Calculus 2 Quiz: Ratio Test
20 questions · exam conditions
0:00
Ratio TestQuestion 1 of 20

A series n=1an\sum_{n=1}^\infty a_n has the property that an+1an=11n+1\frac{a_{n+1}}{a_n} = 1 - \frac{1}{n+1} for all n1n \ge 1. What is the conclusion from the Ratio Test?

The series converges conditionally.
The series converges absolutely.
The series diverges.
The test is inconclusive.
← Back to quizzes

Calculus 2 Quiz

Calculus 2 Quiz: Ratio Test

Practice Ratio Test in Calculus 2 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Ratio Test, giving you a quick way to practice the rules, question types, and explanations that matter most for Calculus 2.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A series n=1an\sum_{n=1}^\infty a_n has the property that an+1an=11n+1\frac{a_{n+1}}{a_n} = 1 - \frac{1}{n+1} for all n1n \ge 1. What is the conclusion from the Ratio Test?

  1. The series converges conditionally.
  2. The series converges absolutely.
  3. The series diverges.
  4. The test is inconclusive. (correct answer)
Explanation: When you encounter a series with a given ratio between consecutive terms, the Ratio Test is your go-to tool for determining convergence. The Ratio Test examines limnan+1an\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| and concludes: if this limit is less than 1, the series converges absolutely; if greater than 1, it diverges; if equal to 1, the test is inconclusive. Here, you're given an+1an=11n+1\frac{a_{n+1}}{a_n} = 1 - \frac{1}{n+1}. To apply the Ratio Test, you need to find the limit as nn \to \infty: limn11n+1=limnn+11n+1=limnnn+1=1\lim_{n \to \infty} \left|1 - \frac{1}{n+1}\right| = \lim_{n \to \infty} \left|\frac{n+1-1}{n+1}\right| = \lim_{n \to \infty} \left|\frac{n}{n+1}\right| = 1 Since the limit equals 1, the Ratio Test is inconclusive, making D correct. Option A suggests conditional convergence, but the Ratio Test cannot determine this—it only tests absolute convergence or divergence. Option B claims absolute convergence, which would require the limit to be less than 1, not equal to 1. Option C claims divergence, which would need the limit to exceed 1. All three options (A, B, C) incorrectly assume the test provides a definitive conclusion when the limit is 1. Remember: when the Ratio Test limit equals 1, you've hit the "borderline case" where the test fails. You'd need a different convergence test (like the Integral Test or Comparison Test) to determine the series' actual behavior.

Question 2

The Ratio Test is applied to the series n=1nk2n\sum_{n=1}^\infty \frac{n^k}{2^n} for a fixed real constant kk. What is the value of L=limnan+1/anL = \lim_{n \to \infty} |a_{n+1}/a_n|?

  1. 00
  2. k/2k/2
  3. 1/21/2 (correct answer)
  4. 11
Explanation: When you encounter a Ratio Test problem, you're examining the behavior of consecutive terms in a series to determine convergence. The Ratio Test finds L=limnan+1anL = \lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right|, and if L<1L < 1, the series converges. For the series n=1nk2n\sum_{n=1}^\infty \frac{n^k}{2^n}, we have an=nk2na_n = \frac{n^k}{2^n}. Let's calculate the ratio: an+1an=(n+1)k2n+1nk2n=(n+1)k2n+12nnk=(n+1)knk2n2n+1=(n+1n)k12\frac{a_{n+1}}{a_n} = \frac{\frac{(n+1)^k}{2^{n+1}}}{\frac{n^k}{2^n}} = \frac{(n+1)^k}{2^{n+1}} \cdot \frac{2^n}{n^k} = \frac{(n+1)^k}{n^k} \cdot \frac{2^n}{2^{n+1}} = \left(\frac{n+1}{n}\right)^k \cdot \frac{1}{2} As nn \to \infty, we know that n+1n=1+1n1\frac{n+1}{n} = 1 + \frac{1}{n} \to 1. Therefore, (n+1n)k1k=1\left(\frac{n+1}{n}\right)^k \to 1^k = 1 regardless of the value of kk. This gives us L=112=12L = 1 \cdot \frac{1}{2} = \frac{1}{2}, confirming answer (C). Looking at the wrong answers: (A) 00 would suggest the exponential dominates completely, ignoring the polynomial factor's contribution to the ratio. (B) k/2k/2 incorrectly assumes the exponent kk affects the limiting ratio, but polynomial growth rates don't impact the exponential's dominance. (D) 11 forgets about the factor of 12\frac{1}{2} that comes from the exponential terms. Key insight: In ratio tests involving exponentials and polynomials, the exponential base determines the limit—polynomial powers wash out in the ratio calculation.

Question 3

For what values of the positive constant cc does the series n=1(cn)nn!\sum_{n=1}^\infty \frac{(cn)^n}{n!} converge, according to the Ratio Test?

  1. For all c>0c > 0.
  2. 0<c<10 < c < 1
  3. c>ec > e
  4. 0<c<1/e0 < c < 1/e (correct answer)
Explanation: When you encounter a series with factorials in the denominator and exponential-like terms in the numerator, the Ratio Test is typically your best tool for determining convergence. For the series n=1(cn)nn!\sum_{n=1}^\infty \frac{(cn)^n}{n!}, apply the Ratio Test by computing limnan+1an\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right|. Here, an=(cn)nn!a_n = \frac{(cn)^n}{n!}, so: an+1an=(c(n+1))n+1(n+1)!n!(cn)n=cn+1(n+1)n+1(n+1)n!n!cnnn=c(n+1)nnn=c(1+1n)n\frac{a_{n+1}}{a_n} = \frac{(c(n+1))^{n+1}}{(n+1)!} \cdot \frac{n!}{(cn)^n} = \frac{c^{n+1}(n+1)^{n+1}}{(n+1) \cdot n!} \cdot \frac{n!}{c^n n^n} = c \cdot \frac{(n+1)^n}{n^n} = c\left(1 + \frac{1}{n}\right)^n As nn \to \infty, we know that (1+1n)ne\left(1 + \frac{1}{n}\right)^n \to e. Therefore, limnan+1an=ce\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| = ce. The Ratio Test tells us the series converges when this limit is less than 1, so we need ce<1ce < 1, which gives us c<1ec < \frac{1}{e}. Since we're told cc is positive, the answer is 0<c<1e0 < c < \frac{1}{e}. Choice A is wrong because large values of cc make the ratio exceed 1. Choice B uses the wrong threshold—it should be 1e0.368\frac{1}{e} \approx 0.368, not 1. Choice C completely reverses the inequality direction. Study tip: When applying the Ratio Test to series with factorials, watch for the limit (1+1n)ne\left(1 + \frac{1}{n}\right)^n \to e—it appears frequently and is key to finding the correct convergence threshold.

Question 4

The series n=1x3n8nn\sum_{n=1}^\infty \frac{x^{3n}}{8^n \sqrt{n}} is analyzed for convergence. According to the Ratio Test, for which values of xx does the series converge absolutely?

  1. x<8|x| < 8
  2. x3<1|x|^3 < 1
  3. x<2|x| < 2 (correct answer)
  4. x<8/3|x| < 8/3
Explanation: When analyzing power series for convergence, the Ratio Test helps you find the radius of convergence by examining the behavior of consecutive terms. For a series an\sum a_n, you calculate limnan+1an\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| and the series converges absolutely when this limit is less than 1. For the series n=1x3n8nn\sum_{n=1}^\infty \frac{x^{3n}}{8^n \sqrt{n}}, let an=x3n8nna_n = \frac{x^{3n}}{8^n \sqrt{n}}. Then: an+1=x3(n+1)8n+1n+1=x3n+38n+1n+1a_{n+1} = \frac{x^{3(n+1)}}{8^{n+1} \sqrt{n+1}} = \frac{x^{3n+3}}{8^{n+1} \sqrt{n+1}} Computing the ratio: an+1an=x3n+38n+1n+18nnx3n=x38nn+1\left|\frac{a_{n+1}}{a_n}\right| = \left|\frac{x^{3n+3}}{8^{n+1} \sqrt{n+1}} \cdot \frac{8^n \sqrt{n}}{x^{3n}}\right| = \left|\frac{x^3}{8}\right| \sqrt{\frac{n}{n+1}} As nn \to \infty, nn+11\sqrt{\frac{n}{n+1}} \to 1, so: limnan+1an=x38\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| = \frac{|x|^3}{8} For absolute convergence, we need x38<1\frac{|x|^3}{8} < 1, which gives us x3<8|x|^3 < 8, so x<2|x| < 2. Option A (x<8|x| < 8) is too large—this comes from incorrectly treating the exponent as 1 instead of 3. Option B (x3<1|x|^3 < 1) stops at an intermediate step without taking the cube root. Option D (x<8/3|x| < 8/3) appears to mix up the algebra somewhere in the calculation. Remember: when applying the Ratio Test to power series with terms like xknx^{kn}, the final condition involves xk|x|^k, so don't forget to take the appropriate root to solve for x|x|.

Question 5

A common error in testing a series an\sum a_n is to calculate limnan\lim_{n \to \infty} a_n and use it as the result of the Ratio Test. Consider the series n=1nn2+1\sum_{n=1}^\infty \frac{n}{n^2+1}. Which statement below is true?

  1. The Ratio Test shows divergence, but the common error would incorrectly suggest convergence.
  2. The Ratio Test shows convergence, and the common error also suggests convergence.
  3. The Ratio Test is inconclusive, but the common error would incorrectly suggest convergence. (correct answer)
  4. The Ratio Test is inconclusive, and the common error would incorrectly suggest divergence.
Explanation: When you encounter series convergence problems, it's crucial to distinguish between different tests and apply them correctly. The Ratio Test examines limnan+1an\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right|, while the common error mentioned simply looks at limnan\lim_{n \to \infty} a_n. For the series n=1nn2+1\sum_{n=1}^\infty \frac{n}{n^2+1}, let's apply the Ratio Test properly. We have an=nn2+1a_n = \frac{n}{n^2+1}, so: an+1an=n+1(n+1)2+1nn2+1=(n+1)(n2+1)n((n+1)2+1)\frac{a_{n+1}}{a_n} = \frac{\frac{n+1}{(n+1)^2+1}}{\frac{n}{n^2+1}} = \frac{(n+1)(n^2+1)}{n((n+1)^2+1)} After algebraic simplification, this ratio approaches 1 as nn \to \infty, making the Ratio Test inconclusive. The "common error" refers to using limnan\lim_{n \to \infty} a_n instead. Here, limnnn2+1=limn1/n1+1/n2=0\lim_{n \to \infty} \frac{n}{n^2+1} = \lim_{n \to \infty} \frac{1/n}{1+1/n^2} = 0. Someone making this error might think the series converges because the limit is zero. Looking at the answer choices: Choice C correctly identifies that the Ratio Test is inconclusive and the common error suggests convergence. Choice A is wrong because the Ratio Test doesn't show divergence. Choice B is wrong because the Ratio Test doesn't show convergence. Choice D is wrong because the common error (getting limit = 0) would suggest convergence, not divergence. Study tip: Always remember that the Ratio Test uses the ratio of consecutive terms, not the limit of the terms themselves. When the ratio limit equals 1, try other tests like the Limit Comparison Test.

Question 6

A student applies the Ratio Test to n=1(2x1)nn2\sum_{n=1}^\infty \frac{(2x-1)^n}{n^2} and correctly sets up the condition for convergence as 2x1limnn2(n+1)2<1|2x-1| \lim_{n \to \infty} \frac{n^2}{(n+1)^2} < 1. After correctly evaluating the limit, the student deduces the condition 2x1<1|2x-1| < 1. What is the correct interval that follows from this inequality, without considering the endpoints?

  1. (1,1)(-1, 1)
  2. (0,1)(0, 1) (correct answer)
  3. (1/2,1/2)(-1/2, 1/2)
  4. (2,2)(-2, 2)
Explanation: When you encounter power series and the Ratio Test, you're typically finding where the series converges by analyzing the behavior of consecutive terms. The student has correctly applied the Ratio Test and found that convergence requires 2x1<1|2x-1| < 1. To solve this absolute value inequality, you need to recognize that 2x1<1|2x-1| < 1 is equivalent to 1<2x1<1-1 < 2x-1 < 1. Adding 1 to all parts gives 0<2x<20 < 2x < 2, and dividing by 2 yields 0<x<10 < x < 1, which is the interval (0,1)(0, 1). Looking at the wrong answers: Choice A gives (1,1)(-1, 1), which would result from incorrectly solving x<1|x| < 1 instead of 2x1<1|2x-1| < 1. This represents forgetting about the linear transformation inside the absolute value. Choice C gives (1/2,1/2)(-1/2, 1/2), which you'd get if you mistakenly wrote x1/2<1/2|x - 1/2| < 1/2 instead of properly handling the original inequality. Choice D gives (2,2)(-2, 2), which comes from solving x<2|x| < 2, again ignoring the 2x12x-1 expression entirely. The correct answer is B: (0,1)(0, 1). Study tip: When solving absolute value inequalities like ax+b<c|ax + b| < c, always work with the compound inequality c<ax+b<c-c < ax + b < c and solve step by step. Don't try to "factor out" or simplify the expression inside the absolute value bars first—this leads to common errors.

Question 7

Let n=1an\sum_{n=1}^{\infty} a_n be a series of positive terms. Suppose the limit L=limnan+1anL = \lim_{n \to \infty} \frac{a_{n+1}}{a_n} exists. Which of the following conditions on LL is sufficient to conclude that limnan=0\lim_{n \to \infty} a_n = 0?

  1. L<1L < 1 (correct answer)
  2. L1L \le 1
  3. L=1L = 1
  4. L>1L > 1
Explanation: If L<1L < 1, the Ratio Test implies that the series an\sum a_n converges absolutely. A necessary condition for any series to converge is that its terms must approach zero. Therefore, if the series converges, we must have limnan=0\lim_{n \to \infty} a_n = 0. The condition L1L \le 1 is not sufficient because if L=1L=1, the series might diverge in a way that its terms still go to zero (e.g., 1/n\sum 1/n) or diverge because its terms do not go to zero (e.g., (n+1)/n\sum (n+1)/n). If L>1L > 1, the terms do not approach zero, so liman0\lim a_n \neq 0.

Question 8

When applying the Ratio Test to a series an\sum a_n, the limit is calculated as L=limnan+1an=1kL = \lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = \frac{1}{k}, where kk is a positive constant from the series definition. Which condition on kk guarantees divergence of the series based on this test?

  1. 0<k<10 < k < 1 (correct answer)
  2. k>1k > 1
  3. k=1k = 1
  4. k>0k > 0
Explanation: The Ratio Test states that a series diverges if the limit LL is greater than 1. Given L=1/kL = 1/k, the condition for divergence is 1/k>11/k > 1. Since kk is a positive constant, we can multiply both sides by kk without changing the inequality direction, which gives 1>k1 > k. Combining this with the given condition that kk is positive, the range for kk that guarantees divergence is 0<k<10 < k < 1.

Question 9

Two series are given: SA=n=1n!100nS_A = \sum_{n=1}^\infty \frac{n!}{100^n} and SB=n=1100n(2n)!S_B = \sum_{n=1}^\infty \frac{100^n}{(2n)!}. Which of the following correctly describes the conclusions of the Ratio Test for these series?

  1. Both series diverge.
  2. Both series converge.
  3. SAS_A diverges and SBS_B converges. (correct answer)
  4. SAS_A converges and SBS_B diverges.
Explanation: When you encounter series with factorials or exponentials, the Ratio Test is typically your most powerful tool. It's designed to handle the rapid growth rates of these expressions by examining how consecutive terms relate to each other. For SA=n=1n!100nS_A = \sum_{n=1}^\infty \frac{n!}{100^n}, applying the Ratio Test gives us limnan+1an=limn(n+1)!100n+1100nn!=limnn+1100=\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| = \lim_{n \to \infty} \frac{(n+1)!}{100^{n+1}} \cdot \frac{100^n}{n!} = \lim_{n \to \infty} \frac{n+1}{100} = \infty. Since this limit exceeds 1, the series diverges. The factorial in the numerator grows much faster than the exponential in the denominator. For SB=n=1100n(2n)!S_B = \sum_{n=1}^\infty \frac{100^n}{(2n)!}, we get limnan+1an=limn100n+1(2n+2)!(2n)!100n=limn100(2n+1)(2n+2)=0\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| = \lim_{n \to \infty} \frac{100^{n+1}}{(2n+2)!} \cdot \frac{(2n)!}{100^n} = \lim_{n \to \infty} \frac{100}{(2n+1)(2n+2)} = 0. Since this limit is less than 1, the series converges. Here, the factorial in the denominator dominates the exponential in the numerator. Therefore, SAS_A diverges and SBS_B converges, making C correct. Choice A incorrectly claims both diverge, ignoring how rapidly (2n)!(2n)! grows. Choice B incorrectly claims both converge, missing that n!n! eventually outpaces 100n100^n. Choice D reverses the conclusions entirely. Remember: factorials grow faster than exponentials, but placement matters—factorials in numerators promote divergence, while factorials in denominators promote convergence.

Question 10

Let an\sum a_n and bn\sum b_n be two series with positive terms. If limnan+1an=0.5\lim_{n \to \infty} \frac{a_{n+1}}{a_n} = 0.5 and limnbn+1bn=1.5\lim_{n \to \infty} \frac{b_{n+1}}{b_n} = 1.5, what can be concluded about the series cn=(an+bn)\sum c_n = \sum (a_n + b_n) by applying the Ratio Test?

  1. The test is inconclusive because properties of limits cannot be applied to the ratio.
  2. The limit of the ratio for cn\sum c_n is 2.0, so the series diverges.
  3. The limit of the ratio for cn\sum c_n is 1.5, so the series diverges. (correct answer)
  4. The limit of the ratio for cn\sum c_n is 1.0, so the test is inconclusive.
Explanation: When you encounter a question about the Ratio Test applied to a sum of series, you need to understand how limits behave when series are combined. The Ratio Test examines limncn+1cn\lim_{n \to \infty} \frac{c_{n+1}}{c_n} where cn=an+bnc_n = a_n + b_n. To find this limit, we need to analyze cn+1cn=an+1+bn+1an+bn\frac{c_{n+1}}{c_n} = \frac{a_{n+1} + b_{n+1}}{a_n + b_n}. As nn \to \infty, we can determine which term dominates. Since limnan+1an=0.5<1\lim_{n \to \infty} \frac{a_{n+1}}{a_n} = 0.5 < 1, the terms ana_n decrease exponentially fast. Meanwhile, limnbn+1bn=1.5>1\lim_{n \to \infty} \frac{b_{n+1}}{b_n} = 1.5 > 1 means bnb_n grows exponentially. For large nn, the bnb_n terms completely dominate both the numerator and denominator, so an+1+bn+1an+bnbn+1bn\frac{a_{n+1} + b_{n+1}}{a_n + b_n} \approx \frac{b_{n+1}}{b_n}. Therefore, limncn+1cn=1.5\lim_{n \to \infty} \frac{c_{n+1}}{c_n} = 1.5. Since this limit exceeds 1, the Ratio Test tells us cn\sum c_n diverges, making C correct. A is wrong because limit properties do apply here through dominance analysis. B incorrectly adds the two ratios (0.5 + 1.5 = 2.0), but ratios don't add this way. D incorrectly averages the ratios to get 1.0, which is mathematically invalid. Study tip: When applying the Ratio Test to sums of series, identify which series dominates by comparing their ratio limits to 1. The faster-growing series determines the behavior of the combined series.

Question 11

The Ratio Test is applied to a power series n=0cn(xa)n\sum_{n=0}^\infty c_n (x-a)^n, and it is found that limncn+1cn=K\lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right| = K, where KK is a finite positive number. What is the radius of convergence, RR?

  1. R=KR = K
  2. R=1/KR = 1/K (correct answer)
  3. R=1R = 1
  4. R=R = \infty
Explanation: When you encounter a power series with the Ratio Test, you're finding the radius of convergence by determining where the series converges absolutely. The key insight is understanding how the Ratio Test connects to the radius formula. For a power series n=0cn(xa)n\sum_{n=0}^\infty c_n (x-a)^n, when you apply the Ratio Test, you examine limncn+1(xa)n+1cn(xa)n=xalimncn+1cn\lim_{n \to \infty} \left| \frac{c_{n+1}(x-a)^{n+1}}{c_n(x-a)^n} \right| = |x-a| \lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right|. This simplifies to xaK|x-a| \cdot K, where KK is your given limit. The Ratio Test tells us the series converges when this expression is less than 1: xaK<1|x-a| \cdot K < 1, which means xa<1K|x-a| < \frac{1}{K}. Since the radius of convergence RR is the distance from the center aa where convergence occurs, we have R=1KR = \frac{1}{K}. This makes choice B correct. Choice A (R=KR = K) confuses the coefficient limit with the radius directly. Choice C (R=1R = 1) might seem tempting since the Ratio Test uses 1 as the convergence threshold, but this ignores the coefficient behavior entirely. Choice D (R=R = \infty) would only occur if K=0K = 0, but the problem states KK is a finite positive number. Remember this inverse relationship: when the ratio of consecutive coefficients is large, the radius of convergence is small, and vice versa. The formula R=1limncn+1cnR = \frac{1}{\lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right|} is fundamental for power series analysis.

Question 12

Consider the series n=1(n!)k(kn)!\sum_{n=1}^\infty \frac{(n!)^k}{(kn)!} where kk is a positive integer greater than 1. When applying the Ratio Test, the limit L=limnan+1/anL = \lim_{n\to\infty} |a_{n+1}/a_n| is found. What is the value of L?

  1. L=1/k!L = 1/k!
  2. L=1/kkL = 1/k^k (correct answer)
  3. L=0L = 0
  4. L=L = \infty
Explanation: When you encounter a series with factorials, the Ratio Test is often your best tool because factorials have predictable cancellation patterns that make the limit calculations manageable. To find L=limnan+1anL = \lim_{n\to\infty} \left|\frac{a_{n+1}}{a_n}\right|, you need to compute the ratio of consecutive terms. Here, an=(n!)k(kn)!a_n = \frac{(n!)^k}{(kn)!}, so: an+1an=((n+1)!)k(k(n+1))!(kn)!(n!)k=((n+1)!)k(kn)!(n!)k(k(n+1))!\frac{a_{n+1}}{a_n} = \frac{((n+1)!)^k}{(k(n+1))!} \cdot \frac{(kn)!}{(n!)^k} = \frac{((n+1)!)^k \cdot (kn)!}{(n!)^k \cdot (k(n+1))!} Since (n+1)!=(n+1)n!(n+1)! = (n+1) \cdot n!, the numerator becomes ((n+1)n!)k(kn)!=(n+1)k(n!)k(kn)!((n+1) \cdot n!)^k \cdot (kn)! = (n+1)^k \cdot (n!)^k \cdot (kn)!. For the denominator, (k(n+1))!=(kn+k)!=(kn+k)(kn+k1)(kn+1)(kn)!(k(n+1))! = (kn+k)! = (kn+k)(kn+k-1)\cdots(kn+1) \cdot (kn)!. After canceling (n!)k(n!)^k and (kn)!(kn)!, you get: an+1an=(n+1)k(kn+k)(kn+k1)(kn+1)\frac{a_{n+1}}{a_n} = \frac{(n+1)^k}{(kn+k)(kn+k-1)\cdots(kn+1)} As nn \to \infty, each factor in the denominator behaves like knkn, giving you kk factors, so the denominator is approximately (kn)k(kn)^k. The ratio becomes (n+1)k(kn)k=1kk\frac{(n+1)^k}{(kn)^k} = \frac{1}{k^k}. Choice A (1/k!1/k!) confuses factorial with exponential growth rates. Choice C (00) would indicate faster factorial decay than actually occurs. Choice D (\infty) would suggest divergence, but the factorial in the denominator grows much faster than the numerator. Strategy tip: For factorial ratios, always look for telescoping patterns and remember that (an)!(an)! grows much faster than (n!)a(n!)^a for any constant aa.

Question 13

The Ratio Test is applied to the series n=1(x3)2nn4n\sum_{n=1}^{\infty} \frac{(x-3)^{2n}}{n \cdot 4^n}. Which of the following conditions on xx guarantees absolute convergence based on the result of the test?

  1. x3<2|x-3| < 2 (correct answer)
  2. x3<4|x-3| < 4
  3. x3<1|x-3| < 1
  4. x32<1/4|x-3|^2 < 1/4
Explanation: To apply the Ratio Test, we compute the limit L=limnan+1anL = \lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right|. Here, an=(x3)2nn4na_n = \frac{(x-3)^{2n}}{n \cdot 4^n}. The ratio is (x3)2(n+1)(n+1)4n+1n4n(x3)2n=(x3)24nn+1\left| \frac{(x-3)^{2(n+1)}}{(n+1)4^{n+1}} \cdot \frac{n 4^n}{(x-3)^{2n}} \right| = \left| \frac{(x-3)^2}{4} \cdot \frac{n}{n+1} \right|. As nn \to \infty, the limit is L=x324L = \frac{|x-3|^2}{4}. For absolute convergence, we need L<1L < 1, which means x324<1\frac{|x-3|^2}{4} < 1, or x32<4|x-3|^2 < 4. Taking the square root of both sides gives x3<2|x-3| < 2.

Question 14

Consider the series n=12nsin(nπ/3)n3n\sum_{n=1}^{\infty} \frac{2^n \sin(n\pi/3)}{n \cdot 3^n}. A student claims the ratio test shows divergence because limnan+1an=23>12\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = \frac{2}{3} > \frac{1}{2}. What is wrong with this reasoning?

  1. The student computed sin((n+1)π/3)/sin(nπ/3)\sin((n+1)\pi/3) / \sin(n\pi/3) incorrectly in the ratio calculation
  2. The student compared the limit to 12\frac{1}{2} instead of 11 for the ratio test criterion (correct answer)
  3. The student ignored that the sine function makes some terms zero, invalidating the ratio test
  4. The student should have used absolute convergence testing before applying the ratio test
Explanation: The ratio test states that if limnan+1an=L\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = L, then: the series converges if L<1L < 1, diverges if L>1L > 1, and is inconclusive if L=1L = 1. The student incorrectly used 12\frac{1}{2} as the comparison threshold instead of 11. Since 23<1\frac{2}{3} < 1, the ratio test actually indicates convergence, not divergence. Choice A addresses a calculation detail that doesn't affect the main error. Choice C is incorrect since sin(nπ/3)\sin(n\pi/3) is never zero for positive integers nn. Choice D is irrelevant to the stated error.

Question 15

The series n=1(2)nn23n\sum_{n=1}^{\infty} \frac{(-2)^n}{n^2 \cdot 3^n} is being analyzed. If we apply the ratio test to an\sum |a_n|, what limit do we obtain, and what does this tell us about the original series?

  1. The limit is 23\frac{2}{3}, so the original series converges conditionally but not absolutely
  2. The limit is 23\frac{2}{3}, so the original series converges absolutely and therefore converges (correct answer)
  3. The limit is 22, so we must use the alternating series test instead
  4. The limit is 49\frac{4}{9}, so the original series converges absolutely and therefore converges
Explanation: When you encounter a series with both positive and negative terms, you need to distinguish between absolute convergence and conditional convergence. The ratio test applied to an\sum |a_n| determines absolute convergence. For this series, an=(2)nn23na_n = \frac{(-2)^n}{n^2 \cdot 3^n}, so an=2nn23n|a_n| = \frac{2^n}{n^2 \cdot 3^n}. Applying the ratio test: limnan+1an=limn2n+1(n+1)23n+1n23n2n\lim_{n \to \infty} \left|\frac{a_{n+1}}{a_n}\right| = \lim_{n \to \infty} \frac{2^{n+1}}{(n+1)^2 \cdot 3^{n+1}} \cdot \frac{n^2 \cdot 3^n}{2^n} =limn2n23(n+1)2=23limnn2(n+1)2=231=23= \lim_{n \to \infty} \frac{2 \cdot n^2}{3 \cdot (n+1)^2} = \frac{2}{3} \lim_{n \to \infty} \frac{n^2}{(n+1)^2} = \frac{2}{3} \cdot 1 = \frac{2}{3} Since 23<1\frac{2}{3} < 1, the series an\sum |a_n| converges, meaning the original series converges absolutely. Absolute convergence is stronger than regular convergence—if a series converges absolutely, it automatically converges. Choice A incorrectly suggests conditional convergence, but since an\sum |a_n| converges, we have absolute convergence, not just conditional. Choice C gets the wrong limit value and misses that the ratio test already gives us our answer. Choice D calculates an incorrect limit of 49\frac{4}{9}—this likely comes from incorrectly handling the alternating signs or making an algebraic error in the ratio calculation. Remember: when the ratio test on an\sum |a_n| gives a limit less than 1, you immediately know the original series converges absolutely, which is the strongest form of convergence.

Question 16

A series has the property that limnan+1an=L\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = L where 0<L<10 < L < 1. If we form a new series n=1cn\sum_{n=1}^{\infty} c_n where cn=a2nc_n = a_{2n} (taking only even-indexed terms), what can we conclude about the convergence of cn\sum c_n?

  1. The ratio test is inconclusive for cn\sum c_n since we changed the indexing structure
  2. cn\sum c_n converges, and the ratio test gives limncn+1cn=L\lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right| = L
  3. cn\sum c_n may diverge because we removed half the terms from a convergent series
  4. cn\sum c_n converges, and the ratio test gives limncn+1cn=L2\lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right| = L^2 (correct answer)
Explanation: When you encounter problems involving subsequences and convergence tests, the key insight is understanding how ratio limits behave when you extract every other term from a sequence. Since the original series has limnan+1an=L<1\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = L < 1, the ratio test tells us an\sum a_n converges. For the new series cn\sum c_n where cn=a2nc_n = a_{2n}, we need to find limncn+1cn\lim_{n \to \infty} \left| \frac{c_{n+1}}{c_n} \right|. This becomes limna2(n+1)a2n=limna2n+2a2n\lim_{n \to \infty} \left| \frac{a_{2(n+1)}}{a_{2n}} \right| = \lim_{n \to \infty} \left| \frac{a_{2n+2}}{a_{2n}} \right|. We can rewrite this as: limna2n+2a2n+1a2n+1a2n=limna2n+2a2n+1limna2n+1a2n\lim_{n \to \infty} \left| \frac{a_{2n+2}}{a_{2n+1}} \cdot \frac{a_{2n+1}}{a_{2n}} \right| = \lim_{n \to \infty} \left| \frac{a_{2n+2}}{a_{2n+1}} \right| \cdot \lim_{n \to \infty} \left| \frac{a_{2n+1}}{a_{2n}} \right| Since both limits equal LL (they're just subsequences of the original ratio sequence), we get LL=L2<1L \cdot L = L^2 < 1. Therefore, cn\sum c_n converges by the ratio test. Option A is wrong because the ratio test works fine on subsequences. Option B incorrectly claims the limit remains LL instead of L2L^2. Option C misunderstands that removing terms from a convergent series with positive terms cannot make the remaining terms diverge—if anything, it makes convergence more likely. Strategy tip: When working with subsequences and ratio tests, remember that skipping terms effectively "jumps" the ratio by the number of terms skipped, leading to powers in the limit.

Question 17

For the series n=1n!annn\sum_{n=1}^{\infty} \frac{n! \cdot a^n}{n^n} where a>0a > 0, the ratio test gives limnan+1an=ae\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = \frac{a}{e}. For which values of aa does this series converge?

  1. 0<a<e0 < a < e only, since the ratio test requires the limit to be less than 1 (correct answer)
  2. 0<ae0 < a \leq e, since the test is inconclusive when a=ea = e
  3. a>ea > e only, since Stirling's approximation reverses the inequality
  4. All a>0a > 0, since the factorial and exponential terms balance exactly
Explanation: Using Stirling's approximation or careful ratio analysis: an+1an=(n+1)!an+1(n+1)n+1nnn!an=an+1n+1(nn+1)n=a(1+1n)n\frac{a_{n+1}}{a_n} = \frac{(n+1)! \cdot a^{n+1}}{(n+1)^{n+1}} \cdot \frac{n^n}{n! \cdot a^n} = a \cdot \frac{n+1}{n+1} \cdot \left(\frac{n}{n+1}\right)^n = a \cdot \left(1 + \frac{1}{n}\right)^{-n}. As nn \to \infty, (1+1n)n1e\left(1 + \frac{1}{n}\right)^{-n} \to \frac{1}{e}, so the limit is ae\frac{a}{e}. For convergence by ratio test, we need ae<1\frac{a}{e} < 1, so a<ea < e. Choice B incorrectly includes the boundary case. Choice C reverses the inequality. Choice D ignores the ratio test conclusion.

Question 18

The series n=1an\sum_{n=1}^{\infty} a_n satisfies limnan+1an=34\lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right| = \frac{3}{4}. If we define bn=(an)2b_n = (a_n)^2, what can we conclude about n=1bn\sum_{n=1}^{\infty} b_n using the ratio test?

  1. The series bn\sum b_n converges since limnbn+1bn=916<1\lim_{n \to \infty} \left| \frac{b_{n+1}}{b_n} \right| = \frac{9}{16} < 1 (correct answer)
  2. The series bn\sum b_n converges since limnbn+1bn=34<1\lim_{n \to \infty} \left| \frac{b_{n+1}}{b_n} \right| = \frac{3}{4} < 1
  3. The ratio test is inconclusive since limnbn+1bn=1\lim_{n \to \infty} \left| \frac{b_{n+1}}{b_n} \right| = 1
  4. The series bn\sum b_n diverges since limnbn+1bn=43>1\lim_{n \to \infty} \left| \frac{b_{n+1}}{b_n} \right| = \frac{4}{3} > 1
Explanation: Since bn=(an)2b_n = (a_n)^2, we have bn+1bn=(an+1)2(an)2=(an+1an)2\frac{b_{n+1}}{b_n} = \frac{(a_{n+1})^2}{(a_n)^2} = \left(\frac{a_{n+1}}{a_n}\right)^2. Therefore, limnbn+1bn=limnan+1an2=(34)2=916<1\lim_{n \to \infty} \left| \frac{b_{n+1}}{b_n} \right| = \lim_{n \to \infty} \left| \frac{a_{n+1}}{a_n} \right|^2 = \left(\frac{3}{4}\right)^2 = \frac{9}{16} < 1, so bn\sum b_n converges. Choice B uses the original ratio instead of squaring it. Choice C incorrectly suggests the limit is 1. Choice D inverts and then squares incorrectly.

Question 19

Let an\sum a_n be a series where an>0a_n > 0 for all nn. If limnan+1an=L\lim_{n \to \infty} \frac{a_{n+1}}{a_n} = L, which statement guarantees that the series nan\sum n \cdot a_n converges?

  1. L<1L < 1 (correct answer)
  2. L=0L = 0
  3. L<1/nL < 1/n
  4. The new series nan\sum n \cdot a_n is guaranteed to diverge.
Explanation: To test the convergence of nan\sum n \cdot a_n, we apply the Ratio Test to its terms. Let bn=nanb_n = n \cdot a_n. The ratio is bn+1bn=(n+1)an+1nan=(n+1n)(an+1an)\frac{b_{n+1}}{b_n} = \frac{(n+1)a_{n+1}}{n a_n} = \left(\frac{n+1}{n}\right) \left(\frac{a_{n+1}}{a_n}\right). The limit of this new ratio is limn(n+1n)limn(an+1an)=1L=L\lim_{n \to \infty} \left(\frac{n+1}{n}\right) \cdot \lim_{n \to \infty} \left(\frac{a_{n+1}}{a_n}\right) = 1 \cdot L = L. Therefore, the series nan\sum n \cdot a_n converges if its ratio limit LL is less than 1, which is the same condition for the convergence of an\sum a_n.

Question 20

For the series n=2(1)n2nn23n+n\sum_{n=2}^{\infty} \frac{(-1)^n \cdot 2^n \cdot n^2}{3^n + n}, the ratio test gives a limit of LL. Which statement is correct?

  1. L=23L = \frac{2}{3} and the series converges absolutely by the ratio test (correct answer)
  2. L=23L = \frac{2}{3} and the series converges conditionally by the ratio test
  3. L=49L = \frac{4}{9} and the series converges absolutely by the ratio test
  4. L=2L = 2 and the series diverges by the ratio test
Explanation: Since we're testing absolute convergence with the ratio test, we consider an=2nn23n+n|a_n| = \frac{2^n \cdot n^2}{3^n + n}. Then an+1an=2n+1(n+1)23n+1+(n+1)3n+n2nn2=2(n+1)2n23n+n33n+(n+1)\frac{|a_{n+1}|}{|a_n|} = \frac{2^{n+1}(n+1)^2}{3^{n+1} + (n+1)} \cdot \frac{3^n + n}{2^n \cdot n^2} = 2 \cdot \frac{(n+1)^2}{n^2} \cdot \frac{3^n + n}{3 \cdot 3^n + (n+1)}. As nn \to \infty, this approaches 2113=23<12 \cdot 1 \cdot \frac{1}{3} = \frac{2}{3} < 1, so the series converges absolutely. Choice B incorrectly suggests conditional convergence. Choice C miscalculates the limit. Choice D uses 22 without the factor of 13\frac{1}{3}.