken. To find the overall enthalpy change, you simply add the ΔH values from each step. Here, Step 1 has ΔH₁ = -150 kJ and Step 2 has ΔH₂ = +75 kJ. The overall reaction combines both steps, so: ΔH_overall = ΔH₁ + ΔH₂ = (-150 kJ) + (+75 kJ) = -75 kJ You can verify this by checking that the intermediate products (C in this case) cancel out when you add the two equations, leaving only the overall reaction shown. Looking at the wrong answers: Choice B (+75 kJ) represents taking only the second step's enthalpy or incorrectly switching the sign of the final answer. Choice C (-225 kJ) comes from incorrectly multiplying the enthalpy values instead of adding them. Choice D (-150 kJ) represents taking only the first step's enthalpy change while ignoring the second step entirely. The correct answer is A (-75 kJ). Study tip: For Hess's Law problems, always add the individual ΔH values algebraically (paying attention to signs), and double-check that your intermediate species cancel out when combining the reaction equations. The math is straightforward addition—the key is being careful with positive and negative signs.

Question 16

Which statement best explains why the enthalpy of formation (ΔHf\Delta H_f^\circ) of elements in their standard states is defined as zero?

  1. It provides a reference point for measuring the relative stability of all compounds formed from those elements (correct answer)
  2. Elements in their standard states contain no chemical bonds and therefore have no stored energy
  3. The activation energy required to form elements from their constituent atoms is negligible at standard conditions
  4. Elements in their standard states are thermodynamically unstable and readily decompose under normal conditions
  5. The entropy change for forming elements from their pure components is always zero at 298 K
Explanation: When you encounter questions about standard enthalpy of formation, remember that thermodynamics requires a reference point to measure energy changes meaningfully. Just like measuring altitude relative to sea level, we need a baseline to compare the energy content of different compounds. The enthalpy of formation (ΔHf\Delta H_f^\circ) represents the energy change when one mole of a compound forms from its constituent elements in their standard states. By defining ΔHf=0\Delta H_f^\circ = 0 for elements in their standard states, we establish a universal reference point that allows us to compare the relative energetic stability of all compounds. This makes option A correct—it provides the reference point for measuring how much energy is stored in chemical compounds relative to their constituent elements. Option B incorrectly assumes elements have no bonds. Many elements in their standard states do have bonds (like O2\mathrm{O_2}, N2\mathrm{N_2}, and solid metals), yet their ΔHf\Delta H_f^\circ is still zero by definition. Option C confuses formation enthalpy with activation energy. The zero value isn't about kinetics or activation barriers—it's purely a thermodynamic reference point. Option D is backwards. Elements in their standard states are defined as the most stable form under standard conditions (like graphite for carbon, not diamond). Remember this key principle: ΔHf=0\Delta H_f^\circ = 0 for elements in standard states is a convention that creates a consistent energy scale. Without this reference point, we couldn't meaningfully compare the stability of different compounds or calculate reaction enthalpies using Hess's law.

Question 17

A chemical reaction occurs in a bomb calorimeter with a heat capacity of 8.45 kJ/°C. The temperature increases from 22.3°C to 27.8°C during the reaction of 2.50 g of a compound. What is the enthalpy change per gram of compound?

  1. -18.6 kJ/g (correct answer)
  2. -9.30 kJ/g
  3. +9.30 kJ/g
  4. +18.6 kJ/g
  5. -46.5 kJ/g
Explanation: When you encounter a bomb calorimeter problem, you're dealing with constant-volume calorimetry where the heat released or absorbed by a reaction equals the heat gained or lost by the calorimeter itself. To find the enthalpy change per gram, start by calculating the total heat transferred using q=C×ΔTq = C \times \Delta T, where C is the calorimeter's heat capacity and ΔT\Delta T is the temperature change. q=8.45 kJ/°C×(27.8°C22.3°C)=8.45×5.5=46.5 kJq = 8.45 \text{ kJ/°C} \times (27.8°C - 22.3°C) = 8.45 \times 5.5 = 46.5 \text{ kJ} This represents the heat absorbed by the calorimeter. Since energy is conserved, the reaction must have released 46.5 kJ of heat, making qreaction=46.5q_{reaction} = -46.5 kJ (negative because heat flows from the reaction to the surroundings). To find the enthalpy change per gram: 46.5 kJ2.50 g=18.6 kJ/g\frac{-46.5 \text{ kJ}}{2.50 \text{ g}} = -18.6 \text{ kJ/g} This confirms answer A is correct. Answer B (-9.30 kJ/g) results from incorrectly using only half the temperature change or heat capacity. Answer C (+9.30 kJ/g) makes both the sign error (forgetting that heat released by the reaction is negative) and the magnitude error from B. Answer D (+18.6 kJ/g) has the correct magnitude but wrong sign—this comes from forgetting that when the calorimeter temperature increases, the reaction is exothermic and ΔH\Delta H should be negative. Remember: temperature increase in the calorimeter always means the reaction released heat, so ΔHreaction\Delta H_{reaction} is negative.

Question 18

Given: 2H2(g)+O2(g)2H2O(l)2H_2(g) + O_2(g) \rightarrow 2H_2O(l), ΔH=572 kJ\Delta H = -572 \text{ kJ} and H2O(l)H2O(g)H_2O(l) \rightarrow H_2O(g), ΔH=+44 kJ/mol\Delta H = +44 \text{ kJ/mol}. What is the enthalpy change for 2H2(g)+O2(g)2H2O(g)2H_2(g) + O_2(g) \rightarrow 2H_2O(g)?

  1. -484 kJ (correct answer)
  2. -528 kJ
  3. -616 kJ
  4. -660 kJ
  5. -440 kJ
Explanation: This question tests your understanding of Hess's Law, which states that enthalpy changes are additive when chemical equations are combined. When you see multiple given reactions that need to be manipulated to find the enthalpy of a target reaction, think about how to algebraically combine the equations. You're given the formation of liquid water (ΔH=572\Delta H = -572 kJ for 2 moles) and the vaporization of water (ΔH=+44\Delta H = +44 kJ per mole). To find the enthalpy for forming gaseous water, you need to combine these processes: first form liquid water, then convert it to gas. The target reaction is: 2H2(g)+O2(g)2H2O(g)2H_2(g) + O_2(g) \rightarrow 2H_2O(g) This equals the first reaction plus two times the second reaction:
  • 2H2(g)+O2(g)2H2O(l)2H_2(g) + O_2(g) \rightarrow 2H_2O(l): ΔH=572\Delta H = -572 kJ
  • 2H2O(l)2H2O(g)2H_2O(l) \rightarrow 2H_2O(g): ΔH=2×(+44)=+88\Delta H = 2 \times (+44) = +88 kJ
Total: 572+88=484-572 + 88 = -484 kJ Answer A (-484 kJ) is correct. Answer B (-528 kJ) likely results from subtracting only one mole's worth of vaporization energy instead of two. Answer C (-616 kJ) comes from incorrectly subtracting the vaporization energy instead of adding it. Answer D (-660 kJ) represents adding the vaporization energies instead of recognizing that vaporization requires energy input. Study tip: Always check the stoichiometry carefully when applying Hess's Law. If your target equation has 2 moles of a compound, make sure you account for 2 moles in all your enthalpy calculations.

Question 19

The standard enthalpy of formation of NH3(g)NH_3(g) is -46.2 kJ/mol. What is the enthalpy change for the reaction 2NH3(g)N2(g)+3H2(g)2NH_3(g) \rightarrow N_2(g) + 3H_2(g)?

  1. +92.4 kJ (correct answer)
  2. -92.4 kJ
  3. +46.2 kJ
  4. -138.6 kJ
  5. +138.6 kJ
Explanation: When you encounter standard enthalpy of formation problems, you're working with the energy change to form one mole of a compound from its elements in their standard states. The key insight is understanding the relationship between formation and decomposition reactions. The given information tells us that forming NH3(g)NH_3(g) from its elements releases 46.2 kJ/mol: 12N2(g)+32H2(g)NH3(g)\frac{1}{2}N_2(g) + \frac{3}{2}H_2(g) \rightarrow NH_3(g) ΔH = -46.2 kJ/mol The question asks about the reverse process - decomposing ammonia back into its elements. For the reaction 2NH3(g)N2(g)+3H2(g)2NH_3(g) \rightarrow N_2(g) + 3H_2(g), you're breaking down 2 moles of NH3NH_3. Since breaking bonds requires the same energy that was released when forming them, you reverse the sign and multiply by 2: ΔH = -(-46.2 kJ/mol) × 2 = +92.4 kJ. Looking at the wrong answers: B (-92.4 kJ) incorrectly keeps the negative sign, suggesting energy is released when decomposing ammonia - this violates the principle that you must input energy to break stable compounds. C (+46.2 kJ) correctly reverses the sign but fails to account for decomposing 2 moles instead of 1. D (-138.6 kJ) appears to add formation energies incorrectly, perhaps calculating (-46.2) × 3 instead of considering the stoichiometry properly. The correct answer is A (+92.4 kJ). Study tip: Always check whether you're forming or decomposing compounds, and remember that decomposition reactions have opposite signs from formation reactions. Pay close attention to stoichiometric coefficients - they directly multiply the enthalpy values.

Question 20

Using Hess's Law and the following data: (1) AB+CA \rightarrow B + C, ΔH1=+125 kJ\Delta H_1 = +125 \text{ kJ} (2) BD+EB \rightarrow D + E, ΔH2=75 kJ\Delta H_2 = -75 \text{ kJ} (3) C+FGC + F \rightarrow G, ΔH3=40 kJ\Delta H_3 = -40 \text{ kJ}. What is ΔH\Delta H for A+FD+E+GA + F \rightarrow D + E + G?

  1. +10 kJ (correct answer)
  2. -10 kJ
  3. +240 kJ
  4. -190 kJ
  5. +160 kJ
Explanation: When you encounter Hess's Law problems, you're working with the principle that enthalpy change depends only on initial and final states, not the path taken. This means you can add, subtract, and manipulate given equations to reach your target equation. To find ΔH\Delta H for A+FD+E+GA + F \rightarrow D + E + G, you need to combine the given reactions strategically. Start by identifying what you need: A and F as reactants, D, E, and G as products. Looking at the given equations, reaction (1) converts A to B and C, reaction (2) converts B to D and E, and reaction (3) converts C and F to G. If you add all three equations as written:
  • Equation (1): AB+CA \rightarrow B + C, ΔH1=+125 kJ\Delta H_1 = +125 \text{ kJ}
  • Equation (2): BD+EB \rightarrow D + E, ΔH2=75 kJ\Delta H_2 = -75 \text{ kJ}
  • Equation (3): C+FGC + F \rightarrow G, ΔH3=40 kJ\Delta H_3 = -40 \text{ kJ}
Adding these gives: A+FD+E+GA + F \rightarrow D + E + G (B and C cancel out as intermediates) Therefore: ΔH=(+125)+(75)+(40)=+10 kJ\Delta H = (+125) + (-75) + (-40) = +10 \text{ kJ} Answer A (+10 kJ) is correct. Answer B (-10 kJ) likely results from a sign error in the calculation. Answer C (+240 kJ) suggests adding absolute values without considering signs. Answer D (-190 kJ) appears to come from incorrectly manipulating the equations or making multiple sign errors. Study tip: In Hess's Law problems, carefully track intermediates that should cancel out, and always double-check your arithmetic with enthalpy signs.