Calculus 2 Quiz: Integrating Sin And Cos Products
20 questions · exam conditions
0:00
Integrating Sin And Cos ProductsQuestion 1 of 20

Evaluate the definite integral 0π/2sin5(x)cos2(x)dx\int_{0}^{\pi/2} \sin^5(x) \cos^2(x) \, dx

235\frac{2}{35}
8105\frac{8}{105}
8105-\frac{8}{105}
421\frac{4}{21}
← Back to quizzes

Calculus 2 Quiz

Calculus 2 Quiz: Integrating Sin And Cos Products

Practice Integrating Sin And Cos Products in Calculus 2 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Integrating Sin And Cos Products, giving you a quick way to practice the rules, question types, and explanations that matter most for Calculus 2.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

Evaluate the definite integral 0π/2sin5(x)cos2(x)dx\int_{0}^{\pi/2} \sin^5(x) \cos^2(x) \, dx

  1. 235\frac{2}{35}
  2. 8105\frac{8}{105} (correct answer)
  3. 8105-\frac{8}{105}
  4. 421\frac{4}{21}
Explanation: The power of sine is odd. We save one sine factor and convert the rest to cosine. 0π/2sin4(x)cos2(x)sin(x)dx=0π/2(1cos2(x))2cos2(x)sin(x)dx\int_{0}^{\pi/2} \sin^4(x) \cos^2(x) \sin(x) \, dx = \int_{0}^{\pi/2} (1-\cos^2(x))^2 \cos^2(x) \sin(x) \, dx. Let u=cos(x)u = \cos(x), so du=sin(x)dxdu = -\sin(x) dx. The bounds change: x=0u=1x=0 \Rightarrow u=1 and x=π/2u=0x=\pi/2 \Rightarrow u=0. The integral becomes 10(1u2)2u2du=01(12u2+u4)u2du=01(u22u4+u6)du-\int_{1}^{0} (1-u^2)^2 u^2 \, du = \int_{0}^{1} (1-2u^2+u^4)u^2 \, du = \int_{0}^{1} (u^2 - 2u^4 + u^6) \, du. Evaluating this gives [u332u55+u77]01=1325+17=3542+15105=8105[\frac{u^3}{3} - \frac{2u^5}{5} + \frac{u^7}{7}]_0^1 = \frac{1}{3} - \frac{2}{5} + \frac{1}{7} = \frac{35 - 42 + 15}{105} = \frac{8}{105}.

Question 2

Which of the following is an antiderivative of f(x)=4sin2(x)cos2(x)f(x) = 4\sin^2(x)\cos^2(x)?

  1. x2+sin(4x)8+C\frac{x}{2} + \frac{\sin(4x)}{8} + C
  2. x2sin(4x)8+C\frac{x}{2} - \frac{\sin(4x)}{8} + C (correct answer)
  3. xsin(2x)+Cx - \sin(2x) + C
  4. 49sin3(x)cos3(x)+C\frac{4}{9} \sin^3(x) \cos^3(x) + C
Explanation: First, simplify the integrand using the double angle identity sin(2x)=2sin(x)cos(x)\sin(2x) = 2\sin(x)\cos(x). So, f(x)=(2sin(x)cos(x))2=sin2(2x)f(x) = (2\sin(x)\cos(x))^2 = \sin^2(2x). To integrate sin2(2x)\sin^2(2x), we use the half-angle identity sin2(θ)=1cos(2θ)2\sin^2(\theta) = \frac{1 - \cos(2\theta)}{2}. Here, θ=2x\theta = 2x, so sin2(2x)dx=1cos(4x)2dx=12(1cos(4x))dx=12(xsin(4x)4)+C=x2sin(4x)8+C\int \sin^2(2x) \, dx = \int \frac{1 - \cos(4x)}{2} \, dx = \frac{1}{2} \int (1 - \cos(4x)) \, dx = \frac{1}{2} (x - \frac{\sin(4x)}{4}) + C = \frac{x}{2} - \frac{\sin(4x)}{8} + C.

Question 3

The integral sin4(x)cos3(x)dx\int \sin^4(x) \cos^3(x) \, dx is evaluated using the substitution u=sin(x)u = \sin(x). Which of the following is the resulting integral in terms of uu?

  1. (u4u6)du\int (u^4 - u^6) \, du (correct answer)
  2. (u4u7)du\int (u^4 - u^7) \, du
  3. (u4u6)du-\int (u^4 - u^6) \, du
  4. (u5u7)du\int (u^5 - u^7) \, du
Explanation: To use the substitution u=sin(x)u = \sin(x), we need a factor of cos(x)dx\cos(x) dx for dudu. We split cos3(x)\cos^3(x) into cos2(x)cos(x)\cos^2(x) \cos(x). The integral becomes sin4(x)cos2(x)cos(x)dx\int \sin^4(x) \cos^2(x) \cos(x) \, dx. We convert the remaining even power of cosine to sine using cos2(x)=1sin2(x)\cos^2(x) = 1 - \sin^2(x). This gives sin4(x)(1sin2(x))cos(x)dx\int \sin^4(x) (1 - \sin^2(x)) \cos(x) \, dx. Now, substituting u=sin(x)u = \sin(x) and du=cos(x)dxdu = \cos(x) dx, we get u4(1u2)du=(u4u6)du\int u^4 (1 - u^2) \, du = \int (u^4 - u^6) \, du.

Question 4

If In=0π/2sinnxdxI_n = \int_0^{\pi/2} \sin^n x \, dx, which relationship correctly connects I4I_4 and I2I_2?

  1. I4=12I2I_4 = \frac{1}{2} I_2
  2. I4=23I2I_4 = \frac{2}{3} I_2
  3. I4=34I2I_4 = \frac{3}{4} I_2 (correct answer)
  4. I4=43I2I_4 = \frac{4}{3} I_2
Explanation: When you encounter integrals of the form 0π/2sinnxdx\int_0^{\pi/2} \sin^n x \, dx, you're dealing with a classic reduction formula problem. These integrals follow a recursive pattern that connects higher powers to lower powers. To find the relationship between I4I_4 and I2I_2, use integration by parts on I4=0π/2sin4xdxI_4 = \int_0^{\pi/2} \sin^4 x \, dx. Rewrite this as 0π/2sin3xsinxdx\int_0^{\pi/2} \sin^3 x \cdot \sin x \, dx. Let u=sin3xu = \sin^3 x and dv=sinxdxdv = \sin x \, dx, so du=3sin2xcosxdxdu = 3\sin^2 x \cos x \, dx and v=cosxv = -\cos x. After applying integration by parts and using the identity sin2x=1cos2x\sin^2 x = 1 - \cos^2 x, you'll derive the reduction formula: In=n1nIn2I_n = \frac{n-1}{n} I_{n-2} for n2n \geq 2. Applying this formula: I4=414I2=34I2I_4 = \frac{4-1}{4} I_2 = \frac{3}{4} I_2. This confirms answer choice C. Looking at the wrong answers: A gives I4=12I2I_4 = \frac{1}{2} I_2, which would correspond to the coefficient 212\frac{2-1}{2} from I2I_2, not I4I_4. B gives 23\frac{2}{3}, which is the reciprocal of the correct fraction—a common error when misremembering the reduction formula. D gives 43\frac{4}{3}, which incorrectly uses nn1\frac{n}{n-1} instead of n1n\frac{n-1}{n}. Study tip: Memorize the reduction formula In=n1nIn2I_n = \frac{n-1}{n} I_{n-2} for sine integrals. Notice that the coefficient is always less than 1, which makes physical sense since higher powers of sine create "sharper" functions with smaller areas.

Question 5

For the integral sin7xdx\int \sin^7 x \, dx, after the first substitution step, which integral must be evaluated?

  1. (1u2)3du\int (1-u^2)^3 \, du where u=sinxu = \sin x
  2. u6(1u2)du\int u^6(1-u^2) \, du where u=sinxu = \sin x
  3. u6(1u2)du-\int u^6(1-u^2) \, du where u=cosxu = \cos x
  4. (1u2)3du-\int (1-u^2)^3 \, du where u=cosxu = \cos x (correct answer)
Explanation: When you encounter integrals of odd powers of sine or cosine, the key strategy is to separate one factor and use substitution with the Pythagorean identity. For sin7xdx\int \sin^7 x \, dx, rewrite this as sin6xsinxdx\int \sin^6 x \cdot \sin x \, dx. Since the power of sine is odd, you can express sin6x=(sin2x)3=(1cos2x)3\sin^6 x = (\sin^2 x)^3 = (1 - \cos^2 x)^3 using the identity sin2x+cos2x=1\sin^2 x + \cos^2 x = 1. The integral becomes (1cos2x)3sinxdx\int (1 - \cos^2 x)^3 \sin x \, dx. Now substitute u=cosxu = \cos x, so du=sinxdxdu = -\sin x \, dx, which means sinxdx=du\sin x \, dx = -du. Substituting: (1u2)3sinxdx=(1u2)3(du)=(1u2)3du\int (1 - u^2)^3 \sin x \, dx = \int (1 - u^2)^3 (-du) = -\int (1 - u^2)^3 \, du This confirms answer D is correct. Looking at the wrong answers: A has the right integrand but wrong sign and substitution variable. B uses u=sinxu = \sin x but keeps the original power structure u6(1u2)u^6(1-u^2) without properly applying the identity—this would come from a cosine integral approach. C has the right sign and substitution variable but the wrong integrand form. Study tip: For odd powers of trig functions, always separate one factor for substitution and convert the remaining even power using sin2x+cos2x=1\sin^2 x + \cos^2 x = 1. Watch your signs carefully when substituting—du=sinxdxdu = -\sin x \, dx when u=cosxu = \cos x.

Question 6

Evaluate π/2π/2sin3(x)cos2(x)dx\int_{-\pi/2}^{\pi/2} \sin^3(x)\cos^2(x) \, dx.

  1. 00 (correct answer)
  2. 215\frac{2}{15}
  3. 415\frac{4}{15}
  4. 215-\frac{2}{15}
Explanation: The integrand is an odd function, and the integral is over a symmetric interval. Let f(x)=sin3(x)cos2(x)f(x) = \sin^3(x)\cos^2(x). Then f(x)=sin3(x)cos2(x)=(sin(x))3(cos(x))2=sin3(x)cos2(x)=f(x)f(-x) = \sin^3(-x)\cos^2(-x) = (-\sin(x))^3(\cos(x))^2 = -\sin^3(x)\cos^2(x) = -f(x). The integral of an odd function over an interval [a,a][-a, a] is always zero. Therefore, the value of the integral is 0.

Question 7

Which integral requires the use of integration by parts rather than standard sine-cosine techniques?

  1. sin4xcos6xdx\int \sin^4 x \cos^6 x \, dx
  2. xsin2xdx\int x \sin^2 x \, dx (correct answer)
  3. sin3xcos2xdx\int \sin^3 x \cos^2 x \, dx
  4. sin2xcos4xdx\int \sin^2 x \cos^4 x \, dx
Explanation: Choice B contains the factor xx, which cannot be handled by standard sine-cosine power techniques (odd power substitution or even power reduction). It requires integration by parts with u=xu = x and dv=sin2xdxdv = \sin^2 x \, dx. All other choices involve only powers of sine and cosine: Choice A uses power reduction since both powers are even, Choice C uses u=cosxu = \cos x substitution since sine has odd power, and Choice D uses power reduction since both powers are even.

Question 8

Find an antiderivative for f(x)=sin3(x)cos2(x)f(x) = \frac{\sin^3(x)}{\cos^2(x)}.

  1. sec(x)cos(x)+C\sec(x) - \cos(x) + C
  2. tan(x)sin(x)+C\tan(x) - \sin(x) + C
  3. sec(x)+cos(x)+C\sec(x) + \cos(x) + C (correct answer)
  4. 13tan3(x)+C\frac{1}{3}\tan^3(x) + C
Explanation: The power of sine is odd. Rewrite the integral as sin2(x)sin(x)cos2(x)dx=(1cos2(x))sin(x)cos2(x)dx\int \frac{\sin^2(x)\sin(x)}{\cos^2(x)} dx = \int \frac{(1-\cos^2(x))\sin(x)}{\cos^2(x)} dx. Let u=cos(x)u = \cos(x), so du=sin(x)dxdu = -\sin(x)dx. The integral becomes 1u2u2(du)=u21u2du=(1u2)du\int \frac{1-u^2}{u^2}(-du) = \int \frac{u^2-1}{u^2} du = \int (1 - u^{-2}) du. Integrating with respect to uu gives uu11+C=u+u1+Cu - \frac{u^{-1}}{-1} + C = u + u^{-1} + C. Substituting back u=cos(x)u = \cos(x) yields cos(x)+1cos(x)+C=cos(x)+sec(x)+C\cos(x) + \frac{1}{\cos(x)} + C = \cos(x) + \sec(x) + C.

Question 9

Which of the following describes the first step in the most efficient method to evaluate sin4(x)cos4(x)dx\int \sin^4(x)\cos^4(x) dx?

  1. Use the substitution u=sin(x)u = \sin(x) after converting cos4(x)\cos^4(x) using cos2(x)=1sin2(x)\cos^2(x)=1-\sin^2(x).
  2. Apply the half-angle identity sin2(x)=1cos(2x)2\sin^2(x) = \frac{1-\cos(2x)}{2} to the sin4(x)\sin^4(x) term.
  3. Use the double-angle identity sin(2x)=2sin(x)cos(x)\sin(2x) = 2\sin(x)\cos(x) to simplify the integrand to 116sin4(2x)\frac{1}{16}\sin^4(2x). (correct answer)
  4. Use integration by parts with u=sin4(x)u = \sin^4(x) and dv=cos4(x)dxdv = \cos^4(x)dx.
Explanation: The integrand can be written as (sin(x)cos(x))4(\sin(x)\cos(x))^4. Using the identity sin(x)cos(x)=12sin(2x)\sin(x)\cos(x) = \frac{1}{2}\sin(2x), the expression becomes (12sin(2x))4=116sin4(2x)(\frac{1}{2}\sin(2x))^4 = \frac{1}{16}\sin^4(2x). This simplifies the problem to integrating 116sin4(2x)dx\frac{1}{16}\int \sin^4(2x) dx, which can then be solved using half-angle identities. This is more efficient than directly applying half-angle identities to sin4(x)\sin^4(x) and cos4(x)\cos^4(x) and multiplying the resulting complex expressions.

Question 10

To evaluate sinm(x)cosn(x)dx\int \sin^m(x)\cos^n(x)dx, a standard strategy is to use substitution. If mm is odd, we use u=cos(x)u=\cos(x). If nn is odd, we use u=sin(x)u=\sin(x). If both mm and nn are even, we use half-angle identities.

Given the strategies in the passage, which integral would require the most applications of half-angle identities to evaluate?

  1. sin2(x)cos4(x)dx\int \sin^2(x)\cos^4(x) dx
  2. sin3(x)cos5(x)dx\int \sin^3(x)\cos^5(x) dx
  3. cos6(x)dx\int \cos^6(x) dx (correct answer)
  4. sin4(x)dx\int \sin^4(x) dx
Explanation: We only need half-angle identities when both powers are even. This eliminates option B. For option A, sin2(x)cos4(x)dx=(1cos(2x)2)(1+cos(2x)2)2dx\int \sin^2(x)\cos^4(x) dx = \int (\frac{1-\cos(2x)}{2})(\frac{1+\cos(2x)}{2})^2 dx. This will expand into terms with cos(2x),cos2(2x),cos3(2x)\cos(2x), \cos^2(2x), \cos^3(2x). The cos2(2x)\cos^2(2x) term needs one half-angle identity. The cos3(2x)\cos^3(2x) term can be solved with substitution. For option D, sin4(x)dx=(1cos(2x)2)2dx=14(12cos(2x)+cos2(2x))dx\int \sin^4(x) dx = \int (\frac{1-\cos(2x)}{2})^2 dx = \frac{1}{4}\int(1-2\cos(2x)+\cos^2(2x))dx. This requires one more half-angle identity for the cos2(2x)\cos^2(2x) term. For option C, cos6(x)dx=(1+cos(2x)2)3dx=18(1+3cos(2x)+3cos2(2x)+cos3(2x))dx\int \cos^6(x) dx = \int (\frac{1+\cos(2x)}{2})^3 dx = \frac{1}{8}\int(1+3\cos(2x)+3\cos^2(2x)+\cos^3(2x))dx. The cos2(2x)\cos^2(2x) term requires a half-angle identity, leading to a cos(4x)\cos(4x) term. The cos3(2x)\cos^3(2x) term can be solved with substitution. However, if one consistently applies half-angle identities, cos6(x)dx\int\cos^6(x)dx will require more steps. For instance, after the first step, you get cos2(2x)\cos^2(2x) which becomes cos(4x)\cos(4x). And another term. Then cos8(x)dx\int\cos^8(x)dx would need more. Comparing the options, cos6(x)\cos^6(x) has the highest even power, requiring expansion to the third power, which creates more terms needing identities than squaring as in the other options.

Question 11

To evaluate sin3xcos4xdx\int \sin^3 x \cos^4 x \, dx, which substitution and resulting integral is correct?

  1. u=cosxu = \cos x, du=sinxdxdu = -\sin x \, dx, giving u4(1u2)du-\int u^4(1-u^2) \, du (correct answer)
  2. u=sinxu = \sin x, du=cosxdxdu = \cos x \, dx, giving u3(1u2)2du\int u^3(1-u^2)^2 \, du
  3. u=cosxu = \cos x, du=sinxdxdu = -\sin x \, dx, giving u4(1u2)2du-\int u^4(1-u^2)^2 \, du
  4. u=sinxu = \sin x, du=cosxdxdu = \cos x \, dx, giving u3(1u2)du\int u^3(1-u^2) \, du
Explanation: Since the power of sine is odd (3), we save one factor of sine and convert the rest using sin2x=1cos2x\sin^2 x = 1 - \cos^2 x. We have sin3x=sin2xsinx=(1cos2x)sinx\sin^3 x = \sin^2 x \cdot \sin x = (1-\cos^2 x)\sin x. With u=cosxu = \cos x, du=sinxdxdu = -\sin x \, dx, the integral becomes (1u2)u4du=u4(1u2)du-\int (1-u^2)u^4 \, du = -\int u^4(1-u^2) \, du. Choice B uses the wrong substitution for odd sine power. Choice C has the wrong converted form. Choice D uses wrong substitution and wrong form.

Question 12

What is the value of 0π/2sin2xcos2xdx\int_0^{\pi/2} \sin^2 x \cos^2 x \, dx?

  1. π16\frac{\pi}{16} (correct answer)
  2. π8\frac{\pi}{8}
  3. π4\frac{\pi}{4}
  4. π32\frac{\pi}{32}
Explanation: Since both powers are even, use the identity sin2xcos2x=14sin2(2x)\sin^2 x \cos^2 x = \frac{1}{4}\sin^2(2x). Then sin2(2x)=1cos(4x)2\sin^2(2x) = \frac{1-\cos(4x)}{2}, so the integral becomes 140π/21cos(4x)2dx=180π/2(1cos(4x))dx=18[xsin(4x)4]0π/2=18π2=π16\frac{1}{4} \int_0^{\pi/2} \frac{1-\cos(4x)}{2} \, dx = \frac{1}{8} \int_0^{\pi/2} (1-\cos(4x)) \, dx = \frac{1}{8}\left[x - \frac{\sin(4x)}{4}\right]_0^{\pi/2} = \frac{1}{8} \cdot \frac{\pi}{2} = \frac{\pi}{16}. Choice B forgets the factor of 2 in the denominator. Choice C uses wrong power reduction. Choice D has an extra factor of 2 in denominator.

Question 13

Evaluate the integral cos(5x)cos(3x)dx\int \cos(5x)\cos(3x) \, dx.

  1. sin(2x)2+sin(8x)8+C\frac{\sin(2x)}{2} + \frac{\sin(8x)}{8} + C
  2. cos(2x)4cos(8x)16+C-\frac{\cos(2x)}{4} - \frac{\cos(8x)}{16} + C
  3. sin(2x)4+sin(8x)16+C\frac{\sin(2x)}{4} + \frac{\sin(8x)}{16} + C (correct answer)
  4. sin(2x)4sin(8x)16+C\frac{\sin(2x)}{4} - \frac{\sin(8x)}{16} + C
Explanation: This integral is solved using the product-to-sum identity cos(A)cos(B)=12[cos(AB)+cos(A+B)]\cos(A)\cos(B) = \frac{1}{2}[\cos(A-B) + \cos(A+B)]. With A=5xA=5x and B=3xB=3x, the integrand becomes 12[cos(2x)+cos(8x)]\frac{1}{2}[\cos(2x) + \cos(8x)]. Integrating this expression gives 12(cos(2x)+cos(8x))dx=12[sin(2x)2+sin(8x)8]+C=sin(2x)4+sin(8x)16+C\int \frac{1}{2}(\cos(2x) + \cos(8x)) \, dx = \frac{1}{2} [\frac{\sin(2x)}{2} + \frac{\sin(8x)}{8}] + C = \frac{\sin(2x)}{4} + \frac{\sin(8x)}{16} + C.

Question 14

What is 0πsin2xcos2xdx\int_0^{\pi} \sin^2 x \cos^2 x \, dx?

  1. 00
  2. π4\frac{\pi}{4}
  3. π16\frac{\pi}{16}
  4. π8\frac{\pi}{8} (correct answer)
Explanation: When you encounter products of powers of sine and cosine, trigonometric identities are your key tools for simplification. This integral requires the power-reduction formulas to convert the fourth-degree trigonometric expression into something manageable. Start by using the identity sin2x=1cos2x2\sin^2 x = \frac{1 - \cos 2x}{2} and cos2x=1+cos2x2\cos^2 x = \frac{1 + \cos 2x}{2}. Therefore: sin2xcos2x=1cos2x21+cos2x2=(1cos2x)(1+cos2x)4=1cos22x4\sin^2 x \cos^2 x = \frac{1 - \cos 2x}{2} \cdot \frac{1 + \cos 2x}{2} = \frac{(1 - \cos 2x)(1 + \cos 2x)}{4} = \frac{1 - \cos^2 2x}{4} Since 1cos22x=sin22x1 - \cos^2 2x = \sin^2 2x, we have sin2xcos2x=sin22x4\sin^2 x \cos^2 x = \frac{\sin^2 2x}{4}. Now apply the power-reduction formula again: sin22x=1cos4x2\sin^2 2x = \frac{1 - \cos 4x}{2}, giving us: sin2xcos2x=141cos4x2=1cos4x8\sin^2 x \cos^2 x = \frac{1}{4} \cdot \frac{1 - \cos 4x}{2} = \frac{1 - \cos 4x}{8} The integral becomes: 0π1cos4x8dx=18[xsin4x4]0π=18[π0]=π8\int_0^{\pi} \frac{1 - \cos 4x}{8} dx = \frac{1}{8} \left[ x - \frac{\sin 4x}{4} \right]_0^{\pi} = \frac{1}{8}[\pi - 0] = \frac{\pi}{8} Choice A (00) ignores that we have a squared term that's always non-negative. Choice B (π4\frac{\pi}{4}) likely comes from forgetting the second power reduction. Choice C (π16\frac{\pi}{16}) probably results from an arithmetic error in the denominators. Remember: products of even powers of sine and cosine almost always require repeated applications of power-reduction formulas. Work systematically through each reduction step.

Question 15

Which statement about sinmxcosnxdx\int \sin^m x \cos^n x \, dx is always true when both mm and nn are positive even integers?

  1. The integral can be evaluated using substitution u=sinxu = \sin x
  2. The integral requires repeated application of power reduction formulas (correct answer)
  3. The integral can be evaluated using substitution u=cosxu = \cos x
  4. The integral equals zero over any symmetric interval
Explanation: When both mm and nn are even, neither substitution method works (since we need at least one odd power for substitution). We must use power reduction formulas sin2x=1cos(2x)2\sin^2 x = \frac{1-\cos(2x)}{2} and cos2x=1+cos(2x)2\cos^2 x = \frac{1+\cos(2x)}{2}, and may need to apply them repeatedly if the powers are large. Choices A and C suggest substitution methods that don't work when both powers are even. Choice D is false; these integrands are not generally odd functions.

Question 16

What is the average value of the function f(x)=cos3(x)f(x) = \cos^3(x) on the interval [0,π/2][0, \pi/2]?

  1. 23π\frac{2}{3\pi}
  2. 43π\frac{4}{3\pi} (correct answer)
  3. 23\frac{2}{3}
  4. 12π\frac{1}{2\pi}
Explanation: The average value is 1baabf(x)dx\frac{1}{b-a}\int_a^b f(x) dx. Here, it is 1π/200π/2cos3(x)dx=2π0π/2cos3(x)dx\frac{1}{\pi/2 - 0} \int_0^{\pi/2} \cos^3(x) dx = \frac{2}{\pi} \int_0^{\pi/2} \cos^3(x) dx. To evaluate the integral, write cos2(x)cos(x)dx=(1sin2(x))cos(x)dx\int \cos^2(x)\cos(x) dx = \int(1-\sin^2(x))\cos(x)dx. Let u=sin(x)u=\sin(x), so du=cos(x)dxdu=\cos(x)dx. The bounds change from 0,π/20, \pi/2 to 0,10, 1. The integral is 01(1u2)du=[uu33]01=113=23\int_0^1 (1-u^2)du = [u-\frac{u^3}{3}]_0^1 = 1-\frac{1}{3} = \frac{2}{3}. The average value is 2π23=43π\frac{2}{\pi} \cdot \frac{2}{3} = \frac{4}{3\pi}.

Question 17

Evaluate the integral sin3(x)cos4(x)dx\int \frac{\sin^3(x)}{\cos^4(x)} \, dx.

  1. sec3(x)3sec(x)+C\frac{\sec^3(x)}{3} - \sec(x) + C (correct answer)
  2. sec3(x)3+sec(x)+C\frac{\sec^3(x)}{3} + \sec(x) + C
  3. sec(x)sec3(x)3+C\sec(x) - \frac{\sec^3(x)}{3} + C
  4. tan4(x)4+C\frac{\tan^4(x)}{4} + C
Explanation: This can be written as tan3(x)sec(x)dx\int \tan^3(x) \sec(x) \, dx. The standard method for this form is to factor out sec(x)tan(x)\sec(x)\tan(x). tan2(x)(sec(x)tan(x))dx\int \tan^2(x) (\sec(x)\tan(x)) \, dx. Then use the identity tan2(x)=sec2(x)1\tan^2(x) = \sec^2(x) - 1. The integral becomes (sec2(x)1)sec(x)tan(x)dx\int (\sec^2(x) - 1) \sec(x)\tan(x) \, dx. Let u=sec(x)u = \sec(x), so du=sec(x)tan(x)dxdu = \sec(x)\tan(x) \, dx. The integral in uu is (u21)du=u33u+C\int (u^2 - 1) \, du = \frac{u^3}{3} - u + C. Substituting back gives sec3(x)3sec(x)+C\frac{\sec^3(x)}{3} - \sec(x) + C.

Question 18

Evaluate the definite integral π/4π/2sin4(x)dx\int_{\pi/4}^{\pi/2} \sin^4(x) \, dx.

  1. 3π16\frac{3\pi}{16}
  2. 3π32+14\frac{3\pi}{32} + \frac{1}{4} (correct answer)
  3. 3π3214\frac{3\pi}{32} - \frac{1}{4}
  4. 3π1612\frac{3\pi}{16} - \frac{1}{2}
Explanation: First, find the antiderivative of sin4(x)\sin^4(x). sin4(x)dx=(sin2(x))2dx=(1cos(2x)2)2dx=14(12cos(2x)+cos2(2x))dx\int \sin^4(x) dx = \int (\sin^2(x))^2 dx = \int (\frac{1-\cos(2x)}{2})^2 dx = \frac{1}{4} \int (1 - 2\cos(2x) + \cos^2(2x)) dx. Use the half-angle identity again for cos2(2x)=1+cos(4x)2\cos^2(2x) = \frac{1+\cos(4x)}{2}. The integral becomes 14(12cos(2x)+1+cos(4x)2)dx=14(322cos(2x)+12cos(4x))dx=14[32xsin(2x)+18sin(4x)]\frac{1}{4} \int (1 - 2\cos(2x) + \frac{1+\cos(4x)}{2}) dx = \frac{1}{4} \int (\frac{3}{2} - 2\cos(2x) + \frac{1}{2}\cos(4x)) dx = \frac{1}{4} [\frac{3}{2}x - \sin(2x) + \frac{1}{8}\sin(4x)]. Now evaluate from π/4\pi/4 to π/2\pi/2. At x=π/2x=\pi/2: 14[3π4sin(π)+18sin(2π)]=3π16\frac{1}{4}[\frac{3\pi}{4} - \sin(\pi) + \frac{1}{8}\sin(2\pi)] = \frac{3\pi}{16}. At x=π/4x=\pi/4: 14[3π8sin(π/2)+18sin(π)]=14[3π81]=3π3214\frac{1}{4}[\frac{3\pi}{8} - \sin(\pi/2) + \frac{1}{8}\sin(\pi)] = \frac{1}{4}[\frac{3\pi}{8} - 1] = \frac{3\pi}{32} - \frac{1}{4}. The result is 3π16(3π3214)=6π3π32+14=3π32+14\frac{3\pi}{16} - (\frac{3\pi}{32} - \frac{1}{4}) = \frac{6\pi - 3\pi}{32} + \frac{1}{4} = \frac{3\pi}{32} + \frac{1}{4}.

Question 19

Which of the following is equivalent to 1sin2(x)cos2(x)dx\int \frac{1}{\sin^2(x)\cos^2(x)} dx?

  1. tan(x)+cot(x)+C\tan(x) + \cot(x) + C
  2. 2cot(2x)+C-2\cot(2x) + C (correct answer)
  3. sec(x)tan(x)csc(x)cot(x)+C\sec(x)\tan(x) - \csc(x)\cot(x) + C
  4. 13sin3(x)cos3(x)+C\frac{1}{3\sin^3(x)\cos^3(x)} + C
Explanation: One method is to use the identity sin(2x)=2sin(x)cos(x)\sin(2x) = 2\sin(x)\cos(x), so sin(x)cos(x)=12sin(2x)\sin(x)\cos(x) = \frac{1}{2}\sin(2x). The integrand is 1(12sin(2x))2=4sin2(2x)=4csc2(2x)\frac{1}{(\frac{1}{2}\sin(2x))^2} = \frac{4}{\sin^2(2x)} = 4\csc^2(2x). The integral is 4csc2(2x)dx\int 4\csc^2(2x) dx. Using the substitution u=2xu=2x, du=2dxdu=2dx, we get 4csc2(u)du2=2csc2(u)du=2cot(u)+C=2cot(2x)+C\int 4\csc^2(u) \frac{du}{2} = 2 \int \csc^2(u) du = -2\cot(u) + C = -2\cot(2x) + C. Another method is to write 1=sin2(x)+cos2(x)1 = \sin^2(x) + \cos^2(x) in the numerator, giving sin2(x)+cos2(x)sin2(x)cos2(x)dx=(1cos2(x)+1sin2(x))dx=(sec2(x)+csc2(x))dx=tan(x)cot(x)+C\int \frac{\sin^2(x) + \cos^2(x)}{\sin^2(x)\cos^2(x)} dx = \int (\frac{1}{\cos^2(x)} + \frac{1}{\sin^2(x)}) dx = \int (\sec^2(x) + \csc^2(x)) dx = \tan(x) - \cot(x) + C. The two answers, 2cot(2x)-2\cot(2x) and tan(x)cot(x)\tan(x) - \cot(x), are equivalent via double angle identities.

Question 20

The integral sin2(x)cos(2x)dx\int \sin^2(x) \cos(2x) \, dx can be solved by first applying a trigonometric identity to one of the terms. Which approach is most effective?

  1. Replace cos(2x)\cos(2x) with cos2(x)sin2(x)\cos^2(x) - \sin^2(x) to get an integral entirely in terms of powers of sin(x)\sin(x) and cos(x)\cos(x).
  2. Replace sin2(x)\sin^2(x) with 1cos(2x)2\frac{1-\cos(2x)}{2} to get an integral in terms of powers of cos(2x)\cos(2x). (correct answer)
  3. Replace sin2(x)\sin^2(x) with 1cos2(x)1-\cos^2(x) and then use integration by parts.
  4. Use the product-to-sum formula sin(A)cos(B)=12[sin(AB)+sin(A+B)]\sin(A)\cos(B) = \frac{1}{2}[\sin(A-B)+\sin(A+B)].
Explanation: By replacing sin2(x)\sin^2(x) with the half-angle identity 1cos(2x)2\frac{1-\cos(2x)}{2}, the integral becomes 1cos(2x)2cos(2x)dx=12(cos(2x)cos2(2x))dx\int \frac{1-\cos(2x)}{2} \cos(2x) \, dx = \frac{1}{2} \int (\cos(2x) - \cos^2(2x)) \, dx. The first term is easily integrated. The second term, cos2(2x)\cos^2(2x), requires one more application of the half-angle identity. This approach systematically reduces the complexity. Approach A results in sin2(x)(cos2(x)sin2(x))dx=(sin2(x)cos2(x)sin4(x))dx\int \sin^2(x)(\cos^2(x) - \sin^2(x)) dx = \int (\sin^2(x)\cos^2(x) - \sin^4(x)) dx, which is more complicated to solve.