Business Calculus Quiz: Asymptotes And Long Run Behavior
17 questions · exam conditions
0:00
Asymptotes And Long Run BehaviorQuestion 1 of 17

The percentage of a target market, S(t), that is aware of a new product t weeks after the start of an advertising campaign is modeled by the function S(t) = 75 / (1 + 24e^(-0.15t)). What is the theoretical saturation level for product awareness according to this model?

3% of the market
24% of the market
75% of the market
100% of the market
← Back to quizzes

Business Calculus Quiz

Business Calculus Quiz: Asymptotes And Long Run Behavior

Practice Asymptotes And Long Run Behavior in Business Calculus with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Asymptotes And Long Run Behavior, giving you a quick way to practice the rules, question types, and explanations that matter most for Business Calculus.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

The percentage of a target market, S(t), that is aware of a new product t weeks after the start of an advertising campaign is modeled by the function S(t) = 75 / (1 + 24e^(-0.15t)). What is the theoretical saturation level for product awareness according to this model?

  1. 3% of the market
  2. 24% of the market
  3. 75% of the market (correct answer)
  4. 100% of the market
Explanation: The theoretical saturation level corresponds to the long-run behavior of the function, which is found by taking the limit as t approaches infinity. As t \to \infty, the term e^(-0.15t) approaches 0. limtS(t)=limt751+24e0.15t=751+24(0)=751=75\lim_{t \to \infty} S(t) = \lim_{t \to \infty} \frac{75}{1 + 24e^{-0.15t}} = \frac{75}{1 + 24(0)} = \frac{75}{1} = 75 Therefore, the model predicts that at most 75% of the market will become aware of the product.

Question 2

The cost C(p), in millions of dollars, for a factory to remove p percent of the particulate matter from its emissions is given by the function C(p) = (15p) / (100 - p). Which statement best describes the financial implications of attempting to achieve 100% emission-free production?

  1. The cost approaches a maximum value of $15 million.
  2. The cost to remove the final 1% of pollutant is $1,485 million.
  3. The cost increases without bound, becoming prohibitively expensive. (correct answer)
  4. The total cost to remove all pollutants is exactly $1,500 million.
Explanation: The phrase 'achieving 100% emission-free production' implies that p is approaching 100. We need to analyze the limit of C(p) as p approaches 100 from the left. limp100C(p)=limp10015p100p\lim_{p \to 100^-} C(p) = \lim_{p \to 100^-} \frac{15p}{100 - p} As p approaches 100, the numerator approaches 1500 and the denominator approaches 0 through positive values. This results in the limit being +\infty. This vertical asymptote means the cost increases without bound, making it infinitely (and thus prohibitively) expensive.

Question 3

A firm's revenue from selling x units is R(x) = ($120x^2$ + 50x)/(x+2) and its cost is C(x) = ($40x^2$ + 300x)/(x+10). What is the long-run profit per unit?

  1. The profit per unit approaches $80. (correct answer)
  2. The profit per unit approaches $120.
  3. The profit per unit approaches $40.
  4. The total profit increases, but the profit per unit approaches $0.
Explanation: The profit per unit is the average profit, AP(x) = P(x)/x = (R(x) - C(x))/x = R(x)/x - C(x)/x. We need to find the limit of AP(x) as x \to \infty. This can be found by taking the limits of the average revenue AR(x) and average cost AC(x) separately. AR(x)=R(x)x=120x2+50xx(x+2)=120x+50x+2AR(x) = \frac{R(x)}{x} = \frac{120x^2 + 50x}{x(x+2)} = \frac{120x + 50}{x+2} limxAR(x)=1201=120\lim_{x \to \infty} AR(x) = \frac{120}{1} = 120 AC(x)=C(x)x=40x2+300xx(x+10)=40x+300x+10AC(x) = \frac{C(x)}{x} = \frac{40x^2 + 300x}{x(x+10)} = \frac{40x + 300}{x+10} limxAC(x)=401=40\lim_{x \to \infty} AC(x) = \frac{40}{1} = 40 The long-run profit per unit is lim AP(x) = lim AR(x) - lim AC(x) = 120 - 40 = 80.

Question 4

The average cost to produce x units of a specialized component is AC(x) = ($3x^2$ + 200x + 120000) / x. The long-run behavior of this function shows the average cost increasing linearly. What does this imply about the long-run marginal cost, MC(x)?

  1. The marginal cost will approach a constant value.
  2. The marginal cost will approach the same value as the average cost.
  3. The marginal cost will increase linearly, but with a greater slope than the average cost. (correct answer)
  4. The marginal cost will increase, but at a slower rate than the average cost.
Explanation: First, analyze the average cost function: AC(x) = 3x + 200 + 120000/x. For large x, AC(x) behaves like its slant asymptote, y = 3x + 200. The average cost grows with a slope of 3. To find the marginal cost, first find the total cost function: C(x) = x \cdot AC(x) = 3x^2 + 200x + 120000. Now, find the marginal cost by taking the derivative: MC(x) = C'(x) = 6x + 200. For large x, the marginal cost MC(x) is a line with a slope of 6. Since 6 > 3, the marginal cost increases linearly with a greater slope than the average cost.

Question 5

A company is deciding between two manufacturing processes. Process A has a total cost function C_A(x) = 80x + 4000, and Process B has a total cost function C_B(x) = 75x + 6000, where x is the number of units. Which statement accurately describes the cost-effectiveness for very large production volumes?

  1. Process A is better in the long run, as its average cost approaches $80 per unit.
  2. Process B is better in the long run, as its average cost approaches $75 per unit. (correct answer)
  3. Process A is always better because its fixed cost of $4000 is lower.
  4. Both processes are equally cost-effective in the long run.
Explanation: Cost-effectiveness in the long run is determined by the limit of the average cost function as production x approaches infinity. For Process A: AC_A(x) = C_A(x)/x = 80 + 4000/x. lim_{x \to \infty} AC_A(x) = 80. For Process B: AC_B(x) = C_B(x)/x = 75 + 6000/x. lim_{x \to \infty} AC_B(x) = 75. Since $75 is less than $80, Process B is more cost-effective for very large production volumes.

Question 6

The weekly sales revenue R(a), in thousands of dollars, from spending a thousand dollars on advertising is modeled by R(a) = (800a + 4000) / (a + 50). What is the maximum weekly revenue the company can expect, even with an unlimited advertising budget?

  1. $80,000
  2. $400,000
  3. There is no maximum; revenue increases indefinitely.
  4. $800,000 (correct answer)
Explanation: When you encounter a rational function like this revenue model, you're looking at a situation where there's a horizontal asymptote that represents a limiting value. As the advertising budget approaches infinity, the revenue approaches but never quite reaches a maximum value. To find this limit, examine what happens to R(a)=800a+4000a+50R(a) = \frac{800a + 4000}{a + 50} as aa gets very large. Divide both numerator and denominator by aa: R(a)=800+4000a1+50aR(a) = \frac{800 + \frac{4000}{a}}{1 + \frac{50}{a}} As aa \to \infty, both 4000a\frac{4000}{a} and 50a\frac{50}{a} approach zero, so the function approaches 8001=800\frac{800}{1} = 800 thousand dollars, which equals $800,000. Answer D ($800,000) is correct because this horizontal asymptote represents the theoretical maximum revenue with unlimited advertising spending. Answer A (80,000)likelycomesfrommisreadingtheunitsormakinganarithmeticerrorwiththelimitcalculation.AnswerB(80,000) likely comes from misreading the units or making an arithmetic error with the limit calculation. Answer B (400,000) might result from incorrectly using just the constant term 4000 from the numerator and converting to dollars. Answer C (no maximum) misses the key insight about rational functions—while revenue does increase with more advertising, it approaches a ceiling due to market saturation effects built into the model. Study tip: For rational functions on business calculus exams, always check for horizontal asymptotes by examining the ratio of leading coefficients when degrees are equal. This often represents a practical limit in real-world scenarios.

Question 7

A factory's total operating cost is modeled by C(x) = 1000 / (2500 - $x^2$) for 0 \le x < 50, where x is the number of machines running simultaneously. What is the operational meaning of the model's behavior as x approaches 50?

  1. The cost to operate 50 machines is minimized.
  2. Operating close to 50 machines causes costs to increase without bound, suggesting a capacity limit. (correct answer)
  3. The long-run cost of operating the factory stabilizes at a value determined by x=50.
  4. The cost of operating 50 machines is zero.
Explanation: The model has a vertical asymptote at x values where the denominator is zero. 2500 - x^2 = 0 implies x^2 = 2500, so x = 50 (since x must be non-negative). As x approaches 50 from the left, 2500 - x^2 approaches 0 from the positive side, so C(x) approaches +\infty. This vertical asymptote means that as the number of machines in operation gets closer to 50, the total cost increases without bound. This suggests a physical or logistical capacity limit of 50 machines.

Question 8

A pharmaceutical company's drug concentration model is C(t)=15tt2+2t+5C(t) = \frac{15t}{t^2 + 2t + 5} mg/L, where tt is hours after injection. For regulatory approval, they must demonstrate that the drug clears from the system. Which statement correctly describes both the horizontal asymptote and the medical significance?

  1. The concentration approaches 15 mg/L, indicating the drug maintains therapeutic levels indefinitely
  2. The concentration approaches 0 mg/L, confirming complete drug clearance over time (correct answer)
  3. The concentration approaches 7.5 mg/L, suggesting the drug reaches a steady-state maintenance level
  4. The concentration approaches 2.5 mg/L, representing the minimum effective therapeutic dose
Explanation: For the horizontal asymptote of 15tt2+2t+5\frac{15t}{t^2 + 2t + 5}, since the denominator has higher degree than the numerator, limtC(t)=0\lim_{t \to \infty} C(t) = 0. This occurs because the t2t^2 term in the denominator grows faster than the tt term in the numerator. Medically, this means the drug is completely metabolized and eliminated from the body over time, which is essential for regulatory approval. Choice A incorrectly uses the numerator coefficient. Choice C appears to use 15/2, which has no mathematical basis. Choice D uses an arbitrary value that doesn't relate to the function's behavior.

Question 9

An e-commerce platform's user engagement function is E(d)=3d212d+15d2E(d) = \frac{3d^2 - 12d + 15}{d - 2} where dd represents days since a major interface update, and d>2d > 2. The platform experiences a technical issue exactly 2 days after the update. What does the model predict about user engagement behavior as time approaches this critical point?

  1. Engagement approaches a finite positive value, indicating the system maintains stability
  2. Engagement approaches negative infinity, indicating users abandon the platform as the failure approaches
  3. Engagement approaches zero, showing users become completely inactive at the critical moment
  4. Engagement approaches positive infinity, suggesting users become increasingly active before the system failure (correct answer)
Explanation: This question tests your understanding of limits and asymptotic behavior in rational functions. When you see a fraction where the denominator approaches zero, you need to analyze what happens to the function values as you approach that critical point. To find what happens as dd approaches 2, you need to evaluate limd2+3d212d+15d2\lim_{d \to 2^+} \frac{3d^2 - 12d + 15}{d - 2}. Since we're told d>2d > 2, we approach from the right side. First, check what happens to the numerator when d=2d = 2: 3(2)212(2)+15=1224+15=33(2)^2 - 12(2) + 15 = 12 - 24 + 15 = 3. So the numerator approaches the positive value 3. The denominator d2d - 2 approaches 0, but since d>2d > 2, we have d2>0d - 2 > 0, so the denominator approaches 0 from the positive side. When you divide a positive constant (3) by values that are positive but getting closer to zero, the result grows without bound toward positive infinity. Choice A is wrong because the function doesn't approach a finite value—dividing by numbers close to zero creates unbounded growth. Choice B is incorrect because both the numerator (approaching 3) and denominator (approaching 0 from the positive side) are positive, so the quotient is positive, not negative. Choice C is wrong because the numerator approaches 3, not 0, so the fraction doesn't approach zero. Remember: when analyzing rational functions near vertical asymptotes, always check the signs of both numerator and denominator separately to determine whether you're heading toward positive or negative infinity.

Question 10

A ride-sharing company's surge pricing algorithm uses S(r)=r2+6r+9r29S(r) = \frac{r^2 + 6r + 9}{r^2 - 9} where rr represents the ratio of ride requests to available drivers. The system has a critical failure point when this ratio equals 3. What does the model predict about pricing behavior as the request-to-driver ratio approaches this critical point from above?

  1. Surge multipliers approach a finite positive value, maintaining system stability
  2. Surge multipliers approach negative infinity, resulting in negative pricing which crashes the system
  3. Surge multipliers approach zero, effectively making rides free during peak demand
  4. Surge multipliers approach positive infinity, causing the app to impose maximum pricing (correct answer)
Explanation: When you encounter rational functions in business contexts, you're often looking at situations where the denominator approaching zero creates dramatic changes in behavior - this is exactly what's happening with surge pricing at the critical failure point. To find what happens as the request-to-driver ratio approaches 3 from above, you need to evaluate the limit: limr3+r2+6r+9r29\lim_{r \to 3^+} \frac{r^2 + 6r + 9}{r^2 - 9}. First, factor both parts. The numerator r2+6r+9=(r+3)2r^2 + 6r + 9 = (r + 3)^2, and the denominator r29=(r+3)(r3)r^2 - 9 = (r + 3)(r - 3). This gives you (r+3)2(r+3)(r3)=r+3r3\frac{(r + 3)^2}{(r + 3)(r - 3)} = \frac{r + 3}{r - 3}. As rr approaches 3 from above, the numerator approaches 3+3=63 + 3 = 6 (positive), while the denominator approaches zero from the positive side. This creates the form 60+=+\frac{6}{0^+} = +\infty, meaning surge multipliers approach positive infinity. Choice A is wrong because the function doesn't approach a finite value - the denominator going to zero prevents this. Choice B incorrectly suggests negative infinity, but since we're approaching from above, r3r - 3 is positive, keeping the result positive. Choice C misses the critical behavior entirely - the function explodes upward, not downward toward zero. The correct answer is D: the surge multipliers approach positive infinity, forcing maximum pricing. Study tip: When analyzing rational functions at points where the denominator equals zero, always factor first, then check the signs of numerator and denominator separately to determine the direction of the infinite limit.

Question 11

The number of items, N(t), an assembly line worker can produce per hour is modeled by a learning curve N(t) = 90 - 60e^(-0.2t), where t is the number of months of experience. What is the difference in hourly production between a new employee (t=0) and a veteran employee with long-term experience?

  1. 30 items
  2. 60 items (correct answer)
  3. 90 items
  4. 150 items
Explanation: First, find the production of a new employee by evaluating N(0): N(0) = 90 - 60e^0 = 90 - 60(1) = 30 items per hour. Next, find the production of a veteran employee by evaluating the limit as t \to \infty: limtN(t)=limt(9060e0.2t)=9060(0)=90 items per hour.\lim_{t \to \infty} N(t) = \lim_{t \to \infty} (90 - 60e^{-0.2t}) = 90 - 60(0) = 90 \text{ items per hour.} The difference is 90 - 30 = 60 items per hour.

Question 12

The concentration K(t) in mg/L of a certain drug in the bloodstream t hours after administration is given by K(t) = (20t) / ($t^2$ + 9). A doctor is interested in the long-term presence of the drug. What does the model predict will happen to the drug concentration after a very long period?

  1. It stabilizes at its maximum concentration of approximately 3.33 mg/L.
  2. It approaches a non-zero concentration of 20 mg/L.
  3. It approaches a concentration of approximately 2.22 mg/L.
  4. It is eventually eliminated, with the concentration approaching 0 mg/L. (correct answer)
Explanation: When analyzing the long-term behavior of a function like drug concentration, you need to find the limit as time approaches infinity. This tells you what happens to the drug concentration after many hours have passed. To find limt20tt2+9\lim_{t \to \infty} \frac{20t}{t^2 + 9}, divide both the numerator and denominator by the highest power of t in the denominator, which is t2t^2: limt20tt2+9=limt20tt2t2+9t2=limt20t1+9t2\lim_{t \to \infty} \frac{20t}{t^2 + 9} = \lim_{t \to \infty} \frac{\frac{20t}{t^2}}{\frac{t^2 + 9}{t^2}} = \lim_{t \to \infty} \frac{\frac{20}{t}}{1 + \frac{9}{t^2}} As t approaches infinity, both 20t\frac{20}{t} and 9t2\frac{9}{t^2} approach 0, giving us 01+0=0\frac{0}{1 + 0} = 0. This confirms that the drug concentration approaches 0 mg/L, meaning the drug is eventually eliminated from the bloodstream. Answer A is incorrect because while the function does have a maximum (which occurs around t = 3), the long-term behavior is different from the maximum value. Answer B misapplies the leading coefficient 20, ignoring that this is a rational function where the denominator's degree exceeds the numerator's. Answer C appears to come from an incorrect calculation, possibly confusing this limit with another value. Study tip: For rational functions where the denominator has a higher degree than the numerator, the limit as x approaches infinity is always 0. This pattern appears frequently in business calculus applications involving decay or elimination processes.

Question 13

A company's average cost function for producing x units of a product is given by AC(x) = ($90x^2$ + 500x) / ($x^2$ + 10). What will be the approximate average cost per unit if the company dramatically increases its production volume over the long run?

  1. $50 per unit
  2. $90 per unit (correct answer)
  3. $500 per unit
  4. The average cost will increase without bound.
Explanation: To find the long-run average cost, we need to evaluate the limit of the average cost function AC(x) as x approaches infinity. For a rational function where the degree of the numerator is equal to the degree of the denominator, the limit is the ratio of the leading coefficients. limxAC(x)=limx90x2+500xx2+10=901=90\lim_{x \to \infty} AC(x) = \lim_{x \to \infty} \frac{90x^2 + 500x}{x^2 + 10} = \frac{90}{1} = 90 Thus, the average cost per unit will approach $90 in the long run.

Question 14

A consultant presents a report stating that as a company's production x increases indefinitely, its average cost per unit will approach $75, while its marginal cost will approach $80. From a mathematical modeling standpoint, which statement best evaluates this claim?

  1. The claim is plausible, as marginal cost is typically higher than average cost in the long run.
  2. The claim is plausible, as fixed costs cause a permanent difference between average and marginal cost.
  3. The claim is mathematically inconsistent; marginal cost must always be less than average cost.
  4. The claim is mathematically inconsistent; if average cost approaches a finite limit L, marginal cost must also approach L. (correct answer)
Explanation: When analyzing cost functions, you need to understand the fundamental relationship between average cost and marginal cost as production approaches infinity. This relationship is governed by a key mathematical principle from calculus. If average cost AC(x)AC(x) approaches a finite limit LL as xx \to \infty, then marginal cost MC(x)MC(x) must also approach that same limit LL. This follows from the fact that AC(x)=C(x)xAC(x) = \frac{C(x)}{x} where C(x)C(x) is total cost, and MC(x)=C(x)MC(x) = C'(x). When limxAC(x)=L\lim_{x \to \infty} AC(x) = L, calculus tells us that limxMC(x)=L\lim_{x \to \infty} MC(x) = L as well. Since the consultant claims average cost approaches $75 while marginal cost approaches $80, this violates this mathematical relationship. The correct answer is D. Looking at the wrong answers: A incorrectly suggests marginal cost is "typically" higher than average cost in the long run, but this ignores the mathematical constraint when limits exist. B misunderstands fixed costs—while fixed costs do affect the relationship between average and marginal cost in the short run, they become negligible as production increases indefinitely, so they don't create permanent differences in the limits. C states the opposite error, claiming marginal cost must always be less than average cost, which isn't true either. Study tip: Remember that when average cost approaches a finite limit as production goes to infinity, marginal cost must approach that same limit. This is a fundamental result you can apply to evaluate the mathematical consistency of any business cost model.

Question 15

A manufacturing company's efficiency ratio is modeled by F(h)=h38h2+16hh24hF(h) = \frac{h^3 - 8h^2 + 16h}{h^2 - 4h} where hh represents hours of operation per day. The model becomes undefined when workers operate exactly 4 hours daily due to union break requirements. After algebraic simplification, what does this model predict about long-run efficiency as daily hours increase indefinitely?

  1. Efficiency approaches infinity because productivity gains compound exponentially with longer hours
  2. Efficiency approaches a constant ratio because worker fatigue eventually balances increased output
  3. Efficiency increases without bound at a linear rate due to economies of continuous operation (correct answer)
  4. Efficiency approaches zero because extended hours lead to diminishing marginal productivity
Explanation: First, we simplify by factoring: F(h)=h(h28h+16)h(h4)=h(h4)2h(h4)=(h4)2h4=h4F(h) = \frac{h(h^2 - 8h + 16)}{h(h - 4)} = \frac{h(h-4)^2}{h(h-4)} = \frac{(h-4)^2}{h-4} = h-4 for h0,4h \neq 0, 4. Therefore, limhF(h)=limh(h4)=\lim_{h \to \infty} F(h) = \lim_{h \to \infty} (h-4) = \infty. The efficiency increases linearly (not exponentially) with hours worked. Choice A incorrectly describes exponential growth. Choice B suggests a horizontal asymptote that doesn't exist. Choice D contradicts the mathematical result showing increasing efficiency.

Question 16

A biotech company's research productivity is modeled by R(f)=f327f2+3f+9R(f) = \frac{f^3 - 27}{f^2 + 3f + 9} patents per year, where ff represents millions of dollars in annual funding. Due to bureaucratic constraints, the model breaks down when funding reaches exactly $3 million annually. After resolving the discontinuity through appropriate algebraic techniques, what can the company conclude about long-term research productivity trends?

  1. Productivity approaches 27 patents annually, representing the maximum sustainable research output
  2. Productivity increases without bound, indicating unlimited potential for research expansion (correct answer)
  3. Productivity approaches zero, suggesting research yields diminish with excessive funding
  4. Productivity approaches 9 patents annually, representing optimal research efficiency
Explanation: First, recognize that f327=(f3)(f2+3f+9)f^3 - 27 = (f-3)(f^2+3f+9), so R(f)=(f3)(f2+3f+9)f2+3f+9=f3R(f) = \frac{(f-3)(f^2+3f+9)}{f^2+3f+9} = f-3 for f3f \neq 3. Therefore, limfR(f)=limf(f3)=\lim_{f \to \infty} R(f) = \lim_{f \to \infty} (f-3) = \infty. The simplified function shows that research productivity increases linearly with funding (minus a constant offset), indicating no upper bound on research potential as funding increases. Choice A incorrectly uses the constant from the factorization. Choice C contradicts the mathematical result. Choice D uses a coefficient from the denominator, which is irrelevant after simplification.

Question 17

A subscription-based software company's monthly revenue function is R(t)=120000tt+24R(t) = \frac{120000t}{t + 24} where tt represents months since launch. The company's board wants to understand the long-term revenue potential. What should management conclude about the horizontal asymptote and its business implications?

  1. Revenue approaches $120,000 monthly, indicating the market will eventually become saturated at this level (correct answer)
  2. Revenue approaches $5,000 monthly, suggesting the business model will become unsustainable long-term
  3. Revenue approaches $24,000 monthly, representing the equilibrium between customer acquisition and churn
  4. Revenue approaches infinity, indicating unlimited growth potential in this market segment
Explanation: To find the horizontal asymptote, we evaluate limt120000tt+24\lim_{t \to \infty} \frac{120000t}{t + 24}. Dividing numerator and denominator by tt: limt1200001+24t=1200001+0=120000\lim_{t \to \infty} \frac{120000}{1 + \frac{24}{t}} = \frac{120000}{1 + 0} = 120000. This indicates that monthly revenue will approach $120,000 as a ceiling, representing market saturation where the rate of new subscriptions balances cancellations. Choice B uses an incorrect calculation (120000/24). Choice C also represents a calculation error. Choice D is mathematically impossible since this is a rational function where the degree of numerator equals denominator.