College Chemistry Quiz: Gibbs Free Energy And Thermodynamic Favorability
20 questions · exam conditions
0:00
Gibbs Free Energy And Thermodynamic FavorabilityQuestion 1 of 20

If ΔG=0\Delta G^=0 for a reaction at 298 K, what is the value of KK?

K=0K=0, so the reaction cannot proceed in either direction.
K=1K=1, so neither reactants nor products are favored.
K>1K>1, so products are strongly favored at equilibrium.
K<1K<1, so reactants are strongly favored at equilibrium.
← Back to quizzes

College Chemistry Quiz

College Chemistry Quiz: Gibbs Free Energy And Thermodynamic Favorability

Practice Gibbs Free Energy And Thermodynamic Favorability in College Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Gibbs Free Energy And Thermodynamic Favorability, giving you a quick way to practice the rules, question types, and explanations that matter most for College Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

If ΔG=0\Delta G^=0 for a reaction at 298 K, what is the value of KK?

  1. K=0K=0, so the reaction cannot proceed in either direction.
  2. K=1K=1, so neither reactants nor products are favored. (correct answer)
  3. K>1K>1, so products are strongly favored at equilibrium.
  4. K<1K<1, so reactants are strongly favored at equilibrium.
Explanation: This question tests the understanding of the equilibrium constant when ΔG° = 0. Gibbs Free Energy (ΔG°) indicates whether a process is thermodynamically favorable, with negative ΔG° signifying spontaneity. In the given scenario, ΔG° = 0 implies ln K = 0, so K = 1. The correct answer states that K = 1, so neither reactants nor products are favored. A common mistake involves thinking K = 0 or associating it with no reaction. To help students, emphasize that K = 1 means equal concentrations at equilibrium. Encourage practice with phase transitions where ΔG° = 0 at specific conditions.

Question 2

In ΔG=ΔHTΔS\Delta G=\Delta H-T\Delta S, what does each term represent for a reaction at constant temperature and pressure?

  1. ΔG\Delta G is heat released; ΔH\Delta H is work; TΔST\Delta S is activation energy.
  2. ΔG\Delta G is free energy change; ΔH\Delta H is enthalpy change; TΔST\Delta S is entropy term. (correct answer)
  3. ΔG\Delta G is entropy change; ΔH\Delta H is temperature; TΔST\Delta S is enthalpy term.
  4. ΔG\Delta G is equilibrium constant; ΔH\Delta H is reaction quotient; TΔST\Delta S is rate constant.
Explanation: This question tests the understanding of the components in the Gibbs Free Energy equation ΔG = ΔH - TΔS. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, ΔH represents the enthalpy change, and -TΔS accounts for the entropy contribution at constant temperature. The correct answer identifies ΔG as the free energy change, ΔH as enthalpy change, and TΔS as the entropy term. A common mistake involves swapping the roles of ΔH and TΔS or confusing them with other concepts like activation energy. To help students, emphasize the physical meaning of each term in energy availability. Encourage practice by deriving the equation from first principles to solidify comprehension.

Question 3

At equilibrium for a reversible reaction at constant TT and PP, what is the value of ΔG\Delta G?

  1. ΔG\Delta G is negative because products are forming spontaneously.
  2. ΔG\Delta G is zero because forward and reverse driving forces balance. (correct answer)
  3. ΔG\Delta G is positive because reactants are favored at equilibrium.
  4. ΔG\Delta G is undefined because equilibrium stops all molecular motion.
Explanation: This question tests the understanding of Gibbs Free Energy at equilibrium for reversible reactions. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, at equilibrium, the forward and reverse rates balance, resulting in ΔG = 0. The correct answer states that ΔG is zero because forward and reverse driving forces balance. A common mistake involves confusing ΔG with ΔG° or thinking equilibrium means positive ΔG. To help students, emphasize that ΔG = 0 defines equilibrium, not cessation of reaction. Encourage practice with reaction quotients to predict shifts from equilibrium.

Question 4

Explain why a reaction with a positive ΔG\Delta G can still occur.

  1. It can proceed if coupled to a more negative ΔG\Delta G process overall. (correct answer)
  2. Positive ΔG\Delta G means the reaction is spontaneous but slow.
  3. A catalyst makes ΔG\Delta G negative by lowering ΔH\Delta H.
  4. Positive ΔG\Delta G means the reaction is already at equilibrium.
Explanation: This question tests the understanding of how reactions with positive ΔG can still proceed. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, a positive ΔG reaction can occur if coupled to another with a more negative ΔG, making the overall process spontaneous. The correct answer highlights that it can proceed if coupled to a more negative ΔG process. A common mistake involves thinking catalysts change ΔG, but they only affect rates. To help students, emphasize biological examples like ATP coupling. Encourage practice with coupled reaction calculations to understand energy transfer.

Question 5

If K=2.0×103K=2.0\times 10^{3} at 298 K, what is the sign of \Delta G^?

  1. \Delta G^ is positive because KK is greater than 1.
  2. \Delta G^ is negative because lnK\ln K is positive. (correct answer)
  3. \Delta G^ is zero because products and reactants are equal.
  4. \Delta G^ is undefined because KK has no units.
Explanation: This question tests the understanding of the sign of ΔG° when K > 1. Gibbs Free Energy (ΔG°) indicates whether a process is thermodynamically favorable, with negative ΔG° signifying spontaneity. In the given scenario, K = 2.0 × 10^3 > 1 means ln K > 0, so ΔG° < 0. The correct answer states that ΔG° is negative because ln K is positive. A common mistake involves associating large K with positive ΔG°. To help students, emphasize how favorable reactions have large K and negative ΔG°. Encourage practice with acid dissociation constants as examples.

Question 6

A reaction has ΔG=0\Delta G=0 under certain conditions; what does this imply about the reaction quotient QQ?

  1. Q=KQ=K, so the system is at equilibrium under those conditions. (correct answer)
  2. Q>KQ>K, so the forward reaction is spontaneous.
  3. Q<KQ<K, so the reverse reaction is spontaneous.
  4. Q=0Q=0, so no products are present and reaction must stop.
Explanation: This question tests the understanding of the reaction quotient when ΔG = 0. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, ΔG = 0 implies the system is at equilibrium, so Q = K. The correct answer states that Q = K, so the system is at equilibrium. A common mistake involves thinking ΔG = 0 means Q = 0 or directional preferences. To help students, emphasize the equation ΔG = ΔG° + RT ln Q. Encourage practice with non-standard conditions to calculate Q and predict shifts.

Question 7

For electrolysis: 2H2O(l)2H2(g)+O2(g)2\text{H}_2\text{O}(l) \rightarrow 2\text{H}_2(g)+\text{O}_2(g) has ΔG>0\Delta G^>0; what follows?

  1. The reaction is spontaneous and releases electrical energy to the surroundings.
  2. The reaction requires external electrical work to proceed under standard conditions. (correct answer)
  3. The reaction is at equilibrium because \Delta G^ is positive.
  4. The reaction rate is fast because \Delta G^ is large.
Explanation: This question tests the understanding of Gibbs Free Energy for nonspontaneous processes like electrolysis. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, positive ΔG° for water electrolysis means it requires external energy input. The correct answer states that the reaction requires external electrical work to proceed. A common mistake involves assuming positive ΔG means equilibrium or fast rates. To help students, emphasize the role of ΔG in electrochemical cells. Encourage practice with battery vs. electrolysis examples to distinguish spontaneous and driven processes.

Question 8

How does temperature affect spontaneity when ΔH<0\Delta H<0 and ΔS<0\Delta S<0 in ΔG=ΔHTΔS\Delta G=\Delta H-T\Delta S?

  1. Higher TT makes ΔG\Delta G more negative, so spontaneity increases.
  2. Higher TT makes ΔG\Delta G more positive, so spontaneity decreases. (correct answer)
  3. Temperature cannot change ΔG\Delta G when both ΔH\Delta H and ΔS\Delta S are negative.
  4. Higher TT always makes reactions spontaneous regardless of signs.
Explanation: This question tests the understanding of temperature's effect on Gibbs Free Energy when ΔH < 0 and ΔS < 0. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, higher temperature makes the -TΔS term more positive because ΔS is negative, thus making ΔG more positive. The correct answer notes that higher T makes ΔG more positive, decreasing spontaneity. A common mistake involves assuming all exothermic reactions are always spontaneous regardless of temperature. To help students, emphasize that at high temperatures, the entropy term can dominate. Encourage practice with examples like gas condensation to illustrate temperature dependence.

Question 9

A reaction has ΔH=25 kJ/mol\Delta H=-25\ \text{kJ/mol} and ΔS=+80 J/(mol0˘0b7K)\Delta S=+80\ \text{J/(mol\u00b7K)}; which is true for ΔG\Delta G?

  1. ΔG\Delta G is positive at all temperatures because ΔH\Delta H is negative.
  2. ΔG\Delta G is negative at all temperatures because both terms favor spontaneity. (correct answer)
  3. ΔG\Delta G is zero at all temperatures because ΔS\Delta S is positive.
  4. ΔG\Delta G changes sign with temperature because ΔH\Delta H and ΔS\Delta S oppose.
Explanation: This question tests the understanding of Gibbs Free Energy signs when both ΔH and ΔS favor spontaneity. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, negative ΔH and positive ΔS ensure ΔG is negative at all temperatures. The correct answer states that ΔG is negative at all temperatures because both terms favor spontaneity. A common mistake involves thinking temperature can reverse the sign when terms align. To help students, emphasize that opposing signs lead to temperature dependence, not aligning ones. Encourage practice with real reactions like combustion to illustrate.

Question 10

For combustion of glucose: C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l)\text{C}_6\text{H}_{12}\text{O}_6(s)+6\text{O}_2(g)\rightarrow 6\text{CO}_2(g)+6\text{H}_2\text{O}(l), ΔG<0\Delta G^<0 implies what?

  1. It is nonspontaneous unless driven by an applied voltage.
  2. It is spontaneous under standard conditions and releases usable free energy. (correct answer)
  3. It must be at equilibrium because products and reactants coexist.
  4. It proceeds quickly because \Delta G^ determines reaction rate.
Explanation: This question tests the understanding of Gibbs Free Energy for spontaneous metabolic reactions like glucose combustion. Gibbs Free Energy (ΔG°) indicates whether a process is thermodynamically favorable, with negative ΔG° signifying spontaneity. In the given scenario, negative ΔG° means the reaction is spontaneous and releases usable energy. The correct answer states it is spontaneous under standard conditions and releases usable free energy. A common mistake involves confusing thermodynamics with kinetics, thinking it implies fast rates. To help students, emphasize biological energy harvesting from such reactions. Encourage practice with calorimetry data to connect ΔG to real processes.

Question 11

If K=1.0×105K=1.0\times 10^{-5} at 298 K, what is the sign of \Delta G^?

  1. \Delta G^ is negative because KK is less than 1.
  2. \Delta G^ is positive because lnK\ln K is negative. (correct answer)
  3. \Delta G^ is zero because KK is a constant.
  4. \Delta G^ cannot be determined without the reaction rate.
Explanation: This question tests the understanding of the sign of ΔG° from the equilibrium constant K. Gibbs Free Energy (ΔG°) indicates whether a process is thermodynamically favorable, with negative ΔG° signifying spontaneity. In the given scenario, K = 1.0 × 10^{-5} < 1 means ln K < 0, so ΔG° > 0. The correct answer states that ΔG° is positive because ln K is negative. A common mistake involves thinking small K implies negative ΔG°. To help students, emphasize the inverse relationship in the formula. Encourage practice with logarithmic calculations for various K values.

Question 12

What does a negative value of ΔG\Delta G indicate about a reaction under the stated conditions?

  1. The reaction is spontaneous in the forward direction under those conditions. (correct answer)
  2. The reaction is at equilibrium and no net reaction occurs.
  3. The reaction rate must be fast because ΔG\Delta G is negative.
  4. The reaction is nonspontaneous unless a catalyst is added.
Explanation: This question tests the understanding of Gibbs Free Energy in predicting thermodynamic favorability and spontaneity. Gibbs Free Energy (ΔG) indicates whether a process is thermodynamically favorable, with negative ΔG signifying spontaneity. In the given scenario, a negative ΔG means the reaction proceeds spontaneously in the forward direction under the specified conditions. The correct answer highlights that the reaction is spontaneous in the forward direction. A common mistake involves confusing spontaneity with reaction rate, assuming negative ΔG implies a fast reaction. To help students, emphasize that ΔG predicts direction and favorability, not speed. Encourage practice with examples where ΔG is negative but reactions are slow due to kinetics.

Question 13

A reaction at 25°C has ΔG=+15.3\Delta G^\circ = +15.3 kJ/mol. If the reaction quotient Q=0.025Q = 0.025, what is ΔG\Delta G for the reaction under these non-standard conditions?

  1. +6.1 kJ/mol (correct answer)
  2. +24.5 kJ/mol
  3. -9.2 kJ/mol
  4. +15.3 kJ/mol
  5. +33.6 kJ/mol
Explanation: When you encounter problems involving both standard and non-standard conditions in thermodynamics, you need to connect the standard Gibbs free energy change (ΔG\Delta G^\circ) with the actual conditions using the reaction quotient Q. The key relationship is: ΔG=ΔG+RTlnQ\Delta G = \Delta G^\circ + RT \ln Q Given: ΔG=+15.3\Delta G^\circ = +15.3 kJ/mol, T = 25°C = 298 K, and Q = 0.025 First, convert R to appropriate units: R = 8.314 J/(mol·K) = 0.008314 kJ/(mol·K) Now calculate: ΔG=15.3+(0.008314)(298)ln(0.025)\Delta G = 15.3 + (0.008314)(298)\ln(0.025) Since ln(0.025)=3.69\ln(0.025) = -3.69: ΔG=15.3+(2.48)(3.69)=15.39.2=+6.1\Delta G = 15.3 + (2.48)(-3.69) = 15.3 - 9.2 = +6.1 kJ/mol Looking at the wrong answers: B (+24.5 kJ/mol) likely comes from incorrectly adding the RT ln Q term instead of recognizing that ln(0.025) is negative. C (-9.2 kJ/mol) represents just the RT ln Q term alone, ignoring ΔG\Delta G^\circ entirely. D (+15.3 kJ/mol) is simply the standard free energy change, suggesting the student forgot that non-standard conditions require the additional RT ln Q correction. The correct answer is A (+6.1 kJ/mol). Study tip: Remember that when Q < 1, ln Q is negative, making the reaction more thermodynamically favorable than under standard conditions. Always check whether ln Q should be positive or negative based on whether Q is greater or less than 1.

Question 14

Which statement best describes the relationship between ΔG\Delta G^\circ and the equilibrium constant KK for a chemical reaction?

  1. When ΔG=0\Delta G^\circ = 0, the reaction is at equilibrium and K=1K = 1
  2. When ΔG<0\Delta G^\circ < 0, the reaction is thermodynamically favorable and K>1K > 1 (correct answer)
  3. When ΔG>0\Delta G^\circ > 0, the reaction proceeds spontaneously and K<1K < 1
  4. The magnitude of KK is directly proportional to ΔG\Delta G^\circ
  5. ΔG\Delta G^\circ and KK are independent quantities with no mathematical relationship
Explanation: When you encounter questions linking thermodynamics to equilibrium, focus on the fundamental relationship: ΔG=RTlnK\Delta G^\circ = -RT \ln K. This equation connects the standard free energy change to the equilibrium constant and reveals how thermodynamic favorability relates to equilibrium position. The correct answer is B because when ΔG<0\Delta G^\circ < 0, the natural logarithm of KK must be positive (since RT-RT is negative). This means K>1K > 1, indicating the reaction is thermodynamically favorable with products favored at equilibrium. Let's examine why the other options are incorrect: Option A incorrectly states that K=1K = 1 when ΔG=0\Delta G^\circ = 0. While ΔG=0\Delta G^\circ = 0 does indicate equilibrium conditions, K=1K = 1 only when reactants and products have equal concentrations at equilibrium, which isn't always the case. Option C contains a contradiction. When ΔG>0\Delta G^\circ > 0, the reaction is thermodynamically unfavorable and does NOT proceed spontaneously under standard conditions. While K<1K < 1 is correct for this scenario, the claim about spontaneous proceeding is wrong. Option D misrepresents the mathematical relationship. The connection between ΔG\Delta G^\circ and KK is logarithmic, not directly proportional. As ΔG\Delta G^\circ becomes more negative, KK increases exponentially. Study tip: Memorize ΔG=RTlnK\Delta G^\circ = -RT \ln K and remember the sign relationships: negative ΔG\Delta G^\circ means favorable reaction and K>1K > 1; positive ΔG\Delta G^\circ means unfavorable reaction and K<1K < 1.

Question 15

For the reaction A+BC+DA + B \rightleftharpoons C + D, ΔG=8.4\Delta G^\circ = -8.4 kJ/mol at 25°C. If the initial concentrations are [A] = 0.10 M, [B] = 0.20 M, [C] = 0.50 M, and [D] = 0.30 M, what is the reaction quotient QQ and in which direction will the reaction proceed?

  1. Q=7.5Q = 7.5; reaction proceeds toward products because Q<KQ < K (correct answer)
  2. Q=0.13Q = 0.13; reaction proceeds toward products because Q<KQ < K
  3. Q=7.5Q = 7.5; reaction proceeds toward reactants because Q>KQ > K
  4. Q=0.13Q = 0.13; reaction proceeds toward reactants because Q>KQ > K
  5. Q=30Q = 30; reaction is at equilibrium because Q=KQ = K
Explanation: This question tests your understanding of reaction quotients and equilibrium constants, which determine reaction direction. When you see initial concentrations and a standard free energy change, you need to calculate both the reaction quotient QQ and equilibrium constant KK to predict which way the reaction will shift. First, calculate the equilibrium constant using ΔG°=RTlnK\Delta G° = -RT \ln K. Rearranging: K=eΔG°/RT=e(8400)/(8.314×298)=e3.39=29.7K = e^{-\Delta G°/RT} = e^{-(-8400)/(8.314 \times 298)} = e^{3.39} = 29.7 Next, calculate the reaction quotient using Q=[C][D][A][B]=(0.50)(0.30)(0.10)(0.20)=0.150.02=7.5Q = \frac{[C][D]}{[A][B]} = \frac{(0.50)(0.30)}{(0.10)(0.20)} = \frac{0.15}{0.02} = 7.5 Since Q=7.5<K=29.7Q = 7.5 < K = 29.7, the reaction proceeds toward products to reach equilibrium. Answer A correctly identifies Q=7.5Q = 7.5 and the forward direction because Q<KQ < K. Answer B has the wrong QQ value (0.13), which would result from incorrectly inverting the quotient expression. Answer C correctly calculates Q=7.5Q = 7.5 but incorrectly states the reaction proceeds toward reactants; this represents the common misconception of confusing the relationship between QQ and KK. Answer D combines both errors: the inverted QQ calculation and wrong directional reasoning. Remember: when Q<KQ < K, reactions shift right (toward products); when Q>KQ > K, they shift left (toward reactants). Always double-check your QQ expression—products in numerator, reactants in denominator.

Question 16

A reaction has K1=2.5×104K_1 = 2.5 \times 10^{-4} at 300 K and K2=1.8×103K_2 = 1.8 \times 10^{-3} at 350 K. What can be concluded about ΔH\Delta H^\circ for this reaction?

  1. ΔH>0\Delta H^\circ > 0 because KK increases with temperature, indicating an endothermic reaction (correct answer)
  2. ΔH<0\Delta H^\circ < 0 because KK increases with temperature, indicating an exothermic reaction
  3. ΔH=0\Delta H^\circ = 0 because the change in KK is proportional to the temperature change
  4. ΔH>0\Delta H^\circ > 0 because higher temperature decreases the activation energy barrier
  5. Cannot determine the sign of ΔH\Delta H^\circ without knowing ΔS\Delta S^\circ
Explanation: When you encounter equilibrium constants at different temperatures, you're dealing with the van't Hoff equation, which relates how KK changes with temperature to the enthalpy change of the reaction. The key insight is observing how the equilibrium constant changes as temperature increases. Here, KK increases from 2.5×1042.5 \times 10^{-4} at 300 K to 1.8×1031.8 \times 10^{-3} at 350 K - roughly a 7-fold increase. When KK increases with temperature, it means higher temperature favors the forward reaction, which only happens when the reaction absorbs heat (endothermic, ΔH>0\Delta H^\circ > 0). This follows Le Châtelier's principle: adding heat shifts equilibrium toward the endothermic direction. Choice A correctly identifies that ΔH>0\Delta H^\circ > 0 because KK increases with temperature, indicating an endothermic reaction. Choice B has the sign backwards - if ΔH<0\Delta H^\circ < 0 (exothermic), then KK would decrease with increasing temperature, not increase. Choice C incorrectly suggests ΔH=0\Delta H^\circ = 0. When enthalpy change is zero, KK doesn't change with temperature at all. The proportional relationship mentioned doesn't determine the sign of ΔH\Delta H^\circ. Choice D mentions activation energy, which affects reaction rate, not equilibrium position. Activation energy is kinetics; equilibrium constants reflect thermodynamics. Study tip: Remember the pattern - when KK increases with temperature, the reaction is endothermic (ΔH>0\Delta H^\circ > 0). When KK decreases with temperature, it's exothermic (ΔH<0\Delta H^\circ < 0). This relationship appears frequently in thermodynamics problems.

Question 17

For a reaction at equilibrium, which statement about Gibbs free energy is correct?

  1. ΔG=0\Delta G = 0 and ΔG=0\Delta G^\circ = 0 for the system under all conditions
  2. ΔG=0\Delta G = 0 for the equilibrium mixture, but ΔG\Delta G^\circ depends on the standard state (correct answer)
  3. ΔG=0\Delta G^\circ = 0 for the standard state, but ΔG\Delta G depends on actual concentrations
  4. Both ΔG\Delta G and ΔG\Delta G^\circ must be negative for a spontaneous reaction at equilibrium
  5. ΔG>0\Delta G > 0 at equilibrium because no net change occurs in either direction
Explanation: When you encounter questions about equilibrium and Gibbs free energy, remember that ΔG\Delta G and ΔG\Delta G^\circ represent fundamentally different conditions and have different meanings at equilibrium. At equilibrium, the system has no driving force for net change in either direction, which means ΔG=0\Delta G = 0. This is always true for any equilibrium mixture, regardless of the actual concentrations of reactants and products. However, ΔG\Delta G^\circ refers to the free energy change when all species are at their standard states (1 M concentrations, 1 atm pressure). This value is fixed for a given reaction at a specific temperature and doesn't become zero just because the reaction reaches equilibrium under different conditions. Choice A is incorrect because ΔG\Delta G^\circ doesn't equal zero for most reactions—it's determined by the inherent thermodynamic properties of the reactants and products under standard conditions. Choice C reverses the correct relationship; it's ΔG\Delta G (not ΔG\Delta G^\circ) that equals zero at equilibrium. Choice D misunderstands equilibrium entirely—at equilibrium, the reaction isn't proceeding spontaneously in either direction, so ΔG\Delta G must be zero, not negative. The key relationship connecting these concepts is: ΔG=ΔG+RTlnQ\Delta G = \Delta G^\circ + RT \ln Q. At equilibrium, ΔG=0\Delta G = 0 and Q=KeqQ = K_{eq}, giving us ΔG=RTlnKeq\Delta G^\circ = -RT \ln K_{eq}. Remember: ΔG=0\Delta G = 0 defines equilibrium, while ΔG\Delta G^\circ determines where that equilibrium lies through the equilibrium constant.

Question 18

The combustion of glucose: C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l)C_6H_{12}O_6(s) + 6O_2(g) \rightarrow 6CO_2(g) + 6H_2O(l) has ΔH=2800\Delta H^\circ = -2800 kJ/mol and ΔS=+180\Delta S^\circ = +180 J/(mol·K) at 25°C. What is ΔG\Delta G^\circ for this reaction?

  1. -2747 kJ/mol
  2. -2854 kJ/mol (correct answer)
  3. -2800 kJ/mol
  4. -53.6 kJ/mol
  5. +53.6 kJ/mol
Explanation: When you encounter thermodynamics problems involving ΔG\Delta G^\circ, you're working with the fundamental relationship that determines whether a reaction is spontaneous. The key equation here is the Gibbs free energy equation: ΔG=ΔHTΔS\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ. To solve this problem, you need to substitute the given values carefully, paying attention to units. Given: ΔH=2800\Delta H^\circ = -2800 kJ/mol, ΔS=+180\Delta S^\circ = +180 J/(mol·K), and T = 25°C = 298 K. First, convert ΔS\Delta S^\circ to kJ: 180 J/(mol\cdotpK)=0.180 kJ/(mol\cdotpK)180 \text{ J/(mol·K)} = 0.180 \text{ kJ/(mol·K)} Then calculate: ΔG=2800 kJ/mol(298 K)(0.180 kJ/(mol\cdotpK))=280053.6=2854 kJ/mol\Delta G^\circ = -2800 \text{ kJ/mol} - (298 \text{ K})(0.180 \text{ kJ/(mol·K)}) = -2800 - 53.6 = -2854 \text{ kJ/mol} Answer A (-2747 kJ/mol) results from incorrectly adding the entropy term instead of subtracting it, showing a sign error in applying the Gibbs equation. Answer C (-2800 kJ/mol) completely ignores the entropy contribution, suggesting the student forgot the TΔST\Delta S^\circ term entirely. Answer D (-53.6 kJ/mol) represents only the entropy contribution (TΔST\Delta S^\circ), indicating the student forgot to include the enthalpy term. Always double-check your unit conversions in thermodynamics problems—mixing kJ and J is a common source of errors. Remember that the entropy term becomes more significant at higher temperatures, making ΔG\Delta G^\circ more negative when ΔS\Delta S^\circ is positive.

Question 19

A reaction mixture contains products and reactants such that Q=KQ = K for the reaction 2A(g)B(g)+C(g)2A(g) \rightleftharpoons B(g) + C(g). If the temperature is suddenly increased, and the reaction is endothermic, what happens to ΔG\Delta G immediately after the temperature change?

  1. ΔG\Delta G becomes positive because Q>KQ > K at the new temperature
  2. ΔG\Delta G becomes negative because Q<KQ < K at the new temperature (correct answer)
  3. ΔG\Delta G remains zero because the concentrations haven't changed yet
  4. ΔG\Delta G becomes positive because ΔG\Delta G^\circ increases with temperature
  5. ΔG\Delta G becomes negative because ΔG\Delta G^\circ decreases with temperature
Explanation: When you encounter equilibrium problems involving temperature changes, you need to consider how temperature affects both the equilibrium constant K and the relationship between Q and K. Initially, the system is at equilibrium with Q=KQ = K, so ΔG=0\Delta G = 0. When temperature suddenly increases for an endothermic reaction, the equilibrium constant K increases according to Le Chatelier's principle - the system favors the forward reaction to absorb the added heat. However, the concentrations of reactants and products don't change instantaneously, so Q remains the same immediately after the temperature change. This creates a situation where Q<KQ < K at the new temperature. Since ΔG=ΔG+RTlnQRTlnK=RTln(Q/K)\Delta G = \Delta G^\circ + RT \ln Q - RT \ln K = RT \ln(Q/K), when Q<KQ < K, we have Q/K<1Q/K < 1, making ln(Q/K)\ln(Q/K) negative. Therefore, ΔG\Delta G becomes negative, indicating the reaction will proceed forward to reach the new equilibrium. Choice A incorrectly states Q>KQ > K, which would occur if the reaction were exothermic. Choice C wrongly assumes ΔG\Delta G stays zero - while concentrations haven't changed, K has changed, disrupting the equilibrium. Choice D correctly notes that temperature affects the system but incorrectly focuses on ΔG\Delta G^\circ rather than the Q/K relationship that determines ΔG\Delta G. Remember: for endothermic reactions, higher temperature increases K, and immediately after the change, Q<KQ < K makes ΔG\Delta G negative, driving the reaction forward.

Question 20

Which combination of ΔH\Delta H^\circ and ΔS\Delta S^\circ values would result in a reaction that is thermodynamically favorable only at low temperatures?

  1. ΔH<0\Delta H^\circ < 0 and ΔS>0\Delta S^\circ > 0
  2. ΔH>0\Delta H^\circ > 0 and ΔS<0\Delta S^\circ < 0
  3. ΔH<0\Delta H^\circ < 0 and ΔS<0\Delta S^\circ < 0 (correct answer)
  4. ΔH>0\Delta H^\circ > 0 and ΔS>0\Delta S^\circ > 0
  5. ΔH=0\Delta H^\circ = 0 and ΔS<0\Delta S^\circ < 0
Explanation: When you encounter questions about temperature-dependent spontaneity, you need to analyze how the Gibbs free energy equation ΔG=ΔHTΔS\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ behaves at different temperatures. A reaction is thermodynamically favorable when ΔG<0\Delta G^\circ < 0. For a reaction to be favorable only at low temperatures, it must become unfavorable as temperature increases. This happens when ΔH<0\Delta H^\circ < 0 and ΔS<0\Delta S^\circ < 0. At low temperatures, the ΔH\Delta H^\circ term dominates, making ΔG\Delta G^\circ negative (favorable). However, as temperature rises, the TΔS-T\Delta S^\circ term becomes increasingly positive (since ΔS\Delta S^\circ is negative), eventually making ΔG\Delta G^\circ positive (unfavorable). Choice A (ΔH<0\Delta H^\circ < 0, ΔS>0\Delta S^\circ > 0) represents a reaction favorable at all temperatures because both terms make ΔG\Delta G^\circ negative. Choice B (ΔH>0\Delta H^\circ > 0, ΔS<0\Delta S^\circ < 0) gives a reaction that's never favorable since both terms make ΔG\Delta G^\circ positive. Choice D (ΔH>0\Delta H^\circ > 0, ΔS>0\Delta S^\circ > 0) describes a reaction favorable only at high temperatures, where the TΔS-T\Delta S^\circ term eventually overcomes the positive ΔH\Delta H^\circ. The correct answer is C. Study tip: Remember the phrase "Hot and Cold" for temperature dependence: when enthalpy and entropy have opposite signs, temperature determines favorability. Negative enthalpy with negative entropy means "favorable when cold."