College Chemistry Quiz: Acids And Bases Definitions And Ph
19 questions · exam conditions
0:00
Acids And Bases Definitions And PhQuestion 1 of 19

A 0.150 M solution of methylamine (CH3NH2CH_3NH_2) has a pH of 11.95. What is the KbK_b value for methylamine?

3.8 × 10⁻⁴
4.2 × 10⁻⁴
4.6 × 10⁻⁴
5.1 × 10⁻⁴
5.7 × 10⁻⁴
← Back to quizzes

College Chemistry Quiz

College Chemistry Quiz: Acids And Bases Definitions And Ph

Practice Acids And Bases Definitions And Ph in College Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Acids And Bases Definitions And Ph, giving you a quick way to practice the rules, question types, and explanations that matter most for College Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A 0.150 M solution of methylamine (CH3NH2CH_3NH_2) has a pH of 11.95. What is the KbK_b value for methylamine?

  1. 3.8 × 10⁻⁴
  2. 4.2 × 10⁻⁴ (correct answer)
  3. 4.6 × 10⁻⁴
  4. 5.1 × 10⁻⁴
  5. 5.7 × 10⁻⁴
Explanation: When you encounter a weak base equilibrium problem, you need to connect the given pH to the base dissociation constant through the equilibrium expression and ICE table analysis. Methylamine is a weak base that accepts protons: CH3NH2+H2OCH3NH3++OHCH_3NH_2 + H_2O \rightleftharpoons CH_3NH_3^+ + OH^- First, convert the pH to [OH⁻]. Since pH = 11.95, pOH = 14.00 - 11.95 = 2.05, so [OH⁻] = 10^{-2.05} = 8.91 × 10⁻³ M. Set up an ICE table with initial [CH3NH2CH_3NH_2] = 0.150 M. At equilibrium, [OH⁻] = [CH3NH3+CH_3NH_3^+] = 8.91 × 10⁻³ M, and [CH3NH2CH_3NH_2] = 0.150 - 8.91 × 10⁻³ = 0.141 M. Now apply the KbK_b expression: Kb=[CH3NH3+][OH][CH3NH2]=(8.91×103)20.141=4.2×104K_b = \frac{[CH_3NH_3^+][OH^-]}{[CH_3NH_2]} = \frac{(8.91 × 10^{-3})^2}{0.141} = 4.2 × 10^{-4} This confirms answer B is correct. Answer A (3.8 × 10⁻⁴) results from incorrectly using the initial concentration (0.150 M) instead of the equilibrium concentration in the denominator. Answer C (4.6 × 10⁻⁴) comes from calculation errors in the hydroxide concentration. Answer D (5.1 × 10⁻⁴) typically results from using [H⁺] instead of [OH⁻] in the calculation. Remember: always use equilibrium concentrations in your KbK_b expression, and double-check your pH/pOH conversions. For weak bases with significant ionization (>5%), you cannot ignore the change in base concentration.

Question 2

Consider the equilibrium: HF(aq)+H2O(l)H3O+(aq)+F(aq)HF(aq) + H_2O(l) \rightleftharpoons H_3O^+(aq) + F^-(aq). If the temperature is increased, which statement correctly describes the effect on the equilibrium and the reasoning?

  1. The equilibrium shifts right because higher temperature always favors ionization of weak acids
  2. The equilibrium shifts left because the ionization of weak acids is typically endothermic, and Le Châtelier's principle favors the reverse reaction
  3. The equilibrium shifts right because the ionization of weak acids is typically endothermic, and Le Châtelier's principle favors the forward reaction (correct answer)
  4. The equilibrium position remains unchanged because temperature changes do not affect acid-base equilibria
  5. The equilibrium shifts left because higher temperature decreases the solubility of ionic compounds like HF
Explanation: When you encounter equilibrium problems involving temperature changes, you need to apply Le Châtelier's principle combined with knowledge of whether the reaction is endothermic or exothermic. The ionization of weak acids like HF is typically an endothermic process, meaning it absorbs heat. You can think of heat as a "reactant" in endothermic reactions. According to Le Châtelier's principle, when you increase temperature (add heat), the equilibrium will shift to consume that excess heat by favoring the forward reaction. Since HF(aq)+H2O(l)+heatH3O+(aq)+F(aq)HF(aq) + H_2O(l) + \text{heat} \rightleftharpoons H_3O^+(aq) + F^-(aq), increasing temperature drives the equilibrium to the right, producing more ions. Option A reaches the correct conclusion but with flawed reasoning—temperature doesn't "always" favor ionization regardless of thermodynamics. Option B incorrectly applies Le Châtelier's principle; while correctly identifying that weak acid ionization is endothermic, it wrongly concludes the equilibrium shifts left. If a process is endothermic, adding heat favors the forward direction, not reverse. Option D is simply wrong—temperature changes significantly affect equilibrium positions for reactions with non-zero enthalpy changes. The key study tip: Always determine whether a reaction is endothermic or exothermic first, then apply Le Châtelier's principle correctly. For weak acid ionizations, remember they're typically endothermic, so higher temperatures increase the degree of ionization and shift equilibrium toward products.

Question 3

A solution contains 0.25 M HClHCl and 0.15 M HNO3HNO_3. What is the pH of this solution?

  1. 0.30
  2. 0.40 (correct answer)
  3. 0.48
  4. 0.60
  5. 0.78
Explanation: When you encounter a solution containing multiple strong acids, you need to find the total concentration of hydrogen ions, since both acids will completely dissociate in water. Both HClHCl and HNO3HNO_3 are strong acids that ionize completely:
  • HClH++ClHCl \rightarrow H^+ + Cl^-
  • HNO3H++NO3HNO_3 \rightarrow H^+ + NO_3^-
Since each acid contributes one H+H^+ ion per molecule, the total [H+][H^+] is simply the sum of both concentrations: [H+]=0.25 M+0.15 M=0.40 M[H^+] = 0.25 \text{ M} + 0.15 \text{ M} = 0.40 \text{ M} Using the pH formula: pH=log[H+]=log(0.40)=0.40pH = -\log[H^+] = -\log(0.40) = 0.40 This confirms answer choice B is correct. Let's examine why the other answers are wrong: A) 0.30 appears to result from incorrectly subtracting the concentrations (0.25 - 0.15) instead of adding them. C) 0.48 might come from a calculation error, possibly from incorrectly handling the logarithm or making an arithmetic mistake. D) 0.60 could result from mistakenly using only the HClHCl concentration and calculating log(0.25)-\log(0.25), ignoring the HNO3HNO_3 entirely. Study tip: Remember that when dealing with multiple strong acids (or bases), always add their concentrations to find the total [H+][H^+] or [OH][OH^-]. Strong acids and bases dissociate completely, so each contributes fully to the solution's acidity or basicity. This additive principle is key for mixture problems.

Question 4

A solution is prepared by dissolving 2.45 g of NaOHNaOH in water to make 500.0 mL of solution. What is the pOH of this solution?

  1. 0.71
  2. 0.81
  3. 0.91 (correct answer)
  4. 1.01
  5. 1.11
Explanation: This question tests your understanding of strong base solutions and the relationship between pH and pOH. When you see a problem involving NaOH (a strong base) dissolved in water, you need to calculate the hydroxide ion concentration first, then find pOH. Start by finding the molarity of the NaOH solution. You have 2.45 g of NaOH (molar mass = 40.0 g/mol) in 500.0 mL of solution: Moles of NaOH = 2.45 g ÷ 40.0 g/mol = 0.0613 mol Molarity = 0.0613 mol ÷ 0.500 L = 0.123 M Since NaOH is a strong base, it completely dissociates: NaOHNa++OHNaOH \rightarrow Na^+ + OH^-. This means [OH⁻] = 0.123 M. Now calculate pOH: pOH=log[OH]=log(0.123)=0.91pOH = -\log[OH^-] = -\log(0.123) = 0.91 Answer A (0.71) represents a calculation error, likely from using an incorrect molar mass or making an arithmetic mistake during the logarithm calculation. Answer B (0.81) could result from rounding errors or miscalculating the molarity. Answer D (1.01) might come from confusion about significant figures or incorrectly applying the logarithm function. The correct answer is C (0.91). Study tip: For strong base problems, always remember the sequence: mass → moles → molarity → [OH⁻] → pOH. Strong bases completely dissociate, so the molarity of the base equals the hydroxide concentration. Practice logarithm calculations since pOH and pH problems heavily rely on them.

Question 5

The autoionization of water is represented by: 2H2O(l)H3O+(aq)+OH(aq)2H_2O(l) \rightleftharpoons H_3O^+(aq) + OH^-(aq). At 50°C, Kw=5.5×1014K_w = 5.5 \times 10^{-14}. What is the pH of pure water at this temperature?

  1. 6.63 (correct answer)
  2. 6.83
  3. 7.00
  4. 7.13
  5. 7.26
Explanation: When you encounter autoionization problems at different temperatures, remember that the neutral pH isn't always 7.00 - it depends on the temperature-specific value of KwK_w. For pure water at any temperature, the concentrations of H3O+H_3O^+ and OHOH^- are equal due to the balanced autoionization reaction. Let's call this concentration xx. Since Kw=[H3O+][OH]K_w = [H_3O^+][OH^-], we have: Kw=xx=x2K_w = x \cdot x = x^2 At 50°C, Kw=5.5×1014K_w = 5.5 \times 10^{-14}, so: x2=5.5×1014x^2 = 5.5 \times 10^{-14} x=5.5×1014=2.35×107 Mx = \sqrt{5.5 \times 10^{-14}} = 2.35 \times 10^{-7} \text{ M} Therefore: pH=log(2.35×107)=6.63pH = -\log(2.35 \times 10^{-7}) = 6.63 This makes (A) 6.63 correct. (B) 6.83 results from calculation errors, possibly in the square root or logarithm steps. (C) 7.00 is the classic trap - this is the pH of pure water only at 25°C where Kw=1.0×1014K_w = 1.0 \times 10^{-14}. Many students forget that neutral pH changes with temperature. (D) 7.13 might come from incorrectly thinking that higher temperature always means higher pH, or from algebraic mistakes. Study tip: Always check whether the problem gives you a KwK_w value different from 1.0×10141.0 \times 10^{-14}. If so, you must calculate the new neutral pH - don't assume it's 7.00. Remember: neutral means [H3O+]=[OH][H_3O^+] = [OH^-], regardless of temperature.

Question 6

Which of the following represents the correct relationship between KaK_a, KbK_b, and KwK_w for a conjugate acid-base pair?

  1. Ka+Kb=KwK_a + K_b = K_w
  2. KaKb=KwK_a - K_b = K_w
  3. Ka×Kb=KwK_a \times K_b = K_w (correct answer)
  4. KaKb=Kw\frac{K_a}{K_b} = K_w
  5. Ka=Kb=KwK_a = K_b = \sqrt{K_w}
Explanation: When you encounter questions about conjugate acid-base pairs, you're dealing with the fundamental relationship between how easily an acid donates protons and how readily its conjugate base accepts them. This relationship is governed by the autoionization of water. The correct relationship is Ka×Kb=KwK_a \times K_b = K_w, which comes from the fact that when an acid and its conjugate base are both present in water, their equilibrium expressions must be consistent with water's autoionization. For any conjugate acid-base pair, if you multiply the acid dissociation constant by the base dissociation constant of its conjugate, you get the ion product of water (Kw=1.0×1014K_w = 1.0 \times 10^{-14} at 25°C). Option A (Ka+Kb=KwK_a + K_b = K_w) incorrectly suggests an additive relationship. This would imply that equilibrium constants combine linearly, which contradicts how equilibrium expressions work. Option B (KaKb=KwK_a - K_b = K_w) similarly assumes a linear relationship and would give negative values in many cases, which is impossible for equilibrium constants. Option D (KaKb=Kw\frac{K_a}{K_b} = K_w) represents a ratio relationship that has no theoretical basis in acid-base chemistry. Remember this key pattern: stronger acids have weaker conjugate bases, and this inverse relationship is mathematically expressed through multiplication, not addition or subtraction. The product Ka×KbK_a \times K_b always equals KwK_w for any conjugate pair, making this one of the most reliable equations in acid-base chemistry.

Question 7

Which of the following statements correctly explains why the pH of 0.1 M CH3COOHCH_3COOH is higher than the pH of 0.1 M HClHCl?

  1. Acetic acid has a lower molecular weight than hydrochloric acid, resulting in fewer acidic protons per gram of solution
  2. Acetic acid is a weak acid that only partially ionizes, while hydrochloric acid is a strong acid that completely ionizes in aqueous solution (correct answer)
  3. Acetic acid contains carbon and hydrogen bonds that are stronger than the hydrogen-chlorine bond in hydrochloric acid
  4. The acetate ion is a stronger base than the chloride ion, causing more neutralization of the acidic protons
  5. Acetic acid forms hydrogen bonds with water molecules, reducing the effective concentration of acidic protons in solution
Explanation: When comparing pH values of acids at the same concentration, you need to understand the fundamental difference between strong and weak acids and how completely they dissociate in water. pH is determined by the concentration of H+H^+ ions in solution. Strong acids like HClHCl completely ionize in water, meaning every molecule releases its proton: HClH++ClHCl \rightarrow H^+ + Cl^-. In contrast, weak acids like acetic acid (CH3COOHCH_3COOH) only partially ionize: CH3COOHH++CH3COOCH_3COOH \rightleftharpoons H^+ + CH_3COO^-. Since only a fraction of acetic acid molecules release protons, the H+H^+ concentration is much lower than the initial acid concentration, resulting in a higher pH than HClHCl at the same molarity. Option A incorrectly focuses on molecular weight, which doesn't affect ionization behavior. The number of acidic protons depends on molecular structure, not mass. Option C misunderstands bond strength—while CHC-H bonds are indeed stronger than HClH-Cl bonds, acetic acid's acidic proton comes from the carboxyl group (COOH-COOH), not the methyl group. Option D contains a grain of truth about acetate being a stronger base than chloride, but this describes the consequence of weak acid behavior, not the cause of the pH difference. Remember: when comparing acids at equal concentrations, strong acids always produce lower pH values than weak acids because they release more H+H^+ ions. Focus on the degree of ionization, not molecular properties or base strength of conjugates.

Question 8

Consider the following equilibria: H2CO3H++HCO3H_2CO_3 \rightleftharpoons H^+ + HCO_3^- (Ka1=4.3×107K_{a1} = 4.3 \times 10^{-7}) and HCO3H++CO32HCO_3^- \rightleftharpoons H^+ + CO_3^{2-} (Ka2=5.6×1011K_{a2} = 5.6 \times 10^{-11}). What is the KbK_b for the reaction CO32+H2OHCO3+OHCO_3^{2-} + H_2O \rightleftharpoons HCO_3^- + OH^-?

  1. 1.8 × 10⁻⁴ (correct answer)
  2. 2.3 × 10⁻⁴
  3. 1.8 × 10⁻⁵
  4. 5.6 × 10⁻¹¹
  5. 4.3 × 10⁻⁷
Explanation: When you encounter acid-base equilibria with multiple ionization steps, you need to understand the relationship between conjugate acid-base pairs. The carbonate system shows a diprotic acid (H2CO3H_2CO_3) with two successive ionizations, and you're asked to find the base constant for the conjugate base of the second ionization. The key insight is that CO32CO_3^{2-} is the conjugate base of HCO3HCO_3^-, so their relationship follows: Ka×Kb=KwK_a \times K_b = K_w. Since you want the KbK_b for CO32CO_3^{2-} accepting a proton to form HCO3HCO_3^-, you need to use the second acid constant: Kb=KwKa2=1.0×10145.6×1011=1.8×104K_b = \frac{K_w}{K_{a2}} = \frac{1.0 \times 10^{-14}}{5.6 \times 10^{-11}} = 1.8 \times 10^{-4}. Let's examine why the other answers are incorrect. Answer B (2.3 × 10⁻⁴) likely results from a calculation error or using an incorrect value for KwK_w. Answer C (1.8 × 10⁻⁵) suggests someone used Ka1K_{a1} instead of Ka2K_{a2}, which would give 1.0×10144.3×107=2.3×108\frac{1.0 \times 10^{-14}}{4.3 \times 10^{-7}} = 2.3 \times 10^{-8} (close to this magnitude). Answer D (5.6 × 10⁻¹¹) is simply Ka2K_{a2} itself, showing confusion between acid and base constants. Remember: for any conjugate acid-base pair, Ka×Kb=Kw=1.0×1014K_a \times K_b = K_w = 1.0 \times 10^{-14}. Always identify which ionization step corresponds to the conjugate pair you're analyzing—here, CO32/HCO3CO_3^{2-}/HCO_3^- corresponds to the second ionization.

Question 9

A student measures the pH of several 0.10 M solutions and obtains the following results: Solution A: pH = 1.0, Solution B: pH = 2.9, Solution C: pH = 11.1. Which statement correctly identifies these solutions?

  1. Solution A is HClHCl, Solution B is CH3COOHCH_3COOH, Solution C is NH3NH_3
  2. Solution A is H2SO4H_2SO_4, Solution B is HFHF, Solution C is NaOHNaOH
  3. Solution A is HNO3HNO_3, Solution B is HCOOHHCOOH, Solution C is Ca(OH)2Ca(OH)_2
  4. Solution A is HClO4HClO_4, Solution B is H3PO4H_3PO_4, Solution C is Ba(OH)2Ba(OH)_2
  5. Solution A is HBrHBr, Solution B is CH3COOHCH_3COOH, Solution C is KOHKOH (correct answer)
Explanation: When you encounter pH problems with specific numerical values, you need to connect the pH readings to the strength and concentration of acids and bases. Strong acids and bases dissociate completely, while weak ones only partially ionize. For a 0.10 M strong acid, you'd expect pH = -log(0.10) = 1.0, which matches Solution A. Strong acids like HClHCl, HNO3HNO_3, and HClO4HClO_4 would all give this result. For weak acids at 0.10 M, the pH would be higher (less acidic) than 1.0 because they don't fully dissociate - Solution B's pH of 2.9 indicates a weak acid. Strong bases like NaOHNaOH at 0.10 M would give pH = 13.0, but Solution C shows pH = 11.1, suggesting either a weak base or a strong base at lower effective concentration. Looking at the choices: Choice A incorrectly pairs HClHCl (strong acid, pH = 1.0) with the wrong solution and includes NH3NH_3 (weak base) which wouldn't reach pH 11.1 at 0.10 M. Choice B matches a strong acid with Solution A correctly but pairs NaOHNaOH (strong base, pH = 13.0) incorrectly with Solution C. Choice C has Ca(OH)2Ca(OH)_2, which provides two hydroxide ions per molecule, making 0.10 M Ca(OH)2Ca(OH)_2 effectively 0.20 M in OHOH^-, giving pH ≈ 13.3, not 11.1. Choice D incorrectly suggests H3PO4H_3PO_4 would have pH = 2.9, but phosphoric acid's first dissociation is stronger than that. The question appears to have an error since none of the provided options correctly match all three pH values with their corresponding 0.10 M solutions. Always double-check that calculated pH values match the acid/base strength and concentration given.

Question 10

Which of the following correctly ranks the relative strengths of the conjugate bases ClCl^-, CH3COOCH_3COO^-, and NH2NH_2^- from weakest to strongest?

  1. Cl<CH3COO<NH2Cl^- < CH_3COO^- < NH_2^- (correct answer)
  2. NH2<CH3COO<ClNH_2^- < CH_3COO^- < Cl^-
  3. CH3COO<Cl<NH2CH_3COO^- < Cl^- < NH_2^-
  4. Cl<NH2<CH3COOCl^- < NH_2^- < CH_3COO^-
  5. NH2<Cl<CH3COONH_2^- < Cl^- < CH_3COO^-
Explanation: When you encounter questions about conjugate base strength, remember that conjugate base strength is inversely related to the acid strength of their corresponding acids. The stronger the acid, the weaker its conjugate base. To rank these conjugate bases, you need to consider the acids they come from: ClCl^- comes from HCl (hydrochloric acid), CH3COOCH_3COO^- comes from CH3COOHCH_3COOH (acetic acid), and NH2NH_2^- comes from NH3NH_3 (ammonia). HCl is a strong acid that completely ionizes in water, making ClCl^- an extremely weak conjugate base with virtually no tendency to accept protons. Acetic acid is a weak acid (Ka1.8×105K_a \approx 1.8 \times 10^{-5}), so CH3COOCH_3COO^- is a moderately weak conjugate base. Ammonia is actually a weak base, not an acid, so NH2NH_2^- (the amide ion) is a very strong conjugate base. Answer A correctly ranks them from weakest to strongest: Cl<CH3COO<NH2Cl^- < CH_3COO^- < NH_2^-. Answer B reverses this order completely, suggesting NH2NH_2^- is the weakest when it's actually the strongest. Answer C places CH3COOCH_3COO^- as weakest, but acetate ion is stronger than chloride as a base. Answer D incorrectly suggests CH3COOCH_3COO^- is stronger than NH2NH_2^-, when the amide ion is far more basic. Remember this pattern: conjugate bases of strong acids (like HCl) are very weak, while conjugate bases of weak acids become progressively stronger as their parent acids become weaker.

Question 11

Which of the following best explains why HFHF is considered a weak acid despite the high electronegativity of fluorine?

  1. The H-F bond is too strong to break easily in aqueous solution, limiting the extent of ionization (correct answer)
  2. Fluorine is too small to stabilize the resulting FF^- ion effectively in aqueous solution
  3. The high electronegativity of fluorine makes the H-F bond too polar, preventing ionization
  4. Hydrogen fluoride forms extensive hydrogen bonding with water, reducing its tendency to ionize
  5. The small size of the fluorine atom creates steric hindrance that prevents effective solvation of the ions
Explanation: When you encounter questions about acid strength, remember that it's fundamentally about the ease of losing a proton (H+H^+) in solution. You might expect HFHF to be a strong acid because fluorine is the most electronegative element, but counterintuitively, it's actually a weak acid. The key lies in bond strength. While fluorine's high electronegativity does create a very polar H-F bond, it also creates an extremely strong bond. The H-F bond has a bond dissociation energy of about 570 kJ/mol, making it one of the strongest single bonds in chemistry. This bond is so strong that it resists breaking in aqueous solution, which limits the extent of ionization and makes HFHF a weak acid. This is why answer A is correct. Looking at the wrong answers: B incorrectly suggests fluorine is too small to stabilize FF^-, but small, highly electronegative ions are actually very stable in solution. C misunderstands polarity—high polarity would typically favor ionization, not prevent it. D mentions hydrogen bonding, which does occur between HFHF and water, but this actually facilitates dissolution rather than preventing ionization. The counterintuitive nature of this relationship is a key concept: bond polarity and bond strength are different properties. High electronegativity can create both polar bonds (favoring ionization) and strong bonds (opposing ionization). When these effects compete, bond strength often wins. Remember this principle when comparing acid strengths within families—sometimes the most electronegative element doesn't produce the strongest acid.

Question 12

A solution has [H+]=2.5×109[H^+] = 2.5 \times 10^{-9} M. What is the [OH][OH^-] in this solution at 25°C?

  1. 2.5 × 10⁻⁹ M
  2. 4.0 × 10⁻⁶ M (correct answer)
  3. 2.5 × 10⁻⁵ M
  4. 4.0 × 10⁻⁵ M
  5. 1.0 × 10⁻⁷ M
Explanation: When you encounter problems involving hydrogen and hydroxide ion concentrations, you're working with the fundamental relationship that governs all aqueous solutions at equilibrium. At 25°C, water maintains a constant equilibrium where Kw=[H+][OH]=1.0×1014K_w = [H^+][OH^-] = 1.0 \times 10^{-14}. To find the hydroxide concentration, you simply rearrange this equation: [OH]=Kw[H+]=1.0×10142.5×109[OH^-] = \frac{K_w}{[H^+]} = \frac{1.0 \times 10^{-14}}{2.5 \times 10^{-9}}. Dividing these values gives you 4.0×1064.0 \times 10^{-6} M, confirming that answer B is correct. Let's examine why the other options miss the mark. Answer A (2.5×1092.5 \times 10^{-9} M) incorrectly assumes that [H+][H^+] equals [OH][OH^-], which only occurs in pure water or neutral solutions where both equal 1.0×1071.0 \times 10^{-7} M. Answer C (2.5×1052.5 \times 10^{-5} M) appears to result from incorrectly multiplying the given [H+][H^+] by 10, perhaps from a calculation error. Answer D (4.0×1054.0 \times 10^{-5} M) gets the coefficient right (4.0) but places the decimal in the wrong position, likely from mishandling the exponent arithmetic during division. Remember this key strategy: whenever you're given one ion concentration, immediately think Kw=1.0×1014K_w = 1.0 \times 10^{-14} to find the other. This relationship is your most reliable tool for pH and pOH calculations, and the math will always check out when [H+]×[OH]=1014[H^+] \times [OH^-] = 10^{-14}.

Question 13

Which of the following 0.10 M aqueous solutions would have the highest pH?

  1. NaClNaCl (Kw=1.0×1014K_w = 1.0 \times 10^{-14})
  2. NH4ClNH_4Cl (KbK_b of NH3=1.8×105NH_3 = 1.8 \times 10^{-5})
  3. CH3COONaCH_3COONa (KaK_a of CH3COOH=1.8×105CH_3COOH = 1.8 \times 10^{-5}) (correct answer)
  4. NaHSO4NaHSO_4 (Ka2K_{a2} of H2SO4=1.2×102H_2SO_4 = 1.2 \times 10^{-2})
  5. AlCl3AlCl_3 (KaK_a of [Al(H2O)6]3+=1.4×105[Al(H_2O)_6]^{3+} = 1.4 \times 10^{-5})
Explanation: When you see a question asking about pH of salt solutions, you need to analyze how each salt affects the water equilibrium through hydrolysis reactions. The highest pH means the most basic solution, so you're looking for the salt that produces the most OHOH^- ions or removes the most H+H^+ ions from water. Choice C (CH3COONaCH_3COONa) is correct because it's the salt of a weak acid and strong base. The acetate ion (CH3COOCH_3COO^-) acts as a weak base, accepting protons from water: CH3COO+H2OCH3COOH+OHCH_3COO^- + H_2O \rightleftharpoons CH_3COOH + OH^-. This produces hydroxide ions, making the solution basic with the highest pH among the options. Choice A (NaClNaCl) is wrong because it's a salt of a strong acid and strong base, so it doesn't hydrolyze. The solution remains neutral with pH = 7. Choice B (NH4ClNH_4Cl) is wrong because it's a salt of a weak base and strong acid. The NH4+NH_4^+ ion acts as a weak acid, donating protons to water and producing H3O+H_3O^+, making the solution acidic (pH < 7). Choice D (NaHSO4NaHSO_4) is wrong because HSO4HSO_4^- is a relatively strong acid (note the large Ka2K_{a2} value). It will donate protons to water, creating an acidic solution with low pH. Study tip: Remember the salt hydrolysis pattern: salts from weak acids + strong bases are basic, salts from strong acids + weak bases are acidic, and salts from strong acid + strong base combinations are neutral.

Question 14

According to the Brønsted-Lowry definition, which of the following statements is correct about the reaction: NH3(aq)+H2O(l)NH4+(aq)+OH(aq)NH_3(aq) + H_2O(l) \rightleftharpoons NH_4^+(aq) + OH^-(aq)?

  1. NH3NH_3 is the acid because it accepts a proton from water, making it the conjugate acid of NH4+NH_4^+
  2. H2OH_2O is the base because it donates a proton to ammonia, forming its conjugate acid OHOH^-
  3. NH3NH_3 is the base because it accepts a proton from water, and NH4+NH_4^+ is its conjugate acid (correct answer)
  4. NH4+NH_4^+ is the acid because it has a positive charge, and OHOH^- is the base because it has a negative charge
  5. Both NH3NH_3 and H2OH_2O are acids because they both contain hydrogen atoms that can be donated
Explanation: When analyzing acid-base reactions, the Brønsted-Lowry definition focuses on proton (H+H^+) transfer: acids donate protons, bases accept protons. Looking at this equilibrium, you need to identify what's happening to the hydrogen atoms. In this reaction, water (H2OH_2O) loses a proton and becomes OHOH^-, while ammonia (NH3NH_3) gains that proton to become NH4+NH_4^+. Since NH3NH_3 accepts the proton, it's acting as the Brønsted-Lowry base. The NH4+NH_4^+ ion that forms is called the conjugate acid of NH3NH_3 because it's what remains after the base accepts a proton. Answer C correctly identifies NH3NH_3 as the base (proton acceptor) and NH4+NH_4^+ as its conjugate acid. Answer A incorrectly calls NH3NH_3 an acid and confuses the conjugate relationship—NH3NH_3 is the conjugate base of NH4+NH_4^+, not the other way around. Answer B misidentifies water's role, calling it a base when it's actually donating a proton (acting as an acid), and incorrectly labels OHOH^- as water's conjugate acid when OHOH^- is actually water's conjugate base. Answer D relies on charge alone to determine acid-base behavior, which is incorrect under Brønsted-Lowry theory—it's about proton transfer, not ionic charge. Remember: in Brønsted-Lowry problems, always track the protons. The species that gains H+H^+ is the base, and what it becomes is the conjugate acid.

Question 15

A student prepares a solution by mixing equal volumes of 0.20 M HClHCl and 0.20 M CH3COOHCH_3COOH (Ka=1.8×105K_a = 1.8 \times 10^{-5}). Which statement best describes the resulting solution?

  1. The pH is determined primarily by the strong acid HClHCl, and the weak acid CH3COOHCH_3COOH has negligible effect on the pH (correct answer)
  2. The pH is exactly halfway between the pH values of the individual acid solutions because equal volumes were mixed
  3. The pH is determined by both acids equally since they have the same initial concentration and volume
  4. The weak acid CH3COOHCH_3COOH is completely suppressed and behaves like a neutral salt in the presence of the strong acid
  5. The solution pH equals the average of the pKapK_a values of both acids
Explanation: When you encounter a mixture of strong and weak acids, remember that strong acids completely ionize while weak acids only partially dissociate. The key is determining which acid controls the solution's pH. In this mixture, you have equal concentrations and volumes of HClHCl (strong acid) and CH3COOHCH_3COOH (weak acid). Since HClHCl completely ionizes, it produces 0.10 M H+H^+ ions in the final solution (diluted from 0.20 M due to mixing equal volumes). Meanwhile, CH3COOHCH_3COOH with Ka=1.8×105K_a = 1.8 \times 10^{-5} would only contribute about 10310^{-3} M H+H^+ ions if it were alone. However, the high H+H^+ concentration from HClHCl suppresses the ionization of the weak acid through the common ion effect. The weak acid's contribution becomes negligible compared to the strong acid's complete dissociation. Choice A correctly identifies that HClHCl determines the pH while CH3COOHCH_3COOH has minimal impact. Choice B incorrectly assumes you can average pH values - pH is logarithmic, so this doesn't work mathematically. Choice C wrongly suggests equal contributions despite the vastly different ionization behaviors. Choice D mischaracterizes the weak acid as behaving like a salt - it's still an acid, just suppressed. Remember: in strong acid/weak acid mixtures, the strong acid almost always dominates the pH calculation. Focus on the complete ionization of the strong acid and consider the weak acid's contribution only if it's significant relative to the strong acid's H+H^+ production.

Question 16

A student measures the pH of a 0.0500 M solution of a monoprotic weak acid and finds it to be 3.18. What is the percent ionization of this acid?

  1. 1.3% (correct answer)
  2. 2.1%
  3. 2.8%
  4. 3.6%
  5. 4.2%
Explanation: When you encounter a weak acid pH problem, you're dealing with equilibrium chemistry and the relationship between concentration, ionization, and pH. The key insight is that percent ionization tells you what fraction of the original acid molecules actually donated their protons. Start with the pH to find the hydrogen ion concentration: [H+]=103.18=6.61×104 M[H^+] = 10^{-3.18} = 6.61 \times 10^{-4} \text{ M}. For a monoprotic weak acid, this equals the concentration of acid that ionized, since each molecule that ionizes produces one H+H^+ ion. Percent ionization is calculated as: concentration that ionizedinitial concentration×100%=6.61×1040.0500×100%=1.3%\frac{\text{concentration that ionized}}{\text{initial concentration}} \times 100\% = \frac{6.61 \times 10^{-4}}{0.0500} \times 100\% = 1.3\% This confirms answer A is correct. Looking at the wrong answers: B (2.1%) might result from calculation errors in converting pH to [H+][H^+]. C (2.8%) could come from incorrectly assuming the acid is diprotic and doubling the ionization, or from rounding errors. D (3.6%) might arise from confusing pH with percent ionization directly, since 3.6% is close to the pH value of 3.18. Remember this pattern: for weak acid problems, always convert pH to [H+][H^+] first, then use that concentration to find what you need. The percent ionization of weak acids is typically small (usually under 5%), so if you calculate a large percentage, double-check your work.

Question 17

A solution is prepared by dissolving 0.234 g of benzoic acid (C6H5COOHC_6H_5COOH, molar mass = 122.1 g/mol, Ka=6.3×105K_a = 6.3 \times 10^{-5}) in enough water to make 250.0 mL of solution. What is the pH of this solution?

  1. 2.48
  2. 2.61 (correct answer)
  3. 2.74
  4. 2.89
  5. 3.02
Explanation: This question tests your understanding of weak acid equilibrium and pH calculations. When you encounter a weak acid problem, you need to set up an ICE table and use the acid dissociation constant. First, calculate the molarity of benzoic acid: 0.234 g122.1 g/mol=1.916×103 mol\frac{0.234 \text{ g}}{122.1 \text{ g/mol}} = 1.916 \times 10^{-3} \text{ mol}. In 0.250 L, this gives [C6H5COOH]=7.664×103 M[C_6H_5COOH] = 7.664 \times 10^{-3} \text{ M}. For the equilibrium C6H5COOHH++C6H5COOC_6H_5COOH \rightleftharpoons H^+ + C_6H_5COO^-, set up an ICE table. Let x=[H+]x = [H^+] at equilibrium. The expression becomes: Ka=x27.664×103x=6.3×105K_a = \frac{x^2}{7.664 \times 10^{-3} - x} = 6.3 \times 10^{-5} Since KaK_a is relatively large and the concentration is low, you can't assume xx is negligible. Solving the quadratic equation: x2+6.3×105x4.828×107=0x^2 + 6.3 \times 10^{-5}x - 4.828 \times 10^{-7} = 0 Using the quadratic formula gives x=2.442×103 Mx = 2.442 \times 10^{-3} \text{ M}, so pH=log(2.442×103)=2.61pH = -\log(2.442 \times 10^{-3}) = 2.61. Answer B (2.61) is correct. Answer A (2.48) likely results from incorrectly assuming the acid is strong. Answer C (2.74) might come from making the small xx approximation when it's not valid here. Answer D (2.89) could result from calculation errors or using incorrect equilibrium expressions. Remember: for weak acids with moderate KaK_a values and low concentrations, always check if the 5% rule applies before making approximations. When in doubt, solve the full quadratic equation.

Question 18

A 0.100 M solution of HCNHCN (Ka=4.9×1010K_a = 4.9 \times 10^{-10}) is diluted to 0.0100 M. How does the percent ionization change?

  1. Decreases by a factor of 10.0 because the concentration decreased by a factor of 10
  2. Increases by a factor of 3.16 because dilution favors ionization of weak acids (correct answer)
  3. Remains exactly the same because KaK_a is independent of concentration
  4. Increases by a factor of 10.0 because the denominator in the percent calculation decreased
  5. Decreases by a factor of 3.16 because there are fewer HCN molecules to ionize
Explanation: When you encounter weak acid dilution problems, remember that percent ionization and concentration have an inverse relationship due to Le Châtelier's principle. For a weak acid like HCN, we can use the relationship: percent ionization = KaC×100%\sqrt{\frac{K_a}{C}} \times 100\%, where C is the concentration. When the concentration decreases by a factor of 10 (from 0.100 M to 0.0100 M), the ratio KaC\frac{K_a}{C} increases by a factor of 10. Since percent ionization involves the square root of this ratio, it increases by 10=3.16\sqrt{10} = 3.16. This happens because dilution shifts the equilibrium HCN+H2OH3O++CNHCN + H_2O \rightleftharpoons H_3O^+ + CN^- to the right, favoring ionization to maintain the constant KaK_a value. Choice A incorrectly assumes percent ionization decreases proportionally with concentration - this would only be true if the degree of ionization stayed constant, which it doesn't for weak acids. Choice C falls into the trap of confusing KaK_a (which is indeed constant) with percent ionization (which changes with concentration). Choice D suggests the wrong proportionality factor - while the denominator does decrease by 10, the percent ionization calculation involves equilibrium concentrations that don't change by the same factor. Study tip: For weak acid dilution problems, remember the key relationship: as you dilute a weak acid, it becomes a larger percentage ionized. The square root relationship (factor of 3.16 for 10-fold dilution) appears frequently on chemistry exams.

Question 19

Which of the following represents the correct Lewis structure and explanation for the Lewis acid-base reaction between BF3BF_3 and NH3NH_3?

  1. BF3BF_3 acts as a Lewis base because it has empty p orbitals that can accept electron pairs from the nitrogen lone pair in NH3NH_3
  2. NH3NH_3 acts as a Lewis acid because it has a lone pair of electrons that it donates to the empty orbital on boron in BF3BF_3
  3. BF3BF_3 acts as a Lewis acid because it has an incomplete octet and can accept the lone pair of electrons from nitrogen in NH3NH_3 (correct answer)
  4. Both molecules act as Lewis bases because they both have available electron pairs for bonding in the resulting adduct
  5. NH3NH_3 acts as a Lewis base because it accepts electron pairs from BF3BF_3 to form a coordinate covalent bond
Explanation: Lewis acid-base reactions involve the donation and acceptance of electron pairs, not protons. When you encounter these problems, focus on identifying which molecule can donate electrons (Lewis base) and which can accept them (Lewis acid). In the reaction between BF3BF_3 and NH3NH_3, you need to examine the electron configurations. Boron in BF3BF_3 has only six electrons around it after forming three bonds with fluorine atoms, leaving it with an incomplete octet and an empty p orbital. Nitrogen in NH3NH_3 has a lone pair of electrons after forming three bonds with hydrogen atoms. The nitrogen's lone pair can be donated to boron's empty orbital, forming a coordinate covalent bond. This makes BF3BF_3 the Lewis acid (electron acceptor) and NH3NH_3 the Lewis base (electron donor). Option A incorrectly identifies BF3BF_3 as a Lewis base, when it's actually the electron acceptor. While it correctly mentions the empty p orbitals, it reverses the roles. Option B has the right idea about electron donation but incorrectly labels NH3NH_3 as the Lewis acid instead of the Lewis base. Option D is wrong because both molecules cannot be Lewis bases in the same reaction - there must be one electron donor and one electron acceptor. Remember: Lewis acids accept electron pairs (often incomplete octets or positive charges), while Lewis bases donate electron pairs (lone pairs or negative charges). Always identify the electron-deficient species as your likely Lewis acid.